1
0
Fork 0
mirror of https://github.com/Ylianst/MeshCentral.git synced 2025-02-15 04:21:51 +00:00
MeshCentral/views/translations/default-min_nl.handlebars
2019-12-18 14:57:29 -08:00

8894 lines
No EOL
626 KiB
Handlebars

<!doctypehtml><html dir=ltr xmlns=http://www.w3.org/1999/xhtml><meta http-equiv=X-UA-Compatible content="IE=edge"><meta content="text/html;charset=utf-8"http-equiv=Content-Type><meta name=viewport content="user-scalable=1,initial-scale=1,minimum-scale=1,maximum-scale=1"><meta name=apple-mobile-web-app-capable content=yes><meta name=format-detection content="telephone=no"><link rel="shortcut icon"type=image/x-icon href={{{domainurl}}}favicon.ico><link keeplink=1 type=text/css href=styles/style.css media=screen rel=stylesheet title=CSS><link type=text/css href=styles/ol.css media=screen rel=stylesheet title=CSS><link type=text/css href=styles/ol3-contextmenu.min.css media=screen rel=stylesheet title=CSS><script src=scripts/common-0.0.1.js></script><script src=scripts/meshcentral.js></script><script src=scripts/amt-0.2.0.js></script><script src=scripts/amt-wsman-0.2.0.js></script><script src=scripts/amt-desktop-0.0.2.js></script><script src=scripts/amt-terminal-0.0.2.js></script><script src=scripts/zlib.js></script><script src=scripts/zlib-inflate.js></script><script src=scripts/zlib-adler32.js></script><script src=scripts/zlib-crc32.js></script><script src=scripts/amt-redir-ws-0.1.0.js></script><script src=scripts/amt-wsman-ws-0.2.0.js></script><script src=scripts/agent-redir-ws-0.1.1.js></script><script src=scripts/agent-redir-rtc-0.1.0.js></script><script src=scripts/agent-desktop-0.0.2.js></script><script src=scripts/qrcode.min.js></script><script keeplink=1 src=scripts/u2f-api.js></script><script keeplink=1 src=scripts/charts.js></script><script keeplink=1 src=scripts/filesaver.js></script><body id=body onload='"undefined"!=typeof startup&&startup()'oncontextmenu=handleContextMenu(event) style=display:none;min-width:495px>{{{StartGeoLocation}}}<script keeplink=1 src=scripts/ol.js></script><script keeplink=1 src=scripts/ol3-contextmenu.js></script>{{{EndGeoLocation}}}<title>{{{title}}}</title><div id=contextMenu class="contextMenu noselect"style=display:none><div id=cxinfo class=cmtext onclick=cmaction(1,event)><b>Informatie</b></div><div id=cxdesktop class=cmtext onclick=cmaction(3,event)>Bureaublad</div><div id=cxterminal class=cmtext onclick=cmaction(2,event)>Terminal</div><div id=cxfiles class=cmtext onclick=cmaction(4,event)>Bestanden</div><div id=cxevents class=cmtext onclick=cmaction(5,event)>Gebeurtenissen</div><div id=cxconsole class=cmtext onclick=cmaction(6,event)>Console</div><hr id=cxmgroupsplit><div id=cxmdesktop class=cmtext onclick=cmaction(7,event) style=display:none>Multi Desktop</div></div><div id=meshContextMenu class="contextMenu noselect"style=display:none;min-width:0><div id=cxselectall class=cmtext onclick=cmmeshaction(1,event)>Selecteer alles</div><div id=cxselectnone class=cmtext onclick=cmmeshaction(2,event)>Selecteer niets</div></div><div id=termShellContextMenu class="contextMenu noselect"style=display:none;min-width:0><div id=cxtermnorm class=cmtext onclick=cmtermaction(1,event)><b>Beheerder Shell</b></div><div id=cxtermps class=cmtext onclick=cmtermaction(6,event)>Beheerder PowerShell</div><div id=cxtermunorm class=cmtext onclick=cmtermaction(8,event)>Gebruiker Shell</div><div id=cxtermups class=cmtext onclick=cmtermaction(9,event)>Gebruiker PowerShell</div></div><div id=termShellContextMenuLinux class="contextMenu noselect"style=display:none;min-width:0><div id=cxtermnorm class=cmtext onclick=cmtermaction(1,event)><b>Root Shell</b></div><div id=cxtermps class=cmtext onclick=cmtermaction(8,event)>Gebruiker Shell</div></div><div id=container><div id=notifiyBox class=notifiyBox style=display:none></div><div id=masthead class=noselect><div style=float:left>{{{titlehtml}}}</div><div class=title>{{{title1}}}</div><div class=title2>{{{title2}}}</div><div style=float:right><div id=notificationCount onclick=clickNotificationIcon() class=unselectable style=display:none title="Klik om de huidige meldingen te bekijken">0</div></div><p id=logoutControl><span id=logoutControlSpan style=color:#fff></span><span id=idleTimeoutNotify style=color:#ff0></span></div><div id=page_leftbar><div style=height:16px></div><div id=LeftMenuMyDevices tabindex=0 class="lbbutton lbbuttonsel"title="Mijn apparaten"onclick=go(1,event) onkeypress='"Enter"==event.key&&go(1)'><div class=lb2></div></div><div id=LeftMenuMyAccount tabindex=0 class=lbbutton title="Mijn Account"onclick=go(2,event) onkeypress='"Enter"==event.key&&go(2)'><div class=lb1></div></div><div id=LeftMenuMyEvents tabindex=0 class=lbbutton title="Mijn gebeurtenissen"onclick=go(3,event) onkeypress='"Enter"==event.key&&go(3)'><div class=lb3></div></div><div id=LeftMenuMyFiles tabindex=0 class=lbbutton style=display:none title="Mijn bestanden"onclick=go(5,event) onkeypress='"Enter"==event.key&&go(5)'><div class=lb4></div></div><div id=LeftMenuMyUsers tabindex=0 class=lbbutton style=display:none title="Mijn gebruikers"onclick=go(4,event) onkeypress='"Enter"==event.key&&go(4)'><div class=lb5></div></div><div id=LeftMenuMyServer tabindex=0 class=lbbutton style=display:none title="Mijn server"onclick=go(6,event) onkeypress='"Enter"==event.key&&go(6)'><div class=lb6></div></div></div><div id=topbar class=noselect><div><div style=position:relative><div tabindex=0 id=uiMenuButton title="Selectie gebruikersinterface"onclick=showUserInterfaceSelectMenu() onkeypress='"Enter"==event.key&&showUserInterfaceSelectMenu()'>♦<div id=uiMenu style=display:none><div tabindex=0 id=uiViewButton1 class=uiSelector onclick=userInterfaceSelectMenu(1) title="Linkerbalk interface"onkeypress='"Enter"==event.key&&userInterfaceSelectMenu(1)'><div class=uiSelector1></div></div><div tabindex=0 id=uiViewButton2 class=uiSelector onclick=userInterfaceSelectMenu(2) title="Boven werkbalk interface"onkeypress='"Enter"==event.key&&userInterfaceSelectMenu(2)'><div class=uiSelector2></div></div><div tabindex=0 id=uiViewButton3 class=uiSelector onclick=userInterfaceSelectMenu(3) title="Interface met vaste breedte"onkeypress='"Enter"==event.key&&userInterfaceSelectMenu(3)'><div class=uiSelector3></div></div><div tabindex=0 id=uiViewButton4 class=uiSelector onclick=toggleNightMode() title="Wissel nachtmodus"onkeypress='"Enter"==event.key&&toggleNightMode()'><div class=uiSelector4></div></div></div></div><table id=MainMenuSpan cellpadding=0 cellspacing=0 class=style1><tr><td tabindex=0 id=MainMenuMyDevices class="topbar_td style3x"onclick=go(1,event) onkeypress='"Enter"==event.key&&go(1)'>Mijn apparaten<td tabindex=0 id=MainMenuMyAccount class="topbar_td style3x"onclick=go(2,event) onkeypress='"Enter"==event.key&&go(2)'>Mijn Account<td tabindex=0 id=MainMenuMyEvents class="topbar_td style3x"onclick=go(3,event) onkeypress='"Enter"==event.key&&go(3)'>Mijn gebeurtenissen<td tabindex=0 id=MainMenuMyFiles class="topbar_td style3x"onclick=go(5,event) onkeypress='"Enter"==event.key&&go(5)'>Mijn bestanden<td tabindex=0 id=MainMenuMyUsers class="topbar_td style3x"onclick=go(4,event) onkeypress='"Enter"==event.key&&go(4)'>Mijn gebruikers<td tabindex=0 id=MainMenuMyServer class="topbar_td style3x"onclick=go(6,event) onkeypress='"Enter"==event.key&&go(6)'>Mijn server<td class="topbar_td_end style3">&nbsp;</table><div id=MainSubMenuSpan style=display:none><table id=MainSubMenu cellpadding=0 cellspacing=0 class=style1><tr><td tabindex=0 id=MainDev class="topbar_td style3x"onclick=go(10,event) onkeypress='"Enter"==event.key&&go(10)'>Algemeen<td tabindex=0 id=MainDevDesktop class="topbar_td style3x"onclick=go(11,event) onkeypress='"Enter"==event.key&&go(11)'>Bureaublad<td tabindex=0 id=MainDevTerminal class="topbar_td style3x"onclick=go(12,event) onkeypress='"Enter"==event.key&&go(12)'>Terminal<td tabindex=0 id=MainDevFiles class="topbar_td style3x"onclick=go(13,event) onkeypress='"Enter"==event.key&&go(13)'>Bestanden<td tabindex=0 id=MainDevEvents class="topbar_td style3x"onclick=go(16,event) onkeypress='"Enter"==event.key&&go(16)'>Gebeurtenissen<td tabindex=0 id=MainDevInfo class="topbar_td style3x"onclick=go(17,event) onkeypress='"Enter"==event.key&&go(17)'>Details<td tabindex=0 id=MainDevAmt class="topbar_td style3x"onclick=go(14,event) onkeypress='"Enter"==event.key&&go(14)'>Intel® AMT<td tabindex=0 id=MainDevConsole class="topbar_td style3x"onclick=go(15,event) onkeypress='"Enter"==event.key&&go(15)'>Console<td tabindex=0 id=MainDevPlugins class="topbar_td style3x"onclick=go(19,event) onkeypress='"Enter"==event.key&&go(19)'>Plugins<td class="topbar_td_end style3">&nbsp;</table></div><div id=MeshSubMenuSpan style=display:none><table id=MeshSubMenu cellpadding=0 cellspacing=0 class=style1><tr><td tabindex=0 id=MeshGeneral class="topbar_td style3x"onclick=go(20,event) onkeypress='"Enter"==event.key&&go(20)'>Algemeen<td tabindex=0 id=MeshSummary class="topbar_td style3x"onclick=go(21,event) onkeypress='"Enter"==event.key&&go(21)'>Summary<td class="topbar_td_end style3">&nbsp;</table></div><div id=UserSubMenuSpan style=display:none><table id=UserSubMenu cellpadding=0 cellspacing=0 class=style1><tr><td tabindex=0 id=UserGeneral class="topbar_td style3x"onclick=go(30,event) onkeypress='"Enter"==event.key&&go(30)'>Algemeen<td tabindex=0 id=UserEvents class="topbar_td style3x"onclick=go(31,event) onkeypress='"Enter"==event.key&&go(31)'>Gebeurtenissen<td class="topbar_td_end style3">&nbsp;</table></div><div id=ServerSubMenuSpan style=display:none><table id=ServerSubMenu cellpadding=0 cellspacing=0 class=style1><tr><td tabindex=0 id=ServerGeneral class="topbar_td style3x"onclick=go(6,event) onkeypress='"Enter"==event.key&&go(6)'>Algemeen<td tabindex=0 id=ServerStats class="topbar_td style3x"onclick=go(40,event) onkeypress='"Enter"==event.key&&go(40)'>Statistieken<td tabindex=0 id=ServerConsole class="topbar_td style3x"onclick=go(115,event) onkeypress='"Enter"==event.key&&go(115)'>Console<td tabindex=0 id=ServerTrace class="topbar_td style3x"onclick=go(41,event) onkeypress='"Enter"==event.key&&go(41)'>Traceer<td tabindex=0 id=ServerPlugins class="topbar_td style3x"onclick=go(42,event) onkeypress='"Enter"==event.key&&go(42)'>Plugins<td class="topbar_td_end style3">&nbsp;</table></div><div id=UserDummyMenuSpan><table id=UserDummyMenu cellpadding=0 cellspacing=0 class=style1><tr><td class=style3>&nbsp;</table></div></div></div></div><div id=column_l><div id=p0 style=display:none><div id=p0message><span id=p0span>Server verbroken</span>,<href onclick=reload() style=cursor:pointer><u>klik om opnieuw verbinding te maken</u></href>.</div></div><div id=p1 style=display:none><div style=display:none id=devListToolbarViewIcons><div tabindex=0 id=devViewButton1 class=viewSelector onclick=onDeviceViewChange(1) onkeypress='"Enter"==event.key&&onDeviceViewChange(1)'title=kolommen><div class=viewSelector2></div></div><div tabindex=0 id=devViewButton2 class=viewSelector onclick=onDeviceViewChange(2) onkeypress='"Enter"==event.key&&onDeviceViewChange(2)'title=Lijst><div class=viewSelector1></div></div><div tabindex=0 id=devViewButton3 class=viewSelector onclick=onDeviceViewChange(3) onkeypress='"Enter"==event.key&&onDeviceViewChange(3)'title=Bureaubladen><div class=viewSelector3></div></div><div tabindex=0 id=devViewButton4 class=viewSelector onclick=onDeviceViewChange(4) onkeypress='"Enter"==event.key&&onDeviceViewChange(4)'title=Kaart style=display:none><div class=viewSelector4></div></div></div><div><h1>Mijn apparaten</h1></div><table id=devListToolbarSpan class=noselect><tr><td class=h1><td id=devListToolbar class=style14 style=display:none>&nbsp;&nbsp;<input type=button id=SelectAllButton onclick=selectallButtonFunction() value="Selecteer alles">&nbsp; <input type=button id=GroupActionButton disabled value=Groepsactie onclick=groupActionFunction()>&nbsp; <input id=SearchInput placeholder=Filter onchange=masterUpdate(5) onkeyup=masterUpdate(5) autocomplete=off onfocus=onSearchFocus(1) onblur=onSearchFocus(0)>&nbsp; <label><input type=checkbox id=RealNameCheckBox onclick=onRealNameCheckBox()><span title="Toon apparaten besturingssysteemnaam">Naam van het besturingssysteem</span></label><td id=kvmListToolbar class=style14 style=display:none>&nbsp;&nbsp;<input type=button onclick=connectAllKvmFunction() value="Alles verbinden">&nbsp; <input type=button onclick=disconnectAllKvmFunction() value="Verbreek alles">&nbsp; <label><input type=checkbox id=autoConnectDesktopCheckbox onclick=autoConnectDesktops(event) title="Automatisch verbinden">Automatisch&nbsp;</label> <input type=button onclick=showMultiDesktopSettings() value=Instellingen>&nbsp;<td id=devMapToolbar class=style14 style=display:none>&nbsp;&nbsp;<input id=mapSearchLocation placeholder="Zoek locatie"onfocus=onMapSearchFocus(1) onblur=onMapSearchFocus(0)> <input type=button value=Zoeken title="Zoeken naar locatie"onclick=getSearchLocation()> <input type=button id=refreshmap title="Reset kaartweergave"value=Reset onclick=refreshMap(!1,!0)><td class=auto-style1 style=height:100%><div style=display:none id=devListToolbarView>Kijken <select id=viewselect onchange=onDeviceViewChange()><option value=1>kolommen<option value=2>Lijst<option value=3>Bureaubladen<option id=viewselectmapoption value=4 style=display:none>Kaart</select></div><div style=display:none id=devListToolbarSort>Sorteer <select id=sortselect onchange=masterUpdate(6)><option>Groep<option>Power<option>Apparaat<option>Tags</select> &nbsp;</div><div style=display:none id=devListToolbarSize>Grootte <select id=sizeselect onchange=onDeviceViewChange()><option value=0>Klein<option value=1>Gemiddeld<option value=2>Grote</select> &nbsp;</div><td class=h2></table><div id=NoMeshesPanel style=display:none><table><tr><td valign=top style=width:50px><img src=images/info.png><td><div id=getStarted1>om meteen aan de slag te gaan, <a href=# onclick="return account_createMesh()"><strong>klik hier om een apparaatgroep te maken</strong></a>.</div><div id=getStarted2>Geen apparaatgroepen.</div></table></div><div id=xdevices class=noselect style=display:none></div><div id=xdevicesmap style=display:none><div id=xmapSearchResultsDlg style=display:none><div id=xmapSearchResultsBck><div id=xmapSearchClose onclick=mapCloseSearchWindow()><b>X</b></div><div style=padding:5px>Locatie resultaten</div><div style=width:100%;margin:6px></div></div><div id=xmapSearchResults style=margin:6px></div></div></div><div id=xmap-info-window></div></div><div id=p2 style=display:none><h1>Mijn Account</h1><img id=p2AccountImage alt=""src=images/clipboard-128.png><div id=p2AccountSecurity style=display:none><p><strong>Gebruikersaccount beveiliging</strong><div style=margin-left:25px><div id=manageAuthApp><div class=p2AccountActions><span id=authAppSetupCheck><strong>✓</strong></span></div><span><a href=# onclick="return account_manageAuthApp()">Beheer authenticator-app</a><br></span></div><div id=manageHardwareOtp><div class=p2AccountActions><span id=authKeySetupCheck><strong>✓</strong></span></div><span><a href=# onclick="return account_manageHardwareOtp(0)">Beheer beveiligingssleutels</a><br></span></div><div id=manageOtp><div class=p2AccountActions><span id=authCodesSetupCheck><strong>✓</strong></span></div><span><a href=# onclick="return account_manageOtp(0)">Beheer back-up codes</a><br></span></div></div></div><div id=p2AccountActions><p><strong>gebruikersacties</strong><p class=mL><span id=verifyEmailId style=display:none><a href=# onclick="return account_showVerifyEmail()">Verifieer Email</a><br></span><span id=accountEnableNotificationsSpan style=display:none><a href=# onclick="return account_enableNotifications()">Schakel webmeldingen in</a><br></span><a href=# onclick="return account_showLocalizationSettings()">Lokalisatie instellingen</a><br><a href=# onclick="return account_showAccountNotifySettings()">meldingsinstellingen</a><br><span id=accountChangeEmailAddressSpan style=display:none><a href=# onclick="return account_showChangeEmail()">Verander e-mailadres</a><br></span><a href=# onclick="return account_showChangePassword()">Verander wachtwoord</a><span id=p2nextPasswordUpdateTime></span><br><a href=# onclick="return account_showDeleteAccount()">Verwijder account</a><br></p><br style=clear:both></div><strong>Apparaatgroepen</strong> <span id=p2createMeshLink1>( <a href=# onclick="return account_createMesh()"class=newMeshBtn>Nieuw</a> )</span><br><br><div id=p2meshes></div><div id=p2noMeshFound style=display:none>Geen apparaatgroepen.<span id=p2createMeshLink2> <a href=# onclick="return account_createMesh()"><strong>Begin hier!</strong></a></span></div><br style=clear:both></div><div id=p3 style=display:none><h1>Mijn gebeurtenissen</h1><table class=pTable><tr><td class=h1><td class=auto-style1>Tonen <select id=p3limitdropdown onchange=refreshEvents()><option value=60>Laatste 60<option value=120>Laatste 120<option value=250>Laatste 250<option value=500>Laatste 500<option value=1000>Laatste 1000</select>&nbsp; <a href=# onclick=p3showDownloadEventsDialog(2)><img src=images/link4.png height=10 width=10 title="Download gebeurtenissen"style=cursor:pointer></a>&nbsp;<td class=h2></table><div id=p3events></div></div><div id=p4 style=display:none><h1>Mijn gebruikers</h1><table class=pTable><tr><td class=h1><td class=style14><div style=float:right><input type=button onclick=showUserBroadcastDialog() style=margin-right:6px value=Uitzending> <a href=# onclick=p4downloadUserInfo()><img style=cursor:pointer title="Download gebruikers informatie"src=images/link4.png></a><a href=# onclick=p4batchAccountCreate()><img id=p4UserBatchCreate style=cursor:pointer;display:none title="Batch aanmaken gebruikersaccounts"src=images/link6.png></a></div><div><input id=UserNewAccountButton type=button style=margin-left:6px onclick=showCreateNewAccountDialog() value="Nieuw account..."> <input id=UserSearchInput style=width:120px;margin-left:6px placeholder=Filter onchange=onUserSearchInputChanged() onkeyup=onUserSearchInputChanged() autocomplete=off onfocus=onUserSearchFocus(1) onblur=onUserSearchFocus(0)></div><td class=h2></table><div id=p3users></div></div><div id=p5 style=display:none><h1>Mijn bestanden</h1><table id=p5toolbar cellpadding=0 cellspacing=0><tr><td id=p5filehead valign=bottom><div id=p5rightOfButtons></div><div><input type=button id=p5FolderUp disabled onclick="return p5folderup()"value=Omhoog>&nbsp; <input type=button id=p5SelectAllButton disabled onclick=p5selectallfile() value="Selecteer alles">&nbsp; <input type=button id=p5RenameFileButton disabled value=Hernoemen onclick=p5renamefile()>&nbsp; <input type=button id=p5DeleteFileButton disabled value=Verwijderen onclick=p5deletefile()>&nbsp; <input type=button id=p5NewFolderButton disabled value="Nieuwe map"onclick=p5createfolder()>&nbsp; <input type=button id=p5UploadButton disabled value=Uploaden onclick=p5uploadFile()>&nbsp; <input type=button id=p5CutButton disabled value=Knippen onclick=p5copyFile(1)>&nbsp; <input type=button id=p5CopyButton disabled value=Kopie onclick=p5copyFile(0)>&nbsp; <input type=button id=p5PasteButton disabled value=Plakken onclick=p5pasteFile()>&nbsp;</div><tr><td id=p5filesubhead><div style=float:right><select id=p5sortdropdown onchange=updateFiles()><option value=1 selected>Sorteren op naam<option value=2>Sorteren op grootte<option value=3>Sorteren op datum<option value=4>Aflopend op naam<option value=5>Aflopend op grootte<option value=6>Aflopend op datum</select></div><div>&nbsp;&nbsp;<span id=p5currentpath></span></div></table><div id=p5filetable><div id=p5PublicShare><div>Deze bestanden worden openbaar gedeeld, klik op "link" om de openbare URL te krijgen.</div></div><div id=bigok style=display:none><b>✓</b></div><div id=bigfail style=display:none><b>✗</b></div><span id=p5files></span></div><table id=p5toolbarBottom style=width:100% cellpadding=0 cellspacing=0><tr><td class=style6>&nbsp;<span id=p5bottomstatus></span></table></div><div id=p6 style=display:none><img id=MainMeshImage src=serverpic.ashx><h1>Mijn server</h1><div id=p2ServerActions><p><strong>Server acties</strong><div class=mL><div id=p2ServerActionsBackup><a href={{{domainurl}}}backup.zip rel="noreferrer noopener"target=_blank>Download server back-up</a></div><div id=p2ServerActionsRestore><a href=# onclick="return server_showRestoreDlg()">Herstel server met back-up</a></div><div id=p2ServerActionsVersion><a href=# onclick="return server_showVersionDlg()">Controleer server versie</a></div><div id=p2ServerActionsErrors><a href=# onclick="return server_showErrorsDlg()">Serverlogboek weergeven</a></div></div></div><br><strong>Serverstatistieken</strong><br><br><div id=serverStats><div id=serverCpuChartView style=display:none><div class=chartViewCanvas><canvas id=serverCpuChart></canvas></div><div class=chartViewText id=serverCpuChartText></div></div><div id=serverMemoryChartView style=display:none><div class=chartViewCanvas><canvas id=serverMemoryChart></canvas></div><div class=chartViewText id=serverMemoryChartText></div></div><br><br><div id=serverStatsTable></div></div><div id=serverWarningsDiv style=display:none><br><strong>Serverwaarschuwingen</strong><br><br><div id=serverWarnings></div></div></div><div id=p10 style=display:none><table style=width:100% cellpadding=0 cellspacing=0><tr><td style=width:auto valign=top><div id=p10title><div id=p10BackButton><div class=backButton tabindex=0 onclick=goBack() title=Terug onkeypress='"Enter"==event.key&&goBack()'><div class=backButtonEx></div></div></div><h1>Algemeen - <span id=p10deviceName></span></h1></div><div id=p10html></div><td style=width:20px><td style=width:200px><a href=# onclick=p10showiconselector()><img id=MainComputerImage></a><div id=MainComputerState></div></table><br><div id=p10html2></div><div id=p10html3></div></div><div id=p11 class=noselect style=display:none><div id=p11title><div id=p11deviceNameHeader><div id=p11BackButton><div class=backButton tabindex=0 onclick=goBack() title=Terug onkeypress='"Enter"==event.key&&goBack()'><div class=backButtonEx></div></div></div><div id=devListToolbarViewIcons><div class=viewSelector onclick=deskToggleFull(event) title="Volledig scherm. Houd shift ingedrukt om de browser op volledig scherm weer te geven."><div class=viewSelector5></div></div></div><h1>bureaublad - <span id=p11deviceName></span></h1></div></div><div id=p11warning onclick=showFeaturesDlg()><div class=icon2></div><div class=warningbox>Intel® AMT omleidingspoort of KVM-functie is uitgeschakeld<span id=p11warninga>, klik hier om in te schakelen</span></div></div><div id=p11warning2 onclick=showPowerActionDlg()><div class=icon2></div><div class=warningbox>Externe computer is niet ingeschakeld, klik hier om een stroomopdracht uit te voeren.</div></div><div id=deskarea0 cellpadding=0 cellspacing=0><div id=deskarea1 class=areaHead><div class=toright2><span id=p11power></span>&nbsp;<div class=deskareaicon title="Schakel weergavemodus"onclick=toggleAspectRatio(1)>⇲</div><div class=deskareaicon title="Draai naar links"onclick=drotate(-1)>↺</div><div class=deskareaicon title="Draai naar rechts"onclick=drotate(1)>↻</div><div id=deskRecordIcon class=deskareaicon title="Server neemt deze sessie op"style=display:none;background-color:red;width:12px;height:12px;border-radius:6px;margin-top:5px></div><input id=deskFocusBtn type=button title="Schakel focusmodus in, indien actief wordt alleen het gebied rond de muis bijgewerkt"onkeypress=return!1 onkeydown=return!1 value="Focus alles"onclick=deskToggleFocus() style=margin-right:3px;display:none> <input id=deskSaveBtn type=button title="Bewaar een screenshot van het externe bureaublad"onkeypress=return!1 onkeydown=return!1 value=Opslaan... onclick=deskSaveImage() class=mR> <input id=deskActionsBtn type=button title="Voer krachtacties uit op het apparaat"onkeypress=return!1 onkeydown=return!1 value=Akties onclick=deviceActionFunction() class=mR> <input id=deskActionsSettings type=button value="Instellingen ..."title="Bewerk externe bureaubladinstellingen"onkeypress=return!1 onkeydown=return!1 onclick=showDesktopSettings() class=mR> <input type=button title="Wijzig de stroomstatus van het externe apparaat"onkeypress=return!1 onkeydown=return!1 value="Power Actie's..."onclick=showPowerActionDlg() style=display:none></div><div><div id=idx_deskFullBtn2 onclick=deskToggleFull(event)>&nbsp;✖</div><input type=button id=autoconnectbutton1 value="Automatisch verbinden"onclick=autoConnectDesktop(event) onkeypress=return!1 onkeydown=return!1 style=display:none> <span id=connectbutton1span><input type=button id=connectbutton1 value=Verbinden onclick=connectDesktop(event,3) onkeypress=return!1 onkeydown=return!1 disabled></span><span id=connectbutton1hspan>&nbsp;<input type=button id=connectbutton1h value="HW verbinden"title="Maak verbinding met Intel AMT hardware KVM"onclick=connectDesktop(event,2) onkeypress=return!1 onkeydown=return!1 disabled></span><span id=disconnectbutton1span>&nbsp;<input type=button id=disconnectbutton1 value=Verbreken onclick=connectDesktop(event,0) onkeypress=return!1 onkeydown=return!1></span>&nbsp;<span id=deskstatus>Verbroken</span></div></div><div id=deskarea2><div class=areaProgress><div id=progressbar></div></div></div><div id=deskarea3x><div id=DeskFocus oncontextmenu=return!1 onmousedown=dmousedown(event) onmouseup=dmouseup(event) onmousemove=dmousemove(event)></div><div id=DeskParent><canvas id=Desk width=640 height=480 oncontextmenu=return!1 onmousedown=dmousedown(event) onmouseup=dmouseup(event) onmousemove=dmousemove(event) onmousewheel=dmousewheel(event)></canvas></div><div id=DeskTools><div id=deskToolsAreaTop><a id=DeskToolsRefreshButton style=right:2px onclick=refreshDeskTools()>Ververs</a><div id=deskToolsTopTabProcess class=deskToolsTopTab onclick=changeDeskToolTab(0) style=left:0;bottom:0>Processen</div><div id=deskToolsTopTabService class=deskToolsTopTab onclick=changeDeskToolTab(1) style=display:none;left:90px;color:gray>Services</div></div><div id=deskToolsArea><div id=DeskToolsProcessTab><div id=deskToolsHeader><a class=colmn1 title="Sorteer op proces ID"onclick=sortProcess(0)>PID</a> <a class=colmn2 title="Sorteren op naam"onclick=sortProcess(1)>Naam</a></div><div id=DeskToolsProcesses></div></div><div id=DeskToolsServiceTab style=display:none><div id=deskToolsServiceHeader><a class=colmn1 style=width:70px title="Sorteer op status"onclick=sortService(0)>Status</a> <a class=colmn2 title="Sorteren op naam"onclick=sortService(1)>Naam</a></div><div id=DeskToolsServices></div></div></div></div><div id=p11DeskConsoleMsg style=display:none;cursor:pointer;position:absolute;left:30px;top:17px;color:#ff0;background-color:rgba(0,0,0,.6);padding:10px;border-radius:5px onclick=p11clearConsoleMsg()></div><div id=p11DeskSessionSelector style=display:none;position:absolute;left:30px;top:17px;right:30px></div></div><div id=deskarea4 class=areaFoot><div class=toright2><span id=DeskTimer title="Sessie tijd"></span>&nbsp; <select id=termdisplays style=display:none onchange=deskSetDisplay(event) onkeypress=return!1 onkeydown=return!1></select>&nbsp; <input id=DeskToolsButton type=button value=Gereedschap title="Schakel hulpmiddelenweergave in"onkeypress=return!1 onkeydown=return!1 onclick=toggleDeskTools()>&nbsp; <span id=DeskChatButton class=deskarea title="Open chatvenster op deze computer"><img src=images/icon-chat.png onclick=deviceChat(event) height=16 width=16 style=padding-top:2px></span><span id=DeskNotifyButton title="Toon een melding op de externe computer"><img src=images/icon-notify.png onclick=deviceToastFunction() height=16 width=16 style=padding-top:2px></span><span id=DeskOpenWebButton title="Open een webadres op de externe computer"><img src=images/icon-url2.png onclick=deviceUrlFunction() height=16 width=16 style=padding-top:2px></span><span id=DeskBackgroundButton title="Wissel bureaubladachtergrond op afstand in"><img src=images/icon-background.png onclick=deviceToggleBackground(event) height=16 width=16 style=padding-top:2px></span></div><div><select id=deskkeys><option value=10>Ctrl+Alt+Del<option value=5>Win<option value=0>Win+pijl naar omlaag<option value=1>Win+ pijl omhoog<option value=2>Win+L<option value=3>Win+M<option value=4>Shift+Win+M<option value=6>Win+R<option value=7>Alt-F4<option value=8>Ctrl-W<option value=9>Alt-Tab<option value=11>Win+pijl Links<option value=12>Win+pijl rechts</select> <input id=DeskWD type=button value=verzenden onkeypress=return!1 onkeydown=return!1 onclick=deskSendKeys()> <input id=DeskClip type=button value=Klembord onkeypress=return!1 onkeydown=return!1 onclick=showDeskClip()> <input id=DeskType type=button value=Typen onkeypress=return!1 onkeydown=return!1 onclick=showDeskType()> <label><span id=DeskControlSpan title="Schakelen tussen muis- en toetsenbordinvoer"><input id=DeskControl type=checkbox onkeypress=return!1 onkeydown=return!1 onclick=toggleKvmControl()>Invoer</span></label>&nbsp;</div></div></div></div><div id=p12 style=display:none><div id=p12title><div id=p12BackButton><div class=backButton tabindex=0 onclick=goBack() title=Terug onkeypress='"Enter"==event.key&&goBack()'><div class=backButtonEx></div></div></div><h1>Terminal - <span id=p12deviceName></span></h1></div><div id=p12warning onclick=showFeaturesDlg()><div class=icon2></div><div class=warningbox>Intel® AMT omleidingspoort of KVM-functie is uitgeschakeld<span id=p12warninga>, klik hier om in te schakelen</span></div></div><div id=p12warning2 onclick=showPowerActionDlg()><div class=icon2></div><div class=warningbox>Externe computer is niet ingeschakeld, klik hier om een stroomopdracht uit te voeren.</div></div><div id=termTable style=position:relative><table style=width:100% cellpadding=0 cellspacing=0><tr><td class=areaHead><div class=toright2><div id=termRecordIcon class=deskareaicon title="Server neemt deze sessie op"style=display:none;background-color:red;width:12px;height:12px;border-radius:6px;margin-top:5px;margin-left:5px></div><input id=termActionsBtn type=button title="Voer krachtacties uit op het apparaat"onkeypress=return!1 onkeydown=return!1 value=Akties onclick=deviceActionFunction()></div><div><input type=button id=autoconnectbutton2 value="Automatisch verbinden"onclick=autoConnectTerminal(event) onkeypress=return!1 onkeydown=return!1 style=display:none> <span id=connectbutton2span><input type=button id=connectbutton2 value=Verbinden onclick=connectTerminal(event,1) onkeypress=return!1 onkeydown=return!1 disabled></span><span id=connectbutton2hspan>&nbsp;<input type=button id=connectbutton2h value="HW verbinden"title="Maak verbinding met Intel AMT hardware KVM"onclick=connectTerminal(event,2) onkeypress=return!1 onkeydown=return!1 disabled></span><span id=disconnectbutton2span>&nbsp;<input type=button id=disconnectbutton2 value=Verbreken onclick=connectTerminal(event,0) onkeypress=return!1 onkeydown=return!1></span>&nbsp;<span id=termstatus>Verbroken</span><span id=termtitle></span></div><tr><td><div class=areaProgress><div id=termprogressbar></div></div><tr><td id=termarea3x><pre id=Term></pre><tr><td class=areaFoot><div class=toright2><span id=TermTimer title="Sessie tijd"></span>&nbsp; <span id=terminalSettingsButtons style=display:none><input id=id_tcrbutton type=button onkeypress=return!1 onkeydown=return!1 class=bottombutton value=CR+LF title="Wissel wat de return toets zal verzenden"onclick=termToggleCr()> <input id=id_tfxkeysbutton type=button onkeypress=return!1 onkeydown=return!1 class=bottombutton value="Intel (F10 = ESC+[OM)"title="Schakel het emulatietype van F1 naar F10-toetsen"onclick=termToggleFx()> <input id=id_ttypebutton type=button onkeypress=return!1 onkeydown=return!1 class=bottombutton value="Extended Ascii"title="Schakel het type terminal emulatie in"onclick=termToggleType()> </span><span id=terminalSizeDropDown><select id=termSizeList onkeypress=return!1><option value=1>80x25<option value=2>100x30<option value=3 selected>Automatisch</select> </span><select id=specialkeylist onkeypress=return!1></select> <input id=specialkeylistinput type=button onkeypress=return!1 class=bottombutton value=verzenden title="Verzend de geselecteerde speciale sleutel"onclick=sendSpecialKey()></div><div>&nbsp; <input type=button onkeypress=return!1 onkeydown=return!1 class=bottombutton id=ctrlcbutton value=Ctl-C onclick='termSendKey(3,"ctrlcbutton")'> <input type=button onkeypress=return!1 onkeydown=return!1 class=bottombutton id=ctrlxbutton value=Ctl-X onclick='termSendKey(24,"ctrlxbutton")'> <input type=button onkeypress=return!1 onkeydown=return!1 class=bottombutton id=escbutton value=ESC onclick='termSendKey(27,"escbutton")'> <input type=button onkeypress=return!1 onkeydown=return!1 class=bottombutton id=bsbutton value=Backspace onclick='termSendKey(8,"bsbutton")'> <input type=button onkeypress=return!1 onkeydown=return!1 class=bottombutton id=pastebutton value=Plakken title="Plak tekst in de terminal"onclick=showTermPasteDialog()></div></table><div id=p12TermConsoleMsg style=display:none;cursor:pointer;position:absolute;left:30px;top:45px;color:#ff0;background-color:rgba(0,0,0,.6);padding:10px;border-radius:5px onclick=p12clearConsoleMsg()></div></div></div><div id=p13 style=display:none><div id=p13title><div id=p13BackButton style=float:left><div class=backButton tabindex=0 onclick=goBack() title=Terug onkeypress='"Enter"==event.key&&goBack()'><div class=backButtonEx></div></div></div><h1>Bestanden - <span id=p13deviceName></span></h1></div><table id=p13toolbar cellpadding=0 cellspacing=0><tr><td class=areaHead><div class=toright2><input id=filesActionsBtn type=button title="Voer krachtacties uit op het apparaat"value=Akties onclick=deviceActionFunction()><div id=filesRecordIcon class=deskareaicon title="Server neemt deze sessie op"style=display:none;background-color:red;width:12px;height:12px;border-radius:6px;margin-top:5px;margin-left:5px></div></div><div><input id=p13AutoConnect value="Automatisch verbinden"onclick=autoConnectFiles(event) type=button style=display:none> <input id=p13Connect value=Verbinden onclick=connectFiles(event) type=button> <span id=p13Status>Verbroken</span></div><tr><td class=areaHead2 valign=bottom><div id=p13rightOfButtons class=toright2></div><div><input type=button id=p13FolderUp disabled onclick=p13folderup() value=Omhoog>&nbsp; <input type=button id=p13SelectAllButton disabled onclick=p13selectallfile() value="Selecteer alles">&nbsp; <input type=button id=p13RenameFileButton disabled value=Hernoemen onclick=p13renamefile()>&nbsp; <input type=button id=p13DeleteFileButton disabled value=Verwijderen onclick=p13deletefile()>&nbsp; <input type=button id=p13ViewFileButton disabled value=Bewerk onclick=p13viewfile()>&nbsp; <input type=button id=p13NewFolderButton disabled value="Nieuwe map"onclick=p13createfolder()>&nbsp; <input type=button id=p13UploadButton disabled value=Uploaden onclick=p13uploadFile()>&nbsp; <input type=button id=p13CutButton disabled value=Knippen onclick=p13copyFile(1)>&nbsp; <input type=button id=p13CopyButton disabled value=Kopie onclick=p13copyFile(0)>&nbsp; <input type=button id=p13PasteButton disabled value=Plakken onclick=p13pasteFile()>&nbsp; <input type=button id=p13RefreshButton disabled value=Ververs onclick=p13folderup(9999)>&nbsp;</div><tr><td class=areaHead3><div class=toright2><select id=p13sortdropdown onchange=p13updateFiles()><option value=1 selected>Sorteren op naam<option value=2>Sorteren op grootte<option value=3>Sorteren op datum<option value=4>Aflopend op naam<option value=5>Aflopend op grootte<option value=6>Aflopend op datum</select></div><div>&nbsp;&nbsp;<span id=p13currentpath></span></div></table><div id=p13FilesConsoleMsg style=display:none;cursor:pointer;position:absolute;left:30px;top:165px;color:#ff0;background-color:rgba(0,0,0,.6);padding:10px;border-radius:5px onclick=p13clearConsoleMsg()></div><div id=p13filetable><div id=p13bigok style=display:none><b>✓</b></div><div id=p13bigfail style=display:none><b>✗</b></div><span id=p13files></span></div><table id=p13toolbarBottom cellpadding=0 cellspacing=0><tr><td class=style6>&nbsp;<span id=p13bottomstatus></span></table></div><div id=p14 style=display:none><div id=p14title><div id=p14BackButton style=float:left><div class=backButton tabindex=0 onclick=goBack() title=Terug onkeypress='"Enter"==event.key&&goBack()'><div class=backButtonEx></div></div></div><div id=devListToolbarViewIcons><div class=viewSelector onclick=deskToggleFull(event) title="Volledig scherm. Houd shift ingedrukt om de browser op volledig scherm weer te geven."><div class=viewSelector5></div></div></div><h1>Intel® AMT - <span id=p14deviceName></span></h1></div><iframe id=p14iframe src={{{domainurl}}}commander.htm></iframe></div><div id=p15 style=display:none><div id=p15title><div id=p15BackButton style=float:left><div class=backButton tabindex=0 onclick=goBack() title=Terug onkeypress='"Enter"==event.key&&goBack()'><div class=backButtonEx></div></div></div><h1><span id=p15deviceName></span></h1></div><table id=consoleTable cellpadding=0 cellspacing=0><tr><td class=areaHead><div class=toright2><div id=p15coreName title="Informatie over de huidige kern die op deze agent wordt uitgevoerd"></div><input type=button id=p15uploadCore value="Agent actie"onclick=p15uploadCore(event) title="Wijzig de Javascript code module van de agent"> <img onclick=p15downloadConsoleText() style=cursor:pointer;margin-top:6px title="Consoletekst downloaden"src=images/link4.png></div><div id=p15statetext></div><tr><td><div class=areaProgress><div id=consoleprogressbar></div></div><tr><td id=p15agentConsole><pre id=p15agentConsoleText></pre><tr><td class=areaFoot><table style=width:100%><tr><td style=width:99%><input id=p15consoleText style=width:100% onkeyup=p15consoleSend(event) onfocus=onConsoleFocus(1) onblur=onConsoleFocus(0)><td>&nbsp;<td id=p15outputselecttd><select id=p15outputselect><option value=1>Agent<option value=2>MQTT</select><td style=width:1%><input id=id_p15consoleClear type=button class=bottombutton value=Wissen onclick=p15consoleClear()></table></table></div><div id=p16 style=display:none><div id=p16title><div id=p16BackButton style=float:left><div class=backButton tabindex=0 onclick=goBack() title=Terug onkeypress='"Enter"==event.key&&goBack()'><div class=backButtonEx></div></div></div><h1>Gebeurtenissen - <span id=p16deviceName></span></h1></div><table class=pTable><tr><td class=h1><td class=auto-style1>Tonen <select id=p16limitdropdown onchange=refreshDeviceEvents()><option value=60>Laatste 60<option value=120>Laatste 120<option value=250>Laatste 250<option value=500>Laatste 500<option value=1000>Laatste 1000</select> <a href=# onclick=p3showDownloadEventsDialog(1)><img src=images/link4.png height=10 width=10 title="Download gebeurtenissen"style=cursor:pointer></a>&nbsp;<td class=h2></table><div id=p16events></div></div><div id=p17 style=display:none><div id=p17title><div id=p17BackButton style=float:left><div class=backButton tabindex=0 onclick=goBack() title=Terug onkeypress='"Enter"==event.key&&goBack()'><div class=backButtonEx></div></div></div><h1>Details - <span id=p17deviceName></span></h1></div><div id=p17info></div></div><div id=p20 style=display:none><picture id=MainMeshImage style=border-width:0;height:200px;width:200px;float:right><source type=image/webp width=200 height=200 srcset=images/webp/mesh-256.webp><img alt=""width=200 height=200 src=images/mesh-256.png></picture><div style=float:left><div class=backButton tabindex=0 onclick=goBack() title=Terug onkeypress='"Enter"==event.key&&goBack()'><div class=backButtonEx></div></div></div><h1>Algemeen - <span id=p20meshName></span></h1><p id=p20info></div><div id=p21 style=display:none><div style=float:left><div class=backButton tabindex=0 onclick=goBack() title=Terug onkeypress='"Enter"==event.key&&goBack()'><div class=backButtonEx></div></div></div><h1>Summary - <span id=p21meshName></span></h1><div style=width:100%><div style=display:table;width:93%><div id=meshPowerChartDiv style=width:31%;display:inline-block;text-align:center;max-width:250px><div style=margin:10px;font-size:16px>Power States</div><canvas id=meshPowerChart style=width:250px;height:250px></canvas></div><div id=meshOsChartDiv style=width:31%;display:inline-block;text-align:center;max-width:250px><div style=margin:10px;font-size:16px>Agent Types</div><canvas id=meshOsChart style=width:250px;height:250px></canvas></div><div id=meshConnChartDiv style=width:31%;display:inline-block;text-align:center;max-width:250px><div style=margin:10px;font-size:16px>connectiviteit</div><canvas id=meshConnChart style=width:250px;height:250px></canvas></div></div></div><p id=p21info></div><div id=p30 style=display:none><table style=width:100% cellpadding=0 cellspacing=0><tr><td style=width:auto valign=top><div id=p30title><div style=float:left><div class=backButton tabindex=0 onclick=goBack() title=Terug onkeypress='"Enter"==event.key&&goBack()'><div class=backButtonEx></div></div></div><h1>Algemeen - <span id=p30userName></span></h1></div><div id=p30html></div><td style=width:20px><td style=width:200px><picture id=MainUserImage style=border-width:0;height:200px;width:200px;float:right><source type=image/webp width=200 height=200 srcset=images/webp/user-256.webp><img alt=""width=200 height=200 src=images/user-256.png></picture><div style=width:100%;text-align:center><strong><span id=MainUserState></span></strong></div></table><br><div id=p30html2></div><div id=p30html3></div></div><div id=p31 style=display:none><div style=float:left><div class=backButton tabindex=0 onclick=goBack() title=Terug onkeypress='"Enter"==event.key&&goBack()'><div class=backButtonEx></div></div></div><h1>Gebeurtenissen - <span id=p31userName></span></h1><table class=pTable><tr><td class=h1><td class=auto-style1>Tonen <select id=p31limitdropdown onchange=refreshUsersEvents()><option value=60>Laatste 60<option value=120>Laatste 120<option value=250>Laatste 250<option value=500>Laatste 500<option value=1000>Laatste 1000</select> <a href=# onclick=p3showDownloadEventsDialog(3)><img src=images/link4.png height=10 width=10 title="Download gebeurtenissen"style=cursor:pointer></a>&nbsp;<td class=h2></table><div id=p31events></div></div><div id=p40 style=display:none><h1>Mijn serverstatistieken</h1><div class=areaHead><div class=toright2><select id=p40type onchange=updateServerTimelineStats()><option value=0>Verbindingen<option value=1>Geheugen</select>&nbsp; <select id=p40time onchange=updateServerTimelineHours()><option value=3>Laatste 3 uur<option value=8>Laatste 8 uur<option value=24>Laatste dag<option value=168>Vorige week<option value=720>Laatste 30 dagen</select>&nbsp; <img src=images/link4.png height=10 width=10 title="Gegevenspunten downloaden (.csv)"style=cursor:pointer onclick=p40downloadEvents()>&nbsp;</div><div><input value=Ververs type=button onclick=refreshServerTimelineStats()> &nbsp;<label><input id=p40log type=checkbox onclick=updateServerTimelineHours()>Log-X</label></div></div><canvas id=serverMainStats></canvas></div><div id=p41 style=display:none><h1>Mijn server traceren</h1><div class=areaHead><div class=toright2>Tonen <select id=p41limitdropdown onchange=displayServerTrace()><option value=100>Laatste 100<option value=250>Laatste 250<option value=500>Laatste 500<option value=1000>Laatste 1000</select> <input value=Wissen type=button onclick=clearServerTracing()> <img src=images/link4.png height=10 width=10 title="Download sporen (.csv)"style=cursor:pointer onclick=p41downloadServerTrace()>&nbsp;</div><div><input value=traceren type=button onclick=setServerTracing()> <span id=p41traceStatus>Geen</span></div></div><div id=p41events></div></div><div id=p42 style=display:none><h1>Mijn serverplug-ins</h1><div class=areaHead><div class=toright2></div><div><input value="Download Plugin"type=button onclick="return pluginHandler.addPluginDlg()"></div></div><div id=pluginRestartNotice class=areaHead style=background-color:gold;display:none><div class=toright2><input value="Agentcores vernieuwen"type=button onclick="return distributeCore(),!1"></div><div style=padding:2px><div style=padding:2px><b>Opmerking:</b> Plug-ins zijn gewijzigd, dit kan een update van de agent vereisen.</div></div></div><table id=p42tbl><tr class=DevSt><th style=width:26px><th style=width:10px><th class=chName>Naam<th class=chDescription>Omschrijving<th class=chSite style=text-align:center>Link<th class=chVersion style=text-align:center>Versie<th class=chUpgradeAvail style=text-align:center>Laatste<th class=chStatus style=text-align:center>Status<th class=chAction style=text-align:center>Aktie<th style=width:10px></table><div id=pluginNoneNotice style=width:100%;text-align:center;padding-top:10px;display:none><i>Geen plug-ins op server.</i></div></div><div id=p43 style=display:none><div id=p43BackButton><div class=backButton tabindex=0 onclick=go(42) title=Terug onkeypress='"Enter"==event.key&&go(42)'><div class=backButtonEx></div></div></div><h1>Mijn serverplug-ins - <span id=p43title></span></h1><iframe id=p43iframe frameborder=0 style="width:100%;height:calc(100vh - 245px);max-height:calc(100vh - 245px)"></iframe></div><div id=p19 style=display:none><h1>Plugins - <span id=p19deviceName></span></h1><div id=p19headers></div><div id=p19pages></div></div><br id=column_l_bottomgap></div><div id=footer><div class=footer1>{{{footer}}}</div><div class=footer2><a id=verifyEmailId2 style=display:none href=# onclick=account_showVerifyEmail()>Verifieer Email</a> &nbsp;<a href=terms>Voorwaarden &amp; Privacy</a></div></div><div id=dialog class=noselect style=display:none><div id=dialogHeader><div tabindex=0 id=id_dialogclose onclick=setDialogMode() onkeypress='"Enter"==event.key&&setDialogMode()'>✖</div><div id=id_dialogtitle></div></div><div id=dialogBody><div id=dialog1><div id=id_dialogMessage></div></div><div id=dialog2><div id=id_dialogOptions></div></div><div id=dialog3><div id=d3upload><div>Bestand selectie</div><select id=d3uploadMode onchange=d3modechange()><option value=1>Lokaal bestand uploaden<option value=2>Selectie serverbestand</select></div><div id=d3localmode style=display:none><div>Upload bestand</div><form id=d3localmodeform method=post enctype=multipart/form-data action=uploadfile.ashx target=fileUploadFrame><input id=d3auth name=auth style=display:none> <input id=d3attrib name=attrib style=display:none> <input type=file id=d3localFile name=files onchange=d3setActions()> <input type=submit id=d3submit style=display:none></form></div><div id=d3servermode><div id=d3serveraction valign=bottom><input type=button id=p3FolderUp disabled onclick=d3folderup() value=Omhoog>&nbsp;</div><div id=d3serverfiles></div></div></div><div id=dialog4><input id=d4WrapButton type=button value="Wrap On"onclick=d4ToggleWrap()> <input id=d4SizeButton type=button value=Klein onclick=d4ToggleSize()> <textarea id=d4editorarea style="height:calc(100vh - 286px);width:100%;overflow:scroll;resize:none;white-space:pre"></textarea></div><div id=dialog7><div id=d7meshkvm><h4>Agent Extern bureaublad</h4><div><div>Kwaliteit</div><select id=d7bitmapquality dir=rtl></select></div><div><div>Schalen</div><select id=d7bitmapscaling dir=rtl><option selected value=1024>100%<option value=896>87.5%<option value=768>75%<option value=640>62.5%<option value=512>50%<option value=384>37.5%<option value=256>25%<option value=128>12.5%</select></div><div><div>Frameverhouding</div><select id=d7framelimiter dir=rtl><option selected value=50>Snel<option value=100>Gemiddeld<option value=400>Traag<option value=1000>erg traag</select></div></div><div id=d7amtkvm><h4>Intel® AMT Hardware KVM</h4><div><div>Beeldcodering</div><select id=d7desktopmode><option value=1>RLE8, snelste<option value=2>RLE16, Aanbevolen<option value=3>RAW8, langzaam<option value=4>RAW16, Zeer langzaam</select></div><div><div>Andere instellingen</div><div id=d7otherset style=display:block><label style=display:block><input type=checkbox id=d7showfocus>Toon focus tool</label> <label style=display:block><input type=checkbox id=d7showcursor>Lokale muiscursor weergeven</label> <label style=display:block><input type=checkbox id=d7localKeyMap>Lokale toetsenbordkaart</label></div></div></div></div></div><div id=idx_dlgButtonBar><input id=idx_dlgCancelButton type=button value=Afbreken onclick=dialogclose(0)> <input id=idx_dlgOkButton type=button value=Oke onclick=dialogclose(1)><div><input id=idx_dlgDeleteButton type=button value=Verwijderen style=display:none onclick=dialogclose(2)></div></div></div><iframe name=fileUploadFrame style=display:none></iframe><form style=display:none method=post action=uploadfile.ashx enctype=multipart/form-data target=fileUploadFrame><input id=p5fileDragName name=name><input id=p5fileDragAuthCookie name=auth><input id=p5fileDragSize name=size><input id=p5fileDragType name=type><input id=p5fileDragData name=data><input id=p5fileDragLink name=link><input type=submit id=p5loginSubmit2 style=display:none></form><form style=display:none method=post action=uploadnodefile.ashx enctype=multipart/form-data target=fileUploadFrame><input id=p13fileDragName name=name><input id=p13fileDragSize name=size><input id=p13fileDragType name=type><input id=p13fileDragData name=data><input id=p13fileDragLink name=link><input type=submit id=p13loginSubmit2 style=display:none></form><audio id=chimes><source src=sounds/chimes.mp3 type=audio/mp3></audio></div><script>'use strict';
// Process server-side web state
var webState = '{{{webstate}}}';
if (webState != '') { webState = JSON.parse(decodeURIComponent(webState)); }
for (var i in webState) { localStorage.setItem(i, webState[i]); }
if (!webState.loctag) { delete localStorage.removeItem('loctag'); }
var args;
var autoReconnect = true;
var powerStatetable = ['', "ingeschakeld", "Slaap", "Slaap", "Slaap", "Slaapstand", "Uitzetten", "Aanwezig"];
var StatusStrs = ["Verbroken", "Verbinden...", "Setup...", "Verbonden", "Intel® AMT verbonden"];
var agentsStr = ["Onbekend", "Windows 32bit console", "Windows 64bit console", "Windows 32bit service", "Windows 64bit service", "Linux 32bit", "Linux 64bit", "MIPS", "XENx86", "Android ARM", "Linux ARM", "MacOS 32bit", "Android x86", "PogoPlug ARM", "Android APK", "Linux Poky x86-32bit", "MacOS 64bit", "ChromeOS", "Linux Poky x86-64bit", "Linux NoKVM x86-32bit", "Linux NoKVM x86-64bit", "Windows MinCore console", "Windows MinCore service", "NodeJS", "ARM-Linaro", "ARMv6l / ARMv7l", "ARMv8 64bit", "ARMv6l / ARMv7l / NoKVM", "Onbekend", "Onbekend", "FreeBSD x86-64"];
var sort = 0;
var searchFocus = 0;
var mapSearchFocus = 0;
var userSearchFocus = 0;
var consoleFocus = 0;
var showRealNames = false;
var meshserver = null;
var meshes = {};
var meshcount = 0;
var nodes = null;
var filetree = {};
var userinfo = null;
var serverinfo = null;
var events = [];
var users = null;
var wssessions = null;
var nodeShortIdent = 0;
var desktop;
var desktopsettings = { encoding: 2, showfocus: false, showmouse: true, showcad: true, quality: 40, scaling: 1024, framerate: 50, localkeymap: false };
var multidesktopsettings = { quality: 20, scaling: 128, framerate: 1000 };
var terminal;
var files;
var debugLevel = parseInt('{{{debuglevel}}}');
var features = parseInt('{{{features}}}');
var sessionTime = parseInt('{{{sessiontime}}}');
var domain = '{{{domain}}}';
var domainUrl = '{{{domainurl}}}';
var authCookie = '{{{authCookie}}}';
var authRelayCookie = '{{{authRelayCookie}}}';
var logoutControls = {{{logoutControls}}};
var authCookieRenewTimer = null;
var multiDesktop = {};
var multiDesktopFilter = null;
var serverPublicNamePort = '{{{serverDnsName}}}:{{{serverPublicPort}}}';
var amtScanResults = null;
var debugmode = 0;
var clickOnce = (((features & 256) != 0) && detectClickOnce());
var attemptWebRTC = ((features & 128) != 0);
var passRequirements = '{{{passRequirements}}}';
if (passRequirements != '') { passRequirements = JSON.parse(decodeURIComponent(passRequirements)); }
var deskAspectRatio = 0;
try { deskAspectRatio = parseInt(getstore('deskAspectRatio', '0')); } catch (ex) { }
var uiMode = parseInt(getstore('uiMode', 1));
var webPageStackMenu = false;
var webPageFullScreen = true;
var nightMode = (getstore('_nightMode', '0') == '1');
var sessionActivity = Date.now();
var updateSessionTimer = null;
var pluginHandlerBuilder = {{{pluginHandler}}};
var pluginHandler = null;
if (pluginHandlerBuilder != null) { pluginHandler = new pluginHandlerBuilder(); }
var installedPluginList = null;
// Console Message Display Timers
var p11DeskConsoleMsgTimer = null;
var p12TermConsoleMsgTimer = null;
var p13FilesConsoleMsgTimer = null;
function startup() {
if ((features & 32) == 0) {
// Guard against other site's top frames (web bugs).
var loc = null;
try { loc = top.location.toString().toLowerCase(); } catch (e) { }
if (top != self && (loc == null || top.active == false)) { top.location = self.location; return; }
}
// Setup logout control
var logoutControl = '';
if (logoutControls.name != null) { logoutControl = format("Welkom {0}.", logoutControls.name); }
if (logoutControls.logoutUrl != null) { logoutControl += format(' <a href=\"' + logoutControls.logoutUrl + '\" style="color:white">' + "Uitloggen" + '</a>'); }
QH('logoutControlSpan', logoutControl);
// Check if we are in debug mode
args = parseUriArgs();
if (!args.locale) { var x = getstore('loctag', 0); if ((x != null) && (x != '*')) { args.locale = x; } }
debugmode = args.debug;
if (args.webrtc != null) { attemptWebRTC = (args.webrtc == 1); }
QV('p13AutoConnect', debugmode); // Files
QV('autoconnectbutton2', debugmode); // Terminal
QV('autoconnectbutton1', debugmode); // Desktop
//QV('DeskClip', debugmode); // Clipboard feature, not completed so show in in debug mode only.
if (nightMode) { QC('body').add('night'); }
toggleFullScreen();
// Setup page visuals
if (args.hide) {
var hide = parseInt(args.hide);
QV('masthead', !(hide & 1));
QV('topbar', !(hide & 2));
QV('footer', !(hide & 4));
QV('p10title', !(hide & 8));
QV('p11title', !(hide & 8));
QV('p12title', !(hide & 8));
QV('p13title', !(hide & 8));
QV('p14title', !(hide & 8));
QV('p15title', !(hide & 8));
QV('p16title', !(hide & 8));
//if (hide & 16) {
// QV('page_leftbar', false);
// QS('page_content').left = '0px';
//}
// Fix the main grid to zero-height elements we want to hide.
QS('container')['grid-template-rows'] = ((hide & 1) ? '0' : '66') + 'px ' + ((hide & 2) ? '0' : '24') + 'px auto ' + ((hide & 4) ? '0' : '45') + 'px';
QS('container')['-ms-grid-rows'] = ((hide & 1) ? '0' : '66') + 'px ' + ((hide & 2) ? '0' : '24') + 'px auto ' + ((hide & 4) ? '0' : '45') + 'px';
// Adjust height of remote desktop, files and Intel AMT
var xh = (((hide & 1) ? 0 : 66) + ((hide & 2) ? 0 : 24) + ((hide & 4) ? 0 : 45) + ((hide & 8) ? 0 : 60)); // 0 to 195
QS('p3users')['max-height'] = 'calc(100vh - ' + (124 + xh) + 'px)';
QS('p3events')['height'] = 'calc(100vh - ' + (124 + xh) + 'px)';
QS('deskarea3x')['height'] = 'calc(100vh - ' + (75 + xh) + 'px)';
QS('deskarea3x')['max-height'] = 'calc(100vh - ' + (75 + xh) + 'px)';
QS('p5filetable')['height'] = 'calc(100vh - ' + (160 + xh) + 'px)';
QS('p13filetable')['height'] = 'calc(100vh - ' + (124 + xh) + 'px)';
QS('serverMainStats')['height'] = 'calc(100vh - ' + (110 + xh) + 'px)';
QS('serverMainStats')['max-height'] = 'calc(100vh - ' + (110 + xh) + 'px)';
QS('xdevices')['max-height'] = 'calc(100vh - ' + (124 + xh) + 'px)';
QS('xdevicesmap')['max-height'] = 'calc(100vh - ' + (124 + xh) + 'px)';
QS('p15agentConsole')['height'] = 'calc(100vh - ' + (84 + xh) + 'px)';
QS('p15agentConsole')['max-height'] = 'calc(100vh - ' + (84 + xh) + 'px)';
QS('p15agentConsoleText')['height'] = 'calc(100vh - ' + (81 + xh) + 'px)';
QS('p15agentConsoleText')['max-height'] = 'calc(100vh - ' + (81 + xh) + 'px)';
QS('p43iframe')['height'] = 'calc(100vh - ' + (84 + xh) + 'px)';
QS('p43iframe')['max-height'] = 'calc(100vh - ' + (84 + xh) + 'px)';
}
// We are looking at a single device, remove all the back buttons
if ('{{currentNode}}' != '') {
QV('p10BackButton', false);
QV('p11BackButton', false);
QV('p12BackButton', false);
QV('p13BackButton', false);
QV('p14BackButton', false);
QV('p15BackButton', false);
QV('p16BackButton', false);
}
p1updateInfo();
// Setup the context menu
document.onclick = function (e) { hideContextMenu(); }
document.onkeypress = ondockeypress;
document.onkeydown = ondockeydown;
document.onkeyup = ondockeyup;
//window.addEventListener('focus', ondocfocus, false);
window.addEventListener('blur', ondocblur, false);
window.onresize = function () { masterUpdate(512); }
setTimeout(function() { masterUpdate(512); }, 200);
// Connect to the mesh server
meshserver = MeshServerCreateControl(domainUrl, authCookie);
meshserver.onStateChanged = onStateChanged;
meshserver.onMessage = onMessage;
meshserver.trace = (args.trace == 1);
meshserver.Start();
// Setup page controls
Q('sortselect').selectedIndex = sort = getstore('sort', 0);
Q('sizeselect').selectedIndex = getstore('_viewsize', 1);
Q('SearchInput').value = getstore('_search', '');
showRealNames = (getstore('showRealNames', 0) == 1);
Q('RealNameCheckBox').checked = showRealNames;
Q('viewselect').value = getstore('_deviceView', 1);
Q('DeskControl').checked = (getstore('DeskControl', 1) == 1);
QV('accountChangeEmailAddressSpan', (features & 0x200000) == 0);
// Display the page devices
masterUpdate(3)
for (var j = 1; j < 5; j++) { Q('devViewButton' + j).classList.remove('viewSelectorSel'); }
Q('devViewButton' + Q('viewselect').value).classList.add('viewSelectorSel');
// Setup upload drag & drop
Q('p5filetable').addEventListener('drop', p5fileDragDrop, false);
Q('p5filetable').addEventListener('dragover', p5fileDragOver, false);
Q('p5filetable').addEventListener('dragleave', p5fileDragLeave, false);
//Q('p5fileCatchAllInput').addEventListener('drop', p5fileDragDrop, false);
//Q('p5fileCatchAllInput').addEventListener('dragover', p5fileDragOver, false);
//Q('p5fileCatchAllInput').addEventListener('dragleave', p5fileDragLeave, false);
// Setup upload drag & drop
Q('p13filetable').addEventListener('drop', p13fileDragDrop, false);
Q('p13filetable').addEventListener('dragover', p13fileDragOver, false);
Q('p13filetable').addEventListener('dragleave', p13fileDragLeave, false);
// Timeline update interval
setInterval(updateDeviceTimeline, 120000); // Check every 2 minutes
// Load desktop settings
var t = localStorage.getItem('desktopsettings');
if (t != null) { desktopsettings = JSON.parse(t); }
t = localStorage.getItem('multidesktopsettings');
if (t != null) { multidesktopsettings = JSON.parse(t); }
applyDesktopSettings();
// Terminal special keys
var x = '';
for (var c = 1; c < 27; c++) x += '<option value=\'' + c + '\'>' + "Ctrl" + '-' + String.fromCharCode(64 + c) + ' (' + c + ')</option>';
QH('specialkeylist', x);
// Setup server stats panels
setupGeneralServerStats();
setupServerTimelineStats();
// Setup the user interface in the right mode
userInterfaceSelectMenu();
// Setup Mesh summary panel
setupMeshSummaryStats();
// If SSPI or LDAP authentication not used, allow batch account creation.
QV('p4UserBatchCreate', (features & 0x00080000) == 0);
// Set the file editor
d4EditWrapVal = getstore('editorWrap', 0);
d4EditSizeVal = getstore('editorSize', 0);
d4ToggleWrap(true);
d4ToggleSize(true);
}
// Toggle the web page to full screen
function toggleAspectRatio(toggle) {
if (toggle === 1) { deskAspectRatio = ((deskAspectRatio + 1) % 3); putstore('deskAspectRatio', deskAspectRatio); }
deskAdjust();
}
// If FullScreen, toggle menu to be horisontal or vertical
function toggleStackMenu(toggle) {
if (webPageFullScreen == true) {
if (toggle === 1) {
webPageStackMenu = !webPageStackMenu;
putstore('webPageStackMenu', webPageStackMenu);
}
if (webPageStackMenu == false) {
QC('body').remove('menu_stack');
} else {
QC('body').add('menu_stack');
if (xxcurrentView >= 10) QC('column_l').remove('room4submenu');
}
deskAdjust();
}
}
// Toggle user interface menu
function showUserInterfaceSelectMenu() {
Q('uiViewButton1').classList.remove('uiSelectorSel');
Q('uiViewButton2').classList.remove('uiSelectorSel');
Q('uiViewButton3').classList.remove('uiSelectorSel');
Q('uiViewButton4').classList.remove('uiSelectorSel');
try { Q('uiViewButton' + uiMode).classList.add('uiSelectorSel'); } catch (ex) { }
QV('uiMenu', (QS('uiMenu').display == 'none'));
//Q('uiViewButton1').focus();
if (nightMode) { Q('uiViewButton4').classList.add('uiSelectorSel'); }
}
function userInterfaceSelectMenu(s) {
if (s) { uiMode = s; putstore('uiMode', uiMode); }
webPageFullScreen = (uiMode < 3);
webPageStackMenu = (uiMode > 1);
toggleFullScreen(0);
toggleStackMenu(0);
if (webPageStackMenu && (xxcurrentView >= 10)) { QC('column_l').add('room4submenu'); } else { QC('column_l').remove('room4submenu'); }
}
function toggleNightMode() {
nightMode = !nightMode;
if (nightMode) { QC('body').add('night'); } else { QC('body').remove('night'); }
putstore('_nightMode', nightMode?'1':'0');
}
// Toggle the web page to full screen
function toggleFullScreen(toggle) {
if (toggle === 1) { webPageFullScreen = !webPageFullScreen; putstore('webPageFullScreen', webPageFullScreen); }
var hide = 0;
if (args.hide) { hide = parseInt(args.hide); }
if (webPageFullScreen == false) {
QC('body').remove('menu_stack');
QC('body').remove('fullscreen');
QC('body').remove('arg_hide');
if (xxcurrentView >= 10) QC('column_l').add('room4submenu');
QV('UserDummyMenuSpan', false);
//QV('page_leftbar', false);
} else {
QC('body').add('fullscreen');
if (hide & 16) QC('body').add('arg_hide'); // This is replacement for QV('page_leftbar', !(hide & 16));
QV('page_leftbar', !(hide & 16));
QV('MainMenuSpan', !(hide & 16));
if (xxcurrentView >= 10) QC('column_l').remove('room4submenu');
QV('UserDummyMenuSpan', (xxcurrentView < 10) && webPageFullScreen);
}
masterUpdate(512);
QV('body', true);
}
function getNodeFromId(id) { if (nodes != null) { for (var i in nodes) { if (nodes[i]._id == id) return nodes[i]; } } return null; }
function reload() {
var x = window.location.href;
if (x.endsWith('/#')) { x = x.substring(0, x.length - 2); }
window.location.href = x;
}
function onStateChanged(server, state, prevState, errorCode) {
if (state == 0) {
// Control web socket disconnected
setDialogMode(0); // Close any dialog boxes if present
go(0); // Go to disconnection panel
// Clean up
powerTimeline = null;
powerTimelineReq = null;
powerTimelineNode = null;
powerTimelineUpdate = null;
deleteAllNotifications(); // Close and clear notifications if present
hideContextMenu(); // Hide the context menu if present
QV('verifyEmailId2', false);
QV('logoutControl', false);
if (errorCode == 'noauth') { QH('p0span', "Kan authenticatie niet uitvoeren"); return; }
if (prevState == 2) { if (autoReconnect) { setTimeout(serverPoll, 5000); } } else { QH('p0span', "Kan geen websocket aansluiten"); }
if (authCookieRenewTimer != null) { clearInterval(authCookieRenewTimer); authCookieRenewTimer = null; }
} else if (state == 2) {
// Fetch list of meshes, nodes, files
meshserver.send({ action: 'meshes' });
meshserver.send({ action: 'nodes', id: '{{currentNode}}' });
if (pluginHandler != null) { meshserver.send({ action: 'plugins' }); }
if ('{{currentNode}}' == '') { meshserver.send({ action: 'files' }); }
if ('{{viewmode}}' == '') { go(1); }
authCookieRenewTimer = setInterval(function () { meshserver.send({ action: 'authcookie' }); }, 1800000); // Request a cookie refresh every 30 minutes.
}
}
// Poll the server, if it responds, refresh the page.
function serverPoll() {
var xdr = null;
try { xdr = new XDomainRequest(); } catch (e) { }
if (!xdr) xdr = new XMLHttpRequest();
xdr.open('HEAD', window.location.href);
xdr.timeout = 15000;
xdr.onload = function () { reload(); };
xdr.onerror = xdr.ontimeout = function () { setTimeout(serverPoll, 10000); };
xdr.send();
}
// Return true if this browser supports clickonce
function detectClickOnce() {
for (var i in window.navigator.mimeTypes) { if (window.navigator.mimeTypes[i].type == 'application/x-ms-application') { return true; } }
var userAgent = window.navigator.userAgent.toUpperCase();
return (userAgent.indexOf('.NET CLR 3.5') >= 0) || (userAgent.indexOf('(WINDOWS NT ') >= 0);
}
function updateSiteAdmin() {
var noServerBackup = '{{{noServerBackup}}}';
var siteRights = userinfo.siteadmin;
if (noServerBackup == 1) { siteRights &= 0xFFFFFFFA; } // If not server backups allowed, remove server backup and restore permissions
// Update account actions
QV('p2AccountSecurity', ((features & 4) == 0) && (serverinfo.domainauth == false) && ((features & 4096) != 0)); // Hide Account Security if in single user mode, domain authentication to 2 factor auth not supported.
QV('p2AccountActions', ((features & 4) == 0) && (serverinfo.domainauth == false)); // Hide Account Actions if in single user mode or domain authentication
QV('p2AccountImage', ((features & 4) == 0) && (serverinfo.domainauth == false)); // If account actions are not visible, also remove the image on that panel
QV('p2ServerActions', siteRights & 21);
QV('LeftMenuMyServer', siteRights & 21); // 16 + 4 + 1
QV('MainMenuMyServer', siteRights & 21);
QV('p2ServerActionsBackup', siteRights & 1);
QV('p2ServerActionsRestore', siteRights & 4);
QV('p2ServerActionsVersion', siteRights & 16);
QV('MainMenuMyFiles', siteRights & 8);
QV('LeftMenuMyFiles', siteRights & 8);
if (((siteRights & 8) == 0) && (xxcurrentView == 5)) { setDialogMode(0); go(1); }
if (currentNode != null) { gotoDevice(currentNode._id, xxcurrentView, true); }
// Update user management state
if ((userinfo.siteadmin & 2) != 0)
{
// We are user administrator
if (users == null) { meshserver.send({ action: 'users' }); }
if (wssessions == null) { meshserver.send({ action: 'wssessioncount' }); }
} else {
// We are not user administrator
users = null;
wssessions = null;
updateUsers();
if (xxcurrentView == 4 || ((xxcurrentView >= 30) && (xxcurrentView < 40))) { setDialogMode(0); go(1); currentUser = null; }
}
meshserver.send({ action: 'events', limit: parseInt(p3limitdropdown.value) });
QV('ServerConsole', userinfo.siteadmin === 0xFFFFFFFF);
QV('ServerTrace', userinfo.siteadmin === 0xFFFFFFFF);
if ((xxcurrentView == 115) && (userinfo.siteadmin != 0xFFFFFFFF)) { go(6); }
if ((xxcurrentView == 6) && ((userinfo.siteadmin & 21) == 0)) { go(1); }
// If we are site administrator, register to get server statistics
if ((siteRights & 21) != 0) { meshserver.send({ action: 'serverstats', interval: 10000 }); }
}
// To boost the speed of the web page when even floods occur, this method perform a delayed update on the web page.
var updateNaggleTimer = null;
var updateNaggleFlags = 0;
function masterUpdate(flags) {
updateNaggleFlags |= flags;
if (updateNaggleTimer == null) {
updateNaggleTimer = setTimeout(function () {
if (updateNaggleFlags & 512) { center(); }
if (updateNaggleFlags & 1) { onSearchInputChanged(); }
if (updateNaggleFlags & 2) { onSortSelectChange(false); }
if (updateNaggleFlags & 128) { updateMeshes(); }
if (updateNaggleFlags & 4) { updateDevices(); if (xxcurrentView == 21) { p21updateMesh(); } }
if (updateNaggleFlags & 8) { drawNotifications(); }
{{{StartGeoLocationJS}}}if (updateNaggleFlags & 16) { updateMapMarkers(); }{{{EndGeoLocationJS}}}
if (updateNaggleFlags & 32) { eventsUpdate(); }
{{{StartGeoLocationJS}}}if (updateNaggleFlags & 64) { refreshMap(false, true); }{{{EndGeoLocationJS}}}
if (updateNaggleFlags & 256) { drawDeviceTimeline(); }
if (updateNaggleFlags & 1024) { deviceEventsUpdate(); }
if (updateNaggleFlags & 2048) { userEventsUpdate(); }
if (updateNaggleFlags & 4096) { p20updateMesh(); }
updateNaggleTimer = null;
updateNaggleFlags = 0;
}, 150);
}
}
var backupCodesWarningDone = false;
function updateSelf() {
QV('verifyEmailId', (userinfo.emailVerified !== true) && (userinfo.email != null) && (serverinfo.emailcheck == true));
QV('verifyEmailId2', (userinfo.emailVerified !== true) && (userinfo.email != null) && (serverinfo.emailcheck == true));
QV('manageOtp', (userinfo.otpsecret == 1) || (userinfo.otphkeys > 0));
QV('authAppSetupCheck', userinfo.otpsecret == 1);
QV('authKeySetupCheck', userinfo.otphkeys > 0);
QV('authCodesSetupCheck', userinfo.otpkeys > 0);
masterUpdate(4 + 128 + 4096);
// Check if backup codes should really be enabled
if ((backupCodesWarningDone == false) && !(userinfo.otpkeys > 0) && (((userinfo.otpsecret == 1) && !(userinfo.otphkeys > 0)) || ((userinfo.otpsecret != 1) && (userinfo.otphkeys == 1)))) {
var n = { text: "Voeg back-upcodes met twee factoren toe. Als de huidige factor verloren gaat, is er geen manier om dit account te herstellen.", title: "Twee-factor authenticatie" };
addNotification(n);
backupCodesWarningDone = true;
}
// If we can't create new groups, hide all links that can do that.
var newGroupsAllowed = ((userinfo.siteadmin == 0xFFFFFFFF) || ((userinfo.siteadmin & 64) == 0));
QV('p2createMeshLink1', newGroupsAllowed);
QV('p2createMeshLink2', newGroupsAllowed);
QV('getStarted1', newGroupsAllowed);
QV('getStarted2', !newGroupsAllowed);
if (typeof userinfo.passchange == 'number') {
if (userinfo.passchange == -1) { QH('p2nextPasswordUpdateTime', " - Reset bij volgende inlog."); }
else if ((passRequirements != null) && (typeof passRequirements.reset == 'number')) {
var seconds = (userinfo.passchange) + (passRequirements.reset * 86400) - Math.floor(Date.now() / 1000);
if (seconds < 0) { QH('p2nextPasswordUpdateTime', " - Reset bij volgende inlog."); }
else if (seconds < 3600) { QH('p2nextPasswordUpdateTime', format(" - Reset in {0} minuten{1}.", Math.floor(seconds / 60), addLetterS(Math.floor(seconds / 60)))); }
else if (seconds < 86400) { QH('p2nextPasswordUpdateTime', format(" - Reset in {0} uur{1}.", Math.floor(seconds / 3600), addLetterS(Math.floor(seconds / 3600)))); }
else { QH('p2nextPasswordUpdateTime', format(" - Reset in {0} dag(en){1}."), Math.floor(seconds / 86400), addLetterS(Math.floor(seconds / 86400))); }
}
}
}
function addLetterS(x) { return (x > 1) ? 's' : ''; }
function setSessionActivity() { sessionActivity = Date.now(); QH('idleTimeoutNotify', ''); }
function checkIdleSessionTimeout() {
var delta = (Date.now() - sessionActivity);
if (delta > serverinfo.timeout) { window.location.href = 'logout'; } else {
var ds = Math.round((serverinfo.timeout - delta) / 1000);
if (ds <= 60) {
QH('idleTimeoutNotify', '<br />' + format("{0} seconde {1} tot verbreken", ds, addLetterS(ds)));
} else {
ds = Math.round(ds / 60);
if (ds <= 5) { QH('idleTimeoutNotify', '<br />' + format("{0} minuut {1} tot verbreken", ds, addLetterS(ds))); }
}
}
}
function onMessage(server, message) {
switch (message.action) {
case 'trace': {
serverTrace.unshift(message);
displayServerTrace();
break;
}
case 'traceinfo': {
if (typeof message.traceSources == 'object') {
if ((message.traceSources != null) && (message.traceSources.length > 0)) {
serverTraceSources = message.traceSources;
QH('p41traceStatus', EscapeHtml(message.traceSources.join(', ')));
} else {
serverTraceSources = [];
QH('p41traceStatus', "Geen");
}
}
break;
}
case 'serverstats': {
updateGeneralServerStats(message);
break;
}
case 'serverwarnings': {
if ((message.warnings != null) && (message.warnings.length > 0)) {
var x = '';
for (var i in message.warnings) { x += '<div style=color:red;padding-bottom:6px><b>' + "Waarschuwing" + message.warnings[i] + '</b></div>'; }
QH('serverWarnings', x);
QV('serverWarningsDiv', true);
}
break;
}
case 'servertimelinestats': {
setServerTimelineStats(message.events);
break;
}
case 'authcookie': {
// Got an authentication cookie refresh
authCookie = message.cookie;
authRelayCookie = message.rcookie;
break;
}
case 'serverinfo': {
serverinfo = message.serverinfo;
if (serverinfo.timeout) { setInterval(checkIdleSessionTimeout, 10000); checkIdleSessionTimeout(); }
if (debugmode == 1) { console.log('Server time: ', printDateTime(new Date(serverinfo.serverTime))); }
break;
}
case 'userinfo': {
userinfo = message.userinfo;
updateSiteAdmin();
updateSelf();
break;
}
case 'users': {
users = {};
for (var m in message.users) { users[message.users[m]._id] = message.users[m]; }
updateUsers();
break;
}
case 'wssessioncount': {
wssessions = message.wssessions;
updateUsers();
break;
}
case 'meshes': {
meshes = {};
for (var m in message.meshes) { meshes[message.meshes[m]._id] = message.meshes[m]; }
masterUpdate(4 + 128);
break;
}
case 'files': {
filetree = setupBackPointers(message.filetree);
updateFiles();
d3updatefiles();
break;
}
case 'nodes': {
nodes = [];
for (var m in message.nodes) {
if (!meshes[m]) { console.log('Invalid mesh (1): ' + m); continue; }
for (var n in message.nodes[m]) {
if (message.nodes[m][n]._id == null) { console.log('Invalid node (' + n + '): ' + JSON.stringify(message.nodes)); continue; }
message.nodes[m][n].namel = message.nodes[m][n].name.toLowerCase();
if (message.nodes[m][n].rname) { message.nodes[m][n].rnamel = message.nodes[m][n].rname.toLowerCase(); } else { message.nodes[m][n].rnamel = message.nodes[m][n].namel; }
message.nodes[m][n].meshnamel = meshes[m].name.toLowerCase();
message.nodes[m][n].meshid = m;
message.nodes[m][n].state = (message.nodes[m][n].state)?(message.nodes[m][n].state):0;
message.nodes[m][n].desc = message.nodes[m][n].desc;
message.nodes[m][n].ip = message.nodes[m][n].ip;
if (!message.nodes[m][n].icon) message.nodes[m][n].icon = 1;
message.nodes[m][n].ident = ++nodeShortIdent;
nodes.push(message.nodes[m][n]);
}
}
masterUpdate(1 | 2 | 4 | 64);
if (xxcurrentView == -1) { if ('{{viewmode}}' != '') { go(parseInt('{{viewmode}}')); } else { setDialogMode(0); go(1); } }
if ('{{currentNode}}' != '') { gotoDevice('{{currentNode}}',parseInt('{{viewmode}}'));}
break;
}
case 'powertimeline': {
if (message.nodeid != powerTimelineReq) break;
powerTimelineNode = message.nodeid;
powerTimeline = message.timeline;
powerTimelineUpdate = Date.now() + 300000; // Update every 5 minutes
for (var i in powerTimeline) { if (i % 2 == 1) { powerTimeline[i] = powerTimeline[i] * 1000; } } // Decompress time
if (currentNode._id == message.nodeid) { masterUpdate(256); }
break;
}
case 'getsysinfo': {
if (message.nodeid != powerTimelineReq) break;
//console.log('getsysinfo', message); // ***********************
if (message.noinfo === true) {
QH('p17info', "Geen informatie over dit apparaat.");
} else {
var x = '', s = {};
if (message.hardware) {
if (message.hardware.identifiers) {
var ident = message.hardware.identifiers;
// BIOS
x += '<div class=DevSt style=margin-bottom:3px><b>' + "BIOS" + '</b></div>';
if (ident.bios_vendor) { x += addDetailItem("Verkoper", ident.bios_vendor, s); }
if (ident.bios_version) { x += addDetailItem("Versie", ident.bios_version, s); }
x += '<br />';
// Motherboard
x += '<div class=DevSt style=margin-bottom:3px><b>' + "Moederbord" + '</b></div>';
if (ident.board_vendor) { x += addDetailItem("Verkoper", ident.board_vendor, s); }
if (ident.board_name) { x += addDetailItem("Naam", ident.board_name, s); }
if (ident.board_serial && (ident.board_serial != '')) { x += addDetailItem("Serieel", ident.board_serial, s); }
if (ident.board_version) { x += addDetailItem("Versie", ident.board_version, s); }
if (ident.product_uuid) { x += addDetailItem("Identifier", ident.product_uuid, s); }
x += '<br />';
}
if (message.hardware.windows) {
if (message.hardware.windows.memory) {
// Memory
x += '<div class=DevSt style=margin-bottom:3px><b>' + "Geheugen" + '</b></div>';
// Sort Memory
function memorySort(a, b) { if (a.BankLabel > b.BankLabel) return 1; if (a.BankLabel < b.BankLabel) return -1; return 0; }
message.hardware.windows.memory.sort(memorySort);
x += '<table style=width:100%>';
for (var i in message.hardware.windows.memory) {
var m = message.hardware.windows.memory[i];
x += '<tr><td VALIGN=Top style=width:38px><img src="images/ram2.png" />'
x += '<td><div style=background-color:lightgray;border-radius:5px;padding:8px>';
x += '<div><b>' + m.BankLabel + '</b></div>';
if (m.Capacity) { x += addDetailItem("Capaciteit / snelheid", format("{0} Mb, {1} Mhz", (m.Capacity / 1024 / 1024), m.Speed), s); }
if (m.PartNumber) { x += addDetailItem("Onderdeel nummer", ((m.Manufacturer && m.Manufacturer != 'Undefined')?(m.Manufacturer + ', '):'') + m.PartNumber, s); }
x += '</div>';
}
x += '</table><br />';
}
if (message.hardware.windows.osinfo) {
// Operating System
var m = message.hardware.windows.osinfo;
x += '<div class=DevSt style=margin-bottom:3px><b>' + "Besturingssysteem" + '</b></div>';
if (m.Caption) { x += addDetailItem("Naam", m.Caption, s); }
if (m.Version) { x += addDetailItem("Versie", m.Version, s); }
if (m.OSArchitecture) { x += addDetailItem("architectuur", m.OSArchitecture, s); }
x += '<br />';
}
// Disks
//x += '<div class=DevSt style=margin-bottom:3px><b>Disks</b></div>';
//x += '<br />';
}
}
QH('p17info', x);
}
break;
}
case 'lastconnect': {
var node = getNodeFromId(message.nodeid);
if (node != null) {
node.lastconnect = message.time;
node.lastaddr = message.addr;
if ((currentNode._id == node._id) && (Q('MainComputerState').innerHTML == '')) {
QH('MainComputerState', '<span>' + "Laatst gezien" + '<br />' + printDateTime(new Date(node.lastconnect)) + '</span>');
}
}
break;
}
case 'msg': {
// Check if this is a message from a node
if (message.nodeid != null) {
var index = -1;
if (nodes != null) { for (var i in nodes) { if (nodes[i]._id == message.nodeid) { index = i; break; } } }
if (index != -1) {
// Node was found, dispatch the message
if (message.type == 'console') { p15consoleReceive(nodes[index], message.value, message.source); } // This is a console message.
else if (message.type == 'notify') { // This is a notification message.
var n = getstore('notifications', 0);
if (((n & 8) == 0) && (message.amtMessage != null)) { break; } // Intel AMT desktop & terminal messages should be ignored.
var n = { text: message.value, title: message.title, icon: message.icon };
if (message.nodeid != null) { n.nodeid = message.nodeid; }
if (message.tag != null) { n.tag = message.tag; }
if (message.username != null) { n.username = message.username; }
addNotification(n);
} else if (message.type == 'ps') {
showDeskToolsProcesses(message);
} else if (message.type == 'services') {
showDeskToolsServices(message);
} else if ((message.type == 'getclip') && (xxdialogTag == 'clipboard') && (currentNode != null) && (currentNode._id == message.nodeid)) {
Q('d2clipText').value = message.data;
} else if ((message.type == 'setclip') && (xxdialogTag == 'clipboard') && (currentNode != null) && (currentNode._id == message.nodeid)) {
// Display success/fail on the clipboard dialog box.
QH('dlgClipStatus', message.success ? '<span style=color:green>' + "Geslaagd" + '</span>' : '<span style=color:red>' + "Mislukt" + '</span>')
setTimeout(function () { try { QH('dlgClipStatus', ''); } catch (ex) { } }, 2000);
} else if ((message.type == 'userSessions') && (currentNode != null) && (currentNode._id == message.nodeid) && (desktop == null)) {
// Got list of user sessions
var userSessions = [];
if (message.data != null) { for (var i in message.data) { if ((message.data[i].State == 'Active') || (message.data[i].StationName == 'Console') || (debugmode == 3)) { userSessions.push(message.data[i]); } } }
if (userSessions.length == 0) { connectDesktop(null, 1); } // No active sessions, do a normal connection.
else if (userSessions.length == 1) { connectDesktop(null, 1, userSessions[0].SessionId); } // One active session, connect to it
else {
var x = '';
for (var i in userSessions) {
x += '<div style="text-align:left;cursor:pointer;background-color:gray;margin:5px;padding:5px;border-radius:5px" onclick=connectDesktop(event,1,' + userSessions[i].SessionId + ')>' + userSessions[i].State + ', ' + userSessions[i].StationName;
if (userSessions[i].Username) { if (userSessions[i].Domain) { x += ' - ' + userSessions[i].Domain + '/' + userSessions[i].Username; } else { x += ' - ' + userSessions[i].Username; } }
x += '</div>';
}
QH('p11DeskSessionSelector', x);
QV('p11DeskSessionSelector', true);
}
}
}
} else {
if (message.type == 'notify') { // This is a notification message.
var n = { text: message.value, title: message.title, icon: message.icon };
if (message.tag != null) { n.tag = message.tag; }
if (message.username != null) { n.username = message.username; }
addNotification(n);
}
}
break;
}
case 'getnetworkinfo': {
if ((currentNode._id == message.nodeid) && (xxdialogMode == 2) && (xxdialogTag == 'if' + message.nodeid)) {
if (message.netif == null) {
QH('d2netinfo', "geen netwerkinterface informatie beschikbaar voor dit apparaat.");
} else {
var x = '<div class=dialogText>';
if (currentNode.lastconnect) { x += addHtmlValue2("Laatste agentverbinding", printDateTime(new Date(currentNode.lastconnect))); }
if (currentNode.lastaddr) {
var splitip = currentNode.lastaddr.split(':');
if (splitip.length > 2) {
// IPv6
x += addHtmlValue2("Laatste agentadres", currentNode.lastaddr + ' <img src="images/link4.png" title="Copy address to clipboard" style="cursor:pointer" onclick=copyTextToClip2(\"' + encodeURIComponent(currentNode.lastaddr) + '\") width=10 height=10>');
} else {
// IPv4
if (isPrivateIP(currentNode.lastaddr)) {
x += addHtmlValue2("Laatste agentadres", splitip[0] + ' <img src="images/link4.png" title="' + "Kopieer adres naar het klembord" + '" style="cursor:pointer" onclick=copyTextToClip2(\"' + encodeURIComponent(splitip[0]) + '\") width=10 height=10>');
} else {
x += addHtmlValue2("Laatste agentadres", '<a href="https://iplocation.com/?ip=' + splitip[0] + '" rel="noreferrer noopener" target="MeshIPLoopup">' + splitip[0] + '</a> <img src="images/link4.png" title="' + "Kopieer adres naar het klembord" + '" style="cursor:pointer" onclick=copyTextToClip2(\"' + encodeURIComponent(splitip[0]) + '\") width=10 height=10>');
}
}
}
x += addHtmlValue2("Laatste update van interfaces", printDateTime(new Date(message.updateTime)));
for (var i in message.netif) {
var net = message.netif[i];
x += '<hr />'
if (net.name) { x += addHtmlValue2("Naam", '<b>' + EscapeHtml(net.name) + '</b>'); }
if (net.desc) { x += addHtmlValue2("Omschrijving", EscapeHtml(net.desc).replace('(R)', '&reg;').replace('(r)', '&reg;')); }
if (net.dnssuffix) { x += addHtmlValue2("DNS-achtervoegsel", EscapeHtml(net.dnssuffix) + ' <img src="images/link4.png" title="' + "Kopieer de naam naar het klembord" + '" style="cursor:pointer" onclick=copyTextToClip2(\"' + encodeURIComponent(net.dnssuffix) + '\") width=10 height=10>'); }
if (net.mac) { x += addHtmlValue2("MAC adres", '<a href="https://dnslytics.com/mac-address-lookup/' + net.mac.substring(0, 6) + '" rel="noreferrer noopener" target="MeshMACLoopup">' + EscapeHtml(net.mac.toLowerCase()) + '</a> <img src="images/link4.png" title="' + "Kopieer MAC adres naar het klembord" + '" style="cursor:pointer" onclick=copyTextToClip2(\"' + encodeURIComponent(net.mac.toLowerCase()) + '\") width=10 height=10>'); }
if (net.v4addr) { x += addHtmlValue2("IPv4 adres", EscapeHtml(net.v4addr) + ' <img src="images/link4.png" title="' + "Kopieer adres naar het klembord" + '" style="cursor:pointer" onclick=copyTextToClip2(\"' + encodeURIComponent(net.v4addr) + '\") width=10 height=10>'); }
if (net.v4mask) { x += addHtmlValue2("IPv4 mask", EscapeHtml(net.v4mask) + ' <img src="images/link4.png" title="' + "Kopieer adres naar het klembord" + '" style="cursor:pointer" onclick=copyTextToClip2(\"' + encodeURIComponent(net.v4mask) + '\") width=10 height=10>'); }
if (net.v4gateway) { x += addHtmlValue2("IPv4 gateway", EscapeHtml(net.v4gateway) + ' <img src="images/link4.png" title="' + "Kopieer adres naar het klembord" + '" style="cursor:pointer" onclick=copyTextToClip2(\"' + encodeURIComponent(net.v4gateway) + '\") width=10 height=10>'); }
if (net.gatewaymac) { x += addHtmlValue2("Gateway MAC", '<a href="https://dnslytics.com/mac-address-lookup/' + net.gatewaymac.substring(0, 6) + '" rel="noreferrer noopener" target="MeshMACLoopup">' + EscapeHtml(net.gatewaymac.toLowerCase()) + '</a> <img src="images/link4.png" title="' + "Kopieer MAC adres naar het klembord" + '" style="cursor:pointer" onclick=copyTextToClip2(\"' + encodeURIComponent(net.gatewaymac.toLowerCase()) + '\") width=10 height=10>'); }
}
x += '</div>';
QH('d2netinfo', x);
}
}
break;
}
case 'serverversion': {
if ((xxdialogMode == 2) && (xxdialogTag == 'MeshCentralServerUpdate')) {
var x = '<div class=dialogText>';
if (!message.current) { message.current = "Onbekend"; }
if (!message.latest) { message.latest = "Onbekend"; }
x += addHtmlValue2("Huidige versie", '<b>' + EscapeHtml(message.current) + '</b>');
x += addHtmlValue2("Laatste versie", '<b>' + EscapeHtml(message.latest) + '</b>');
x += '</div>';
if ((message.latest.indexOf('.') == -1) || (message.current == message.latest) || ((features & 2048) == 0)) {
setDialogMode(2, "MeshCentral Versie", 1, null, x);
} else {
setDialogMode(2, "MeshCentral Versie", 3, server_showVersionDlgEx, x + '<br /><label><input id=d2updateCheck type=checkbox onclick=server_showVersionDlgUpdate() /> ' + "Controleer en klik op OK om de serverupdate te starten." + '</label>');
server_showVersionDlgUpdate();
}
}
break;
}
case 'servererrors': {
if ((xxdialogMode == 2) && (xxdialogTag == 'MeshCentralServerErrors')) {
if (message.data == null) {
setDialogMode(2, "MeshCentral serverfouten", 1, null, "Server heeft geen foutenlogboek.");
} else {
var x = '<div class="dialogText dialogTextLog"><pre id=d2ServerErrorsLogPre>' + message.data + '<pre></div>';
setDialogMode(2, "MeshCentral serverfouten", 3, server_showErrorsDlgEx, x + '<br /><div style=float:right><img src=images/link4.png height=10 width=10 title="' + "Foutenlogboek downloaden" + '" style=cursor:pointer onclick=d2CopyServerErrorsToClip()></div><div><label><input id=d2updateCheck type=checkbox onclick=server_showVersionDlgUpdate() /> ' + "Controleer en klik op OK om het foutenlogboek te wissen." + '</label></div>');
server_showVersionDlgUpdate();
}
}
break;
}
case 'serverconsole': {
p15consoleReceive('serverconsole', message.value);
break;
}
case 'events': {
if ((message.nodeid != null) && (message.nodeid == currentNode._id)) {
currentDeviceEvents = message.events;
masterUpdate(1024);
} else if ((message.user != null) && (message.user == currentUser.name)) {
currentUserEvents = message.events;
masterUpdate(2048);
} else {
events = message.events;
masterUpdate(32);
}
break;
}
case 'getcookie': {
if (message.tag == 'clickonce') {
var basicPort = '{{{serverRedirPort}}}' == '' ? '{{{serverPublicPort}}}' : '{{{serverRedirPort}}}';
var rdpurl = 'http://' + window.location.hostname + ':' + basicPort + '/clickonce/minirouter/MeshMiniRouter.application?WS=wss%3A%2F%2F' + window.location.hostname + '%2Fmeshrelay.ashx%3Fauth=' + message.cookie + '&CH={{{webcerthash}}}&AP=' + message.protocol + ((debugmode == 1) ? '' : '&HOL=1');
var newWindow = window.open(rdpurl, '_blank');
newWindow.opener = null;
}
break;
}
case 'getNotes': {
var n = Q('d2devNotes');
if (n && (message.id == decodeURIComponent(n.attributes['noteid'].value))) {
if (message.notes) { QH('d2devNotes', decodeURIComponent(message.notes)); } else { QH('d2devNotes', ''); }
var ro = (n.attributes['ro'].value == 'true');
if (ro == false) { // If we have permissions, set read/write on this note.
n.removeAttribute('readonly');
QE('idx_dlgOkButton', true);
QV('idx_dlgOkButton', true);
focusTextBox('d2devNotes');
}
}
break;
}
case 'otpauth-request': {
if ((xxdialogMode == 2) && (xxdialogTag == 'otpauth-request')) {
var secret = message.secret;
if (secret.length == 52) { secret = secret.split(/(.............)/).filter(Boolean).join(' '); }
else if (secret.length == 32) { secret = secret.split(/(....)/).filter(Boolean).join(' '); secret = secret.substring(0, 20) + '<br/>' + secret.substring(20) }
QH('d2optinfo', '<table style=width:380px><tr><td style=vertical-align:top>' + "Installeer <a href=\"https://play.google.com/store/apps/details?id=com.google.android.apps.authenticator2\" rel=\"noreferrer noopener\" target=_blank> Google Authenticator </a> of een compatibele applicatie en scan de streepjescode, gebruik <a href=\"' + message.url +'\" rel=\"noreferrer noopener\" target=_blank> deze link </a> of voer de link in geheim. Voer vervolgens het huidige 6-cijferige token hieronder in om 2-staps aanmelding te activeren." + '<br /><br />Secret<br /><tt id=d2optsecret secret=\"' + message.secret + '\" style=font-size:12px>' + secret + '</tt><br /><br /></td><td style=width:1px;vertical-align:top><a href=\"' + message.url + '\" rel=\"noreferrer noopener\" target=_blank><div id="qrcode"></div></a></td><tr><td colspan=2 style="text-align:center;border-top:1px solid black"><br />' + "Voer hier het token in voor tweestaps-aanmelding:" + ' <input type=text onkeypress=\"return (event.keyCode == 8) || (event.charCode >= 48 && event.charCode <= 57)\" onkeyup=account_addOtpCheck(event) onkeydown=account_addOtpCheck() maxlength=6 id=d2otpauthinput type=text></td></table>');
new QRCode(Q('qrcode'), { text: message.url, width: 128, height: 128, colorDark: '#000000', colorLight: '#EEE', correctLevel: QRCode.CorrectLevel.H });
QV('idx_dlgOkButton', true);
QE('idx_dlgOkButton', false);
Q('d2otpauthinput').focus();
}
break;
}
case 'otpauth-setup': {
if (xxdialogMode) return;
setDialogMode(2, "Verificatie-app", 1, null, message.success ? ('<b style=color:green>' + "Verificatie-app activatie geslaagd" + '</b> ' + "U hebt nu een geldig token nodig om opnieuw in te loggen.") : ('<b style=color:red>' + "Tweestapsverificatie is msilukt." + '</b> ' + "Wis het geheim van de applicatie en probeer het opnieuw. Je hebt maar een paar minuten om de juiste code in te voeren."));
break;
}
case 'otpauth-clear': {
if (xxdialogMode) return;
setDialogMode(2, "Verificatie-app", 1, null, message.success ? ('<b>' + "Verificatie-applicatie verwijderd." + '</b> ' + "U kunt deze functie op elk moment opnieuw activeren.") : ('<b style=color:red>' + "Tweestapsverificatie verwijdering is mislukt." + '</b> ' + "Probeer opnieuw"));
break;
}
case 'otpauth-getpasswords': {
if (xxdialogMode) return;
var x = "Eenmalige tokens kunnen worden gebruikt als secundaire authenticatie. Genereer een set, druk ze af en bewaar ze op een veilige plaats.";
x += '<div style="border-radius:6px;border: 2px dashed #888;width:100%;margin-top:8px"><div style="padding:8px;font-family:Arial, Helvetica, sans-serif;font-size:20px;font-weight:bold"><table class=selecttext style=width:100%;text-align:center>';
if (message.passwords) {
var j = 0, clipb = '';
for (var i in message.passwords) {
if (++j % 2) { x += '<tr>'; }
var p = '' + message.passwords[i].p;
while (p.length < 8) { p = '0' + p; }
if (message.passwords[i].u === true) {
x += '<td>' + p.substring(0, 4) + '&nbsp;' + p.substring(4);
if (clipb != '') { clipb += ' '; }
clipb += p;
} else {
x += '<td><strike style=color:#BBB>' + p.substring(0, 4) + '&nbsp;' + p.substring(4); + '</strike>';
}
}
} else {
x += '<tr><td>' + "geen actieve tokens";
}
x += '</table></div></div><br />';
x += '<div><input type=button value=' + "Sluiten" + ' onclick=setDialogMode(0) style=float:right></input>';
x += '<input type=button value="' + "Genereer nieuwe tokens" + '" onclick="account_manageOtp(1);"></input>';
if (message.passwords != null) {
x += '<input type=button value="' + "Wis Tokens" + '" onclick="account_manageOtp(2);"></input>';
x += '&nbsp;<img src=images/link4.png height=10 width=10 title="' + "Kopieer de geldige code's naar het klembord" + '" style=cursor:pointer onclick=copyTextToClip2("' + encodeURIComponent(clipb) + '")>';
}
x += '</div><br />';
setDialogMode(2, "Beheer back-up codes", 8, null, x, 'otpauth-manage');
break;
}
case 'otp-hkey-get': {
if (xxdialogMode && (xxdialogTag != 'otpauth-hardware-manage')) return;
var start = '<div style="border-radius:6px;border:2px solid #CCC;background-color:#BBB;width:100%;box-sizing:border-box;margin-bottom:6px"><div style="margin:3px;font-family:Arial, Helvetica, sans-serif;font-size:16px;font-weight:bold"><table style=width:100%;text-align:left>';
var end = '</table></div></div>';
var x = "<a href=\"https://www.yubico.com/\" rel=\"noreferrer noopener\" target=\"_blank\">Hardware sleutels</a> worden gebruikt als secundaire inlogverificatie.";
x += '<div style="max-height:150px;overflow-y:auto;overflow-x:hidden;margin-top:6px;margin-bottom:6px">';
if (message.keys && message.keys.length > 0) {
for (var i in message.keys) {
var key = message.keys[i], type = (key.type == 2)?'OTP':'WebAuthn';
x += start + '<tr style=margin:5px><td style=width:30px><img width=24 height=18 src="images/hardware-key-' + type + '-24.png" style=margin-top:4px><td style=width:250px>' + key.name + '<td><input type=button value="' + "verwijderen" + '" onclick=account_removehkey(' + key.i + ')></input>' + end;
}
} else {
x += start + '<tr style=text-align:center><td>' + "Geen sleutels geconfigureerd" + end;
}
x += '</div>';
x += '<div><input type=button value="' + "Sluiten" + '" onclick=setDialogMode(0) style=float:right></input>';
if ((features & 0x00020000) != 0) { x += '<input id=d2addkey3 type=button value="' + "Sleutel toevoegen" + '" onclick="account_addhkey(3);"></input>'; }
if ((features & 0x00004000) != 0) { x += '<input id=d2addkey2 type=button value="' + "Voeg YubiKey® OTP toe" + '" onclick="account_addhkey(2);"></input>'; }
x += '</div><br />';
setDialogMode(2, "Beheer beveiligingssleutels", 8, null, x, 'otpauth-hardware-manage');
if (u2fSupported() == false) { QE('d2addkey1', false); }
break;
}
case 'otp-hkey-yubikey-add': {
if (message.result) {
meshserver.send({ action: 'otp-hkey-get' }); // Success, ask for the full list of keys.
} else {
setDialogMode(2, "Beveiligingssleutel toevoegen", 1, null, '<br />' + "Fout, kan sleutel niet toevoegen." + '<br /><br />');
}
break;
}
case 'otp-hkey-setup-response': {
if (xxdialogMode && (xxdialogTag != 'otpauth-hardware-manage')) return;
if (message.result == true) {
meshserver.send({ action: 'otp-hkey-get' }); // Success, ask for the full list of keys.
} else {
setDialogMode(2, "Beveiligingssleutel toevoegen", 1, null, '<br />' + "FOUT: kan sleutel niet toevoegen." + '<br /><br />', 'otpauth-hardware-manage');
}
break;
}
case 'webauthn-startregister': {
if (xxdialogMode && (xxdialogTag != 'otpauth-hardware-manage')) return;
var x = "Druk nu op de sleutelknop." + '<br /><br /><div style=width:100%;text-align:center><img width=120 height=117 src="images/hardware-keypress-120.png" /></div><input id=dp1keyname style=display:none value=' + message.name + ' />';
setDialogMode(2, "Beveiligingssleutel toevoegen", 2, null, x);
var publicKey = message.request;
message.request.challenge = Uint8Array.from(atob(message.request.challenge), function (c) { return c.charCodeAt(0) })
message.request.user.id = Uint8Array.from(atob(message.request.user.id), function (c) { return c.charCodeAt(0) })
navigator.credentials.create({ publicKey: publicKey })
.then(function(newCredentialInfo) {
// Public key credential
var r = { rawId: btoa(String.fromCharCode.apply(null, new Uint8Array(newCredentialInfo.rawId))), response: { attestationObject: btoa(String.fromCharCode.apply(null, new Uint8Array(newCredentialInfo.response.attestationObject))), clientDataJSON: btoa(String.fromCharCode.apply(null, new Uint8Array(newCredentialInfo.response.clientDataJSON))) }, type: newCredentialInfo.type };
meshserver.send({ action: 'webauthn-endregister', response: r });
setDialogMode(0);
}, function(error) {
// Error
setDialogMode(2, "Beveiligingssleutel toevoegen", 1, null, "FOUT:" + error);
});
break;
}
case 'event': {
if (!message.event.nolog) {
if (currentNode && (message.event.nodeid == currentNode._id)) {
// If this event has a nodeid and we are looking at this node, update the log in real time.
currentDeviceEvents.unshift(message.event);
var eventLimit = parseInt(p16limitdropdown.value);
while (currentDeviceEvents.length > eventLimit) { currentDeviceEvents.pop(); } // Remove element(s) at the end
masterUpdate(1024);
}
if (currentUser && (message.event.userid == currentUser._id)) {
// If this event has a userid and we are looking at this user, update the log in real time.
currentUserEvents.unshift(message.event);
var eventLimit = parseInt(p31limitdropdown.value);
while (currentUserEvents.length > eventLimit) { currentUserEvents.pop(); } // Remove element(s) at the end
masterUpdate(2048);
}
// Add this event to the master events log.
events.unshift(message.event);
var eventLimit = parseInt(p3limitdropdown.value);
while (events.length > eventLimit) { events.pop(); } // Remove element(s) at the end
masterUpdate(32);
}
if (message.event.noact) break; // Take no action on this event
switch (message.event.action) {
case 'userWebState': {
// New user web state, update the web page as needed
if (localStorage != null) {
var oldShowRealNames = localStorage.getItem('showRealNames');
var oldUiMode = localStorage.getItem('uiMode');
var oldSort = localStorage.getItem('sort');
var oldLoctag = localStorage.getItem('loctag');
var webstate = JSON.parse(message.event.state);
for (var i in webstate) { localStorage.setItem(i, webstate[i]); }
// Update the web page
if ((webstate.deskAspectRatio != null) && (webstate.deskAspectRatio != deskAspectRatio)) { deskAspectRatio = webstate.deskAspectRatio; deskAdjust(); }
if ((webstate.showRealNames != null) && (webstate.showRealNames != oldShowRealNames)) { showRealNames = Q('RealNameCheckBox').checked = (webstate.showRealNames == '1'); masterUpdate(6); }
if ((webstate.uiMode != null) && (webstate.uiMode != oldUiMode)) { userInterfaceSelectMenu(parseInt(webstate.uiMode)); }
if ((webstate.sort != null) && (webstate.sort != oldSort)) { document.getElementById('sortselect').selectedIndex = sort = parseInt(webstate.sort); masterUpdate(6); }
if ((webstate.loctag != null) && (webstate.loctag != oldLoctag)) { if (webstate.loctag != null) { args.locale = webstate.loctag; } else { delete args.locale; } masterUpdate(0xFFFFFFFF); }
}
break;
}
case 'servertimelinestats': { addServerTimelineStats(message.event.data); break; }
case 'accountcreate':
case 'accountchange': {
// An account was created or changed
if (userinfo.name == message.event.account.name) {
var newsiteadmin = message.event.account.siteadmin?message.event.account.siteadmin:0;
var oldsiteadmin = userinfo.siteadmin?userinfo.siteadmin:0;
if ((message.event.account.quota != userinfo.quota) || (((userinfo.siteadmin & 8) == 0) && ((message.event.account.siteadmin & 8) != 0))) { meshserver.send({ action: 'files' }); }
var oldgroups = userinfo.groups;
userinfo = message.event.account;
if (oldsiteadmin != newsiteadmin) updateSiteAdmin();
updateSelf();
if ((userinfo.siteadmin & 2) != 0) {
// Compare our groups
var og = oldgroups ? oldgroups : [];
var ng = userinfo.groups ? userinfo.groups : [];
if (og.join(',') != ng.join(',')) {
// Our groups have changed, re-ask for a list of users.
users = wssessions = null;
meshserver.send({ action: 'users' });
meshserver.send({ action: 'wssessioncount' });
}
}
}
if (users == null) break;
// Check if the account is part of our user group
if ((userinfo.groups == null) || (userinfo.groups.length == 0) || (findOne(message.event.account.groups, userinfo.groups) == true)) {
users[message.event.account._id] = message.event.account; // Part of our groups, update this user.
} else {
delete users[message.event.account._id]; // No longer part of our groups, remove this user.
}
updateUsers();
break;
}
case 'accountremove': {
// An account was removed
if (users == null) break;
delete users['user/' + domain + '/' + message.event.username.toLowerCase()];
updateUsers();
break;
}
case 'createmesh': {
// A new mesh was created
if ((meshes[message.event.meshid] == null) && (message.event.links[userinfo._id] != null)) { // Check if this is a mesh create for a mesh we own. If site administrator, we get all messages so need to ignore some.
meshes[message.event.meshid] = { _id: message.event.meshid, name: message.event.name, mtype: message.event.mtype, desc: message.event.desc, links: message.event.links };
masterUpdate(4 + 128);
meshserver.send({ action: 'files' });
}
break;
}
case 'meshchange': {
// Update mesh information
if (meshes[message.event.meshid] == null) {
// This is a new mesh for us
meshes[message.event.meshid] = { _id: message.event.meshid, name: message.event.name, mtype: message.event.mtype, desc: message.event.desc, links: message.event.links };
meshserver.send({ action: 'nodes' }); // Request a refresh of all nodes (TODO: We could optimize this to only request nodes for the new mesh).
} else {
// This is an existing mesh
if (message.event.name != null) {
meshes[message.event.meshid].name = message.event.name;
for (var i in nodes) { if (nodes[i].meshid == message.event.meshid) { nodes[i].meshnamel = message.event.name.toLowerCase(); } }
}
if (message.event.desc != null) { meshes[message.event.meshid].desc = message.event.desc; }
if (message.event.flags != null) { meshes[message.event.meshid].flags = message.event.flags; }
if (message.event.consent != null) { meshes[message.event.meshid].consent = message.event.consent; }
if (message.event.links) { meshes[message.event.meshid].links = message.event.links; }
if (message.event.amt) { meshes[message.event.meshid].amt = message.event.amt; }
// Check if we lost rights to this mesh in this change.
if (meshes[message.event.meshid].links[userinfo._id] == null) {
if ((xxcurrentView == 20) && (currentMesh == meshes[message.event.meshid])) go(2);
delete meshes[message.event.meshid];
// Delete all nodes in that mesh
var newnodes = [];
for (var i in nodes) { if (nodes[i].meshid != message.event.meshid) { newnodes.push(nodes[i]); } }
nodes = newnodes;
// If we are looking at a node in the deleted mesh, move back to "My Devices"
if (xxcurrentView >= 10 && xxcurrentView < 20 && currentNode && currentNode.meshid == message.event.meshid) { setDialogMode(0); go(1); }
}
}
masterUpdate(4 + 128);
if (currentNode && (currentNode.meshid == message.event.meshid)) { currentNode = null; if ((xxcurrentView >= 10) && (xxcurrentView < 20)) { go(1); } }
//meshserver.send({ action: 'files' }); // TODO: Why do we need to do this??
// If we are looking at a mesh that is now deleted, move back to "My Account"
if (xxcurrentView == 20 && currentMesh._id == message.event.meshid) { masterUpdate(4096); }
break;
}
case 'deletemesh': {
// Delete the mesh
if (meshes[message.event.meshid]) {
delete meshes[message.event.meshid];
masterUpdate(128);
meshserver.send({ action: 'files' });
}
// Delete all nodes in that mesh
var newnodes = [];
if (nodes != null) { for (var i in nodes) { if (nodes[i].meshid != message.event.meshid) { newnodes.push(nodes[i]); } } }
nodes = newnodes;
masterUpdate(4);
// If we are looking at a mesh that is now deleted, move back to "My Account"
if (xxcurrentView >= 20 && xxcurrentView < 30 && currentMesh._id == message.event.meshid) { setDialogMode(0); go(2); }
// If we are looking at a node in the deleted mesh, move back to "My Devices"
if (xxcurrentView >= 10 && xxcurrentView < 20 && currentNode && currentNode.meshid == message.event.meshid) { setDialogMode(0); go(1); }
break;
}
case 'addnode': {
var node = message.event.node;
if (!meshes[node.meshid]) break; // This is a node for a mesh we don't know. Happens when we are site administrator, we get all messages.
if (getNodeFromId(node._id) != null) break; // This node is already known.
node.namel = node.name.toLowerCase();
if (node.rname) { node.rnamel = node.rname.toLowerCase(); } else { node.rnamel = node.namel; }
node.meshnamel = meshes[node.meshid].name.toLowerCase();
node.state = 0;
if (!node.icon) node.icon = 1;
node.ident = ++nodeShortIdent;
if (nodes == null) { }
nodes.push(node);
// Web page update
masterUpdate(1 | 2 | 4 | 16);
break;
}
case 'removenode': {
var index = -1;
for (var i in nodes) { if (nodes[i]._id == message.event.nodeid) { index = i; break; } }
if (index != -1) {
var node = nodes[index];
if (currentNode == node) {
if (xxcurrentView >= 10 && xxcurrentView < 20) { setDialogMode(0); go(1); }
currentNode = null;
// TODO: Correctly disconnect from this node (Desktop/Terminal/Files...)
}
nodes.splice(index, 1);
// Web page update
masterUpdate(4 | 16);
}
break;
}
case 'changenode': {
var index = -1;
for (var i in nodes) { if (nodes[i]._id == message.event.nodeid) { index = i; break; } }
if (index != -1) {
var node = nodes[index];
// Change the node
node.name = message.event.node.name;
node.rname = message.event.node.rname;
node.users = message.event.node.users;
node.host = message.event.node.host;
node.desc = message.event.node.desc;
node.ip = message.event.node.ip;
node.osdesc = message.event.node.osdesc;
node.publicip = message.event.node.publicip;
node.iploc = message.event.node.iploc;
node.wifiloc = message.event.node.wifiloc;
node.gpsloc = message.event.node.gpsloc;
node.tags = message.event.node.tags;
node.userloc = message.event.node.userloc;
if (message.event.node.agent != null) {
if (node.agent == null) node.agent = {};
if (message.event.node.agent.ver != null) { node.agent.ver = message.event.node.agent.ver; }
if (message.event.node.agent.id != null) { node.agent.id = message.event.node.agent.id; }
if (message.event.node.agent.caps != null) { node.agent.caps = message.event.node.agent.caps; }
if (message.event.node.agent.core != null) { node.agent.core = message.event.node.agent.core; } else { if (node.agent.core) { delete node.agent.core; } }
node.agent.tag = message.event.node.agent.tag;
}
if (message.event.node.intelamt != null) {
if (node.intelamt == null) node.intelamt = {};
if (message.event.node.intelamt.state != null) { node.intelamt.state = message.event.node.intelamt.state; }
if (message.event.node.intelamt.host != null) { node.intelamt.user = message.event.node.intelamt.host; }
if (message.event.node.intelamt.user != null) { node.intelamt.user = message.event.node.intelamt.user; }
if (message.event.node.intelamt.tls != null) { node.intelamt.tls = message.event.node.intelamt.tls; }
if (message.event.node.intelamt.ver != null) { node.intelamt.ver = message.event.node.intelamt.ver; }
if (message.event.node.intelamt.tag != null) { node.intelamt.tag = message.event.node.intelamt.tag; }
if (message.event.node.intelamt.uuid != null) { node.intelamt.uuid = message.event.node.intelamt.uuid; }
if (message.event.node.intelamt.realm != null) { node.intelamt.realm = message.event.node.intelamt.realm; }
}
if (message.event.node.av != null) { node.av = message.event.node.av; }
node.namel = node.name.toLowerCase();
if (node.rname) { node.rnamel = node.rname.toLowerCase(); } else { node.rnamel = node.namel; }
if (message.event.node.icon) { node.icon = message.event.node.icon; }
// Web page update
masterUpdate(2 | 4 | 8 | 16);
refreshDevice(node._id);
if ((currentNode == node) && (xxdialogMode != null) && (xxdialogTag == '@xxmap')) { p10showNodeLocationDialog(); }
}
break;
}
case 'nodemeshchange': {
var index = -1;
for (var i in nodes) { if (nodes[i]._id == message.event.nodeid) { index = i; break; } }
if (index != -1) {
var node = nodes[index];
if (meshes[message.event.newMeshId] == null) {
// We don't see the new mesh, remove this device
// TODO: Correctly disconnect from this node (Desktop/Terminal/Files...)
if (currentNode == node) { if (xxcurrentView >= 10 && xxcurrentView < 20) { setDialogMode(0); go(1); } currentNode = null; }
nodes.splice(index, 1);
masterUpdate(4 | 16);
} else {
// We see the new mesh, move this device
node.meshid = message.event.newMeshId;
node.meshnamel = meshes[message.event.newMeshId].name.toLowerCase();
masterUpdate(1 | 2 | 4);
}
refreshDevice(message.event.nodeid);
} else {
// This is a new device, add it.
var node = message.event.node;
if (!meshes[node.meshid]) break; // This is a node for a mesh we don't know. Happens when we are site administrator, we get all messages.
node.namel = node.name.toLowerCase();
if (node.rname) { node.rnamel = node.rname.toLowerCase(); } else { node.rnamel = node.namel; }
node.meshnamel = meshes[node.meshid].name.toLowerCase();
node.state = 0;
if (!node.icon) node.icon = 1;
node.ident = ++nodeShortIdent;
if (nodes == null) { }
nodes.push(node);
// Web page update
masterUpdate(1 | 2 | 4 | 16);
}
break;
}
case 'nodeconnect': {
// Indicated a node has changed connectivity state
var index = -1;
for (var i in nodes) { if (nodes[i]._id == message.event.nodeid) { index = i; break; } }
if (index != -1) {
var node = nodes[index];
// Event the connection change if needed
var n = getstore('notifications', 0); // Account notification settings
// Per-group notification settings
if (message.event.meshid && userinfo.links && userinfo.links[message.event.meshid] && userinfo.links[message.event.meshid].notify) {
n &= userinfo.links[message.event.meshid].notify;
} else {
n = 0;
}
// Show the notification
if (n & 2) {
if (((node.conn & 1) == 0) && ((message.event.conn & 1) != 0)) { addNotification({ text: "Agent verbonden", title: node.name, icon: node.icon, nodeid: node._id }); }
if (((node.conn & 2) == 0) && ((message.event.conn & 2) != 0)) { addNotification({ text: "Intel AMT gedetecteerd", title: node.name, icon: node.icon, nodeid: node._id }); }
if (((node.conn & 4) == 0) && ((message.event.conn & 4) != 0)) { addNotification({ text: "Intel AMT CIRA verbonden", title: node.name, icon: node.icon, nodeid: node._id }); }
if (((node.conn & 16) == 0) && ((message.event.conn & 16) != 0)) { addNotification({ text: "MQTT verbonden", title: node.name, icon: node.icon, nodeid: node._id }); }
}
if (n & 4) {
if (((node.conn & 1) != 0) && ((message.event.conn & 1) == 0)) { addNotification({ text: "Agent niet verbonden", title: node.name, icon: node.icon, nodeid: node._id }); }
if (((node.conn & 2) != 0) && ((message.event.conn & 2) == 0)) { addNotification({ text: "Intel AMT niet gedetecteerd", title: node.name, icon: node.icon, nodeid: node._id }); }
if (((node.conn & 4) != 0) && ((message.event.conn & 4) == 0)) { addNotification({ text: "Intel AMT CIRA verbroken", title: node.name, icon: node.icon, nodeid: node._id }); }
if (((node.conn & 16) != 0) && ((message.event.conn & 16) == 0)) { addNotification({ text: "MQTT verbroken", title: node.name, icon: node.icon, nodeid: node._id }); }
}
// Change the node connection state
node.conn = message.event.conn;
node.pwr = message.event.pwr;
// Web page update
masterUpdate(4 | 16);
refreshDevice(node._id);
}
break;
}
case 'wssessioncount': {
// Update the active web socket session count for a user
if (wssessions != null) {
if (message.event.count == 0 && wssessions['user/' + domain + '/' + message.event.username.toLowerCase()]) {
delete wssessions['user/' + domain + '/' + message.event.username.toLowerCase()];
} else {
wssessions['user/' + domain + '/' + message.event.username.toLowerCase()] = message.event.count;
}
updateUsers();
}
break;
}
case 'login': {
// Update the last login time
if (users != null && users['user/' + domain + '/' + message.event.username.toLowerCase()]) {
users['user/' + domain + '/' + message.event.username.toLowerCase()].login = Math.floor(new Date(message.event.time).getTime() / 1000);
}
break;
}
case 'scanamtdevice': {
// Populate the Intel AMT scan dialog box with the result of the RMCP scan
if ((xxdialogMode == null) || (!Q('dp1range')) || (Q('dp1range').value != message.event.range)) return;
var x = '';
if (message.event.results == null) {
// The scan could not occur because of an error. Likely the user range was invalid.
x = '<div style=width:100%;text-align:center;margin-top:12px>' + "Kan dit adresbereik niet scannen." + '</div><div style=width:100%;text-align:center;margin-top:12px;color:gray;line-height:1.5>' + "Voorbeeld van IP-bereikwaarden <br /> 192.168.0.100 <br /> 192.168.1.0/24 <br /> 192.167.0.1-192.168.0.100" + '</div>';
} else {
// Go thru all the results and populate the dialog box
amtScanResults = message.event.results;
for (var i in message.event.results) {
var r = message.event.results[i], shortname = r.hostname;
if (shortname.length > 20) { shortname = shortname.substring(0, 20) + '...'; }
var str = '<b title="' + EscapeHtml(r.hostname) + '">' + EscapeHtml(shortname) + '</b> - v' + r.ver;
if (r.state == 2) { if (r.tls == 1) { str += " met TLS."; } else { str += "zonder TLS."; } } else { str += ' not activated.'; }
x += '<div style=width:100%;margin-bottom:2px;background-color:lightgray><div style=padding:4px><div style=display:inline-block;margin-right:5px><input class=DevScanCheckbox name=dp1checkbox tag="' + EscapeHtml(i) + '" type=checkbox onclick=addAmtScanToMeshCheckbox() /></div><div class=j1 style=display:inline-block></div><div style=display:inline-block;margin-left:5px;overflow-x:auto;white-space:nowrap>' + str + '</div></div></div>';
}
// If no results where found, display a nice message
if (x == '') { x = '<div style=width:100%;text-align:center;margin-top:12px>Scan returned no results.</div><div style=width:100%;text-align:center;margin-top:12px;color:gray;line-height:1.5>Sample IP range values<br />192.168.0.100<br />192.168.1.0/24<br />192.167.0.1-192.168.0.100</div>'; }
}
// Set the html in the dialog box and re-enable the scan button
QH('dp1results', x);
QE('dp1range', true);
QE('dp1rangebutton', true);
break;
}
case 'notify': {
var n = { text: message.event.value, title: message.event.title, icon: message.event.icon };
if (message.event.tag != null) { n.tag = message.event.tag; }
addNotification(n);
break;
}
case 'traceinfo': {
if (typeof message.event.traceSources == 'object') {
if ((message.event.traceSources != null) && (message.event.traceSources.length > 0)) {
serverTraceSources = message.event.traceSources;
QH('p41traceStatus', EscapeHtml(message.event.traceSources.join(', ')));
} else {
serverTraceSources = [];
QH('p41traceStatus', "Geen");
}
}
break;
}
case 'sysinfohash': {
// If the sysinfo document has changed and we are looking at it, request an update.
if ((currentNode != null) && (message.event.nodeid == powerTimelineReq)) {
meshserver.send({ action: 'getsysinfo', nodeid: message.event.nodeid });
}
break;
}
case 'stopped': { // Server is stopping.
// Disconnect
//console.log(message.msg);
break;
}
case 'updatePluginList': {
installedPluginList = message.event.list;
updatePluginList();
break;
}
case 'pluginStateChange': {
if (pluginHandler == null) break;
pluginHandler.refreshPluginHandler();
break;
}
case 'plugin': {
if (pluginHandler == null) break;
try { pluginHandler[message.event.plugin][message.event.pluginaction](message); } catch (e) { console.log("PluginHandler could not event message: ", e); }
break;
}
default:
//console.log('Unknown message.event.action', message.event.action);
break;
}
break;
}
case 'createInviteLink': { // Agent installation invitation link
if (xxdialogTag != message.meshid) break;
var servername = serverinfo.name;
if ((servername.indexOf('.') == -1) || ((features & 2) != 0)) { servername = window.location.hostname; } // If the server name is not set or it's in LAN-only mode, use the URL hostname as server name.
var domainUrlNoSlash = domainUrl.substring(0, domainUrl.length - 1);
var url;
if (serverinfo.https == true) {
var portStr = (serverinfo.port == 443) ? '' : (':' + serverinfo.port);
url = 'https://' + servername + portStr + domainUrl + 'agentinvite?c=' + message.cookie;
} else {
var portStr = (serverinfo.port == 80) ? '' : (':' + serverinfo.port);
url = 'http://' + servername + portStr + domainUrl + 'agentinvite?c=' + message.cookie;
}
Q('agentInvitationLink').href = url;
var t = format("{0} uur{1}", message.expire, addLetterS(message.expire));
if (message.expire == 24) { t = "1 dag"; }
if (message.expire == 168) { t = "1 week"; }
if (message.expire == 5040) { t = "1 maand"; }
if (message.expire == 0) { t = "Ongelimiteerd"; }
QH('agentInvitationLink', format("Uitnodigingslink ({0})", t));
QV('agentInvitationLinkDiv', true);
break;
}
case 'getmqttlogin': {
if ((currentNode == null) || (currentNode._id != message.nodeid) || (xxdialogMode != null)) return;
var x = "Deze instellingen kunnen worden gebruikt om MQTT voor dit apparaat te verbinden." + '<br /><br />';
delete message.action;
delete message.nodeid;
x += '<textarea readonly=readonly style=width:100%;resize:none;height:100px;overflow:auto;font-size:12px readonly>' + JSON.stringify(message) + '</textarea>';
/*
x += addHtmlValue('Username', '<input style=width:230px readonly value="' + message.user + '" />');
x += addHtmlValue('Password', '<input style=width:230px readonly value="' + message.pass + '" />');
x += addHtmlValue('WS URL', '<input style=width:230px readonly value="' + message.wsUrl + '" />');
if (message.mpsUrl && message.mpsCertHash) {
x += addHtmlValue('MPS URL', '<input style=width:230px readonly value="' + message.mpsUrl + '" />');
x += addHtmlValue('MPS Cert Hash', '<input style=width:230px readonly value="' + message.mpsCertHash + '" />');
}
*/
setDialogMode(2, "MQTT referenties", 1, null, x);
break;
}
case 'stopped': { // Server is stopping.
// Disconnect
autoReconnect = false;
QH('p0span', message.msg);
break;
}
case 'updatePluginList': {
installedPluginList = message.list;
updatePluginList();
break;
}
case 'pluginVersionsAvailable': {
if (pluginHandler == null) break;
updatePluginList(message.list);
break;
}
case 'downgradePluginVersions': {
var vSelect = '<select id="lastPluginVersion">';
message.info.versionList.forEach(function(v) { vSelect += '<option value="' + v.zipball_url + '">' + v.name + '</option>'; });
vSelect += '</select>';
setDialogMode(2, "Plugin Actie", 3, pluginActionEx, format('Select the version to downgrade the plugin: {0}', message.info.name) + '<hr />' + vSelect + '<hr />' + "Houd er rekening mee dat downgraden niet wordt aanbevolen. Doe dit alleen als een recente upgrade iets heeft gebroken." + + '<input id="lastPluginAct" type="hidden" value="downgrade" /><input id="lastPluginId" type="hidden" value="' + message.info.id + '" />');
break;
}
case 'pluginError': {
setDialogMode(2, "Plugin fout", 1, null, message.msg);
break;
}
case 'plugin': {
if ((pluginHandler == null) || (typeof message.plugin != 'string')) break;
try { pluginHandler[message.plugin][message.method](server, message); } catch (e) { console.log('Error loading plugin handler ('+ e + ')'); }
break;
}
default:
//console.log('Unknown message.action', message.action);
break;
}
}
//
// MY DEVICES
//
function onRealNameCheckBox() {
showRealNames = Q('RealNameCheckBox').checked;
putstore('showRealNames', showRealNames ? 1 : 0);
masterUpdate(6);
return;
}
function onDeviceViewChange(i) {
if (i != null) { Q('viewselect').value = i; }
for (var j = 1; j < 5; j++) { Q('devViewButton' + j).classList.remove('viewSelectorSel'); }
Q('devViewButton' + Q('viewselect').value).classList.add('viewSelectorSel');
putstore('_deviceView', Q('viewselect').value);
putstore('_viewsize', Q('sizeselect').value);
masterUpdate(4);
setTimeout(function () { masterUpdate(512); }, 200);
}
function ondockeypress(e) {
setSessionActivity();
if (!xxdialogMode && xxcurrentView == 11 && desktop && Q('DeskControl').checked) {
// Check what keys we are allows to send
if (currentNode != null) {
var mesh = meshes[currentNode.meshid];
var meshrights = mesh.links[userinfo._id].rights;
var inputAllowed = ((meshrights == 0xFFFFFFFF) || (((meshrights & 8) != 0) && ((meshrights & 256) == 0)));
if (inputAllowed == false) return false;
var limitedInputAllowed = ((meshrights != 0xFFFFFFFF) && (((meshrights & 8) != 0) && ((meshrights & 256) == 0) && ((meshrights & 4096) != 0)));
if (limitedInputAllowed == true) { if ((e.altKey == true) || (e.ctrlKey == true) || ((e.keyCode < 32) && (e.keyCode != 8) && (e.keyCode != 13)) || (e.keyCode > 90)) return false; }
}
return desktop.m.handleKeys(e);
}
if (!xxdialogMode && xxcurrentView == 12 && terminal && terminal.State == 3) { return terminal.m.TermHandleKeys(e); }
if (!xxdialogMode && ((xxcurrentView == 15) || (xxcurrentView == 115))) return agentConsoleHandleKeys(e);
if (!xxdialogMode && xxcurrentView == 4) {
if (e.ctrlKey == true || e.altKey == true || e.metaKey == true) return;
var processed = 0;
if (e.key) {
if (e.key.length === 1 && userSearchFocus == 0) { Q('UserSearchInput').value = ((Q('UserSearchInput').value + e.key)); processed = 1; }
if (e.keyCode == 8 && userSearchFocus == 0) { var x = Q('UserSearchInput').value; Q('UserSearchInput').value = x.substring(0, x.length - 1); processed = 1; }
if (e.keyCode == 27) { Q('UserSearchInput').value = ''; processed = 1; }
} else {
if (e.charCode != 0 && userSearchFocus == 0) { Q('UserSearchInput').value = ((Q('UserSearchInput').value + String.fromCharCode(e.charCode))); processed = 1; }
}
if (processed > 0) { if (processed == 1) { onUserSearchInputChanged(); } return haltEvent(e); }
}
if (xxdialogMode || xxcurrentView != 1) return;
if (e.ctrlKey == true && e.charCode == 96) {
showRealNames = !showRealNames;
Q('RealNameCheckBox').value = showRealNames;
putstore('showRealNames', showRealNames ? 1 : 0);
masterUpdate(6)
return;
}
if (e.ctrlKey == true || e.altKey == true || e.metaKey == true) return;
if (Q('viewselect').value < 3) {
var processed = 0;
if (e.key) {
if (e.key.length === 1 && searchFocus == 0) { Q('SearchInput').value = ((Q('SearchInput').value + e.key)); processed = 1; }
if (e.keyCode == 8 && searchFocus == 0) { var x = Q('SearchInput').value; Q('SearchInput').value = x.substring(0, x.length - 1); processed = 1; }
if (e.keyCode == 27) { Q('SearchInput').value = ''; processed = 1; }
} else {
if (e.charCode != 0 && searchFocus == 0) { Q('SearchInput').value = ((Q('SearchInput').value + String.fromCharCode(e.charCode))); processed = 1; }
}
if (processed > 0) { if (processed == 1) { masterUpdate(5); } return haltEvent(e); }
}
if (Q('viewselect').value == 3) {
if (e.key) {
if (e.key.length === 1 && mapSearchFocus == 0) { Q('mapSearchLocation').value = ((Q('mapSearchLocation').value + e.key)); processed = 1; }
//if (e.keyCode == 8 && mapSearchFocus == 0) { var x = Q('mapSearchLocation').value; Q('mapSearchLocation').value = x.substring(0, x.length - 1); processed = 1; }
if (e.keyCode == 27) { Q('mapSearchLocation').value = ''; mapCloseSearchWindow(); processed = 1; }
if (e.keyCode == 13) { getSearchLocation(); }
} else {
if (e.charCode != 0 && mapSearchFocus == 0) { Q('mapSearchLocation').value = ((Q('mapSearchLocation').value + String.fromCharCode(e.charCode))); processed = 1; }
}
}
}
function ondockeydown(e) {
setSessionActivity();
if (!xxdialogMode && xxcurrentView == 11 && desktop && Q('DeskControl').checked) {
// Check what keys we are allows to send
if (currentNode != null) {
var mesh = meshes[currentNode.meshid];
var meshrights = mesh.links[userinfo._id].rights;
var inputAllowed = ((meshrights == 0xFFFFFFFF) || (((meshrights & 8) != 0) && ((meshrights & 256) == 0)));
if (inputAllowed == false) return false;
var limitedInputAllowed = ((meshrights != 0xFFFFFFFF) && (((meshrights & 8) != 0) && ((meshrights & 256) == 0) && ((meshrights & 4096) != 0)));
if (limitedInputAllowed == true) { if ((e.altKey == true) || (e.ctrlKey == true) || ((e.keyCode < 32) && (e.keyCode != 8) && (e.keyCode != 13)) || (e.keyCode > 90)) return false; }
}
return desktop.m.handleKeyDown(e);
}
if (!xxdialogMode && xxcurrentView == 12 && terminal && terminal.State == 3) { terminal.m.TermHandleKeyDown(e); if ((e.keyCode >= 37) && (e.keyCode <= 40)) { haltEvent(e); } }
if (!xxdialogMode && xxcurrentView == 13 && e.keyCode == 116 && p13filetree != null) { haltEvent(e); return false; } // F5 Refresh on files
if (!xxdialogMode && ((xxcurrentView == 15) || (xxcurrentView == 115))) { return agentConsoleHandleKeys(e); }
if (!xxdialogMode && xxcurrentView == 4) {
if (e.keyCode === 8 && userSearchFocus == 0) { var x = Q('UserSearchInput').value; Q('UserSearchInput').value = (x.substring(0, x.length - 1)); processed = 1; }
if (e.keyCode === 27) { Q('UserSearchInput').value = ''; processed = 1; }
if (processed > 0) { if (processed == 1) { masterUpdate(5); } return haltEvent(e); }
}
if (xxdialogMode || xxcurrentView != 1 || e.ctrlKey == true || e.altKey == true || e.metaKey == true) return;
var processed = 0;
if (Q('viewselect').value < 3) {
if (e.keyCode === 8 && searchFocus == 0) { var x = Q('SearchInput').value; Q('SearchInput').value = (x.substring(0, x.length - 1)); processed = 1; }
if (e.keyCode === 27) { Q('SearchInput').value = ''; processed = 1; }
if (processed > 0) { if (processed == 1) { masterUpdate(5); } return haltEvent(e); }
}
if (Q('viewselect').value == 3) {
if (e.keyCode === 8 && mapSearchFocus == 0) { var x = Q('mapSearchLocation').value; Q('mapSearchLocation').value = (x.substring(0, x.length - 1)); processed = 1; }
if (e.keyCode === 27) { Q('mapSearchLocation').value = ''; mapCloseSearchWindow(); processed = 1; }
}
}
function ondockeyup(e) {
setSessionActivity();
if (!xxdialogMode && xxcurrentView == 11 && desktop && Q('DeskControl').checked) {
// Check what keys we are allows to send
if (currentNode != null) {
var mesh = meshes[currentNode.meshid];
var meshrights = mesh.links[userinfo._id].rights;
var inputAllowed = ((meshrights == 0xFFFFFFFF) || (((meshrights & 8) != 0) && ((meshrights & 256) == 0)));
if (inputAllowed == false) return false;
var limitedInputAllowed = ((meshrights != 0xFFFFFFFF) && (((meshrights & 8) != 0) && ((meshrights & 256) == 0) && ((meshrights & 4096) != 0)));
if (limitedInputAllowed == true) { if ((e.altKey == true) || (e.ctrlKey == true) || ((e.keyCode < 32) && (e.keyCode != 8) && (e.keyCode != 13)) || (e.keyCode > 90)) return false; }
}
return desktop.m.handleKeyUp(e);
}
if (!xxdialogMode && xxcurrentView == 12 && terminal && terminal.State == 3) { return terminal.m.TermHandleKeyUp(e); }
if (!xxdialogMode && xxcurrentView == 13 && e.keyCode == 116 && p13filetree != null) { p13folderup(9999); haltEvent(e); return false; } // F5 Refresh on files
if (!xxdialogMode && xxcurrentView == 4) { if ((e.keyCode === 8 && searchFocus == 0) || e.keyCode === 27) { return haltEvent(e); } }
if (xxdialogMode && e.keyCode == 27) { dialogclose(0); }
if (xxdialogMode || xxcurrentView != 0 || e.ctrlKey == true || e.altKey == true || e.metaKey == true) return;
if (Q('viewselect').value < 3) { if ((e.keyCode === 8 && searchFocus == 0) || e.keyCode === 27) { return haltEvent(e); } }
if (Q('viewselect').value == 3) { if ((e.keyCode === 8 && mapSearchFocus == 0) || e.keyCode === 27) { return haltEvent(e); } }
}
//function ondocfocus() { }
// TODO: Add handleReleaseKeys() for Intel AMT.
function ondocblur() { if (!xxdialogMode && xxcurrentView == 11 && desktop && Q('DeskControl').checked && desktop.m.handleReleaseKeys) { return desktop.m.handleReleaseKeys(); } }
// Highlights the device being hovered
function devMouseHover(element, over) {
setSessionActivity();
var view = Q('viewselect').value;
if (view == 1) {
var e = element.children[1].children[1];
e.children[0].classList.remove('g1s');
e.children[1].classList.remove('e2s');
e.children[2].classList.remove('g2s');
if (over == 1) {
e.children[0].classList.add('g1s');
e.children[1].classList.add('e2s');
e.children[2].classList.add('g2s');
}
} else if (view == 2) {
var e = element;
e.children[2].classList.remove('g1s');
e.children[4].classList.remove('e2s');
e.children[3].classList.remove('g2s');
if (over == 1) {
e.children[2].classList.add('g1s');
e.children[4].classList.add('e2s');
e.children[3].classList.add('g2s');
}
}
}
var deviceHeaderId = 0;
var deviceHeaderTotal = 0;
var deviceHeadersTitles = {};
var deviceHeaderCount;
var deviceHeaders = {};
var oldviewmode = 0;
function updateDevices() {
if (nodes == null) { return; }
var r = '', c = 0, current = null, count = 0, scount = 0, displayedMeshes = {}, view = Q('viewselect').value, groups = {}, groupCount = {};
QV('xdevices', view < 4);
QV('xdevicesmap', view == 4);
QV('devListToolbar', view < 3);
QV('kvmListToolbar', view == 3);
QV('devMapToolbar', view == 4);
QV('devListToolbarSize', view == 3);
QV('NoMeshesPanel', meshcount == 0);
//QV('devListToolbarView', (meshcount != 0) && (nodes.length > 0));
QV('devListToolbarViewIcons', (meshcount != 0) && (nodes.length > 0));
QV('devListToolbarSort', (meshcount != 0) && (nodes.length > 0) && (view < 4));
if ((meshcount == 0) || (nodes.length == 0)) { view = 1; sort = 0; }
if (view == 4) {
setTimeout( function() { if (xxmap.map != null) { xxmap.map.updateSize(); } }, 200);
// TODO
} else {
// 3 wide, list view or desktop view
deviceHeaderId = 0;
deviceHeaderCount = {};
deviceHeaderTotal = 0;
deviceHeaders = {};
deviceHeadersTitles = {};
var kvmDivs = [];
// Perform node sort
if (sort == 0) { nodes.sort(meshSort); }
else if (sort == 1) { nodes.sort(powerSort); }
else if (sort == 2) { if (showRealNames == true) { nodes.sort(deviceHostSort); } else { nodes.sort(deviceSort); } }
// Save the list of currently checked nodeid's
var checkedNodeids = [], elements = document.getElementsByClassName('DeviceCheckbox'), checkcount = 0;
for (var i=0;i<elements.length;i++) { if (elements[i].checked) { checkedNodeids.push(elements[i].value); } }
if ((oldviewmode < 3) && (view == 3)) { multiDesktopFilter = checkedNodeids; }
else if ((oldviewmode == 3) && (view < 3)) { checkedNodeids = multiDesktopFilter; }
// Compute the width of the device view.
var totalDeviceViewWidth = Q('column_l').clientWidth - 60;
var deviceBoxWidth = Math.floor(totalDeviceViewWidth / 301);
deviceBoxWidth = 301 + Math.floor((totalDeviceViewWidth - (deviceBoxWidth * 301)) / deviceBoxWidth);
// Go thru the list of nodes and display them
for (var i in nodes) {
var node = nodes[i];
if (node.v == false) continue;
var mesh2 = meshes[node.meshid], meshlinks = mesh2.links[userinfo._id];
if (meshlinks == null) continue;
var meshrights = meshlinks.rights;
if ((view == 3) && (mesh2.mtype == 1)) continue;
if (sort == 0) {
// Mesh header
if (node.meshid != current) {
deviceHeaderSet();
var extra = '';
if (view == 2) { r += '<tr><td colspan=5>'; }
if (meshes[node.meshid].mtype == 1) { extra = '<span class=devHeaderx>' + ", Intel&reg; AMT alleen" + '</span>'; }
if ((view == 1) && (current != null)) { if (c == 2) { r += '<td><div style=width:301px></div></td>'; } if (r != '') { r += '</tr></table>'; } }
if (view == 2) { r += '<div>'; }
r += '<div class=DevSt style=width:100%;padding-top:4px><span style=float:right>';
r += '<span id=DevxHeader' + deviceHeaderId + ' class=devHeaderx></span>' + extra;
r += '</span><span id=MxMESH tabindex=0 style=cursor:pointer onclick=gotoMesh("' + node.meshid + '") onkeypress="if (event.key==\'Enter\') gotoMesh(\'' + node.meshid + '\')">' + EscapeHtml(meshes[node.meshid].name) + '</span>' + getMeshActions(mesh2, meshrights) + '</div>';
if (view == 2) { r += '</div>'; }
current = node.meshid;
displayedMeshes[current] = 1;
c = 0;
}
} else if (sort == 1) {
// Power header
var pwr = node.pwr?node.pwr:0;
if (pwr !== current) {
deviceHeaderSet();
if ((view == 1) && (current !== null)) { if (c == 2) { r += '<td><div style=width:301px></div></td>'; } if (r != '') { r += '</tr></table>'; } }
if (view == 2) { r += '<tr><td>'; }
r += '<div class=DevSt style=width:100%;padding-top:4px><span id=DevxHeader' + deviceHeaderId + ' class=devHeaderx style=float:right></span><span>' + PowerStateStr2(node.pwr) + '</span></div>';
current = pwr;
c = 0;
}
} else if (sort == 2) {
// Device header
if (current == null) { current = '1'; }
}
count++;
var title = EscapeHtml(node.name);
if (title.length == 0) { title = '<i>' + "Geen" + '</i>'; }
if ((node.rname != null) && (node.rname.length > 0)) { title += ' / ' + EscapeHtml(node.rname); }
var name = EscapeHtml(node.name);
if (showRealNames == true && node.rname != null) name = EscapeHtml(node.rname);
if (name.length == 0) { name = '<i>' + "Geen" + '</i>'; }
// Node
var icon = node.icon;
if ((!node.conn) || (node.conn == 0)) { icon += ' gray'; }
if (view == 1) {
r += '<div id=devs onmouseover=devMouseHover(this,1) onmouseout=devMouseHover(this,0) style=display:inline-block;width:' + deviceBoxWidth + 'px;height:50px;padding-top:1px;padding-bottom:1px><div style=width:22px;height:50%;float:left;padding-top:12px><input class="' + node.meshid + ' DeviceCheckbox" onclick=p1updateInfo() value=devid_' + node._id + ' type=checkbox></div><div style=height:100%;cursor:pointer tabindex=0 onclick=gotoDevice(\'' + node._id + '\',null,null,event) onkeypress="if (event.key==\'Enter\') gotoDevice(\'' + node._id + '\',null,null,event)"><div class="i' + icon + '" style=width:50px;float:left></div><div style=height:100%><div class=g1></div><div class=e2><div class=e1 style=width:' + (deviceBoxWidth - 100) + 'px title="' + title + '">' + name + '</div><div>' + NodeStateStr(node) + '</div></div><div class=g2></div></div></div></div>';
} else if (view == 2) {
var states = [];
if (node.conn) {
if ((node.conn & 1) != 0) { states.push('<span title=\"' + "Mesh-agent is verbonden en klaar voor gebruik." + '\">' + "Agent" + '</span>'); }
if ((node.conn & 2) != 0) { states.push('<span title=\"' + "Intel® AMT CIRA is verbonden en klaar voor gebruik." + '\">' + "CIRA" + '</span>'); }
else if ((node.conn & 4) != 0) { states.push('<span title=\"' + "Intel® AMT is routeerbaar." + '\">' + "AMT" + '</span>'); }
if ((node.conn & 8) != 0) { states.push('<span title=\"' + "Mesh-agent is bereikbaar met een andere agent als relay." + '\">' + "Relay" + '</span>'); }
if ((node.conn & 16) != 0) { states.push('<span title=\"' + "MQTT verbinding met het apparaat is actief." + '\">' + "MQTT" + '</span>'); }
}
r += '<tr><td><div id=devs class=bar18 tabindex=0 onmouseover=devMouseHover(this,1) onmouseout=devMouseHover(this,0) style=height:18px;width:100%;font-size:medium onkeypress="if (event.key==\'Enter\') gotoDevice(\'' + node._id + '\',null,null,event)">';
r += '<div class=deviceBarCheckbox><input class="' + node.meshid + ' DeviceCheckbox" onclick=p1updateInfo() value=devid_' + node._id + ' type=checkbox></div>';
r += '<div class=deviceBarIcon onclick=gotoDevice(\'' + node._id + '\',null,null,event)><div class=\"j' + icon + '\" style=width:16px;margin-top:1px;margin-left:2px;height:16px></div></div>';
r += '<div class=g1 style=height:18px;float:left></div><div class=g2 style=height:18px;float:right></div>';
r += '<div style=cursor:pointer;font-size:14px title="' + title + '" onclick=gotoDevice(\'' + node._id + '\',null,null,event)><span style=width:300px>' + name + '</span></div></div></td>';
r += '<td style=text-align:center>' + getUserShortStr(node);
r += '<td style=text-align:center>' + (node.ip != null ? node.ip : '');
r += '<td style=text-align:center>' + states.join('&nbsp;+&nbsp;');
//r += '<td style=text-align:center>' + (node.pwr != null ? powerStateStrings[node.pwr] : '');
r += '</tr>';
} else if ((view == 3) && (node.conn & 1) && (((meshrights & 8) || (meshrights & 256)) != 0) && ((node.agent.caps & 1) != 0)) { // Check if we have rights and agent is capable of KVM.
if ((multiDesktopFilter) && ((multiDesktopFilter.length == 0) || (multiDesktopFilter.indexOf('devid_' + node._id) >= 0))) {
r += '<div id=devs style=display:inline-block;margin:1px;background-color:lightgray;border-radius:5px;position:relative><div tabindex=0 style=padding:3px;cursor:pointer onclick=gotoDevice(\'' + node._id + '\',11,null,event) onkeypress="if (event.key==\'Enter\') gotoDevice(\'' + node._id + '\',11,null,event)">';
//r += '<input class="' + node.meshid + ' DeviceCheckbox" onclick=p1updateInfo() value=devid_' + node._id + ' type=checkbox style=float:left>';
r += '<div class="j' + icon + '" style=width:16px;float:left></div>&nbsp;' + name + '</div>';
r += '<span onclick=gotoDevice(\'' + node._id + '\',null,null,event)></span><div id=xkvmid_' + node._id.split('/')[2] + '><div id=skvmid_' + node._id.split('/')[2] + ' tabindex=0 style="position:absolute;color:white;left:5px;top:27px;text-shadow:0px 0px 5px #000;z-index:1000;cursor:default" onclick=toggleKvmDevice(\'' + node._id + '\') onkeypress="if (event.key==\'Enter\') toggleKvmDevice(\'' + node._id + '\')">' + "Verbroken" + '</div></div>';
r += '</div>';
kvmDivs.push(node._id);
}
}
// If we are displaying devices by group, put the device in the right group.
if ((sort == 3) && (r != '')) {
if (node.tags) {
for (var j in node.tags) {
var tag = node.tags[j];
if (groups[tag] == null) { groups[tag] = r; groupCount[tag] = 1; } else { groups[tag] += r; groupCount[tag] += 1; }
if (view == 3) break;
}
}
r = '';
}
deviceHeaderTotal++;
if (typeof deviceHeaderCount[node.state] == 'undefined') { deviceHeaderCount[node.state] = 1; } else { deviceHeaderCount[node.state]++; }
}
// Above 32 devices, gray out the auto connect feature.
if (kvmDivs.length >= 32) { Q('autoConnectDesktopCheckbox').checked = false; }
QE('autoConnectDesktopCheckbox', kvmDivs.length < 32);
// If displaying devices by groups, sort the group names and display the devices.
if (sort == 3) {
var groupNames = [];
for (var i in groups) { groupNames.push(i); }
groupNames.sort(function (a, b) { return a.toLowerCase().localeCompare(b.toLowerCase()); });
for (var j in groupNames) {
var i = groupNames[j];
if (view == 2) {
r += '<tr><td colspan=4><div class=DevSt style=width:100%;padding-top:4px><span class=devHeaderx style=float:right>' + groupCount[i] + ' node' + ((groupCount[i] > 1) ? 's' : '') + '</span><span>' + i + '</span></div>' + groups[i];
} else {
r += '<div class=DevSt style=width:100%;padding-top:4px><span class=devHeaderx style=float:right>' + groupCount[i] + ' node' + ((groupCount[i] > 1) ? 's' : '') + '</span><span>' + i + '</span></div>' + groups[i];
}
}
}
// If there is nothing to display, explain the problem
if ((r == '') && (meshcount > 0) && (Q('SearchInput').value != '')) {
if (sort == 3) {
r = '<div style="margin:30px">' + "Er zijn geen apparaten opgenomen in groepen, klik op een apparaat \"Groepen\" om toe te voegen aan een groep." + '</div>';
} else {
r = '<div style="margin:30px">' + "Geen apparaten die overeenkomen met deze zoekopdracht." + '</div>';
}
}
if ((view == 1) && (c == 2)) r += '<td><div style=width:301px></div></td>'; // Adds device padding
// Display all empty device groups, we need to do this because users can add devices to these at any time.
if ((sort == 0) && (Q('SearchInput').value == '') && (view < 3)) {
for (var i in meshes) {
var mesh = meshes[i], meshlink = mesh.links[userinfo._id];
if (meshlink != null) {
var meshrights = meshlink.rights;
if (displayedMeshes[mesh._id] == null) {
if ((current != '') && (r != '')) { r += '</tr></table>'; }
r += '<table style=width:100%;padding-top:4px cellpadding=0 cellspacing=0><tr><td colspan=3 class=DevSt><span id=MxMESH style=cursor:pointer onclick=gotoMesh("' + mesh._id + '")>' + EscapeHtml(mesh.name) + '</span><span>';
r += getMeshActions(mesh, meshrights);
r += '</span></td></tr><tr>';
if (mesh.mtype == 1) {
r += '<td><div style=padding:10px><i>' + "Geen Intel&reg; AMT-apparaten in deze mesh";
if ((meshrights & 4) != 0) { r += ', <a href=# style=cursor:pointer onclick=\'return addDeviceToMesh(\"' + mesh._id + '\")\'>' + "Voeg toe" + '</a>'; }
}
if (mesh.mtype == 2) {
r += '<td><div style=padding:10px><i>' + "Geen apparaten in deze groep";
if ((meshrights & 4) != 0) { r += ', <a href=# style=cursor:pointer onclick=\'return addAgentToMesh(\"' + mesh._id + '\")\'>' + "Voeg toe" + '</a>'; }
}
r += '.</i></div></td>';
current = mesh._id;
count++;
}
}
}
}
if (r != '') {
if (view == 2) {
// This height of 1 div at the end to fix a problem in Linux firefox browsers
r = '<table style=width:100%;margin-top:4px cellpadding=0 cellspacing=0><th style=color:gray><th style=color:gray;width:120px>' + "Gebruiker" + '<th style=color:gray;width:120px>' + "Adres" + '<th style=color:gray;width:100px>' + "connectiviteit" + r + '</tr></table><div style=height:1px></div>'; //<th style=color:gray;width:100px>State';
}
} else {
if (sort == 3) { r = '<div style="margin:10px"><i>' + "No devices with tags found." + '</i></div>'; }
}
// Add a "Add Device Group" option
r += '<div style=border-top-style:solid;border-top-width:1px;border-top-color:#DDDDDD;cursor:pointer;font-size:10px>';
if ((view < 3) && (sort == 0) && (meshcount > 0) && ((userinfo.siteadmin == 0xFFFFFFFF) || ((userinfo.siteadmin & 64) == 0))) {
r += '<a href=# onclick="return account_createMesh()" title=\"' + "Maak een nieuwe apparaatgroep." + '\" style=cursor:pointer>' + "Apparaatgroep toevoegen" + '</a>&nbsp';
}
if ((userinfo.siteadmin == 0xFFFFFFFF) || ((userinfo.siteadmin & 128) == 0)) {
r += '<a href=# onclick=\'return p10showMeshCmdDialog(0)\' style=cursor:pointer title=\"' + "Download MeshCmd, een opdrachtregelprogramma dat vele functies uitvoert." + '\">' + "MeshCmd" + '</a>&nbsp';
if (navigator.platform.toLowerCase() == 'win32') { r += '<a href=# onclick=\'return p10showMeshRouterDialog()\' style=cursor:pointer title=\"' + "Download MeshCentral Router, een hulpmiddel voor het toewijzen van TCP-poorten." + '\">' + "Router" + '</a>&nbsp'; }
}
r += '</div><br/>';
QH('xdevices', r);
deviceHeaderSet();
// Re-check nodeid's
var elements = document.getElementsByClassName('DeviceCheckbox'), checkcount = 0;
if (checkedNodeids) { for (var i=0;i<elements.length;i++) { elements[i].checked = (checkedNodeids.indexOf(elements[i].value) >= 0); } }
for (var i in deviceHeaders) { QH(i, deviceHeaders[i]); }
for (var i in deviceHeadersTitles) { Q(i).title = deviceHeadersTitles[i]; }
p1updateInfo();
// Take care of KVM surfaces in desktop view mode
if (view == 3) {
// Figure out and adjust the size to fill the width of the div
var vsize = [{ x: 180, y: 101 }, { x: 302, y: 169 }, { x: 454, y: 255 }][Q('sizeselect').selectedIndex];
//var realw = vsize.x + 2, tw = Q('xdevices').clientWidth - 30, xw = Math.floor(tw / realw);
var realw = vsize.x + 2, tw = totalDeviceViewWidth - 5, xw = Math.floor(tw / realw);
xw = realw + Math.floor((tw - (xw * realw)) / xw);
vsize.y = vsize.y * (xw / vsize.x);
vsize.x = xw;
for (var i in multiDesktop) { multiDesktop[i].xxdelete = true; }
for (var i in kvmDivs) {
var id = kvmDivs[i], shortid = id.split('/')[2], desk = multiDesktop[id];
if (desk != null) {
// This device already has a canvas, use it.
desk.m.CanvasId.setAttribute('style', 'background-color:black;width:' + vsize.x + 'px;height:' + vsize.y + 'px');
Q('xkvmid_' + shortid).appendChild(desk.m.CanvasId);
delete desk.xxdelete;
QH('skvmid_' + shortid, ["Verbroken", "Verbinden...", "Setup...", '', ''][((desk.m.State == null)?desk.m.state:desk.m.State)]);
} else {
var node = getNodeFromId(id);
if ((desktopNode == node) && (desktop != null)) { // Check if the main desktop is this device, if it is, use that.
// This device already has a canvas, use it.
var c = desktop.m.CanvasId;
c.setAttribute('id', 'kvmid_' + shortid);
c.setAttribute('style', 'background-color:black;width:' + vsize.x + 'px;height:' + vsize.y + 'px');
c.setAttribute('onclick', 'toggleKvmDevice(\'' + id + '\')');
c.removeAttribute('onmousedown');
c.removeAttribute('onmouseup');
c.removeAttribute('onmousemove');
Q('xkvmid_' + shortid).appendChild(c);
QH('skvmid_' + shortid, ["Verbroken", "Verbinden...", "Setup...", '', ''][((desktop.m.State == null)?desktop.m.state:desktop.m.State)]);
if (desktop.m.SendCompressionLevel) { desktop.m.SendCompressionLevel(1, multidesktopsettings.quality, multidesktopsettings.scaling, multidesktopsettings.framerate); }
desktop.shortid = shortid;
desktop.onStateChanged = onMultiDesktopStateChange;
multiDesktop[id] = desktop;
desktop = desktopNode = currentNode = null;
// Setup a replacement desktop
QH('DeskParent', '<canvas id="Desk" oncontextmenu="return false" onmousedown=dmousedown(event) onmouseup=dmouseup(event) onmousemove=dmousemove(event)></canvas>');
} else {
// This is a new device, create a canvas for it.
var c = document.createElement('canvas');
c.setAttribute('id', 'kvmid_' + shortid);
c.setAttribute('width', 640);
c.setAttribute('height', 480);
c.setAttribute('oncontextmenu', 'return false');
c.setAttribute('style', 'background-color:black;width:' + vsize.x + 'px;height:' + vsize.y + 'px');
c.setAttribute('onclick', 'toggleKvmDevice(\'' + id + '\')');
try { Q('xkvmid_' + shortid).appendChild(c); } catch (ex) {}
// Check if we need to auto-connect
if (Q('autoConnectDesktopCheckbox').checked == true) { setTimeout(function() { connectMultiDesktop(node, 1); }, 100); }
}
}
}
for (var i in multiDesktop) {
// If a device is no longer viewed, disconnect it.
if (multiDesktop[i].xxdelete == true) { multiDesktop[i].Stop(); delete multiDesktop[i]; }
else if (debugmode && multiDesktop[i].m && multiDesktop[i].m.onScreenSizeChange) {
mdeskAdjust(multiDesktop[i].m, multiDesktop[i].m.ScreenWidth, multiDesktop[i].m.ScreenHeight, multiDesktop[i].m.CanvasId); // Adjust screen size change
}
}
deskAdjust();
} else {
disconnectAllKvmFunction();
Q('autoConnectDesktopCheckbox').checked = false;
}
}
oldviewmode = view;
}
function toggleKvmDevice(node) {
if (typeof node == 'string') { node = getNodeFromId(node); } // Convert nodeid to node if needed
var mesh = meshes[node.meshid], meshrights = mesh.links[userinfo._id].rights;
if ((meshrights & 8) || (meshrights & 256)) { // Requires remote control rights or desktop view only rights
//var conn = 0;
//if ((node.conn & 1) != 0) { conn = 1; } else if ((node.conn & 6) != 0) { conn = 2; } // Check what type of connect we can do (Agent vs AMT)
if (node.conn & 1) { connectMultiDesktop(node, 1); }
}
}
function getUserShortStr(node) {
if (node == null || node.users == null || node.users.length == 0) return '';
if (node.users.length > 1) { return '<span title="' + EscapeHtml(node.users.join(', ')) + '">' + nobreak(format("{0} gebruikers", node.users.length)) + '</span>'; }
var u = node.users[0], su = u, i = u.indexOf('\\');
if (i > 0) { su = u.substring(i + 1); }
su = EscapeHtml(su);
if (su.length > 15) { su = su.substring(0, 14) + '&#8230;'; }
return '<span title="' + EscapeHtml(u) + '">' + su + '</span>';
}
function autoConnectDesktops() { if (Q('autoConnectDesktopCheckbox').checked == true) { connectAllKvmFunction(); } }
function connectAllKvmFunction(force) {
if (xxdialogMode) return false;
if (force !== true) { // We need to count how many devices will need to be connected, if it's a lot, prompt first.
var count = 0;
for (var i in nodes) {
var node = nodes[i], nodeid = nodes[i]._id;
if (multiDesktop[nodeid] == null) {
var mesh = meshes[node.meshid], meshrights = mesh.links[userinfo._id].rights;
if ((meshrights & 8) || (meshrights & 256)) { // Requires remote control rights or desktop view only rights
//var conn = 0;
//if ((node.conn & 1) != 0) { conn = 1; } else if ((node.conn & 6) != 0) { conn = 2; } // Check what type of connect we can do (Agent vs AMT)
if (node.conn & 1) { count++; }
}
}
}
if (count > 8) { setDialogMode(2, "Alles verbinden", 3, function() { connectAllKvmFunction(true); }, format("Weet u zeker dat u verbinding wilt maken met {0} -apparaten?", count)); return; }
}
// Perform connect all
for (var i in nodes) { if (multiDesktop[nodes[i]._id] == null) { toggleKvmDevice(nodes[i]._id); } }
}
function disconnectAllKvmFunction() { if (xxdialogMode) return false; for (var nodeid in multiDesktop) { multiDesktop[nodeid].Stop(); } multiDesktop = {}; }
function onMultiDesktopStateChange(desk, state) { try { QH('skvmid_' + desk.shortid, ["Verbroken", "Verbinden...", "Setup...", '', ''][state]); } catch (ex) {} }
function showMultiDesktopSettings() {
QV('d7amtkvm', false);
QV('d7meshkvm', true);
d7bitmapquality.value = multidesktopsettings.quality;
d7bitmapscaling.value = multidesktopsettings.scaling;
if (multidesktopsettings.framerate) { d7framelimiter.value = multidesktopsettings.framerate; } else { d7framelimiter.value = 1000; }
setDialogMode(7, "Instellingen extern bureaublad", 3, showMultiDesktopSettingsChanged);
}
function showMultiDesktopSettingsChanged() {
multidesktopsettings.quality = d7bitmapquality.value;
multidesktopsettings.scaling = d7bitmapscaling.value;
multidesktopsettings.framerate = d7framelimiter.value;
localStorage.setItem('multidesktopsettings', JSON.stringify(multidesktopsettings));
// Make changes to all current connections
for (var i in multiDesktop) { multiDesktop[i].m.SendCompressionLevel(1, multidesktopsettings.quality, multidesktopsettings.scaling, multidesktopsettings.framerate); }
}
function connectMultiDesktop(node, contype) {
var nodeid = node._id, shortid = nodeid.split('/')[2];
var desk = multiDesktop[nodeid];
if (desk == null) {
if (Q('kvmid_' + shortid) == null) return; // Check if this device is being displayed, if not, exit now.
if (contype == 2) {
// Setup the Intel AMT remote desktop
if ((node.intelamt.user == null) || (node.intelamt.user == '')) { return; }
desk = CreateAmtRedirect(CreateAmtRemoteDesktop('kvmid_' + shortid), authCookie);
desk.shortid = shortid;
//desk.debugmode = debugmode;
desk.onStateChanged = onMultiDesktopStateChange;
desk.m.bpp = 1;
desk.m.useZRLE = true;
desk.m.showmouse = true;
desk.m.onKvmData = function (data) { console.log('KVM Data received in multi-desktop mode, this is not supported.'); }; // KVM Data Channel not supported in multi-desktop right now.
//desk.m.onScreenSizeChange = deskAdjust;
if (debugmode > 0) { desk.m.onScreenSizeChange = mdeskAdjust; } // Multi-Desktop Adjust
desk.Start(nodeid, 16994, '*', '*', 0);
desk.contype = 2;
multiDesktop[nodeid] = desk;
} else if (contype == 1) {
// Setup the Mesh Agent remote desktop
desk = CreateAgentRedirect(meshserver, CreateAgentRemoteDesktop('kvmid_' + shortid), serverPublicNamePort, authCookie, authRelayCookie, domainUrl);
desk.shortid = shortid;
desk.attemptWebRTC = attemptWebRTC;
desk.onStateChanged = onMultiDesktopStateChange;
//desk.onConsoleMessageChange = function () { console.log('CONSOLEMSG:', desk.consoleMessage); }
desk.m.CompressionLevel = multidesktopsettings.quality;
desk.m.ScalingLevel = multidesktopsettings.scaling;
desk.m.FrameRateTimer = multidesktopsettings.framerate;
//desk.m.onDisplayinfo = deskDisplayInfo;
//desk.m.onScreenSizeChange = deskAdjust;
if (debugmode > 0) { desk.m.onScreenSizeChange = mdeskAdjust; } // Multi-Desktop Adjust
desk.Start(nodeid);
desk.contype = 1;
multiDesktop[nodeid] = desk;
}
} else {
// Disconnect and clean up the remote desktop
desk.Stop();
delete multiDesktop[nodeid];
}
}
function getMeshActions(mesh, meshrights) {
if ((meshrights & 4) == 0) return '';
var r = '';
if ((features & 1024) == 0) { // If CIRA is allowed
r += ' <a href=# style=cursor:pointer;font-size:10px title=\"' + "Voeg een nieuwe Intel® AMT computer toe welke zich op het internet bevind." + '\" onclick=\'return addCiraDeviceToMesh(\"' + mesh._id + '\")\'>' + "Toevoegen CIRA" + '</a>';
}
if (mesh.mtype == 1) {
if ((features & 1) == 0) { // If not WAN-Only
r += ' <a href=# style=cursor:pointer;font-size:10px title=\"' + "Voeg een nieuwe Intel® AMT computer toe welke zich op het lokale netwerk bevind." + '\" onclick=\'return addDeviceToMesh(\"' + mesh._id + '\")\'>' + "Lokaal toevoegen" + '</a>';
r += ' <a href=# style=cursor:pointer;font-size:10px title=\"' + "Voeg een nieuwe Intel® AMT computer toe door het lokale netwerk te scannen." + '\" onclick=\'return addAmtScanToMesh(\"' + mesh._id + '\")\'>' + "Scan Netwerk" + '</a>';
}
if (mesh.amt && (mesh.amt.type == 2)) { // CCM activation
r += ' <a href=# style=cursor:pointer;font-size:10px title=\"' + "Voer Intel AMT client control mode (CCM) activering uit." + '\" onclick=\'return showCcmActivation(\"' + mesh._id + '\")\'>' + "Activatie" + '</a>';
} else if (mesh.amt && (mesh.amt.type == 3) && ((features & 0x00100000) != 0)) { // ACM activation
r += ' <a href=# style=cursor:pointer;font-size:10px title=\"' + "Voer Intel AMT admin control mode (ACM) activering uit." + '\" onclick=\'return showAcmActivation(\"' + mesh._id + '\")\'>' + "Activatie" + '</a>';
}
}
if (mesh.mtype == 2) {
r += ' <a href=# style=cursor:pointer;font-size:10px title=\"' + "Voeg een nieuwe computer toe aan deze mesh door de mesh-agent te installeren." + '\" onclick=\'return addAgentToMesh(\"' + mesh._id + '\")\'>' + "Toevoegen Agent" + '</a>';
if ((features & 2) == 0) { r += ' <a href=# style=cursor:pointer;font-size:10px title=\"' + "Nodig iemand uit om de mesh-agent op deze mesh te installeren." + '\" onclick=\'return inviteAgentToMesh(\"' + mesh._id + '\")\'>' + "Nodig uit" + '</a>'; }
}
return r;
}
function addDeviceToMesh(meshid) {
if (xxdialogMode) return false;
var mesh = meshes[meshid];
var x = format("Voeg een nieuwe Intel&reg; AMT computer toe aan een apparaatgroep \"{0}\".", EscapeHtml(mesh.name)) + '<br /><br />';
x += addHtmlValue("Apparaat naam", '<input id=dp1devicename style=width:230px maxlength=32 autocomplete=off onchange=validateDeviceToMesh() onkeyup=validateDeviceToMesh() />');
x += addHtmlValue("Hostname", '<input id=dp1hostname style=width:230px maxlength=32 autocomplete=off placeholder=\"' + "Hetzelfde als de apparaatnaam" + '\" onchange=validateDeviceToMesh() onkeyup=validateDeviceToMesh() />');
x += addHtmlValue("Gebruikersnaam", '<input id=dp1username style=width:230px maxlength=32 autocomplete=off placeholder=\"' + "Beheerder" + '\" onchange=validateDeviceToMesh() onkeyup=validateDeviceToMesh() />');
x += addHtmlValue("wachtwoord", '<input id=dp1password type=password style=width:230px autocomplete=off maxlength=32 onchange=validateDeviceToMesh() onkeyup=validateDeviceToMesh() />');
x += addHtmlValue("Veiligheid", '<select id=dp1tls style=width:236px><option value=0>' + "Geen TLS beveiliging" + '</option><option value=1>' + "TLS beveiliging vereist" + '</option></select>');
setDialogMode(2, "Add Intel&reg; AMT aaparaat", 3, addDeviceToMeshEx, x, meshid);
validateDeviceToMesh();
Q('dp1devicename').focus();
return false;
}
// Intel AMT CCM Activation
function showCcmActivation(meshid) {
if (xxdialogMode) return false;
var servername = serverinfo.name, mesh = meshes[meshid];
if ((servername.indexOf('.') == -1) || ((features & 2) != 0)) { servername = window.location.hostname; } // If the server name is not set or it's in LAN-only mode, use the URL hostname as server name.
var url, domainUrlNoSlash = domainUrl.substring(0, domainUrl.length - 1);
if (serverinfo.https == true) {
var portStr = (serverinfo.port == 443) ? '' : (':' + serverinfo.port);
url = 'wss://' + servername + portStr + domainUrl;
} else {
var portStr = (serverinfo.port == 80) ? '' : (':' + serverinfo.port);
url = 'ws://' + servername + portStr + domainUrl;
}
var x = format("Voer Intel AMT client control mode (CCM) activering uit naar groep \"{0}\" door het hulpprogramma MeshCMD te downloaden en als volgt uit te voeren:", EscapeHtml(mesh.name)) + '<br /><br />';
x += '<textarea readonly=readonly style=width:100%;resize:none;height:100px;overflow:auto;font-size:12px readonly>meshcmd amtccm --url ' + url + 'amtactivate?id=' + meshid.split('/')[2] + ' --serverhttpshash ' + serverinfo.tlshash + '</textarea>';
setDialogMode(2, "Intel&reg; AMT activatie", 9, null, x);
Q('idx_dlgOkButton').focus();
return false;
}
// Intel AMT ACM Activation
function showAcmActivation(meshid) {
if (xxdialogMode) return false;
var servername = serverinfo.name, mesh = meshes[meshid];
if ((servername.indexOf('.') == -1) || ((features & 2) != 0)) { servername = window.location.hostname; } // If the server name is not set or it's in LAN-only mode, use the URL hostname as server name.
var url, domainUrlNoSlash = domainUrl.substring(0, domainUrl.length - 1);
if (serverinfo.https == true) {
var portStr = (serverinfo.port == 443) ? '' : (':' + serverinfo.port);
url = 'wss://' + servername + portStr + domainUrl;
} else {
var portStr = (serverinfo.port == 80) ? '' : (':' + serverinfo.port);
url = 'ws://' + servername + portStr + domainUrl;
}
var x = format("Voer Intel AMT admin control mode (ACM) activering uit naar groep \"{0}\" door het hulpprogramma MeshCMD te downloaden en als volgt uit te voeren:", EscapeHtml(mesh.name)) + '<br /><br />';
x += '<textarea readonly=readonly style=width:100%;resize:none;height:100px;overflow:auto;font-size:12px readonly>meshcmd amtacm --url ' + url + 'amtactivate?id=' + meshid.split('/')[2] + ' --serverhttpshash ' + serverinfo.tlshash + '</textarea>';
if (serverinfo.amtAcmFqdn != null) {
x += ('<div style=margin-top:8px>' + "Intel AMT moet worden ingesteld met een vertrouwd FQDN in MEBx of een bekabeld LAN op het netwerk hebben:" + ' <b>' + serverinfo.amtAcmFqdn.join(', ') + '</b></div>');
}
setDialogMode(2, "Intel&reg; AMT activatie", 9, null, x);
Q('idx_dlgOkButton').focus();
return false;
}
// Display the Intel AMT scanning dialog box
function addAmtScanToMesh(meshid) {
if (xxdialogMode) return false;
var x = "Voer een reeks IP-adressen in om te scannen op Intel AMT-apparaten." + '<br /><br />';
x += addHtmlValue("IP-bereik", '<input id=dp1range style=width:184px value="192.168.1.0/24" onkeyup=addAmtScanToMeshKeyUp(event) /><input id=dp1rangebutton type=button value=\"' + "Scan" + '\" onclick=addAmtScanToMeshButton()></input>');
x += '<div id=dp1results style="width:100%;height:200px;background-color:white;border:1px gray solid;overflow-y:scroll"></div>';
setDialogMode(2, "Scannen naar Intel® AMT-apparaten", 3, addAmtScanToMeshEx, x, meshid);
QE('idx_dlgOkButton', false);
QH('dp1results', '<div style=width:100%;text-align:center;margin-top:12px;color:gray;line-height:1.5>Sample IP range values<br />192.168.0.100<br />192.168.1.0/24<br />192.167.0.1-192.168.0.100</div>');
focusTextBox('dp1range');
return false;
}
function addAmtScanToMeshKeyUp(e) {
if (e.keyCode == 13) { haltEvent(e); addAmtScanToMeshButton(); }
}
// Called when OK is pressed on the Intel AMT scanning box
function addAmtScanToMeshEx(button, meshid) {
var elements = document.getElementsByClassName('DevScanCheckbox'), checkcount = 0;
for (var i=0;i<elements.length;i++) {
if (elements[i].checked) {
var ipaddr = elements[i].getAttribute('tag');
var amtinfo = amtScanResults[ipaddr];
meshserver.send({ action: 'addamtdevice', meshid: meshid, devicename: ipaddr, hostname: amtinfo.hostname, amtusername: '', amtpassword: '', amttls: amtinfo.tls });
}
}
}
// If the user presses the "Scan" button on the Intel AMT scanning dialog box, start a scan.
function addAmtScanToMeshButton() {
QE('dp1range', false);
QE('dp1rangebutton', false);
QH('dp1results', '<div style=width:100%;text-align:center;margin-top:12px>' + "Scannen van ..." + '</div>');
meshserver.send({ action: 'scanamtdevice', range: Q('dp1range').value });
}
// Called when a scanned computer is checked or unchecked.
function addAmtScanToMeshCheckbox() {
var elements = document.getElementsByClassName('DevScanCheckbox'), checkcount = 0;
for (var i=0;i<elements.length;i++) { if (elements[i].checked) checkcount++; }
QE('idx_dlgOkButton', checkcount > 0);
}
function addCiraDeviceToMesh(meshid) {
if (xxdialogMode) return false;
var mesh = meshes[meshid];
// Replace non alphabetic characters (@ and $) with 'X' because MPS username cannot accept it.
var meshidx = meshid.split('/')[2].replace(/\@/g, 'X').replace(/\$/g, 'X');
var y = '<select id=dlgAddCiraSel onclick=dlgAddCiraSelClick() style=width:230px><option value=0>' + "MeshCommander Script" + '</option><option value=1>' + "Handmatige gebruikersnaam / wachtwoord" + '</option>';
if ((features & 16) == 0) { y += ('<option value=2>' + "Handmatig certificaat" + '</option></select>'); } // Only display this option if Intel AMT CIRA with Mutual-Auth is allowed.
var x = '';
x += addHtmlValue("Setup methode", y);
x += '<hr>';
// Setup CIRA using a MeshCommander script (Pretty Simple)
x += '<div id=dlgAddCira0>' + format("Om een nieuw Intel® AMT-apparaat toe te voegen aan apparaatgroep \"{0}\" met CIRA, downloadt u de volgende scriptbestanden en gebruikt u <a href = 'http: //meshcommander.com' rel = 'noreferrer noopener' target = ' _blank '> MeshCommander </a> om het script uit te voeren om computers te configureren.", EscapeHtml(mesh.name)) + '<br /><br />';
//x += addHtmlValue('Setup CIRA', '<a href="mescript.ashx?type=1&meshid=' + meshidx.substring(0, 16) + '" download>cira_setup.mescript</a>');
x += addHtmlValue("CIRA instellen", '<a href="mescript.ashx?type=1&meshid=' + meshid + '" download>cira_setup.mescript</a>');
x += addHtmlValue("Opruimen CIRA", '<a href="mescript.ashx?type=2" download>cira_clean.mescript</a>');
x += '</div>';
// Setup CIRA with user/pass authentication (Somewhat difficult)
x += '<div id=dlgAddCira1 style=display:none>' + format("v", EscapeHtml(mesh.name));
if (serverinfo.mpspass) { x += (" verifieer bij de server met deze gebruikersnaam en wachtwoord." + '<br /><br />'); } else { x += (" verifieer bij de server met deze gebruikersnaam en elk wachtwoord." + '<br /><br />'); }
x += addHtmlValue("Hoofd certificaat", '<a href=\"' + "MeshServerRootCert.cer" + '\" download>' + "Hoofd certificaat bestand" + '</a>');
x += addHtmlValue("Gebruikersnaam", '<input style=width:230px readonly value="' + meshidx.substring(0, 16) + '" />');
if (serverinfo.mpspass) { x += addHtmlValue("wachtwoord", '<input style=width:230px readonly value="' + EscapeHtml(serverinfo.mpspass) + '" />'); }
if (serverinfo != null) { x += addHtmlValue("MPS Server", '<input style=width:230px readonly value="' + EscapeHtml(serverinfo.mpsname) + ':' + serverinfo.mpsport + '" />'); }
x += '</div>';
// Setup CIRA with certificate authentication (Really difficult, only if TLS offload is not used)
if ((features & 16) == 0) {
x += '<div id=dlgAddCira2 style=display:none>' + format("Om een nieuw Intel® AMT-apparaat toe te voegen aan apparaatgroep \"{0}\" met CIRA, laadt u het volgende certificaat als vertrouwde root in Intel AMT, verifieert u met een clientcertificaat met de volgende gemeenschappelijke naam en maakt u verbinding met de volgende server.", EscapeHtml(mesh.name)) + '<br /><br />';
x += addHtmlValue("Hoofd certificaat", '<a href="MeshServerRootCert.cer" download>' + "Hoofd certificaat bestand" + '</a>');
x += addHtmlValue("Organisatie", '<input style=width:230px readonly value="' + meshidx + '" />');
if (serverinfo != null) { x += addHtmlValue("MPS Server", '<input style=width:230px readonly value="' + EscapeHtml(serverinfo.mpsname) + ':' + serverinfo.mpsport + '" />'); }
x += '</div>';
}
setDialogMode(2, "Toevoegen Intel® AMT CIRA apparaat", 2, null, x, 'fileDownload');
Q('dlgAddCiraSel').focus();
return false;
}
function dlgAddCiraSelClick() {
var val = Q('dlgAddCiraSel').value;
QV('dlgAddCira0', val == 0);
QV('dlgAddCira1', val == 1);
QV('dlgAddCira2', val == 2);
}
// Return true is the input string looks like an email address
function checkEmail(str) {
var x = str.split('@');
var ok = ((x.length == 2) && (x[0].length > 0) && (x[1].split('.').length > 1) && (x[1].length > 2));
if (ok == true) { var y = x[1].split('.'); for (var i in y) { if (y[i].length == 0) { ok = false; } } }
return ok;
}
function inviteAgentToMesh(meshid) {
if (xxdialogMode) return false;
var x = '', mesh = meshes[meshid];
if (features & 64) {
x += addHtmlValue("Type uitnodiging", '<select id=d2InviteType onchange=d2ChangedInviteType() style=width:236px><option value=0>Link invitation</option><option value=1>Email invitation</option></select>') + '<hr />';
x += '<div id=emailInviteDiv style=display:none>' + format("Nodig iemand uit om de mesh-agent te installeren. Er wordt een e-mail verzonden met de link naar de installatie van de mesh-agent voor de apparaatgroep \"{0}\".", EscapeHtml(mesh.name)) + '<br /><br />';
x += addHtmlValue("Naam (Optioneel)", '<input id=agentInviteName value="" style=width:230px maxlength=64 />');
x += addHtmlValue("Email", '<input id=agentInviteEmail style=width:230px placeholder=\"' + "voorbeeld@email.nl" + '\" onkeyup=validateAgentInvite()></input>');
x += addHtmlValue("Besturingssysteem", '<select id=agentInviteNameOs onchange=d2ChangedInviteType() style=width:236px><option value=4>' + "Verzend installatie link" + '</option><option value=0 selected>' + "Alle ondersteunde" + '</option><option value=1>' + "alleen Windows" + '</option><option value=3>' + "Apple MacOS alleen" + '</option><option value=2>' + "alleen Linux" + '</option></select>');
x += '<div id=d2agentexpirediv>';
x += addHtmlValue("Link vervaldatum", '<select id=agentInviteExpire style=width:236px><option value=1>' + "1 uur" + '</option><option value=8>' + "8 uur" + '</option><option value=24>' + "1 dag" + '</option><option value=168>' + "1 week" + '</option><option value=5040>' + "1 maand" + '</option><option value=0>' + "Ongelimiteerd" + '</option></select>');
x += '</div>';
x += addHtmlValue("Installatie type", '<select id=agentInviteType style=width:236px><option value=0>' + "Achtergrond en interactief" + '</option><option value=2>' + "Achtergrond alleen" + '</option><option value=1>' + "Alleen interactief" + '</option></select>');
x += addHtmlValue("Bericht" + '<br />' + "(optioneel)", '<textarea id=agentInviteMessage value="" style=width:230px;height:100px;resize:none maxlength=1024 /></textarea>');
x += '</div>';
}
x += '<div id=urlInviteDiv>' + format("Nodig iemand uit om de mesh-agent te installeren door een uitnodigingslink te delen. Deze koppeling verwijst de gebruiker naar installatie-instructies voor de apparaatgroep \"{0}\". De link is openbaar en er is geen account voor deze server nodig.", EscapeHtml(mesh.name)) + '<br /><br />';
x += addHtmlValue("Link vervaldatum", '<select id=d2inviteExpire style=width:236px onchange=d2RequestInvitationLink()><option value=1>' + "1 uur" + '</option><option value=8>' + "8 uur" + '</option><option value=24>' + "1 dag" + '</option><option value=168>' + "1 week" + '</option><option value=5040>' + "1 maand" + '</option><option value=0>' + "Ongelimiteerd" + '</option></select>');
x += '<div id=agentInvitationLinkDiv style="text-align:center;font-size:large;margin:16px;display:none"><a href=# id=agentInvitationLink target="_blank" style=cursor:pointer></a> <img src=images/link4.png height=10 width=10 title=\"' + "Kopieer link naar het klembord" + '\" style=cursor:pointer onclick=d2CopyInviteToClip()></div></div>';
setDialogMode(2, "Nodig uit", 3, performAgentInvite, x, meshid);
if (features & 64) { Q('d2InviteType').focus(); d2ChangedInviteType(); } else { Q('d2inviteExpire').focus(); validateAgentInvite(); }
d2RequestInvitationLink();
return false;
}
function d2RequestInvitationLink() {
meshserver.send({ action: 'createInviteLink', meshid: xxdialogTag, expire: parseInt(Q('d2inviteExpire').value), flags: 0 });
}
function d2ChangedInviteType() {
QV('urlInviteDiv', Q('d2InviteType').value == 0);
QV('d2agentexpirediv', Q('agentInviteNameOs').value == 4);
QV('emailInviteDiv', Q('d2InviteType').value == 1);
validateAgentInvite();
}
function d2CopyInviteToClip() { copyTextToClip(Q('agentInvitationLink').href); }
function validateAgentInvite() {
if ((features & 64) && (Q('d2InviteType').value == 1)) {
QE('idx_dlgOkButton', checkEmail(Q('agentInviteEmail').value));
QV('idx_dlgCancelButton', true);
} else {
QE('idx_dlgOkButton', true);
QV('idx_dlgCancelButton', false);
}
}
function performAgentInvite(button, meshid) {
if ((features & 64) && (Q('d2InviteType').value == 1)) {
meshserver.send({ action: 'inviteAgent', meshid: meshid, email: Q('agentInviteEmail').value, name: Q('agentInviteName').value, os: Q('agentInviteNameOs').value, flags: Q('agentInviteType').value, msg: Q('agentInviteMessage').value, expire: parseInt(Q('agentInviteExpire').value) });
}
}
function addAgentToMesh(meshid) {
if (xxdialogMode) return false;
var mesh = meshes[meshid], x = '', installType = 0;
x += addHtmlValue("Besturingssysteem", '<select id=aginsSelect onchange=addAgentToMeshClick() style=width:236px><option value=0>' + "Windows" + '</option><option value=1>' + "Linux / BSD" + '</option><option value=2>' + "Apple MacOS" + '</option><option value=3>' + "Windows (deinstallatie)" + '</option><option value=4>' + "Linux / BSD (de-installeren)" + '</option></select>');
x += '<div id=aginsTypeDiv>';
x += addHtmlValue("Installatie type", '<select id=aginsType onchange=addAgentToMeshClick() style=width:236px><option value=0>' + "Achtergrond & interactief" + '</option><option value=2>' + "Achtergrond alleen" + '</option><option value=1>' + "Alleen interactief" + '</option></select>');
x += '</div><hr>';
// \/:*?"<>|
var meshfilename = mesh.name
meshfilename = meshfilename.split('\\').join('').split('/').join('').split(':').join('').split('*').join('').split('?').join('').split('"').join('').split('<').join('').split('>').join('').split('|').join('').split(' ').join('').split('\'').join('');
// Windows agent install
//x += "<div id=agins_windows>To add a new computer to device group \"" + EscapeHtml(mesh.name) + "\", download the mesh agent and configuration file and install the agent on the computer to manage.<br /><br />";
x += '<div id=agins_windows>' + format("Als u een nieuwe computer aan apparaatgroep \"{0}\" wilt toevoegen, downloadt u de mesh-agent en installeert u deze op de te beheren computer. Deze agent heeft server- en apparaatgroepinformatie erin ingebed.", EscapeHtml(mesh.name)) + '<br /><br />';
x += addHtmlValue("Mesh Agent", '<a id=aginsw32lnk href="meshagents?id=3&meshid=' + meshid.split('/')[2] + '&installflags=0" download onclick="setDialogMode(0)" title=\"' + "32bit versie van de MeshAgent" + '\">' + "Windows (.exe)" + '</a> <img src=images/link4.png height=10 width=10 title="Copy Windows 32bit agent URL to clipboard" style=cursor:pointer onclick=copyAgentUrl("meshagents?id=3&meshid=' + meshid.split('/')[2] + '&installflags=",1)>');
x += addHtmlValue("Mesh Agent", '<a id=aginsw64lnk href="meshagents?id=4&meshid=' + meshid.split('/')[2] + '&installflags=0" download onclick="setDialogMode(0)" title=\"' + "64bit versie van de MeshAgent" + '\">' + "Windows x64 (.exe)" + '</a> <img src=images/link4.png height=10 width=10 title="Copy Windows 64bit agent URL to clipboard" style=cursor:pointer onclick=copyAgentUrl("meshagents?id=4&meshid=' + meshid.split('/')[2] + '&installflags=",1)>');
if (debugmode > 0) { x += addHtmlValue("Instellingenbestand", '<a id=aginswmshlnk href="meshsettings?id=' + meshid.split('/')[2] + '&installflags=0" rel="noreferrer noopener" target="_blank">' + format("{0} instellingen (.msh)", EscapeHtml(mesh.name)) + '</a>'); }
x += '</div>';
// Linux agent install
x += '<div id=agins_linux style=display:none>' + format("Voer de volgende opdracht uit om een computer toe te voegen aan {0}. Root gegevens zijn nodig.", EscapeHtml(mesh.name)) + '<br />';
x += '<textarea id=agins_linux_area rows=2 cols=20 readonly=readonly style=width:100%;resize:none;height:120px;overflow:scroll;font-size:12px readonly></textarea>';
x += '<div style=\'font-size:x-small\'>' + "* Voor BSD, start eerst \"pkg install wget sudo bash\" ." + '</div></div>';
// MacOS agent install
x += '<div id=agins_osx style=display:none>' + format("Als u een nieuwe computer aan apparaatgroep \"{0}\" wilt toevoegen, downloadt u de mesh-agent en installeert u deze op de te beheren computer. In dit installatieprogramma van de agent zijn server- en apparaatgroepgegevens ingebed.", EscapeHtml(mesh.name)) + '<br /><br />';
x += addHtmlValue("Mesh Agent", '<a href="meshosxagent?id=16&meshid=' + meshid.split('/')[2] + '" rel="noreferrer noopener" target="_blank" title="64bit version of MacOS Mesh Agent">MacOS Agent (64bit)</a> <img src=images/link4.png height=10 width=10 title="' + "Kopieer MacOS agent link naar het klembord" + '" style=cursor:pointer onclick=copyAgentUrl("meshosxagent?id=16&meshid=' + meshid.split('/')[2] + '",0)>');
x += '</div>';
// Windows agent uninstall
x += '<div id=agins_windows_un style=display:none>' + "Om een mesh-agent te verwijderen, download het onderstaande bestand, voer het uit en klik op \"deinstalleer\"." + '<br /><br />';
x += addHtmlValue("Mesh Agent", '<a href="meshagents?id=3" download onclick="setDialogMode(0)" title="' + "32bit versie van de MeshAgent" + '">' + "Windows (.exe)" + '</a>');
x += addHtmlValue("Mesh Agent", '<a href="meshagents?id=4" download onclick="setDialogMode(0)" title="' + "64bit versie van de MeshAgent" + '">' + "Windows x64 (.exe)" + '</a>');
x += '</div>';
// Linux agent uninstall
x += '<div id=agins_linux_un style=display:none>' + "Voer de volgende opdracht uit om een mesh-agent te verwijderen. Root gegevens zijn nodig." + '<br />';
x += '<textarea id=agins_linux_area_un rows=2 cols=20 readonly=readonly style=width:100%;resize:none;height:120px;overflow:scroll;font-size:12px readonly></textarea>';
x += '</div>';
setDialogMode(2, "Toevoegen Mesh agent", 2, null, x, 'fileDownload');
var servername = serverinfo.name;
if ((servername.indexOf('.') == -1) || ((features & 2) != 0)) { servername = window.location.hostname; } // If the server name is not set or it's in LAN-only mode, use the URL hostname as server name.
var domainUrlNoSlash = domainUrl.substring(0, domainUrl.length - 1);
if (serverinfo.https == true)
{
var portStr = (serverinfo.port == 443)?'':(':' + serverinfo.port);
if ((features & 0x2000) == 0)
{
Q('agins_linux_area').value = '(wget https://' + servername + portStr + domainUrl + 'meshagents?script=1 --no-check-certificate -O ./meshinstall.sh || wget https://' + servername + portStr + domainUrl + 'meshagents?script=1 --no-proxy --no-check-certificate -O ./meshinstall.sh) && chmod 755 ./meshinstall.sh && sudo -E ./meshinstall.sh https://' + servername + portStr + domainUrlNoSlash + ' \'' + meshid.split('/')[2] + '\' || ./meshinstall.sh https://' + servername + portStr + domainUrlNoSlash + ' \'' + meshid.split('/')[2] + '\'\r\n';
Q('agins_linux_area_un').value = '(wget https://' + servername + portStr + domainUrl + 'meshagents?script=1 --no-check-certificate -O ./meshinstall.sh || wget https://' + servername + portStr + domainUrl + 'meshagents?script=1 --no-proxy --no-check-certificate -O ./meshinstall.sh) && chmod 755 ./meshinstall.sh && sudo ./meshinstall.sh uninstall\r\n';
}
else
{
// Server asked that agent be installed to preferably not use a HTTP proxy.
Q('agins_linux_area').value = 'wget https://' + servername + portStr + domainUrl + 'meshagents?script=1 --no-proxy --no-check-certificate -O ./meshinstall.sh && chmod 755 ./meshinstall.sh && sudo ./meshinstall.sh https://' + servername + portStr + domainUrlNoSlash + ' \'' + meshid.split('/')[2] + '\' || ./meshinstall.sh https://' + servername + portStr + domainUrlNoSlash + ' \'' + meshid.split('/')[2] + '\'\r\n';
Q('agins_linux_area_un').value = 'wget https://' + servername + portStr + domainUrl + 'meshagents?script=1 --no-proxy --no-check-certificate -O ./meshinstall.sh && chmod 755 ./meshinstall.sh && sudo ./meshinstall.sh uninstall\r\n';
}
}
else
{
var portStr = (serverinfo.port == 80) ? '' : (':' + serverinfo.port);
if ((features & 0x2000) == 0)
{
Q('agins_linux_area').value = '(wget http://' + servername + portStr + domainUrl + 'meshagents?script=1 -O ./meshinstall.sh || wget http://' + servername + portStr + domainUrl + 'meshagents?script=1 --no-proxy -O ./meshinstall.sh) && chmod 755 ./meshinstall.sh && sudo -E ./meshinstall.sh http://' + servername + portStr + domainUrlNoSlash + ' \'' + meshid.split('/')[2] + '\'\r\n';
Q('agins_linux_area_un').value = '(wget http://' + servername + portStr + domainUrl + 'meshagents?script=1 -O ./meshinstall.sh || wget http://' + servername + portStr + domainUrl + 'meshagents?script=1 --no-proxy -O ./meshinstall.sh) && chmod 755 ./meshinstall.sh && sudo ./meshinstall.sh uninstall\r\n';
}
else
{
// Server asked that agent be installed to preferably not use a HTTP proxy.
Q('agins_linux_area').value = 'wget http://' + servername + portStr + domainUrl + 'meshagents?script=1 --no-proxy -O ./meshinstall.sh && chmod 755 ./meshinstall.sh && sudo ./meshinstall.sh http://' + servername + portStr + domainUrlNoSlash + ' \'' + meshid.split('/')[2] + '\'\r\n';
Q('agins_linux_area_un').value = 'wget http://' + servername + portStr + domainUrl + 'meshagents?script=1 --no-proxy -O ./meshinstall.sh && chmod 755 ./meshinstall.sh && sudo ./meshinstall.sh uninstall\r\n';
}
}
Q('aginsSelect').focus();
addAgentToMeshClick();
return false;
}
function copyAgentUrl(url,addflag) {
var servername = serverinfo.name;
if ((servername.indexOf('.') == -1) || ((features & 2) != 0)) { servername = window.location.hostname; } // If the server name is not set or it's in LAN-only mode, use the URL hostname as server name.
var domainUrlNoSlash = domainUrl.substring(0, domainUrl.length - 1);
var portStr = (serverinfo.port == 443) ? '' : (':' + serverinfo.port);
var c = 'https://' + servername + portStr + domainUrl + url;
if (addflag == 1) c += Q('aginsType').value;
copyTextToClip(c);
}
function addAgentToMeshClick() {
var v = Q('aginsSelect').value;
QV('agins_windows', v == 0);
QV('agins_linux', v == 1);
QV('agins_osx', v == 2);
QV('agins_windows_un', v == 3);
QV('agins_linux_un', v == 4);
QV('aginsTypeDiv', v == 0);
// Fix the links if needed
Q('aginsw32lnk').href = (Q('aginsw32lnk').href.split('installflags=')[0]) + 'installflags=' + Q('aginsType').value;
Q('aginsw64lnk').href = (Q('aginsw64lnk').href.split('installflags=')[0]) + 'installflags=' + Q('aginsType').value;
if (debugmode > 0) { Q('aginswmshlnk').href = (Q('aginswmshlnk').href.split('installflags=')[0]) + 'installflags=' + Q('aginsType').value; }
}
function validateDeviceToMesh() {
QE('idx_dlgOkButton', (Q('dp1devicename').value.length > 0) && (passwordcheck(Q('dp1password').value)));
}
function addDeviceToMeshEx(button, meshid) {
var amtuser = Q('dp1username').value;
if (amtuser == '') amtuser = 'admin';
var host = Q('dp1hostname').value;
if (host == '') host = Q('dp1devicename').value;
meshserver.send({ action: 'addamtdevice', meshid: meshid, devicename: Q('dp1devicename').value, hostname: host, amtusername: amtuser, amtpassword: Q('dp1password').value, amttls: Q('dp1tls').value });
}
function deviceHeaderSet() {
if (deviceHeaderId == 0) { deviceHeaderId = 1; return; }
deviceHeaders['DevxHeader' + deviceHeaderId] = ((deviceHeaderTotal == 1) ? "1 apparaat" : format("{0} knooppunten", deviceHeaderTotal));
//var title = '';
//for (x in deviceHeaderCount) { if (title.length > 0) title += ', '; title += deviceHeaderCount[x] + ' ' + PowerStateStr2(x); }
//deviceHeadersTitles["DevxHeader" + deviceHeaderId] = title;
deviceHeaderId++;
deviceHeaderCount = {};
deviceHeaderTotal = 0;
}
var powerStateStrings = ['', '<span title=\"' + "Apparaat is ingeschakeld." + '\">' + "ingeschakeld" + '</span>', '<span title=\"' + "Apparaat bevindt zich in slaapstand (S1)." + '\">' + "Slapen" + '</span>', '<span title=\"' + "Apparaat bevindt zich in slaapstand (S2)." + '\">' + "Slapen" + '</span>', '<span title=\"' + "Apparaat bevindt zich in diepe slaapstand (S3)." + '\">' + "Slaapstand" + '</span>', '<span title=\"' + "Apparaat bevindt zich in de slaapstand (S4)." + '\">' + "Slaapstand" + '</span>', '<span title=\"' + "Apparaat is uitgeschakeld (S5)." + '\">' + "softwarematig uit" + '</span>', '<span title=\"' + "Apparaat is gedetecteerd, maar de stroomstatus kon niet worden verkregen." + '\">' + "Aanwezig" + '</span>'];
var powerStateStrings2 = ['', "Apparaat is ingeschakeld", "Apparaat bevindt zich in slaapstand (S1)", "Apparaat bevindt zich in slaapstand (S2)", "Apparaat bevindt zich in diepe slaapstand (S3)", "Apparaat is in slaapstand (S4)", "Apparaat is uitgeschakeld (S5)", "Apparaat is aanwezig, maar de stroomstatus kan niet worden bepaald"];
var powerColorTable = ['pwsTransparent', 'pwsBlack', 'pwsBlue', 'pwsBlue2', 'pwsLightblue', 'pwsBlueviolet', 'pwsDarkgreen', 'pwsLightseagreen', 'pwsLightseagreen2'];
function NodeStateStr(node) {
var states = [];
if (node.state > 0 && node.state < powerStatetable.length) state.push(powerStatetable[node.state]);
if (node.conn) {
if ((node.conn & 1) != 0) { states.push('<span title=\"' + "Mesh-agent is verbonden en klaar voor gebruik." + '\">' + "Agent" + '</span>'); }
if ((node.conn & 2) != 0) { states.push('<span title=\"' + "Intel® AMT CIRA is verbonden en klaar voor gebruik." + '\">' + "CIRA" + '</span>'); }
else if ((node.conn & 4) != 0) { states.push('<span title=\"' + "Intel® AMT is routeerbaar." + '\">' + "AMT" + '</span>'); }
if ((node.conn & 8) != 0) { states.push('<span title=\"' + "Mesh-agent is bereikbaar met een andere agent als relay." + '\">' + "Relay" + '</span>'); }
if ((node.conn & 16) != 0) { states.push('<span title=\"' + "MQTT verbinding met het apparaat is actief." + '\">' + "MQTT" + '</span>'); }
}
if ((node.pwr != null) && (node.pwr != 0)) { states.push(powerStateStrings[node.pwr]); }
return states.join(', ');
}
function PowerStateStr(x) {
if (x < powerStatetable.length) return powerStatetable[x];
return '';
}
function PowerStateStr2(x) {
if ((x != 0) && (x < powerStatetable.length)) return powerStatetable[x];
return "Onbekend";
}
function selectallButtonFunction() {
var elements = document.getElementsByClassName('DeviceCheckbox'), checkcount = 0;
for (var i=0;i<elements.length;i++) { if (elements[i].checked === true) checkcount++; }
for (var i=0;i<elements.length;i++) { elements[i].checked = (checkcount == 0); }
p1updateInfo();
}
function p1updateInfo() {
var elements = document.getElementsByClassName('DeviceCheckbox'), checkcount = 0;
for (var i=0;i<elements.length;i++) { if (elements[i].checked === true) { checkcount++; } }
if (checkcount > 0) {
QE('GroupActionButton', true);
Q('SelectAllButton').value = "Selecteer niets";
QV('cxmgroupsplit', true);
QV('cxmdesktop', true);
} else {
QE('GroupActionButton', false);
Q('SelectAllButton').value = "Selecteer alles";
QV('cxmgroupsplit', false);
QV('cxmdesktop', false);
}
}
function groupActionFunction() {
var addedOptions = '', nodeids = getCheckedDevices();
// Check if any of the selected devices have a MQTT connection active
if (features & 0x00400000) {
for (var i in nodeids) { if ((getNodeFromId(nodeids[i]).conn & 16) != 0) { addedOptions += '<option value=103>' + "Verzend MQTT bericht" + '</option>'; break; } }
}
// Display the "Uninstall Agent" option if allowed and we selected connected devices.
for (var i in nodeids) {
var node = getNodeFromId(nodeids[i]);
var mesh = meshes[node.meshid];
var meshrights = mesh.links[userinfo._id].rights;
if (((node.conn & 1) != 0) && ((meshrights & 32768) != 0)) { addedOptions += '<option value=104>' + "deinstallatie agent" + '</option>'; break; }
}
var x = "Selecteer een bewerking die op alle geselecteerde apparaten moet worden uitgevoerd. Acties worden alleen uitgevoerd met de juiste rechten." + '<br /><br />';
x += addHtmlValue("Operatie", '<select id=d2groupop><option value=100>' + "apparaat wekken" + '</option><option value=4>' + "Slaap apparaten" + '</option><option value=3>' + "Reset apparaten" + '</option><option value=2>' + "Schakel apparaten uit" + '</option><option value=102>' + "Verplaatsen naar apparaatgroep" + '</option>' + addedOptions + '<option value=101>' + "Verwijder apparaten" + '</option></select>');
setDialogMode(2, "Groepsactie", 3, groupActionFunctionEx, x);
}
// Get the list of checked devices, removes any duplicates.
function getCheckedDevices() {
var nodeids = [], elements = document.getElementsByClassName("Apparaat Checkbox"), checkcount = 0;
for (var i=0;i<elements.length;i++) { if (elements[i].checked) { if (elements[i].value) { var nid = elements[i].value.substring(6); if (nodeids.indexOf(nid) == -1) { nodeids.push(nid); } } } }
return nodeids;
}
function groupActionFunctionEx() {
var op = Q('d2groupop').value;
if (op == 100) {
// Group wake
meshserver.send({ action: 'wakedevices', nodeids: getCheckedDevices() });
} else if (op == 101) {
// Group delete, ask for confirmation
var x = "Bevestig geselecteerde apparaten verwijderen?" + '<br /><br />';
x += '<label><input id=d2check type=checkbox onchange=d2groupActionFunctionDelEx() />' + "Bevestig" + '</label>';
setDialogMode(2, "Verwijder apparaten", 3, groupActionFunctionDelEx, x);
QE('idx_dlgOkButton', false);
} else if (op == 102) {
// Move computers to a different group
p10showChangeGroupDialog(getCheckedDevices());
} else if (op == 103) {
// Send MQTT Message
p10showSendMqttMsgDialog(getCheckedDevices());
} else if (op == 104) {
// Uninstall agent
p10showSendUninstallAgentDialog(getCheckedDevices());
} else {
// Power operation
meshserver.send({ action: 'poweraction', nodeids: getCheckedDevices(), actiontype: parseInt(op) });
}
}
function d2groupActionFunctionDelEx() { QE('idx_dlgOkButton', Q('d2check').checked); }
function groupActionFunctionDelEx() { meshserver.send({ action: 'removedevices', nodeids: getCheckedDevices() }); }
function onSortSelectChange(skipsave) {
sort = document.getElementById('sortselect').selectedIndex;
if (!skipsave) { putstore('sort', sort); }
}
function meshSort(a, b) { if (a.meshnamel > b.meshnamel) return 1; if (a.meshnamel < b.meshnamel) return -1; if (a.meshid == b.meshid) { if (showRealNames == true) { if (a.rnamel > b.rnamel) return 1; if (a.rnamel < b.rnamel) return -1; return 0; } else { if (a.namel > b.namel) return 1; if (a.namel < b.namel) return -1; return 0; } } return 0; }
function powerSort(a, b) { var ap = a.pwr?a.pwr:0; var bp = b.pwr?b.pwr:0; if (ap > bp) return -1; if (ap < bp) return 1; if (ap == bp) { if (showRealNames == true) { if (a.rnamel > b.rnamel) return 1; if (a.rnamel < b.rnamel) return -1; return 0; } else { if (a.namel > b.namel) return 1; if (a.namel < b.namel) return -1; return 0; } } return 0; }
function deviceSort(a, b) { if (a.namel > b.namel) return 1; if (a.namel < b.namel) return -1; return 0; }
function deviceHostSort(a, b) { if (a.rnamel > b.rnamel) return 1; if (a.rnamel < b.rnamel) return -1; return 0; }
function onSearchFocus(x) { searchFocus = x; }
function onMapSearchFocus(x) { mapSearchFocus = x; }
function onUserSearchFocus(x) { userSearchFocus = x; }
function onConsoleFocus(x) { consoleFocus = x; }
function onSearchInputChanged() {
var x = Q('SearchInput').value.toLowerCase().trim(); putstore('_search', x);
var userSearch = null, ipSearch = null, groupSearch = null;
if (x.startsWith('user:')) { userSearch = x.substring(5); }
else if (x.startsWith('u:')) { userSearch = x.substring(2); }
else if (x.startsWith('ip:')) { ipSearch = x.substring(3); }
else if (x.startsWith('group:')) { groupSearch = x.substring(6); }
else if (x.startsWith('g:')) { groupSearch = x.substring(2); }
if (x == '') {
// No search
for (var d in nodes) { nodes[d].v = true; }
} else if (ipSearch != null) {
// IP address search
for (var d in nodes) { nodes[d].v = ((nodes[d].ip != null) && (nodes[d].ip.indexOf(ipSearch) >= 0)); }
} else if (groupSearch != null) {
// Group filter
for (var d in nodes) { nodes[d].v = (meshes[nodes[d].meshid].name.toLowerCase().indexOf(groupSearch) >= 0); }
} else if (userSearch != null) {
// User search
for (var d in nodes) {
nodes[d].v = false;
if (nodes[d].users && nodes[d].users.length > 0) { for (var i in nodes[d].users) { if (nodes[d].users[i].toLowerCase().indexOf(userSearch) >= 0) { nodes[d].v = true; } } }
}
} else {
// Device name search
try {
var rs = x.split(/\s+/).join('|'), rx = new RegExp(rs); // In some cases (like +), this can throw an exception.
for (var d in nodes) {
nodes[d].v = (rx.test(nodes[d].name.toLowerCase())) || (nodes[d].rnamel != null && rx.test(nodes[d].rnamel.toLowerCase()));
if ((nodes[d].v == false) && nodes[d].tags) {
for (var s in nodes[d].tags) {
if (rx.test(nodes[d].tags[s].toLowerCase())) {
nodes[d].v = true;
break;
} else {
nodes[d].v = false;
}
}
}
}
} catch (ex) { for (var d in nodes) { nodes[d].v = true; } }
}
}
var contextelement = null;
function handleContextMenu(event) {
hideContextMenu();
var scrollLeft = (window.pageXOffset !== null) ? window.pageXOffset : (document.documentElement || document.body.parentNode || document.body).scrollLeft;
var scrollTop = (window.pageYOffset !== null) ? window.pageYOffset : (document.documentElement || document.body.parentNode || document.body).scrollTop;
var elem = document.elementFromPoint(event.pageX - scrollLeft, event.pageY - scrollTop);
if (elem && elem != null && elem.id == 'connectbutton2' && currentNode && currentNode.agent && (currentNode.agent.id > 0) && (currentNode.agent.id < 5)) {
contextelement = elem;
var contextmenudiv = document.getElementById('termShellContextMenu');
contextmenudiv.style.left = event.pageX + 'px';
contextmenudiv.style.top = event.pageY + 'px';
contextmenudiv.style.display = 'block';
} else if (elem && elem != null && elem.id == 'connectbutton2' && currentNode && currentNode.agent && (currentNode.agent.id > 4)) {
contextelement = elem;
var contextmenudiv = document.getElementById('termShellContextMenuLinux');
contextmenudiv.style.left = event.pageX + 'px';
contextmenudiv.style.top = event.pageY + 'px';
contextmenudiv.style.display = 'block';
} else if (elem && elem != null && elem.id == 'MxMESH') {
contextelement = elem;
var contextmenudiv = document.getElementById('meshContextMenu');
contextmenudiv.style.left = event.pageX + 'px';
contextmenudiv.style.top = event.pageY + 'px';
contextmenudiv.style.display = 'block';
/*} else if (elem && elem != null && elem.classList.contains('pluginTab')) {
contextelement = elem;
var contextmenudiv = document.getElementById('pluginTabContextMenu');
contextmenudiv.style.left = event.pageX + 'px';
contextmenudiv.style.top = event.pageY + 'px';
contextmenudiv.style.display = 'block';*/
} else {
while (elem && elem != null && elem.id != 'devs') { elem = elem.parentElement; }
if (!elem || elem == null) return true;
contextelement = elem;
var contextmenudiv = document.getElementById('contextMenu');
contextmenudiv.style.left = event.pageX + 'px';
contextmenudiv.style.top = event.pageY + 'px';
contextmenudiv.style.display = 'block';
// Get the node and set the menu options
var nodeid = contextelement.children[1].attributes.onclick.value;
var node = getNodeFromId(nodeid.substring(12, nodeid.length - 18));
var mesh = meshes[node.meshid];
var meshlinks = mesh.links[userinfo._id];
var meshrights = meshlinks.rights;
var consoleRights = ((meshrights & 16) != 0);
// Check if we have terminal and file access
var terminalAccess = ((meshrights == 0xFFFFFFFF) || ((meshrights & 512) == 0));
var fileAccess = ((meshrights == 0xFFFFFFFF) || ((meshrights & 1024) == 0));
QV('cxdesktop', ((mesh.mtype == 1) || (node.agent == null) || (node.agent.caps == null) || ((node.agent.caps & 1) != 0) || (node.intelamt && (node.intelamt.state == 2))) && ((meshrights & 8) || (meshrights & 256)));
QV('cxterminal', ((mesh.mtype == 1) || (node.agent == null) || (node.agent.caps == null) || ((node.agent.caps & 2) != 0) || (node.intelamt && (node.intelamt.state == 2))) && (meshrights & 8) && terminalAccess);
QV('cxfiles', ((mesh.mtype == 2) && ((node.agent == null) || (node.agent.caps == null) || ((node.agent.caps & 4) != 0))) && (meshrights & 8) && fileAccess);
QV('cxevents', (node.intelamt != null) && ((node.intelamt.state == 2) || (node.conn & 2)) && (meshrights & 8));
QV('cxconsole', (consoleRights && (mesh.mtype == 2) && ((node.agent == null) || (node.agent.caps == null) || ((node.agent.caps & 8) != 0))) && (meshrights & 8));
}
return haltEvent(event);
}
function cmaction(action,event) {
var nodeid = contextelement.children[1].attributes.onclick.value;
nodeid = nodeid.substring(12, nodeid.length - 18);
if (action == 7) { Q('viewselect').value = 3; Q('viewselect').onchange(); Q('autoConnectDesktopCheckbox').checked = true; Q('autoConnectDesktopCheckbox').onclick(); } // Multi-Desktop
if ((action > 0) && (action < 7)) {
var panel = [0, 10, 12, 11, 13, 16, 15][action]; // (invalid), General, Desktop, Terminal, Files, Events, Console
if (event && (event.shiftKey == true)) {
// Open the device in a different tab
window.open(window.location.origin + '?node=' + nodeid.split('/')[2] + '&viewmode=' + panel + '&hide=16', 'meshcentral:' + nodeid);
} else {
// Go to the right panel
gotoDevice(nodeid, panel);
// If possible, connect...
var mesh = meshes[currentNode.meshid];
if ((currentNode.conn & 1) && (mesh.mtype == 2)) {
if ((panel == 11) && (desktop == null) && (currentNode.agent.caps & 1)) { connectDesktop(null, 3); } // Desktop
if ((panel == 12) && (terminal == null) && (currentNode.agent.caps & 2)) { connectTerminal(null, 1); } // Terminal
if ((panel == 13) && (files == null)) { connectFiles(null); } // files
}
}
}
}
function cmmeshaction(action) {
var meshid = contextelement.attributes.onclick.value.substring(10, contextelement.attributes.onclick.value.length - 2);
var elements = document.getElementsByClassName('DeviceCheckbox');
if ((action == 1) || (action == 2)) {
for (var i = 0; i < elements.length; i++) {
if ((elements[i].attributes) && (elements[i].attributes['class']['value'].split(' ')[0] == meshid)) { elements[i].checked = (action == 1); }
}
}
//if (action == 3) { window.location = "multidesktop.aspx?mesh=" + meshid + "&auto=1"; }
p1updateInfo();
}
function cmtermaction(action) {
connectTerminal(null, 1, { protocol: action });
}
/*
function pluginTabClose() {
var pluginTab = contextelement;
var pname = pluginTab.getAttribute('x-data-plugin-sname');
var pdiv = Q('plugin-'+pname);
pdiv.parentNode.removeChild(pdiv);
pluginTab.parentNode.removeChild(pluginTab);
QV('p42', true);
goPlugin(-1);
}
*/
function hideContextMenu() {
QV('contextMenu', false);
QV('meshContextMenu', false);
QV('termShellContextMenu', false);
QV('termShellContextMenuLinux', false);
//QV('pluginTabContextMenu', false);
contextelement = null;
}
//
// DEVICES MAP
//
// Maps code starts from here. Initialize all the variables
var xxmap = {
map: null,
contextmenu: null,
activeInteractions: [], // Save Modified features in this list
showindex: 0,
markersSource: null, // Initialize a Source Vector
markersLayer: null,
mapLayer: null, // Create a tile and use OSM source
mapView: null, // Sets the initial view
}
{{{StartGeoLocationJS}}}
// Add a feature for every Node and change style if connection status changes
function updateMapMarkers(selectedMesh) {
if ((xxmap != null) && (xxmap.map == null)) { try { loadmap(); } catch (ex) { console.error('loadmap() exception', ex); } }
if (xxmap == null) return;
var boundingBox = null;
for (var i in nodes) {
try {
var loc = map_parseNodeLoc(nodes[i]), feature = xxmap.markersSource.getFeatureById(nodes[i]._id);
if ((loc != null) && ((nodes[i].meshid == selectedMesh) || (selectedMesh == null))) { // Draw markers for devices with locations
var lat = loc[0], lon = loc[1], type = loc[2];
if (boundingBox == null) { boundingBox = [ lat, lon, lat, lon, 0 ]; } else { if (lat < boundingBox[0]) { boundingBox[0] = lat; } if (lon < boundingBox[1]) { boundingBox[1] = lon; } if (lat > boundingBox[2]) { boundingBox[2] = lat; } if (lon > boundingBox[3]) { boundingBox[3] = lon; } }
if (feature == null) { addFeature(nodes[i]); boundingBox[4] = 1; } else { updateFeature(nodes[i], feature); feature.setStyle(markerStyle(nodes[i], loc[2])); } // Update Feature
} else {
if (feature) { xxmap.markersSource.removeFeature(feature); }
}
} catch (ex) { console.error('updateMapMarkers() exception', ex, JSON.stringify(nodes[i])); }
}
return boundingBox;
}
// Show node details on hovering over a feature
var map_cm_popup = new ol.Overlay({ element: Q('xmap-info-window'), positioning: 'bottom-center', stopEvent: false });
// Edit Marker item
var map_cm_editMarker = { text: "Wijzig knooppuntlocatie", callback: function (obj) { modifyMarkerloc(obj.data); } };
// Clear Marker item
var map_cm_clearMarker = { text: "Verwijder knooppuntlocatie", callback: function (obj) {
meshserver.send({ action: 'changedevice', nodeid: obj.data.a, userloc: [] }); // Clear the user position marker
}};
// Save Marker item
var map_cm_saveMarker = { text: "Knooppuntlocatie opslaan", callback: function (obj) { saveMarkerloc(obj.data); } };
// Build a context menu for a feature
var map_cm_nodemenu_items = [
{ text: "Algemene informatie", callback: function (obj) { if (obj.data !=null) { gotoDevice(obj.data, 10); } } },
{ text: "Bureaublad", callback: function (obj) { if (obj.data !=null) { gotoDevice(obj.data, 11); } } },
{ text: "Terminal", callback: function (obj) { if (obj.data !=null) { gotoDevice(obj.data, 12); } } },
{ text: "Intel&reg; AMT", callback: function (obj) { if (obj.data !=null) { gotoDevice(obj.data, 14); } } },
'-',
{ text: "Inzoomen tot maat", callback: function(obj) { var coords = obj.data.getGeometry().getCoordinates(); zoomToLocation(coords, 19); } },
{ text: "Uitzoomen naar maat", callback: function(obj) { var coords = obj.data.getGeometry().getCoordinates(); zoomToLocation(coords, 2); } }
];
// Context menu for clicks other than on feature
var contextmenu_items = [
{ text: "Ververs", callback: function () { refreshMap(true, true); } },
{ text: "Zoom in op maat", callback: function () { zoomToFitExtent(); } },
{ text: "Centreer kaart hier", callback: function(obj) { xxmap.mapView.animate({ center: obj.coordinate } ); } },
{ text: "Plaats hier een knooppunt", callback: function(obj) { placeNode(obj.coordinate); } }
];
function stringToIntHash(str) {
var hash = 0, i;
for (i = 0; i < str.length; i++) { hash = ((hash << 5) - hash) + str.charCodeAt(i); hash |= 0; }
return hash;
};
// Get the lat/lon from a node
function map_parseNodeLoc(node) {
var loc = null, t = 0;
if (node.iploc) { loc = node.iploc; t = 1; }
if (node.wifiloc) { loc = node.wifiloc; t = 2; }
if (node.gpsloc) { loc = node.gpsloc; t = 3; }
if (node.userloc) { loc = node.userloc; t = 4; }
if ((loc == null) || (typeof loc != 'string')) return null;
loc = loc.split(',');
if (t == 1) {
// If this is IP location, randomize the position a little.
return [ parseFloat(loc[0]) + (stringToIntHash(node._id.substring(0, 20)) / 100000000000), parseFloat(loc[1]) + (stringToIntHash(node._id.substring(20)) / 100000000000), t ];
} else {
// Return the real position
return [ parseFloat(loc[0]), parseFloat(loc[1]), t ];
}
}
// Load the entire map
function loadmap() {
if (xxmap == null) return;
if ((features & 0x8000) == 0) { xxmap = null; return; } // Geolocation not supported
QV('viewselectmapoption', true);
QV('devViewButton4', true);
try {
// Initialize a Source Vector
xxmap.markersSource = new ol.source.Vector();
xxmap.markersLayer = new ol.layer.Vector({
source: xxmap.markersSource
});
// Create a tile and use OSM source
xxmap.mapLayer = new ol.layer.Tile({ source: new ol.source.OSM() });
xxmap.mapView = new ol.View({ // Set the initial view
center: ol.proj.transform([0, 0], 'EPSG:4326', 'EPSG:3857'),
zoom: 2,
minZoom: 2,
maxZoom: 20,
extent: ol.proj.transformExtent([-100000, -69.55, 100000, 69.55], 'EPSG:4326', 'EPSG:3857')
});
xxmap.map = new ol.Map({
target: 'xdevicesmap',
layers: [xxmap.mapLayer, xxmap.markersLayer],
view: xxmap.mapView
});
xxmap.map.addOverlay(map_cm_popup);
// Goto information tab if a user clicks on a feature
xxmap.map.on('click', function(evt) {
var feature = xxmap.map.forEachFeatureAtPixel(evt.pixel, function(feat, layer) { return feat; });
if (feature) {
var nodeid = feature.getId();
if (nodeid != null) { gotoDevice(nodeid, 10); } // Goto general info tab
else { // For pointer
var nodeFeatgoto = getCorrespondingFeature(feature); gotoDevice(nodeFeatgoto.getId(), 10);
}
}
});
// On hover feature show the name of the node. Also add pointer style
xxmap.map.on('pointermove', function(evt) {
var feature = xxmap.map.forEachFeatureAtPixel(evt.pixel, function(feat, layer) { return feat; });
if (feature) {
xxmap.map.getTargetElement().style.cursor = 'pointer';
var coord = feature.getGeometry().getCoordinates();
// map_cm_popup.setPosition(evt.coordinate);
map_cm_popup.setPosition(coord);
var featid = feature.getId();
if (featid) {
QH('xmap-info-window', feature.get('name'));
} else {
var nodeFeat = getCorrespondingFeature(feature); // Return the node feature associated to pointer.
QH('xmap-info-window', nodeFeat.get('name'));
}
} else {
xxmap.map.getTargetElement().style.cursor = '';
QH('xmap-info-window', '');
}
});
// Initialize context menu for openlayers
var contextmenu = new ContextMenu({
width: 160,
defaultItems: false, // defaultItems are Zoom In/Zoom Out
items: contextmenu_items
});
// On right click open the context menu
contextmenu.on("Open", function (evt) {
var feature = xxmap.map.forEachFeatureAtPixel(evt.pixel, function(ft, l){ return ft; });
xxmap.contextmenu.clear(); //Clear the context menu
if (feature) {
var featId = feature.getId();
if (featId) { addContextMenuItems(feature); } // Node feature will have an id
else { // If the feature is a pointer, Get its corresponding Node feature
var nodeFeature = getCorrespondingFeature(feature); //return the node feature associated to pointer.
if (nodeFeature) { addContextMenuItems(nodeFeature); }
else{ xxmap.contextmenu.extend(contextmenu_items); }
}
}
else { xxmap.contextmenu.extend(contextmenu_items); }
});
if (xxmap.contextmenu == null) { xxmap.contextmenu = contextmenu; }
xxmap.map.addControl(xxmap.contextmenu);
//addMeshOptions(); // Adds Mesh names to mesh dropdown
} catch (ex) {
console.log(ex);
QV('viewselectmapoption', false);
QV('devViewButton4', false);
xxmap = null;
}
}
// Add feature on to Map for a Node
function addFeature(node, lat, lon) {
var existingfeature = getModifiedFeature(node._id); // Check if Corresponding feature was Modified ( Modifed feature are in active interactions list)
if (existingfeature) { xxmap.markersSource.addFeature(existingfeature); } // Add that existing feature
else { // Add new feature for this node
if (!lat && !lon) { var loc = map_parseNodeLoc(node); lat = loc[0]; lon = loc[1]; }
// Fix the longiture and send an event to patch the db to correct coordinate format. It will cause second unnecessary updateFeature on this node to the map.
if (lon > 180) { lon = 180 - lon; meshserver.send({ action: 'changedevice', nodeid: node._id, userloc: [ lat, lon ] }); }
if ((lat < 90) && (lat > -90) && (lon < 180) && (lon > -180)) { // Check valid lat/lon
var feature = new ol.Feature({ geometry: new ol.geom.Point(ol.proj.transform([lon, lat], 'EPSG:4326','EPSG:3857')), name: node.name, status: node.conn, lat: lat, lon: lon });
feature.setId(node._id); // Set id for the device as nodeid
feature.setStyle(markerStyle(node));
xxmap.markersSource.addFeature(feature); // Add the feature to Marker Source
}
}
}
// Removing any feature from map
function removeFeature(node) {
var feature = xxmap.markersSource.getFeatureById(node._id);
if (feature) { xxmap.markersSource.removeFeature(feature); }
}
// Update feature
function updateFeature(node, feature) {
if (node.conn != feature.get('status') ) { // Update status if changed
feature.set('status',node.conn)
feature.setStyle(markerStyle(node));
}
// Since this is IP address location, add some fixed randomness to the location. Avoid pin pile-up.
var loc = map_parseNodeLoc(node);
if (loc != null) {
var lat = loc[0], lon = loc[1];
if ((lat != feature.get('lat')) || (lon != feature.get('lon'))) { // Update lat and lon if changed
feature.set('lat', lat); feature.set('lon', lon);
var modifiedCoordinates = ol.proj.transform([parseFloat(lon), parseFloat(lat)], 'EPSG:4326', 'EPSG:3857');
feature.getGeometry().setCoordinates(modifiedCoordinates);
}
}
if (node.name != feature.get('name') ) { feature.set('name', node.name); } // Update name
}
// Enable dragging of a marker after edit option is clicked in context menu
function modifyMarkerloc(ft){
var featid = ft.getId();
if (featid) {
ft.setStyle(markerStyle(getNodeFromId(ft.a), 4)); // Switch to a user marker
if ( !getActiveInteractions(ft)) {
var dragInteration = new ol.interaction.Modify({
features: new ol.Collection([ft]),
pixelTolerance: 10
});
xxmap.activeInteractions.push({ featureid: featid, feature:ft, interaction: dragInteration }); // Also keep track of Interactions
xxmap.map.addInteraction(dragInteration);
}
}
}
// This will be called when save location option is clicked in context menu
function saveMarkerloc(ft){
var featid = ft.getId()
if (featid) {
var actInteraction = getActiveInteractions(ft);
if (actInteraction) { // Check if the interaction exists
xxmap.map.removeInteraction(actInteraction); //Clear Interaction for that node
removeInteraction(featid);
var coord = ft.getGeometry().getCoordinates();
var v = ol.proj.transform(coord, 'EPSG:3857', 'EPSG:4326');
if (v[0] > 180) { v[0] = 180 - v[0]; }
var vx = [ v[1], v[0] ]; // Flip the coordinates around, lat/long
meshserver.send({ action: 'changedevice', nodeid: featid, userloc: vx }); // Send them to server to save changes
}
}
}
// Style the Markers
function markerStyle(node, type) {
if (type == null) {
type = 0;
if (node.iploc) { type = 1; }
if (node.wifiloc) { type = 2; }
if (node.gpsloc) { type = 3; }
if (node.userloc) { type = 4; }
}
var types = ['', '-ip','-wifi','-gps','-user'];
var color = connStateColor(node);
var style = new ol.style.Style({
image: new ol.style.Icon({ color: color, anchor: [0.5, 1], src: 'images/mapmarker' + types[type] + '.png' })
//stroke: new ol.style.Stroke({ color: '#000', width: 20 })
//text: new ol.style.Text({ text: 'bob!', textAlign: 'right', offsetX: -10, fill: new ol.style.Fill({ color: '#000' }), stroke: new ol.style.Stroke({ color: '#fff', width: 2 }) })
});
//deviceMark.setStyle(new ol.style.Style({
// text: new ol.style.Text({
// //font: '12px helvetica,sans-serif',
// text: currentNode.name,
// textAlign: 'right',
// offsetX: -10,
// fill: new ol.style.Fill({ color: '#000' }),
// stroke: new ol.style.Stroke({ color: '#fff', width: 2 })
// }),
// image: new ol.style.Icon(({ color: [113, 140, 0], src: 'images/dot.png' })) }));
return [ style ];
}
// TODO: Add more connection status types. Currently we only change color if connection status changes
function connStateColor(nodeConn){
if (nodeConn.conn == 1 || nodeConn.conn == 3 || nodeConn.conn == 5) { return '#00ffdd'; } // Green for connected devices
return '#C70039'; // Red if the Agent is not connected
}
// Add save/edit option to context menu
function addContextMenuItems(feature) {
if (getActiveInteractions(feature)) { // If this feature is modified then display save option in contextmenu
map_cm_saveMarker.data = feature;
xxmap.contextmenu.push(map_cm_saveMarker);
} else {
map_cm_editMarker.data = feature;
xxmap.contextmenu.push(map_cm_editMarker);
var node = getNodeFromId(feature.a);
if (node.userloc) {
map_cm_clearMarker.data = feature;
xxmap.contextmenu.push(map_cm_clearMarker);
}
}
map_cm_nodemenu_items.forEach(function (item){
if (item.text == "Inzoomen tot maat" || item.text == "Uitzoomen naar maat") { item.data = feature; }
else { if (item != '-') { item.data = feature.getId(); } }
});
xxmap.contextmenu.extend(map_cm_nodemenu_items);
}
// Return a active Interaction if it exists in activeInteractions list
function getActiveInteractions(feature) {
var featid = feature.getId();
for (var i = 0; i < xxmap.activeInteractions.length; i++) {
if (xxmap.activeInteractions[i].featureid == featid) { return xxmap.activeInteractions[i].interaction; }
}
return false;
}
// Return Modified feature based on Id
function getModifiedFeature(featid) {
if (featid) {
for (var i = 0; i < xxmap.activeInteractions.length; i++) {
if (xxmap.activeInteractions[i].featureid == featid) { return xxmap.activeInteractions[i].feature; }
}
}
return null;
}
// Remove Interaction
function removeInteraction(ftid) {
var index = -1;
for (var i = 0; i < xxmap.activeInteractions.length; i++) {
if (xxmap.activeInteractions[i].featureid === ftid) { index = i; break; }
}
if (index >= 0) { xxmap.activeInteractions.splice(index, 1); }
}
// Check if pointer coordinates are equal to features and return node feature
function getCorrespondingFeature(pointerFeat) {
var pointerCoord = pointerFeat.getGeometry().getCoordinates();
for (var i = 0; i < xxmap.activeInteractions.length ; i++) {
var modifiedFeatures = xxmap.activeInteractions[i].feature;
var fearCoord = modifiedFeatures.getGeometry().getCoordinates();
if (fearCoord[0].toFixed(5) == pointerCoord[0].toFixed(5) && fearCoord[1].toFixed(5) == pointerCoord[1].toFixed(5) ) { return modifiedFeatures; }
}
return null;
}
// Refresh the map and clear list
function refreshMap(reset, rebound){
if (reset) {
xxmap.map.setTarget(null);
xxmap.map = null;
xxmap.markersSource = null;
xxmap.mapView = null;
xxmap.mapLayer = null;
xxmap.activeInteractions = []; // Clear Active Interaction list
}
//clearMeshOptions();
//onSelectMeshChange();
var box = updateMapMarkers();
if ((box != null) && (rebound || (box[4] == 1))) {
var clat = (box[0] + box[2]) / 2;
var clon = (box[1] + box[3]) / 2;
var cscale = Math.max(Math.abs(box[0] - box[2]), Math.abs(box[1] - box[3]));
var view = xxmap.map.getView();
view.setCenter(ol.proj.transform([clon, clat], 'EPSG:4326', 'EPSG:3857'));
var i = 360, j = -2;
while (i > cscale) { j++; i = i / 2; }
view.setZoom(j);
}
}
// Called When Place a node option is clicked from context menu
function placeNode(coords) {
if (xxdialogMode) return;
var x = '<div style=margin-bottom:6px><label for=selectnode-search>' + "Zoeken" + '</label>&nbsp&nbsp<input type=text placeholder="' + "Apparaat naam" + '" id="selectnode-search" onchange=onPlaceNodeInputChange() onkeyup=onPlaceNodeInputChange() autocomplete=off style=width:120px></div><div id=placenode style="height:254px;overflow-y:auto;width:100%;margin:12px 1px 4px 1px;"><div id=noNodesMapPlace style=text-align:center;width:100%;display:none>' + "Geen apparaten gevonden." + '</div>';
for (var i in nodes) {
x += '<div class=noselect id=' + nodes[i]._id + '-rowid onclick=selectNodeToPlace(event,\''+ nodes[i]._id +'\') style=background-color:lightgray;margin-bottom:4px;border-radius:2px><input name=PlaceMapDeviceCheckbox id=' + nodes[i]._id + '-checkid type=checkbox style=width:16px;display:inline />';
x += '<div class=j' + nodes[i].icon + ' style=width:16px;height:16px;margin-top:2px;margin-right:4px;display:inline-block></div><div style=width:16px;display:inline>' + nodes[i].name + '</div></div>';
}
setDialogMode(2, "Selecteer een knooppunt om te plaatsen", 3, placeNodeEx, x + '</div>', coords);
onPlaceNodeInputChange();
}
function placeNodeEx(button, coords) {
var elements = document.getElementsByName('PlaceMapDeviceCheckbox');
for (var i in elements) {
if (elements[i].checked) {
var node = getNodeFromId(elements[i].id.substring(0, elements[i].id.length - 8));
if (node) {
var feature = xxmap.markersSource.getFeatureById(i);
var v = ol.proj.transform(coords, 'EPSG:3857', 'EPSG:4326');
var vx = [ v[1], v[0] ]; // Flip the coordinates around, lat/long
if (feature) {
feature.getGeometry().setCoordinates(coords);
var activeInteraction = getActiveInteractions(feature);
if (activeInteraction) {
saveMarkerloc(feature);
} else { // If this feature is not saved after its location is changed, then send updated coords to server.
meshserver.send({ action: 'changedevice', nodeid: node._id, userloc: vx }); // Send them to server to save changes
}
} else {
meshserver.send({ action: 'changedevice', nodeid: node._id, userloc: vx }); // This Node is not yet added to maps.
}
}
}
}
}
// Called when the user changes the search box
function onPlaceNodeInputChange() {
updatePlaceNodeTable(Q('selectnode-search').value.trim().toLowerCase());
}
// Update the list of devices in the "place on map" table
function updatePlaceNodeTable(inputSearch) {
var elements = document.getElementsByName('PlaceMapDeviceCheckbox'), count = 0;
for (var i in nodes) {
var visible = ((nodes[i].namel.indexOf(inputSearch) >= 0 || inputSearch == '') || (nodes[i].rnamel != null && nodes[i].rnamel.indexOf(inputSearch) >= 0));
if (visible) { count++; }
QV(nodes[i]._id + '-rowid', visible);
}
QV('noNodesMapPlace', count == 0);
//console.log(selected);
//for (var i in nodes) {
// if ((nodes[i].name.toLowerCase().indexOf(inputSearch) >= 0 || inputSearch == '') || (nodes[i].rnamel != null && nodes[i].rnamel.toLowerCase().indexOf(inputSearch) >= 0)) {
// console.log(selected.indexOf(nodes[i]._id));
// x += '<div class=noselect id=' + nodes[i]._id + '-rowid onclick=selectNodeToPlace(event,\''+ nodes[i]._id +'\') style=background-color:lightgray;margin-bottom:4px;border-radius:2px><input name=PlaceMapDeviceCheckbox id=' + nodes[i]._id + '-checkid type=checkbox style=width:16px;display:inline ' + ((selected.indexOf(nodes[i]._id) >= 0)?'checked':'') + ' />';
// x += '<div class=j' + nodes[i].icon + ' style=width:16px;height:16px;margin-top:2px;margin-right:4px;display:inline-block></div><div style=width:16px;display:inline>' + nodes[i].name + '</div></div>';
// }
//}
//if (x == '') { x = '<div style=text-align:center;width:100%>No devices found.</div>'; }
//QH('placenode', '');
}
// Called when a user clicks on a device to toggle selection for placement on map.
function selectNodeToPlace(e, id) {
// Toggle checkbox if needed
if (e.target.name != 'PlaceMapDeviceCheckbox') { var inputElement = Q(id + '-checkid'); inputElement.checked = !inputElement.checked; }
// Check button state
var elements = document.getElementsByName('PlaceMapDeviceCheckbox'), checkcount = 0;
for (var i in elements) { if (elements[i].checked) checkcount++; }
QE('idx_dlgOkButton', checkcount > 0);
}
// Add option for available meshes in mesh Dropdown
function addMeshOptions(addMeshid, meshName) {
//var meshOptions = Q('select-mesh');
//if (addMeshid && meshName) {
// var option = document.createElement('option');
// option.value =addMeshid;
// option.text = meshName;
// meshOptions.add(option); // Add specific option
//}
//else {
// for (var i in meshes) { // Add all options
// var option = document.createElement('option');
// option.value = i;
// option.text = meshes[i].name;
// meshOptions.add(option);
// }
//}
}
// Remove/Modify options in Mesh dropdown (if modMeshname is defined then Modify else Remove)
function meshOptionRmvMod(delMeshid, modMeshname){
//var meshOptions = Q('select-mesh');
//if (delMeshid) {
// var index=-1;
// for (var i = 1; i < meshOptions.options.length; i++) {
// if (meshOptions[i].value === delMeshid) { index=i; }
// }
// if (index > 0) {
// if (modMeshname) {
// meshOptions[index].innerHTML=modMeshname; // If Mesh name is Modified
// }
// else { meshOptions.remove(index); }
// }
//}
}
//Check if there is any mesh created
function meshExists() {
for (var i in meshes) { if (meshes[i]) { return true; } }
return false;
}
// Reset Mesh dropdown option to 'All' when a current view mesh is deleted.
function setMeshView(emeshid) {
var selectMeshElement=Q('select-mesh');
var selectedIndex = selectMeshElement.selectedIndex;
if (selectMeshElement[selectedIndex].value == emeshid) { selectMeshElement[0].selected = true; onSelectMeshChange(); }
}
// Clear all mesh options except 'All'
function clearMeshOptions() {
//var meshOptions=Q('select-mesh');
//for(var i = meshOptions.options.length - 1 ; i > 0 ; i--) { meshOptions.remove(i); }
}
// Make a http get call- Replace this with AJAX get if jquery is used
function getSearchLocation() {
try {
var searchdata = Q('mapSearchLocation').value.trim();
if (searchdata.length > 0) {
var xmlhttp = new XMLHttpRequest(); // Compatible with Chrome, Opera, Safari, IE7+, Firefox.
xmlhttp.onreadystatechange = function() { if (xmlhttp.readyState == 4 && xmlhttp.status == 200) { formatSearchData(xmlhttp.responseText); } }
xmlhttp.open('GET', 'https://nominatim.openstreetmap.org/search?q=' + searchdata + '&format=json', true); // Get request
xmlhttp.send();
}
} catch (e) {}
}
// Format data recieved from nominatim API and display it on content window
function formatSearchData(data) {
try {
QH('xmapSearchResults','');
var dataInfo = JSON.parse(data), count = 0, x = '<div class="xmapItem">';
for (var i = 0; i < dataInfo.length; i++) {
if (dataInfo[i].display_name && dataInfo[i].boundingbox[0] && dataInfo[i].boundingbox[1] && dataInfo[i].boundingbox[2] && dataInfo[i].boundingbox[3]) {
count++;
var itemclass = (i % 2 == 0)?'xmapItemSel1':'xmapItemSel1';
x += '<div class="' + itemclass + '" onclick=mapGotoSelectedLocation(this)><div>' + dataInfo[i].display_name + '</div><div style=display:none>' + dataInfo[i].boundingbox[0] + '!#!' + dataInfo[i].boundingbox[1] + '!#!' + dataInfo[i].boundingbox[2] + '!#!' + dataInfo[i].boundingbox[3] + '</div></div>';
}
}
x += '</div>';
if (count == 1) {
// If only one result is returned then zoom to that location
var extent = [ parseFloat(dataInfo[0].boundingbox[2]), parseFloat(dataInfo[0].boundingbox[0]), parseFloat(dataInfo[0].boundingbox[3]), parseFloat(dataInfo[0].boundingbox[1]) ];
zoomToExtent(extent);
} else {
if (count == 0) { x = '<div style=width:200px>' + "Geen locatie gevonden." + '<div>'; }
QV('xmapSearchResultsDlg', true);
}
QH('xmapSearchResults', x);
}
catch (e) {}
}
// Zoom into the bounding box
function mapGotoSelectedLocation(obj) {
var objchildren = obj.children;
var boundingBox = objchildren[1].innerHTML.split('!#!');
var extent = [parseFloat(boundingBox[2]), parseFloat(boundingBox[0]), parseFloat(boundingBox[3]), parseFloat(boundingBox[1])];
//Q('search-location').value = objchildren[0].innerHTML;
zoomToExtent(extent);
mapCloseSearchWindow();
}
// Close the search window
function mapCloseSearchWindow() {
QH('xmapSearchResults', '');
QV('xmapSearchResultsDlg', false);
}
// Zoom to specific cordinates
function zoomToLocation(coordinates, zoomVal) {
var view = xxmap.map.getView();
view.setCenter(coordinates);
view.setZoom(zoomVal);
}
function zoomToFitExtent() {
var features = xxmap.markersSource.getFeatures();
if (features.length > 0) {
var extent = xxmap.markersSource.getExtent();
xxmap.map.getView().fit(extent, xxmap.map.getSize());
}
}
function zoomToExtent(extent){
var boundingExtent = ol.proj.transformExtent(extent, ol.proj.get('EPSG:4326'), ol.proj.get('EPSG:3857'));
xxmap.map.getView().fit(boundingExtent, xxmap.map.getSize());
}
{{{EndGeoLocationJS}}}
//
// MY DEVICE
//
function refreshDevice(nodeid) {
if (!currentNode || currentNode._id != nodeid) return;
gotoDevice(nodeid, xxcurrentView, true);
}
function getNodeRights(nodeid) {
var node = getNodeFromId(nodeid), mesh = meshes[node.meshid];
return mesh.links[userinfo._id].rights;
}
var currentNode;
var powerTimelineNode = null;
var powerTimelineReq = null;
var powerTimelineUpdate = null;
var powerTimeline = null;
function getCurrentNode() { return currentNode; };
function gotoDevice(nodeid, panel, refresh, event) {
// Remind the user to verify the email address
if ((userinfo.emailVerified !== true) && (serverinfo.emailcheck == true) && (userinfo.siteadmin != 0xFFFFFFFF)) { setDialogMode(2, "Gebruikersaccount beveiliging", 1, null, "Geen toegang tot een apparaat totdat een e-mailadres is geverifieerd. Dit is vereist voor wachtwoordherstel. Ga naar het tabblad \"Mijn account\" om een e-mailadres te wijzigen en te verifiëren."); return; }
// Remind the user to add two factor authentication
if ((features & 0x00040000) && !((userinfo.otpsecret == 1) || (userinfo.otphkeys > 0) || (userinfo.otpkeys > 0))) { setDialogMode(2, "Gebruikersaccount beveiliging", 1, null, "Geen toegang tot een apparaat totdat tweefactorauthenticatie is ingeschakeld. Dit is vereist voor extra beveiliging. Ga naar het tabblad \"Mijn account\" en bekijk het gedeelte \"Accountbeveiliging\"."); return; }
if (event && (event.shiftKey == true)) {
// Open the device in a different tab
window.open(window.location.origin + '?node=' + nodeid.split('/')[2] + '&viewmode=10&hide=16', 'meshcentral:' + nodeid);
return;
}
//disconnectAllKvmFunction();
var node = getNodeFromId(nodeid);
var mesh = meshes[node.meshid];
var meshrights = mesh.links[userinfo._id].rights;
if (!currentNode || currentNode._id != node._id || refresh == true) {
currentNode = node;
// Add node name
var nname = EscapeHtml(node.name);
if (nname.length == 0) { nname = '<i>' + "Geen" + '</i>'; }
if (((meshrights & 4) != 0) && ((!mesh.flags) || ((mesh.flags & 2) == 0))) { nname = '<span tabindex=0 title=\"' + "Klik hier om de apparaatnaam van de server te bewerken" + '\" onclick=showEditNodeValueDialog(0) onkeyup="if (event.key == \'Enter\') showEditNodeValueDialog(0)" style=cursor:pointer>' + nname + ' <img class=hoverButton src="images/link5.png" /></span>'; }
nname += '<span style=color:#AAA;font-size:small> - ' + EscapeHtml(mesh.name) + '</span>';
QH('p10deviceName', nname);
QH('p11deviceName', nname);
QH('p12deviceName', nname);
QH('p13deviceName', nname);
QH('p14deviceName', nname);
QH('p15deviceName', "Console - " + nname);
QH('p16deviceName', nname);
QH('p17deviceName', nname);
QH('p19deviceName', nname);
// Node attributes
var x = '<table style=width:100%>';
// Attribute: Mesh
x += addDeviceAttribute('<span title=\"' + "De naam van de apparaatgroep waartoe deze computer behoort" + '\">' + "Groep" + '</span>', '<a href=# title=\"' + "De naam van de apparaatgroep waartoe deze computer behoort" + '\" onclick=gotoMesh("' + node.meshid + '") style=cursor:pointer>' + EscapeHtml(meshes[node.meshid].name) + '</a>');
// Attribute: Name
if ((node.rname != null) && (node.name != node.rname)) { x += addDeviceAttribute('<span title="The name of this computer as set in the operating system">Name</span>', '<span title="The name of this computer as set in the operating system">' + EscapeHtml(node.rname) + '</span>'); }
// Attribute: Host
if ((features & 1) == 0) { // If not WAN-only, local hostname is in use
if ((meshrights & 4) != 0) {
if (node.host) {
x += addDeviceAttribute("Hostname", '<span onclick=showEditNodeValueDialog(1) style=cursor:pointer>' + EscapeHtml(node.host) + '</span>');
} else {
x += addDeviceAttribute("Hostname", '<span onclick=showEditNodeValueDialog(1) style=cursor:pointer><i>' + "Geen" + '</i></span>');
}
} else {
x += addDeviceAttribute("Hostname", EscapeHtml(node.host));
}
}
// Attribute: Description
var description = node.desc?EscapeHtml(node.desc):('<i>' + "Geen" + '</i>');
if ((meshrights & 4) != 0) {
x += addDeviceAttribute("Omschrijving", '<span onclick=showEditNodeValueDialog(2) style=cursor:pointer>' + description + ' <img class=hoverButton src="images/link5.png" /></span>');
} else {
x += addDeviceAttribute("Omschrijving", description);
}
// Attribute: Mesh Agent
if ((node.agent != null) && (node.agent.id != null) && (node.agent.ver != null)) {
var str = '';
if (node.agent.id <= agentsStr.length) { str = agentsStr[node.agent.id]; } else { str = agentsStr[0]; }
if (node.agent.ver != 0) { str += ' v' + node.agent.ver; }
x += addDeviceAttribute("Mesh Agent", str);
}
// Attribute: Intel AMT
if (node.intelamt != null) {
var str = '';
var provisioningStates = { 0: nobreak("Niet geactiveerd (Pre)"), 1: nobreak("Niet geactiveerd (In)"), 2: nobreak("Geactiveerd") };
if (node.intelamt.ver != null && node.intelamt.state == null) { str += '<i>' + "Onbekende staat" + '</i>, v' + node.intelamt.ver; } else
if ((node.intelamt.ver == null) && (node.intelamt.state == 2)) { str += '<i>' + "Geactiveerd" + '</i>'; }
else if ((node.intelamt.ver == null) || (node.intelamt.state == null)) { str += '<i>' + "Onbekende versie en staat" + '</i>'; }
else {
str += provisioningStates[node.intelamt.state];
if ((node.intelamt.state == 2) && node.intelamt.flags) { if (node.intelamt.flags & 2) { str += ' <span title=\"' + "Intel AMT wordt geactiveerd in Client Control Mode" + '\">' + "CCM" + '</span>'; } else if (node.intelamt.flags & 4) { str += ' <span title=\"' + "Intel AMT wordt geactiveerd in de beheerdersmodus" + '\">' + "ACM" + '</span>'; } }
str += (', v' + node.intelamt.ver);
}
if (node.intelamt.tls == 1) { str += ', <span title=\"' + "Intel AMT is ingesteld met TLS-netwerkbeveiliging" + '\">' + "TLS" + '</span>'; }
if (node.intelamt.state == 2) {
if (node.intelamt.user == null || node.intelamt.user == '') {
if ((meshrights & 4) != 0) {
str += ', <i style=color:#FF0000;cursor:pointer title=\"' + "Bewerk Intel® AMT-gegevens" + '\" onclick=editDeviceAmtSettings("' + node._id + '")>' + "Geen referenties" + '</i>';
} else {
str += ', <i style=color:#FF0000>' + "Geen referenties" + '</i>';
}
}
str += ' ';
if ((meshrights & 4) != 0) {
str += '<img src=images/link4.png height=10 width=10 title=\"' + "Bewerk Intel® AMT-gegevens" + '\" style=cursor:pointer onclick=editDeviceAmtSettings("' + node._id + '")>';
}
}
var meName = '<span title=\"Intel&reg; Manageability Engine\">' + "Intel&reg; ME" + '<span>';
if (typeof node.intelamt.sku == 'number') {
if ((node.intelamt.sku & 8) != 0) { meName = '<span title=\"' + "Intel&reg; Active Management Technology" + '\">' + "Intel&reg; AMT" + '<span>'; }
else if ((node.intelamt.sku & 16) != 0) { meName = '<span title=\"' + "Standaard beheerbaarheid van Intel®" + '\">' + "Intel&reg; SM" + '<span>'; }
}
x += addDeviceAttribute(meName, str);
}
if (mesh.mtype == 2) {
// Attribute: Mesh Agent Tag
if ((node.agent != null) && (node.agent.tag != null)) {
var tag = EscapeHtml(node.agent.tag);
if (tag.startsWith('mailto:')) { tag = '<a href="' + tag + '">' + tag.substring(7) + '</a>'; }
x += addDeviceAttribute("Agent Tag", tag);
}
} else {
// Attribute: Intel AMT Tag
if ((node.intelamt != null) && (node.intelamt.tag != null)) {
var tag = EscapeHtml(node.intelamt.tag);
if (tag.startsWith('mailto:')) { tag = '<a href="' + tag + '">' + tag.substring(7) + '</a>'; }
x += addDeviceAttribute("Intel&reg; AMT Tag", tag);
}
}
// Attribute: Intel AMT
//if (node.intelamt && node.intelamt.user) { x += addDeviceAttribute('Intel&reg; AMT', node.intelamt.user); }
// Operating system description
if (node.osdesc) { x += addDeviceAttribute("Besturingssysteem", node.osdesc); }
// Antivirus
if (node.av && node.av.length > 0) {
var y = [];
for (var i in node.av) {
if (node.av[i].product) {
var avx = EscapeHtml(node.av[i].product);
if (node.av[i].enabled !== true) { avx += ' - <span style=color:red>' + "Uitgeschakeld" + '</span>'; }
if (node.av[i].updated !== true) { avx += ' - <span style=color:red>' + "Verouderd" + '</span>'; }
if ((node.av[i].enabled == true) && (node.av[i].updated == true)) { avx += ' - <span style=color:green>' + "Oke" + '</span>'; }
y.push(avx);
}
}
x += addDeviceAttribute("Anti-virus", y.join('<br />'));
}
// Active Users
if (node.users && node.conn && (node.users.length > 0) && (node.conn & 1)) { x += addDeviceAttribute(format("Actieve gebruiker(s){0}", ((node.users.length > 1)?'s':'')), node.users.join(', ')); }
// Attribute: Connectivity (Only show this if more than just the agent is connected).
var connectivity = node.conn;
if (connectivity && connectivity > 1) {
var cstate = [];
if ((node.conn & 1) != 0) cstate.push('<span title=\"' + "Mesh-agent is verbonden en klaar voor gebruik." + '\">' + "Mesh Agent" + '</span>');
if ((node.conn & 2) != 0) cstate.push('<span title=\"' + "Intel® AMT CIRA is verbonden en klaar voor gebruik." + '\">' + "Intel&reg; AMT CIRA" + '</span>');
else if ((node.conn & 4) != 0) cstate.push('<span title=\"' + "Intel® AMT is routeerbaar en klaar voor gebruik." + '\">' + "Intel&reg; AMT" + '</span>');
if ((node.conn & 8) != 0) cstate.push('<span title=\"' + "Mesh-agent is bereikbaar met een andere agent als relay." + '\">' + "Mesh Relay" + '</span>');
if ((node.conn & 16) != 0) { cstate.push('<span title=\"' + "MQTT verbinding met het apparaat is actief." + '\">' + "MQTT" + '</span>'); }
x += addDeviceAttribute("connectiviteit", cstate.join(', '));
}
// Node grouping tags
var groupingTags = '<i>' + "Geen" + '</i>';
if (node.tags != null) { groupingTags = ''; for (var i in node.tags) { groupingTags += '<span class="tagSpan">' + node.tags[i] + '</span>'; } }
if ((meshrights & 4) != 0) {
x += addDeviceAttribute('Tags', '<span onclick=showEditNodeValueDialog(3) style=cursor:pointer>' + groupingTags + ' <img class=hoverButton src="images/link5.png" /></span>');
} else {
x += addDeviceAttribute('Tags', groupingTags);
}
x += '</table><br />';
// Show action button, only show if we have permissions 4, 8, 64
if ((meshrights & 76) != 0) { x += '<input type=button value=\"' + "Akties" + '\" title=\"' + "Voer krachtacties uit op het apparaat" + '\" onclick=deviceActionFunction() />'; }
x += '<input type=button value=\"' + "Notities" + '\" title=\"' + "Bekijk opmerkingen over dit apparaat" + '\" onclick=showNotes(' + ((meshrights & 128) == 0) + ',"' + encodeURIComponent(node._id) + '") />';
x += '<input type=button value=\"' + "Gebeurtenissenlog" + '\" title=\"' + "Schrijf een gebeurtenis voor dit apparaat" + '\" onclick=writeDeviceEvent("' + encodeURIComponent(node._id) + '") />';
//if ((connectivity & 1) && (meshrights & 8) && (node.agent.id < 5)) { x += '<input type=button value=Toast title="Display a text message of the remote device" onclick=deviceToastFunction() />'; }
QH('p10html', x);
// Show node last 7 days timeline
masterUpdate(256);
// Show bottom buttons
x = '<div class="p10html3right">';
if ((meshrights & 4) != 0) {
// TODO: Show change group only if there is another mesh of the same type.
x += '&nbsp;<a href=# onclick=p10showChangeGroupDialog(["' + node._id + '"]) title=\"' + "Verplaats dit apparaat naar een andere apparaatgroep" + '\">' + "verander groep" + '</a>';
x += '&nbsp;<a href=# onclick=p10showDeleteNodeDialog("' + node._id + '") title=\"' + "Verwijder dit apparaat" + '\">' + "Verwijder apparaat" + '</a>';
}
x += '</div><div class="p10html3left">';
if (mesh.mtype == 2) x += '<a href=# onclick=p10showNodeNetInfoDialog("' + node._id + '") title=\"' + "Toon apparaat netwerk interface informatie" + '\">' + "Interfaces" + '</a>&nbsp;';
if (xxmap != null) x += '<a href=# onclick=p10showNodeLocationDialog("' + node._id + '") title=\"' + "Informatie over apparaatlocaties weergeven" + '\">' + "Lokatie" + '</a>&nbsp;';
if (((meshrights & 8) != 0) && (mesh.mtype == 2)) x += '<a href=# onclick=p10showMeshCmdDialog(1,"' + node._id + '") title=\"' + "Verkeersrouter gebruikt om verbinding te maken met een apparaat via deze server" + '.\">' + "Router" + '</a>&nbsp;';
// RDP link, show this link only of the remote machine is Windows.
if (((connectivity & 1) != 0) && (clickOnce == true) && (mesh.mtype == 2) && ((meshrights & 8) != 0)) {
if ((node.agent.id > 0) && (node.agent.id < 5)) { x += '<a href=# onclick=p10clickOnce("' + node._id + '","RDP2",3389) title=\"' + "Vereist Microsoft ClickOnce-ondersteuning in uw browser" + '.\">' + "RDP" + '</a>&nbsp;'; }
if (node.agent.id > 4) {
x += '<a href=# onclick=p10clickOnce("' + node._id + '","PSSH",22) title=\"' + "Vereist Microsoft ClickOnce-ondersteuning in uw browser" + '\">' + "Putty" + '</a>&nbsp;';
x += '<a href=# onclick=p10clickOnce("' + node._id + '","WSCP",22) title=\"' + "Vereist Microsoft ClickOnce-ondersteuning in uw browser" + '\">' + "WinSCP" + '</a>&nbsp;';
}
}
// MQTT options
if ((meshrights == 0xFFFFFFFF) && (features & 0x00400000)) { x += '<a href=# onclick=p10showMqttLoginDialog("' + node._id + '") title=\"' + "Ontvang MQTT-inloggegevens voor dit apparaat." + '\">' + "MQTT Login" + '</a>&nbsp;'; }
x += '</div><br>'
QH('p10html3', x);
// Set the node power state
var powerstate = PowerStateStr(node.state);
//if (node.state == 0) { powerstate = 'Unknown State'; }
if ((connectivity & 1) != 0) { if (powerstate.length > 0) { powerstate += '<br/>'; } powerstate += '<span style=font-size:12px title=\"' + "Agent verbonden" + '\">' + "Agent verbonden" + '</span>'; }
if ((connectivity & 2) != 0) { if (powerstate.length > 0) { powerstate += '<br/>'; } powerstate += '<span style=font-size:12px title=\"' + "Intel® AMT verbonden" + '\">' + "Intel® AMT verbonden" + '</span>'; }
else if ((connectivity & 4) != 0) { if (powerstate.length > 0) { powerstate += '<br/>'; } powerstate += '<span style=font-size:12px title=\"' + "Intel&reg; AMT gedetecteerd" + '\">' + "Intel&reg; AMT gedetecteerd" + '</span>'; }
if ((connectivity & 16) != 0) { if (powerstate.length > 0) { powerstate += '<br/>'; } powerstate += '<span style=font-size:12px title=\"' + "MQTT verbonden" + '\">' + "MQTT-kanaal verbonden" + '</span>'; }
if ((powerstate == '') && node.lastconnect) { powerstate = '<span style=font-size:12px>' + "Laatst gezien" + '<br />' + printDateTime(new Date(node.lastconnect)) + '</span>'; }
QH('MainComputerState', powerstate);
// Set the node icon
Q('MainComputerImage').setAttribute('src', 'images/icons256-' + node.icon + '-1.png');
Q('MainComputerImage').className = ((!node.conn) || (node.conn == 0)?'gray':'');
// Check if we have terminal and file access
var terminalAccess = ((meshrights == 0xFFFFFFFF) || ((meshrights & 512) == 0));
var fileAccess = ((meshrights == 0xFFFFFFFF) || ((meshrights & 1024) == 0));
var amtAccess = ((meshrights == 0xFFFFFFFF) || ((meshrights & 2048) == 0));
// Setup/Refresh the desktop tab
if (terminalAccess) { setupTerminal(); }
if (fileAccess) { setupFiles(); }
var consoleRights = ((meshrights & 16) != 0);
if (consoleRights) { setupConsole(); } else { if (panel == 15) { panel = 10; } }
// Show or hide the tabs
// mesh.mtype: 1 = Intel AMT only, 2 = Mesh Agent
// node.agent.caps (bitmask): 1 = Desktop, 2 = Terminal, 4 = Files, 8 = Console
QV('MainDevDesktop', (((mesh.mtype == 1) && ((typeof node.intelamt.sku !== 'number') || ((node.intelamt.sku & 8) != 0)))
|| ((mesh.mtype == 2) && ((node.agent == null) || (node.agent.caps == null) || ((node.agent.caps & 1) != 0) || (node.intelamt && (node.intelamt.state == 2)))))
&& ((meshrights & 8) || (meshrights & 256))
);
QV('MainDevTerminal', ((mesh.mtype == 1) || (node.agent == null) || (node.agent.caps == null) || ((node.agent.caps & 2) != 0) || (node.intelamt && (node.intelamt.state == 2))) && (meshrights & 8) && terminalAccess);
QV('MainDevFiles', ((mesh.mtype == 2) && ((node.agent == null) || (node.agent.caps == null) || ((node.agent.caps & 4) != 0))) && (meshrights & 8) && fileAccess);
QV('MainDevAmt', (node.intelamt != null) && ((node.intelamt.state == 2) || (node.conn & 2)) && (meshrights & 8) && amtAccess);
QV('MainDevConsole', (consoleRights && (mesh.mtype == 2) && ((node.agent == null) || (node.agent.caps == null) || ((node.agent.caps & 8) != 0))) && (meshrights & 8));
QV('MainDevPlugins', false);
QV('p15uploadCore', (node.agent != null) && (node.agent.caps != null) && ((node.agent.caps & 16) != 0));
QH('p15coreName', ((node.agent != null) && (node.agent.core != null))?node.agent.core:'');
// Setup/Refresh Intel AMT tab
var amtFrameNode = Q('p14iframe').contentWindow.getCurrentMeshNode();
if ((amtFrameNode != null) && (amtFrameNode._id != currentNode._id)) { Q('p14iframe').contentWindow.disconnect(); }
var online = ((node.conn & 6) != 0)?true:false; // If CIRA (2) or AMT (4) connected, enable Commander
Q('p14iframe').contentWindow.setConnectionState(online);
Q('p14iframe').contentWindow.setFrameHeight('650px');
Q('p14iframe').contentWindow.setAuthCallback(updateAmtCredentials);
// Display "action" button on desktop/terminal/files
QV('deskActionsBtn', (meshrights & 72) != 0); // 72 = Wake-up + Remote Control permissions
QV('termActionsBtn', (meshrights & 72) != 0);
QV('filesActionsBtn', (meshrights & 72) != 0);
// Request the power timeline
if ((powerTimelineNode != currentNode._id) && (powerTimelineReq != currentNode._id)) {
QH('p10html2', '');
powerTimelineReq = currentNode._id;
meshserver.send({ action: 'powertimeline', nodeid: currentNode._id });
meshserver.send({ action: 'lastconnect', nodeid: currentNode._id });
meshserver.send({ action: 'getsysinfo', nodeid: currentNode._id });
QH('p17info', '');
}
// Reset the desktop tools
QV('DeskTools', false);
showDeskToolsProcesses();
// Ask for device events
refreshDeviceEvents();
// Update the web page title
if ((currentNode) && (xxcurrentView >= 10) && (xxcurrentView < 20)) {
document.title = decodeURIComponent('{{{extitle}}}') + ' - ' + currentNode.name + ' - ' + mesh.name;
} else {
document.title = decodeURIComponent('{{{extitle}}}');
}
// Clear user consent status if present
p11clearConsoleMsg();
p12clearConsoleMsg();
p13clearConsoleMsg();
// Device refresh plugin handler
if (pluginHandler != null) {
QH('p19headers', ''); QH('p19pages', '');
pluginHandler.callHook('onDeviceRefreshEnd', nodeid, panel, refresh, event);
var lastTab = getstore('_curPluginPage', null);
if (lastTab != null && Q('p19ph-' + lastTab) != null) pluginHandler.callPluginPage(lastTab, Q('p19ph-' + lastTab));
}
}
setupDesktop(); // Always refresh the desktop, even if we are on the same device, we need to do some canvas switching.
if (!panel) panel = 10;
go(panel);
}
function writeDeviceEvent(nodeid) {
if (xxdialogMode) return;
setDialogMode(2, "Apparaatgebeurtenis toevoegen", 3, writeDeviceEventEx, '<textarea id=d2devEvent style=background-color:#fcf3cf;width:100%;height:200px;resize:none;overflow-y:scroll></textarea><span style=font-size:10px>' + "Hiermee wordt een vermelding toegevoegd aan het gebeurtenislogboek van dit apparaat." + '<span>', nodeid);
}
function writeDeviceEventEx(buttons, tag) { meshserver.send({ action: 'setDeviceEvent', nodeid: decodeURIComponent(tag), msg: encodeURIComponent(Q('d2devEvent').value) }); }
function showNotes(readonly, noteid) {
if (xxdialogMode) return;
setDialogMode(2, "Notities", 2, showNotesEx, '<textarea id=d2devNotes ro=' + readonly + ' noteid=' + noteid + ' readonly style=background-color:#fcf3cf;width:100%;height:200px;resize:none;overflow-y:scroll></textarea><span style=font-size:10px>' + "Apparaatgroepnotities kunnen worden bekeken en gewijzigd door andere apparaatgroepbeheerders." + '<span>', noteid);
meshserver.send({ action: 'getNotes', id: decodeURIComponent(noteid) });
}
function showNotesEx(buttons, tag) { meshserver.send({ action: 'setNotes', id: decodeURIComponent(tag), notes: encodeURIComponent(Q('d2devNotes').value) }); }
function deviceChat(e) {
if (xxdialogMode) return;
var url = '/messenger?id=meshmessenger/' + encodeURIComponent(currentNode._id) + '/' + encodeURIComponent(userinfo._id) + '&title=' + currentNode.name;
if ((authCookie != null) && (authCookie != '')) { url += '&auth=' + authCookie; }
if (e && (e.shiftKey == true)) {
window.open(url, 'meshmessenger:' + currentNode._id);
} else {
window.open(url, 'meshmessenger:' + currentNode._id, 'directories=no,titlebar=no,toolbar=no,location=no,status=no,menubar=no,scrollbars=no,resizable=no,width=400,height=560');
}
meshserver.send({ action: 'meshmessenger', nodeid: decodeURIComponent(currentNode._id) });
}
function deviceToggleBackground() {
if (xxdialogMode) return;
meshserver.send({ action: 'msg', type: 'deskBackground', nodeid: currentNode._id, op: 1 }); // Toggle desktop background image
}
function deviceUrlFunction() {
if (xxdialogMode) return;
setDialogMode(2, "Open pagina op apparaat", 3, deviceUrlFunctionEx, '<input id=d2devurl placeholder="http://server.com" style=width:100%;overflow-y:scroll></input>');
Q('d2devurl').focus();
}
function deviceUrlFunctionEx() {
meshserver.send({ action: 'msg', type: 'openUrl', nodeid: currentNode._id, url: Q('d2devurl').value });
}
function deviceToastFunction() {
if (xxdialogMode) return;
setDialogMode(2, "Apparaatmelding", 3, deviceToastFunctionEx, '<textarea id=d2devToast style=width:100%;height:80px;resize:none;overflow-y:scroll></textarea>');
Q('d2devToast').focus();
}
function deviceToastFunctionEx() {
meshserver.send({ action: 'toast', nodeids: [ currentNode._id ], title: 'MeshCentral', msg: Q('d2devToast').value });
}
function deviceActionFunction() {
if (xxdialogMode) return;
var meshrights = meshes[currentNode.meshid].links[userinfo._id].rights;
var x = "Selecteer een bewerking die u op dit apparaat wilt uitvoeren." + '<br /><br />';
var y = '<select id=d2deviceop style=float:right;width:250px>';
if ((meshrights & 64) != 0) { y += '<option value=100>' + "Wakker worden" + '</option>'; } // Wake-up permission
if ((meshrights & 8) != 0) { y += '<option value=4>' + "Slaap" + '</option><option value=3>' + "Reset" + '</option><option value=2>' + "Uitzetten" + '</option>'; } // Remote control permission
if ((currentNode.conn & 16) != 0) { y += '<option value=103>' + "Verzend MQTT bericht" + '</option>'; }
if (((currentNode.conn & 1) != 0) && ((meshrights & 32768) != 0)) { y += '<option value=104>' + "deinstallatie agent" + '</option>'; }
y += '</select>';
x += addHtmlValue("Operatie", y);
setDialogMode(2, "Apparaatactie", 3, deviceActionFunctionEx, x);
}
function deviceActionFunctionEx() {
var op = Q('d2deviceop').value;
if (op == 100) {
// Device wake
meshserver.send({ action: 'wakedevices', nodeids: [currentNode._id] });
} else if (op == 103) {
// Send MQTT Message
p10showSendMqttMsgDialog([currentNode._id]);
} else if (op == 104) {
// Uninstall agent
p10showSendUninstallAgentDialog([currentNode._id]);
} else {
// Power operation
meshserver.send({ action: 'poweraction', nodeids: [ currentNode._id ], actiontype: parseInt(op) });
}
}
// Called when MeshCommander needs new credentials or updated credentials.
function updateAmtCredentials(forceDialog) {
var node = getNodeFromId(currentNode._id);
if ((forceDialog == true) || (node.intelamt.user == null) || (node.intelamt.user == '')) {
editDeviceAmtSettings(currentNode._id, updateAmtCredentialsEx);
} else {
Q('p14iframe').contentWindow.connectButtonfunctionEx();
}
}
function updateAmtCredentialsEx(button, tag) {
Q('p14iframe').contentWindow.connectButtonfunctionEx();
}
// Look to see if we need to update the device timeline
function updateDeviceTimeline() {
if ((meshserver.State != 2) || (powerTimelineNode == null) || (powerTimelineUpdate == null) || (currentNode == null)) return;
if ((powerTimelineNode == powerTimelineReq) && (currentNode._id == powerTimelineNode) && (powerTimelineUpdate < Date.now())) {
powerTimelineUpdate = null;
meshserver.send({ action: 'powertimeline', nodeid: currentNode._id });
meshserver.send({ action: 'lastconnect', nodeid: currentNode._id });
}
}
// Draw device power bars. The bars are 766px wide.
function drawDeviceTimeline() {
if ((currentNode == null) || (xxcurrentView < 10) || (xxcurrentView > 19)) return;
var timeline = null, now = Date.now();
if (currentNode._id == powerTimelineNode) { timeline = powerTimeline; }
// Calculate when the timeline starts
var d = new Date();
d.setHours(0, 0, 0, 0);
d = new Date(d.getTime() - (1000 * 60 * 60 * 24 * 6));
var timelineStart = d.getTime();
// De-compact the timeline
var timeline2 = [];
if (timeline != null && timeline.length > 1) {
timeline2.push([ 0, timeline[1], timeline[0] ]); // Start, End, Power
var ct = timeline[1];
for (var i = 2; i < timeline.length; i += 2) {
var power = timeline[i], dt = now;
if (timeline.length > (i + 1)) { dt = timeline[i + 1]; }
timeline2.push([ ct, ct + dt, power ]); // Start, End, Power
ct = ct + dt;
}
}
// Draw the timeline
var x = '', count = 1, date = new Date();
var totalWidth = Q('masthead').offsetWidth - (160 + 9 + 9 + 14); // Compute the total width of the power bar
date.setHours(0, 0, 0, 0);
for (var i = 0; i < 7; i++) {
var datavalue = '', start = date.getTime(), end = start + (1000 * 60 * 60 * 24);
for (var j in timeline2) {
var block = timeline2[j];
if (isTimeBlockInside(start, end, block[0], block[1]) == true) {
var ts = Math.max(start, block[0]);
var te = Math.min(Math.min(end, block[1]), now);
var width = Math.round(((te - ts) * totalWidth) / 86400000);
if (width > 0) {
var title = format('{0} from {1} to {2}.', powerStateStrings2[block[2]], printTime(new Date(ts)), printTime(new Date(te)));
datavalue += '<div class="pwState ' + powerColor(block[2]) + '" title="' + title + '" style="width:' + width + 'px;"></div>';
}
}
}
x += '<tr class=' + (((count % 2) == 0)?'altBack':'') + '><td><div>&nbsp;' + printDate(date) + '<div></div></div></td><td><div>' + datavalue + '</div></td></tr>';
++count;
date = new Date(date.getTime() - (1000 * 60 * 60 * 24)); // Substract one day
}
QH('p10html2', '<table cellpadding=2 cellspacing=0><thead><tr style=><th scope=col style=text-align:center;width:150px>' + "Dag" + '</th><th scope=col style=text-align:center><a download href="devicepowerevents.ashx?id=' + currentNode._id + '" onclick="setDialogMode(0)"><img title=\"' + "Downloaden Power gebeurtenissen" + '\" src="images/link4.png" /></a>' + "7 dagen stroom status" + '</th></tr></thead><tbody>' + x + '</tbody></table>');
}
// Return a color for the given power state
function powerColor(x) { if (x < powerColorTable.length) { return powerColorTable[x]; } return 'pwsYellow'; }
// Return true if the time block is visible within the start/end period
function isTimeBlockInside(start, end, blockStart, blockEnd) {
if ((blockStart < start) && (blockEnd > end)) return true; // Block is wider than timespan
if ((blockStart > start) && (blockStart < end)) return true;
if ((blockEnd > start) && (blockEnd < end)) return true;
return false;
}
function addDeviceAttribute(name, value) { return '<tr><td class=style7>' + name + '</td><td class=style9>' + value + '</td></tr>'; }
function editDeviceAmtSettings(nodeid, func, arg) {
if (xxdialogMode) return;
var x = '', node = getNodeFromId(nodeid), buttons = 3, meshrights = getNodeRights(nodeid);
if ((meshrights & 4) == 0) return;
x += addHtmlValue("Gebruikersnaam", '<input id=dp10username style=width:230px maxlength=32 autocomplete=nope placeholder="admin" onchange=validateDeviceAmtSettings() onkeyup=validateDeviceAmtSettings() />');
x += addHtmlValue("wachtwoord", '<input id=dp10password type=password style=width:230px autocomplete=nope maxlength=32 onchange=validateDeviceAmtSettings() onkeyup=validateDeviceAmtSettings() />');
x += addHtmlValue("Veiligheid", '<select id=dp10tls style=width:236px><option value=0>' + "Geen TLS beveiliging" + '</option><option value=1>' + "TLS beveiliging vereist" + '</option></select>');
if ((node.intelamt.user != null) && (node.intelamt.user != '')) { buttons = 7; }
setDialogMode(2, "Bewerk Intel® AMT-gegevens", buttons, editDeviceAmtSettingsEx, x, { node: node, func: func, arg: arg });
if ((node.intelamt.user != null) && (node.intelamt.user != '')) { Q('dp10username').value = node.intelamt.user; } else { Q('dp10username').value = 'admin'; }
Q('dp10tls').value = node.intelamt.tls;
validateDeviceAmtSettings();
}
function validateDeviceAmtSettings() {
QE('idx_dlgOkButton', passwordcheck(Q('dp10password').value));
}
function editDeviceAmtSettingsEx(button, tag) {
if (button == 2) {
// Delete button pressed, remove credentials
meshserver.send({ action: 'changedevice', nodeid: tag.node._id, intelamt: { user: '', pass: '' } });
} else {
// Change Intel AMT credentials
var amtuser = Q('dp10username').value;
if (amtuser == '') amtuser = 'admin';
var amtpass = Q('dp10password').value;
if (amtpass == '') amtuser = '';
meshserver.send({ action: 'changedevice', nodeid: tag.node._id, intelamt: { user: amtuser, pass: amtpass, tls: Q('dp10tls').value } });
tag.node.intelamt.user = amtuser;
tag.node.intelamt.tls = Q('dp10tls').value;
if (tag.func) { setTimeout(function () { tag.func(null, tag.arg); }, 300); }
}
}
function p10showSendMqttMsgDialog(nodeids) {
if (xxdialogMode) return false;
var x = addHtmlValue("Onderwerp", '<input id=dp2topic style=width:230px maxlength=64 onchange=p10validateSendMqttMsgDialog() onkeyup=p10validateSendMqttMsgDialog(event,1) />');
x += addHtmlValue("Bericht", '<div style=width:230px;margin:0;padding:0><textarea id=dp2msg maxlength=4096 style=width:100%;height:150px;resize:none onchange=p10validateSendMqttMsgDialog() onkeyup=p10validateSendMqttMsgDialog(event,1)></textarea></div>');
setDialogMode(2, "Verzend MQTT bericht", 3, p10showSendMqttMsgDialogEx, x, nodeids);
p10validateSendMqttMsgDialog();
Q('dp2topic').focus();
return false;
}
function p10validateSendMqttMsgDialog() {
QE('idx_dlgOkButton', (Q('dp2topic').value.length > 0) && (Q('dp2msg').value.length > 0));
}
function p10showSendMqttMsgDialogEx(b, nodeids) {
meshserver.send({ action: 'sendmqttmsg', nodeids: nodeids, topic: Q('dp2topic').value, msg: Q('dp2msg').value });
}
function p10showSendUninstallAgentDialog(nodeids) {
if (xxdialogMode) return false;
var x = '';
if (nodeids.length > 1) { x = format("Weet u zeker dat u de geselecteerde {0} agenten wilt verwijderen?", nodeids.length); } else { x = "Weet u zeker dat u de geselecteerde agent wilt verwijderen?"; }
x += '<br /><br />';
if (nodeids.length > 1) { x += "Hiermee worden de apparaten niet van de server verwijderd, maar kunnen de apparaten geen verbinding meer maken met de server. Alle externe toegang tot de apparaten gaat verloren. De apparaten moeten zijn aangesloten om deze opdracht te laten werken."; } else { x += "Hiermee wordt dit apparaat niet van de server verwijderd, maar kan het apparaat geen verbinding meer maken met de server. Alle externe toegang tot het apparaat gaat verloren. Het apparaat moet verbonden zijn om dit commando te laten werken."; }
x += '<br /><br /><label style=color:red><input id=p10check type=checkbox onchange=p10validateDeleteNodeDialog() />' + "Bevestig" + '</label>';
setDialogMode(2, "deinstallatie agent", 3, p10showSendUninstallAgentDialogEx, x, nodeids);
p10validateSendUninstallAgentDialog();
return false;
}
function p10validateSendUninstallAgentDialog() { QE('idx_dlgOkButton', Q('p10check').checked); }
function p10showSendUninstallAgentDialogEx(b, nodeids) { meshserver.send({ action: 'uninstallagent', nodeids: nodeids }); }
function p10showChangeGroupDialog(nodeids) {
if (xxdialogMode) return false;
var targetMeshId = null;
if (nodeids.length == 1) { try { targetMeshId = meshes[getNodeFromId(nodeids[0])]._id; } catch (ex) { } }
// List all available alternative groups
var y = '<select id=p10newGroup style=width:236px>', count = 0;
for (var i in meshes) {
var meshrights = meshes[i].links[userinfo._id].rights;
if ((meshes[i]._id != targetMeshId) && (meshrights & 4)) { count++; y += '<option value=\'' + meshes[i]._id + '\'>' + meshes[i].name + '</option>'; }
}
y += '</select>';
if (count > 0) {
var x = (nodeids.length == 1) ? ("Selecteer een nieuwe groep voor dit apparaat" + '<br /><br />') : ("Selecteer een nieuwe groep voor geselecteerde apparaten" + '<br /><br />');
x += addHtmlValue("Nieuwe apparaatgroep", y);
setDialogMode(2, "verander groep", 3, p10showChangeGroupDialogEx, x, nodeids);
} else {
setDialogMode(2, "verander groep", 1, null, "Er bestaat geen andere apparaatgroep van hetzelfde type.");
}
return false;
}
function p10showChangeGroupDialogEx(b, nodeids) {
meshserver.send({ action: 'changeDeviceMesh', nodeids: nodeids, meshid: Q('p10newGroup').value });
}
function p10showDeleteNodeDialog(nodeid) {
if (xxdialogMode) return false;
var x = format("Weet u zeker dat u apparaat {0} wilt verwijderen?", EscapeHtml(currentNode.name)) + '<br /><br /><label><input id=p10check type=checkbox onchange=p10validateDeleteNodeDialog() />' + "Bevestig" + '</label>';
setDialogMode(2, "Verwijder apparaat", 3, p10showDeleteNodeDialogEx, x, nodeid);
p10validateDeleteNodeDialog();
return false;
}
function p10validateDeleteNodeDialog() {
QE('idx_dlgOkButton', Q('p10check').checked);
}
function p10showDeleteNodeDialogEx(buttons, nodeid) {
meshserver.send({ action: 'removedevices', nodeids: [ nodeid ] });
}
function p10clickOnce(nodeid, protocol, port) {
meshserver.send({ action: 'getcookie', nodeid: nodeid, tcpport: port, tag: 'clickonce', protocol: protocol });
return false;
}
// Show current location
var d2map = null;
function p10showNodeLocationDialog() {
if ((xxdialogMode != null) && (xxdialogTag == '@xxmap')) { setDialogMode(0); } else { if (xxdialogMode) return false; }
var markers = [], types = ['iploc', 'wifiloc', 'gpsloc', 'userloc'], boundingBox = null;
for (var loctype in types) {
if (currentNode[types[loctype]] != null) {
var loc = currentNode[types[loctype]].split(','), lat = parseFloat(loc[0]), lon = parseFloat(loc[1]);
if ((lat < 90) && (lat > -90) && (lon < 180) && (lon > -180)) { // Check valid lat/lon
var deviceMark = new ol.Feature({ geometry: new ol.geom.Point(ol.proj.fromLonLat([lon, lat])) });
deviceMark.setStyle(markerStyle(currentNode, parseInt(loctype) + 1));
markers.push(deviceMark);
if (boundingBox == null) { boundingBox = [ lat, lon, lat, lon, 0 ]; } else { if (lat < boundingBox[0]) { boundingBox[0] = lat; } if (lon < boundingBox[1]) { boundingBox[1] = lon; } if (lat > boundingBox[2]) { boundingBox[2] = lat; } if (lon > boundingBox[3]) { boundingBox[3] = lon; } }
}
}
}
// Setup the device mark layer
var vectorSource = new ol.source.Vector({ features: markers });
var vectorLayer = new ol.layer.Vector({ source: vectorSource });
//var x = '<div><a href="https://www.google.com/maps/preview/@' + lat + ',' + lng + ',12z" rel="noreferrer noopener" target=_blank>Open in Google maps</a></div>';
var x = '<div id=d2map style=width:100%;height:300px></div>';
setDialogMode(2, "Apparaat locatie", 1, null, x, '@xxmap');
var clng = 0, clat = 0, zoom = 8;
if (boundingBox != null) {
var clat = (boundingBox[0] + boundingBox[2]) / 2;
var clng = (boundingBox[1] + boundingBox[3]) / 2;
var cscale = Math.max(Math.abs(boundingBox[0] - boundingBox[2]), Math.abs(boundingBox[1] - boundingBox[3]));
var i = 360, zoom = -2;
while (i > cscale) { zoom++; i = i / 2; }
}
if (markers.length == 1) { zoom = 8; }
// Setup the map
d2map = new ol.Map({
target: 'd2map',
interactions: ol.interaction.defaults({dragPan:false, mouseWheelZoom:false}),
layers: [ new ol.layer.Tile({ source: new ol.source.OSM() }), vectorLayer ],
view: new ol.View({ center: ol.proj.fromLonLat([clng, clat]), zoom: zoom })
});
return false;
}
// Show network interfaces
function p10showNodeNetInfoDialog() {
if (xxdialogMode) return false;
setDialogMode(2, "Netwerk Interfaces", 1, null, '<div id=d2netinfo>' + "Laden..." + '</div>', 'if' + currentNode._id );
meshserver.send({ action: 'getnetworkinfo', nodeid: currentNode._id });
return false;
}
// Show MeshCentral Router dialog
function p10showMeshRouterDialog() {
if (xxdialogMode) return;
var x = '<div>' + "MeshCentral Router is een Windows tool voor het toewijzen van TCP poorten. U kunt RDP bijvoorbeeld via deze server naar een extern apparaat sturen." + '</div><br />';
x += addHtmlValue('Win32 Executable', '<a style=cursor:pointer download href="meshagents?meshaction=winrouter" onclick="setDialogMode(0)">MeshCentralRouter.exe</a>');
setDialogMode(2, "MeshCentral Router", 1, null, x, 'fileDownload');
}
// Request MQTT login credentials
function p10showMqttLoginDialog(nodeid) { meshserver.send({ action: 'getmqttlogin', nodeid: nodeid }); }
// Show MeshCmd dialog
function p10showMeshCmdDialog(mode, nodeid) {
if (xxdialogMode) return;
var y = '<select id=aginsSelect onclick=meshCmdOsClick() style=width:236px>';
y += '<option value=3>' + "Windows (32bit)" + '</option>';
y += '<option value=4>' + "Windows (64bit)" + '</option>';
y += '<option value=5>' + "Linux x86 (32bit)" + '</option>';
y += '<option value=6>' + "Linux x86 (64bit)" + '</option>';
y += '<option value=16>' + "MacOS (64bit)" + '</option>';
y += '<option value=25>' + "Linux ARM, Raspberry Pi (32bit)" + '</option>';
y += '</select>';
var x = '';
if (mode == 0) { x += '<div>MeshCmd is a command line tool that performs lots of different operations. The action file can optionally be downloaded and edited to provide server information and credentials.<br /><br />'; }
if (mode == 1) { x += '<div>Download "meshcmd" with an action file to route traffic thru this server to this device. Make sure to edit meshaction.txt and add your account password or make any changes needed.<br /><br />'; }
x += addHtmlValue('Operating System', y);
x += addHtmlValue('MeshCmd', '<a id=meshcmddownloadid href="meshagents?meshcmd=3" download></a>');
if (mode == 0) { x += addHtmlValue('Action File', '<a href="meshagents?meshaction=generic" download>MeshAction (.txt)</a>'); }
if (mode == 1) { x += addHtmlValue('Action File', '<a href="meshagents?meshaction=route&nodeid=' + nodeid + '" download>MeshAction (.txt)</a>'); }
x += '</div>';
setDialogMode(2, [ "Download MeshCmd", "Netwerk Router" ][mode], 9, null, x, 'fileDownload');
meshCmdOsClick();
}
function meshCmdOsClick() {
var os = Q('aginsSelect').value, osn = '', osurl = '';
//Q('meshcmddownloadid').href = 'meshagents?meshcmd=' + os;
if (os == 3) { osn = 'MeshCmd (Win32 executable)'; }
if (os == 4) { osn = 'MeshCmd (Win64 executable)'; }
if (os == 5) { osn = 'MeshCmd (Linux x86, 32bit)'; }
if (os == 6) { osn = 'MeshCmd (Linux x86, 64bit)'; }
if (os == 16) { osn = 'MeshCmd (MacOS, 64bit)'; }
if (os == 25) { osn = 'MeshCmd (Linux ARM, 32bit)'; }
QH('meshcmddownloadid', osn);
Q('meshcmddownloadid').setAttribute('href', 'meshagents?meshcmd=' + os);
}
function p10showiconselector() {
if (xxdialogMode) return;
var mesh = meshes[currentNode.meshid];
var meshrights = mesh.links[userinfo._id].rights;
if ((meshrights & 4) == 0) return;
var x = '<br><div style=display:inline-block;width:40px></div>';
x += '<div tabindex=0 style=display:inline-block class=i1 onclick=p10setIcon(1) onkeypress="if (event.key==\'Enter\') p10setIcon(1)"></div>';
x += '<div tabindex=0 style=display:inline-block class=i2 onclick=p10setIcon(2) onkeypress="if (event.key==\'Enter\') p10setIcon(2)"></div>';
x += '<div tabindex=0 style=display:inline-block class=i3 onclick=p10setIcon(3) onkeypress="if (event.key==\'Enter\') p10setIcon(3)"></div>';
x += '<div tabindex=0 style=display:inline-block class=i4 onclick=p10setIcon(4) onkeypress="if (event.key==\'Enter\') p10setIcon(4)"></div>';
x += '<div tabindex=0 style=display:inline-block class=i5 onclick=p10setIcon(5) onkeypress="if (event.key==\'Enter\') p10setIcon(5)"></div>';
x += '<div tabindex=0 style=display:inline-block class=i6 onclick=p10setIcon(6) onkeypress="if (event.key==\'Enter\') p10setIcon(6)"></div><br><br>';
setDialogMode(2, "Pictogram selectie", 0, null, x);
QV('id_dialogclose', true);
}
function p10setIcon(icon) {
setDialogMode(0);
meshserver.send({ action: 'changedevice', nodeid: currentNode._id, icon: icon });
}
var showEditNodeValueDialog_modes = ["Apparaat naam", "Hostname", "Omschrijving", "Tags"];
var showEditNodeValueDialog_modes2 = ['name', 'host', 'desc', 'tags'];
var showEditNodeValueDialog_modes3 = ['', '', '', "Tag1, Tag2, Tag3"];
function showEditNodeValueDialog(mode) {
if (xxdialogMode) return;
var x = addHtmlValue(showEditNodeValueDialog_modes[mode], '<input id=dp10devicevalue maxlength=64 placeholder="' + showEditNodeValueDialog_modes3[mode] + '" onchange=p10editdevicevalueValidate(' + mode + ',event) onkeyup=p10editdevicevalueValidate(' + mode + ',event) />');
setDialogMode(2, "Bewerk apparaat", 3, showEditNodeValueDialogEx, x, mode);
var v = currentNode[showEditNodeValueDialog_modes2[mode]];
if (v == null) v = '';
if (Array.isArray(v)) { v = v.join(', '); }
Q('dp10devicevalue').value = v;
p10editdevicevalueValidate();
Q('dp10devicevalue').focus();
}
function showEditNodeValueDialogEx(button, mode) {
var x = { action: 'changedevice', nodeid: currentNode._id };
x[showEditNodeValueDialog_modes2[mode]] = Q('dp10devicevalue').value;
meshserver.send(x);
}
function p10editdevicevalueValidate(mode, e) {
var x = ((mode > 1) || (Q('dp10devicevalue').value.length > 0));
QE('idx_dlgOkButton', x);
if ((e != null) && (x == true) && (e.keyCode == 13)) { dialogclose(1); }
}
//
// DESKTOP
//
var desktopNode;
function setupDesktop() {
// Setup the remote desktop
if ((desktopNode != currentNode) && (desktop != null)) { desktop.Stop(); desktopNode = null; desktop = null; }
// If the device desktop is already connected in multi-desktop, use that.
if ((desktopNode != currentNode) || (desktop == null)) {
var xdesk = multiDesktop[currentNode._id];
if (xdesk != null) {
// This device already has a canvas, use it.
QH('DeskParent', '');
var c = xdesk.m.CanvasId;
c.setAttribute('id', 'Desk');
c.setAttribute('onmousedown', 'dmousedown(event)');
c.setAttribute('onmouseup', 'dmouseup(event)');
c.setAttribute('onmousemove', 'dmousemove(event)');
c.removeAttribute('onclick');
Q('DeskParent').appendChild(c);
desktop = xdesk;
if (desktop.m.SendCompressionLevel) { desktop.m.SendCompressionLevel(1, desktopsettings.quality, desktopsettings.scaling, desktopsettings.framerate); }
desktop.onStateChanged = onDesktopStateChange;
desktopNode = currentNode;
onDesktopStateChange(desktop, desktop.State);
delete multiDesktop[currentNode._id];
} else {
// Device is not already connected, just setup a blank canvas
QH('DeskParent', '<canvas id=Desk oncontextmenu="return false" onmousedown=dmousedown(event) onmouseup=dmouseup(event) onmousemove=dmousemove(event)></canvas>');
desktopNode = currentNode;
}
// Setup the mouse wheel
Q('Desk').addEventListener('DOMMouseScroll', function (e) { return dmousewheel(e); });
Q('Desk').addEventListener('mousewheel', function (e) { return dmousewheel(e); });
}
desktopNode = currentNode;
updateDesktopButtons();
deskAdjust();
// On some browsers like IE, we can't save screen shots. Hide the scheenshot/capture buttons.
if (!Q('Desk')['toBlob']) { QV('deskSaveBtn', false); }
}
// Show and enable the right buttons
function updateDesktopButtons() {
var mesh = meshes[currentNode.meshid];
var deskState = 0;
if (desktop != null) { deskState = desktop.State; }
var meshrights = mesh.links[userinfo._id].rights;
// Show the right buttons
QV('disconnectbutton1span', (deskState != 0));
QV('connectbutton1span', (deskState == 0) && ((meshrights & 8) || (meshrights & 256)) && (mesh.mtype == 2) && (currentNode.agent.caps & 1));
QV('connectbutton1hspan',
(deskState == 0) &&
(meshrights & 8) &&
((mesh.mtype == 1) ||
((currentNode.intelamt != null) &&
(currentNode.intelamt.state == 2) &&
(currentNode.intelamt.ver != null) &&
(typeof currentNode.intelamt.sku == 'number') &&
((currentNode.intelamt.sku & 8) != 0))
)
);
// Show the right settings
QV('d7amtkvm', (currentNode.intelamt != null && ((currentNode.intelamt.ver != null) || (mesh.mtype == 1))) && ((deskState == 0) || (desktop.contype == 2)));
QV('d7meshkvm', (webRtcDesktop) || ((mesh.mtype == 2) && (currentNode.agent.caps & 1) && ((deskState == false) || (desktop.contype == 1))));
// Enable buttons
var inputAllowed = (meshrights == 0xFFFFFFFF) || (((meshrights & 8) != 0) && ((meshrights & 256) == 0) && ((meshrights & 4096) == 0));
var online = ((currentNode.conn & 1) != 0); // If Agent (1) connected, enable remote desktop
QE('connectbutton1', online);
var hwonline = ((currentNode.conn & 6) != 0); // If CIRA (2) or AMT (4) connected, enable hardware terminal
QE('connectbutton1h', hwonline);
QE('deskSaveBtn', deskState == 3);
QV('deskFocusBtn', (desktop != null) && (desktop.contype == 2) && (deskState != 0) && (desktopsettings.showfocus));
QV('DeskClip', (currentNode.agent) && (currentNode.agent.id != 11) && (currentNode.agent.id != 16) && ((desktop == null) || (desktop.contype != 2))); // Clipboard not supported on MacOS
QE('DeskClip', deskState == 3);
QE('DeskType', deskState == 3);
QV('DeskWD', inputAllowed);
QE('DeskWD', deskState == 3);
QV('deskkeys', inputAllowed);
QE('deskkeys', deskState == 3);
// Display this only if we have Chat & Notify permissions
QV('DeskChatButton', ((meshrights & 16384) != 0) && (browserfullscreen == false) && (inputAllowed) && (mesh.mtype == 2) && online);
QV('DeskNotifyButton', ((meshrights & 16384) != 0) && (browserfullscreen == false) && (currentNode.agent) && (currentNode.agent.id < 5) && (inputAllowed) && (mesh.mtype == 2) && online);
QV('DeskToolsButton', (inputAllowed) && (mesh.mtype == 2) && online);
QV('DeskOpenWebButton', (browserfullscreen == false) && (inputAllowed) && (mesh.mtype == 2) && online);
QV('DeskBackgroundButton', (deskState == 3) && (desktop.contype == 1) && (mesh.mtype == 2) && (currentNode.agent.id != 11) && (currentNode.agent.id != 16) && online);
QV('DeskControlSpan', inputAllowed)
QV('deskActionsBtn', (browserfullscreen == false));
QV('deskActionsSettings', (browserfullscreen == false));
if (meshrights & 8) { Q('DeskControl').checked = (getstore('DeskControl', 1) == 1); } else { Q('DeskControl').checked = false; }
if (online == false) QV('DeskTools', false);
}
// Debug
var autoConnectDesktopTimer = null;
function autoConnectDesktop(e) { if (autoConnectDesktopTimer == null) { autoConnectDesktopTimer = setInterval(function() { connectDesktop(null, 1) }, 1000); } else { clearInterval(autoConnectDesktopTimer); autoConnectDesktopTimer = null; } }
function connectDesktop(e, contype, tsid) {
if (xxdialogMode) return;
if ((e != null) && (e.shiftKey == false) && (contype == 3)) { contype = 1; } // If the shift key is not pressed, don't try to ask for session list.
QV('p11DeskSessionSelector', false);
p11clearConsoleMsg();
if (desktop == null) {
desktopNode = currentNode;
if (contype == 2) {
// Setup the Intel AMT remote desktop
if ((desktopNode.intelamt.user == null) || (desktopNode.intelamt.user == '')) { editDeviceAmtSettings(desktopNode._id, connectDesktop, 2); return; }
desktop = CreateAmtRedirect(CreateAmtRemoteDesktop('Desk'), authCookie);
desktop.debugmode = debugmode;
desktop.onStateChanged = onDesktopStateChange;
desktop.m.bpp = (desktopsettings.encoding == 1 || desktopsettings.encoding == 3) ? 1 : 2;
desktop.m.useZRLE = (desktopsettings.encoding < 3);
desktop.m.localKeyMap = desktopsettings.localkeymap;
desktop.m.showmouse = desktopsettings.showmouse;
desktop.m.onScreenSizeChange = deskAdjust;
desktop.m.onKvmData = function (x) {
//console.log('onKvmData (' + x.length + '): ' + x);
// Send the presense probe only once if needed.
if (x.length == 0) { if (!desktop.m._sentPresence) { desktop.m._sentPresence = true; desktop.m.sendKvmData(JSON.stringify({ action: 'present', ver: 1 })); } return; }
var data = null;
try { data = JSON.parse(x); } catch (e) { }
if ((data != null) && (data.action != null)) {
if (data.action == 'restart') {
// Clear WebRTC channel
webRtcDesktopReset();
desktop.m.sendKvmData(JSON.stringify({ action: 'present', ver: 1 }));
} else if ((data.action == 'present') && (webRtcDesktop == null)) {
// Setup WebRTC channel
webRtcDesktop = { platform: data.platform };
var configuration = null; //{ "iceServers": [ { 'urls': 'stun:stun.services.mozilla.com' }, { 'urls': 'stun:stun.l.google.com:19302' } ] };
if (typeof RTCPeerConnection !== 'undefined') { webRtcDesktop.webrtc = new RTCPeerConnection(configuration); }
else if (typeof webkitRTCPeerConnection !== 'undefined') { webRtcDesktop.webrtc = new webkitRTCPeerConnection(configuration); }
webRtcDesktop.webchannel = webRtcDesktop.webrtc.createDataChannel("Data kanaal", {}); // { ordered: false, maxRetransmits: 2 }
webRtcDesktop.webchannel.onopen = function () {
// Switch to software KVM
//if (urlvars && urlvars['kvmdatatrace']) { console.log('WebRTC Data Channel Open'); }
console.log('WebRTC Data Channel Open');
Q('deskstatus').textContent = StatusStrs[desktop.State] + ", Soft-KVM";
desktop.m.hold(true);
webRtcDesktop.webRtcActive = true;
webRtcDesktop.softdesktop = CreateKvmDataChannel(webRtcDesktop.webchannel, CreateAgentRemoteDesktop('Desk', Q('id_mainarea')), desktop.m);
webRtcDesktop.softdesktop.m.setRotation(desktop.m.rotation);
webRtcDesktop.softdesktop.m.onScreenSizeChange = deskAdjust;
if (desktopsettings.quality) { webRtcDesktop.softdesktop.m.CompressionLevel = desktopsettings.quality; } // Number from 1 to 100. 50 or less is best.
if (desktopsettings.scaling) { webRtcDesktop.softdesktop.m.ScalingLevel = desktopsettings.scaling; }
webRtcDesktop.softdesktop.Start();
// Check if we can get remote file access
// ###BEGIN###{DesktopInbandFiles}
/*
QV('go24', true); // Files
downloadFile = null;
p24files = webRtcDesktop.softdesktop;
p24targetpath = '';
webRtcDesktop.softdesktop.onControlMsg = onFilesControlData;
webRtcDesktop.softdesktop.sendCtrlMsg(JSON.stringify({ action: 'ls', reqid: 1, path: '' })); // Ask for the root folder
*/
// ###END###{DesktopInbandFiles}
}
webRtcDesktop.webchannel.onclose = function (event) {
//if (urlvars['kvmdatatrace']) { console.log('WebRTC Data Channel Closed'); }
console.log('WebRTC Data Channel Closed');
webRtcDesktopReset();
}
webRtcDesktop.webrtc.onicecandidate = function (e) {
if (e.candidate == null) {
desktop.m.sendKvmData(JSON.stringify({ action: 'offer', ver: 1, sdp: webRtcDesktop.webrtcoffer.sdp }));
} else {
webRtcDesktop.webrtcoffer.sdp += ('a=' + e.candidate.candidate + '\r\n'); // New candidate, add it to the SDP
}
}
webRtcDesktop.webrtc.oniceconnectionstatechange = function () {
if ((webRtcDesktop != null) && (webRtcDesktop.webrtc != null) && ((webRtcDesktop.webrtc.iceConnectionState == 'disconnected') || (webRtcDesktop.webrtc.iceConnectionState == 'failed'))) { /*console.log('WebRTC ICE Failed');*/ webRtcDesktopReset(); }
}
webRtcDesktop.webrtc.createOffer(function (offer) {
// Got the offer
webRtcDesktop.webrtcoffer = offer;
webRtcDesktop.webrtc.setLocalDescription(offer, function () { }, webRtcDesktopReset);
}, webRtcDesktopReset, { mandatory: { OfferToReceiveAudio: false, OfferToReceiveVideo: false } });
} else if ((data.action == 'answer') && (webRtcDesktop != null)) {
// Complete the WebRTC channel
webRtcDesktop.webrtc.setRemoteDescription(new RTCSessionDescription({ type: 'answer', sdp: data.sdp }), function () { }, webRtcDesktopReset);
}
}
};
desktop.Start(desktopNode._id, 16994, '*', '*', 0);
desktop.contype = 2;
} else if ((contype == null) || (contype == 1) || ((contype == 3) && (currentNode.agent.id > 4))) {
// Setup the Mesh Agent remote desktop
desktop = CreateAgentRedirect(meshserver, CreateAgentRemoteDesktop('Desk'), serverPublicNamePort, authCookie, authRelayCookie, domainUrl);
desktop.debugmode = debugmode;
desktop.m.debugmode = debugmode;
desktop.attemptWebRTC = attemptWebRTC;
if (tsid != null) { desktop.options = { tsid: tsid }; }
desktop.onStateChanged = onDesktopStateChange;
desktop.onConsoleMessageChange = function () {
p11clearConsoleMsg();
if (desktop.consoleMessage) {
QH('p11DeskConsoleMsg', EscapeHtml(desktop.consoleMessage).split('\n').join('<br />'));
QV('p11DeskConsoleMsg', true);
p11DeskConsoleMsgTimer = setTimeout(p11clearConsoleMsg, 8000);
}
}
desktop.m.CompressionLevel = desktopsettings.quality; // Number from 1 to 100. 50 or less is best.
desktop.m.ScalingLevel = desktopsettings.scaling;
desktop.m.FrameRateTimer = desktopsettings.framerate;
desktop.m.onDisplayinfo = deskDisplayInfo;
desktop.m.onScreenSizeChange = deskAdjust;
desktop.Start(desktopNode._id);
desktop.contype = 1;
} else if (contype == 3) {
// Ask for user sessions
meshserver.send({ action: 'msg', type: 'userSessions', nodeid: currentNode._id });
}
} else {
// Disconnect and clean up the remote desktop
desktop.Stop();
webRtcDesktopReset();
desktopNode = desktop = null;
if (pluginHandler != null) { pluginHandler.callHook('onDesktopDisconnect'); }
}
}
function p11clearConsoleMsg() { QV('p11DeskConsoleMsg', false); if (p11DeskConsoleMsgTimer) { clearTimeout(p11DeskConsoleMsgTimer); p11DeskConsoleMsgTimer = null; } }
function p12clearConsoleMsg() { QV('p12TermConsoleMsg', false); if (p12TermConsoleMsgTimer) { clearTimeout(p12TermConsoleMsgTimer); p12TermConsoleMsgTimer = null; } }
function p13clearConsoleMsg() { QV('p13FilesConsoleMsg', false); if (p13FilesConsoleMsgTimer) { clearTimeout(p13FilesConsoleMsgTimer); p13FilesConsoleMsgTimer = null; } }
var webRtcDesktop = null;
function webRtcDesktopReset() {
if (webRtcDesktop == null) return;
if (webRtcDesktop.softdesktop != null) { webRtcDesktop.softdesktop.Stop(); webRtcDesktop.softdesktop = null; }
if (webRtcDesktop.webchannel != null) { try { webRtcDesktop.webchannel.close(); } catch (e) { } webRtcDesktop.webchannel = null; }
if (webRtcDesktop.webrtc != null) { try { webRtcDesktop.webrtc.close(); } catch (e) { } webRtcDesktop.webrtc = null; }
webRtcDesktop = null;
// Switch back to hardware KVM
if (desktop && desktop.m) {
desktop.m.hold(false);
Q('deskstatus').textContent = StatusStrs[desktop.State];
}
// ###BEGIN###{DesktopInbandFiles}
/*
p24files = null;
p24downloadFileCancel() // If any downloads are in process, cancel them.
p24uploadFileCancel(); // If any uploads are in process, cancel them.
QV('go24', false); // Files
if (currentView == 24) { go(14); }
*/
// ###END###{DesktopInbandFiles}
}
function onDesktopStateChange(xdesktop, state) {
var xstate = state;
if ((xstate == 3) && (xdesktop.contype == 2)) { xstate++; }
var str = StatusStrs[xstate];
if ((desktop != null) && (desktop.webRtcActive == true)) { str += ", WebRTC"; }
//if (desktop.m.stopInput == true) { str += ', Loopback'; }
QH('deskstatus', str);
switch (state) {
case 0:
// Disconnect and clean up the remote desktop
desktop.Stop();
desktopNode = desktop = null;
QV('DeskFocus', false);
QV('termdisplays', false);
QV('deskRecordIcon', false);
deskFocusBtn.value = "All Focus";
if (fullscreen == true) { deskToggleFull(); }
webRtcDesktopReset();
deskPreferedStickyDisplay = 0;
break;
case 2:
break;
case 3:
if (desktop && (desktop.serverIsRecording == true)) { QV('deskRecordIcon', true); }
desktop.startTime = new Date();
if (updateSessionTimer == null) { updateSessionTimer = setInterval(updateSessionTime, 1000); }
break;
default:
//console.log('Unknown onDesktopStateChange state', state);
break;
}
updateDesktopButtons();
deskAdjust();
setTimeout(deskAdjust, 50);
}
function updateSessionTime() {
// Desktop
var seconds = 0;
if (desktop && desktop.startTime) {
seconds = Math.floor((new Date() - desktop.startTime) / 1000);
QH('DeskTimer', zeroPad(Math.floor(seconds / 3600), 2) + ':' + zeroPad((Math.floor(seconds / 60) % 60), 2) + ':' + zeroPad((seconds % 60), 2));
} else {
QH('DeskTimer', '');
}
// Terminal
seconds = 0;
if (terminal && terminal.startTime) {
seconds = Math.floor((new Date() - terminal.startTime) / 1000);
QH('TermTimer', zeroPad(Math.floor(seconds / 3600), 2) + ':' + zeroPad((Math.floor(seconds / 60) % 60), 2) + ':' + zeroPad((seconds % 60), 2));
} else {
QH('TermTimer', '');
}
if ((desktop == null) && (terminal == null)) { clearInterval(updateSessionTimer); updateSessionTimer = null; }
}
function showDesktopSettings() {
if (xxdialogMode) return;
applyDesktopSettings();
updateDesktopButtons();
setDialogMode(7, "Instellingen extern bureaublad", 3, showDesktopSettingsChanged);
}
function showDesktopSettingsChanged() {
desktopsettings.encoding = d7desktopmode.value;
desktopsettings.showfocus = d7showfocus.checked;
desktopsettings.showmouse = d7showcursor.checked;
desktopsettings.quality = d7bitmapquality.value;
desktopsettings.scaling = d7bitmapscaling.value;
desktopsettings.framerate = d7framelimiter.value;
desktopsettings.localkeymap = d7localKeyMap.checked;
localStorage.setItem('desktopsettings', JSON.stringify(desktopsettings));
applyDesktopSettings();
if (desktop) {
if (desktop.contype == 1) {
if (desktop.State != 0) {
desktop.m.SendCompressionLevel(1, desktopsettings.quality, desktopsettings.scaling, desktopsettings.framerate);
}
}
if (desktop.contype == 2) {
if (desktopsettings.showfocus == false) { desktop.m.focusmode = 0; deskFocusBtn.value = "All Focus"; }
if (desktop.State != 0) { desktop.Stop(); setTimeout(function () { connectDesktop(null, 2); }, 50); }
}
}
}
function applyDesktopSettings() {
var r = '', ops = (features & 512)?[90,80,70,60,50,40,30,20,10,5,1]:[60,50,40,30,20,10,5,1];
for (var i in ops) { r += '<option value=' + ops[i] + '>' + ops[i] + '%</option>'; }
QH('d7bitmapquality', r);
d7desktopmode.value = desktopsettings.encoding;
d7showfocus.checked = desktopsettings.showfocus;
d7showcursor.checked = desktopsettings.showmouse;
d7bitmapquality.value = 40; // Default value
if (ops.indexOf(parseInt(desktopsettings.quality)) >= 0) { d7bitmapquality.value = desktopsettings.quality; }
d7bitmapscaling.value = desktopsettings.scaling;
if (desktopsettings.framerate) { d7framelimiter.value = desktopsettings.framerate; }
if (desktopsettings.localkeymap) { d7localKeyMap.checked = desktopsettings.localkeymap; }
QV('deskFocusBtn', (desktop != null) && (desktop.contype == 2) && (desktop.state != 0) && (desktopsettings.showfocus));
}
// Enter browser fullscreen
function enterBrowserFullscreen(elem) {
if (elem.requestFullscreen) { elem.requestFullscreen(); }
else if (elem.msRequestFullscreen) { elem.msRequestFullscreen(); }
else if (elem.mozRequestFullScreen) { elem.mozRequestFullScreen(); }
else if (elem.webkitRequestFullscreen) { elem.webkitRequestFullscreen(Element.ALLOW_KEYBOARD_INPUT); }
}
// Exit browser fullscreen
function exitBrowserFullscreen() {
if (document.exitFullscreen) { document.exitFullscreen(); }
else if (document.msExitFullscreen) { document.msExitFullscreen(); }
else if (document.mozCancelFullScreen) { document.mozCancelFullScreen(); }
else if (document.webkitExitFullscreen) { document.webkitExitFullscreen(); }
}
// Return true if the browser is fullscreen. This is a delayed method that will return true/false late. Not very useful.
function isBrowserFullscreen() {
if (!document.fullscreenElement && !document.mozFullScreenElement && !document.webkitFullscreenElement && !document.msFullscreenElement) { return false; } else { return true; }
}
var fullscreen = false;
var browserfullscreen = false;
function deskToggleFull(e) {
fullscreen = !fullscreen;
if (fullscreen) {
QC('body').add('fulldesk');
QS('deskarea3x')['height'] = '100%';
QS('deskarea3x')['max-height'] = '100%';
// If shift is pressed, enter browser full screen.
if (e.shiftKey == true) { enterBrowserFullscreen(Q('deskarea0')); browserfullscreen = true; }
} else {
QC('body').remove('fulldesk');
QS('deskarea3x')['height'] = null;
QS('deskarea3x')['max-height'] = null;
if (browserfullscreen == true) { exitBrowserFullscreen(); browserfullscreen = false; }
}
deskAdjust();
updateDesktopButtons();
}
function deskToggleFocus() {
desktop.m.focusmode = (desktop.m.focusmode + 64) % 192;
Q('deskFocusBtn').value = ["All Focus", "Kleine focus", "Grote focus"][desktop.m.focusmode / 64];
}
function deskAdjust() {
var parentH = Q('DeskParent').clientHeight, parentW = Q('DeskParent').clientWidth;
var deskH = Q('Desk').height, deskW = Q('Desk').width;
if (deskAspectRatio == 2) {
// Scale mode
QS('Desk')['margin-top'] = null;
QS('Desk').height = '100%';
QS('Desk').width = '100%';
//QS('deskarea3x').height = null;
QS('DeskParent').overflow = 'hidden';
} else if (deskAspectRatio == 1) {
// Zoomed mode
QS('Desk')['margin-top'] = '0px';
QS('Desk').height = deskH + 'px';
QS('Desk').width = deskW + 'px';
QS('DeskParent').overflow = 'scroll';
} else {
// Fixed aspect ratio
if ((parentH / parentW) > (deskH / deskW)) {
var hNew = ((deskH * parentW) / deskW) + 'px';
//if (webPageFullScreen || fullscreen) {
//QS('deskarea3x').height = null;
//} else {
// QS('deskarea3x').height = hNew;
//QS('deskarea3x').height = null;
//}
QS('Desk').height = hNew;
QS('Desk').width = '100%';
} else {
var wNew = ((deskW * parentH) / deskH) + 'px';
if (webPageFullScreen || fullscreen) {
QS('Desk').height = null;
} else {
QS('Desk').height = '100%';
}
QS('Desk').width = wNew;
}
QS('Desk')['margin-top'] = null;
QS('DeskParent').overflow = 'hidden';
}
}
function mdeskAdjust(mod, sw, sh, cv) {
if (!mod || !sw || !sh || !cv) return;
// Check if we are in single desktop mode
if (cv.id == 'Desk') { deskAdjust(); return; }
// Figure out and adjust the size to fill the width of the div
var vsize = [{ x: 180, y: 101 }, { x: 302, y: 169 }, { x: 454, y: 255 }][Q('sizeselect').selectedIndex];
var realw = vsize.x + 2, tw = Q('xdevices').clientWidth - 30, xw = Math.floor(tw / realw);
xw = realw + Math.floor((tw - (xw * realw)) / xw);
vsize.y = vsize.y * (xw / vsize.x);
vsize.x = xw;
var mh = vsize.y, mw = vsize.x;
if (mod.State != 0) { mh = vsize.y; mw = (sw / sh) * vsize.y; }
QS(cv.id)['max-height'] = mh + 'px';
QS(cv.id)['max-width'] = mw + 'px';
QS(cv.id)['margin-top'] = '0';
QS(cv.id)['margin-bottom'] = '0';
}
// Remote desktop special key combos for Windows
function deskSendKeys() {
if (xxdialogMode || desktop == null || desktop.State != 3) return;
var ks = Q('deskkeys').value;
if (ks == 0) { // WIN+Down arrow
if (desktop.contype == 2) {
desktop.m.sendkey([[0xffe7,1],[0xff54,1],[0xff54,0],[0xffe7,0]]); // Intel AMT: Meta-left down, Down arrow press, Down arrow release, Meta-left release
} else {
desktop.m.SendKeyMsgKC([[desktop.m.KeyAction.EXDOWN,0x5B],[desktop.m.KeyAction.DOWN,40],[desktop.m.KeyAction.UP,40],[desktop.m.KeyAction.EXUP,0x5B]]); // Agent: L-Winkey press, Down arrow press, Down arrow release, L-Winkey release
}
} else if (ks == 1) { // WIN+Up arrow
if (desktop.contype == 2) {
desktop.m.sendkey([[0xffe7,1],[0xff52,1],[0xff52,0],[0xffe7,0]]); // Intel AMT: Meta-left down, Up arrow press, Up arrow release, Meta-left release
} else {
desktop.m.SendKeyMsgKC([[desktop.m.KeyAction.EXDOWN,0x5B],[desktop.m.KeyAction.DOWN,38],[desktop.m.KeyAction.UP,38],[desktop.m.KeyAction.EXUP,0x5B]]); // MeshAgent: L-Winkey press, Up arrow press, Up arrow release, L-Winkey release
}
} else if (ks == 2) { // WIN+L arrow
if (desktop.contype == 2) {
desktop.m.sendkey([[0xffe7,1],[0x6c,1],[0x6c,0],[0xffe7,0]]); // Intel AMT: Meta-left down, 'l' press, 'l' release, Meta-left release
} else {
desktop.sendCtrlMsg('{"action":"lock"}');
//desktop.m.SendKeyMsgKC([[desktop.m.KeyAction.EXDOWN,0x5B],[desktop.m.KeyAction.DOWN,76],[desktop.m.KeyAction.UP,76],[desktop.m.KeyAction.EXUP,0x5B]]); // MeshAgent: L-Winkey press, 'L' press, 'L' release, L-Winkey release
//desktop.m.SendKeyMsgKC(desktop.m.KeyAction.EXDOWN, 0x5B);
//desktop.m.SendKeyMsgKC(desktop.m.KeyAction.DOWN, 76);
//desktop.m.SendKeyMsgKC(desktop.m.KeyAction.UP, 76);
//desktop.m.SendKeyMsgKC(desktop.m.KeyAction.EXUP, 0x5B);
}
} else if (ks == 3) { // WIN+M arrow
if (desktop.contype == 2) {
desktop.m.sendkey([[0xffe7,1],[0x6d,1],[0x6d,0],[0xffe7,0]]); // Intel AMT: Meta-left down, 'm' press, 'm' release, Meta-left release
} else {
desktop.m.SendKeyMsgKC([[desktop.m.KeyAction.EXDOWN,0x5B],[desktop.m.KeyAction.DOWN,77],[desktop.m.KeyAction.UP,77],[desktop.m.KeyAction.EXUP,0x5B]]); // MeshAgent: L-Winkey press, 'M' press, 'M' release, L-Winkey release
}
} else if (ks == 4) { // Shift+WIN+M arrow
if (desktop.contype == 2) {
desktop.m.sendkey([[0xffe1,1],[0xffe7,1],[0x6d,1],[0x6d,0],[0xffe7,0],[0xffe1,0]]); // Intel AMT: Shift-left down, Meta-left down, 'm' press, 'm' release, Meta-left release, Shift-left release
} else {
desktop.m.SendKeyMsgKC([[desktop.m.KeyAction.DOWN,16],[desktop.m.KeyAction.EXDOWN,0x5B],[desktop.m.KeyAction.DOWN,77],[desktop.m.KeyAction.UP,77],[desktop.m.KeyAction.EXUP,0x5B],[desktop.m.KeyAction.UP, 16]]); // MeshAgent: L-shift press, L-Winkey press, 'M' press, 'M' release, L-Winkey release, L-shift release
}
} else if (ks == 5) { // WIN
if (desktop.contype == 2) {
desktop.m.sendkey([[0xffe7,1],[0xffe7,0]]); // Intel AMT: Meta-left down, Meta-left release
} else {
desktop.m.SendKeyMsgKC([[desktop.m.KeyAction.EXDOWN,0x5B], [desktop.m.KeyAction.EXUP,0x5B]]); // MeshAgent: L-Winkey press, L-Winkey release
}
} else if (ks == 6) { // WIN+R
if (desktop.contype == 2) {
desktop.m.sendkey([[0xffe7,1],[0x72,1],[0x72,0],[0xffe7,0]]); // Intel AMT: Meta-left down, 'r' press, 'r' release, Meta-left release
} else {
desktop.m.SendKeyMsgKC([[desktop.m.KeyAction.EXDOWN, 0x5B], [desktop.m.KeyAction.DOWN, 82], [desktop.m.KeyAction.UP, 82], [desktop.m.KeyAction.EXUP, 0x5B]]); // MeshAgent: L-Winkey press, 'R' press, 'R' release, L-Winkey release
}
} else if (ks == 7) { // ALT-F4
if (desktop.contype == 2) {
desktop.m.sendkey([[0xffe9,1],[0xffc1,1],[0xffc1,0],[0xffe9,0]]); // Intel AMT: Alt down, 'F4' press, 'F4' release, Alt release
} else {
desktop.m.SendKeyMsgKC([[desktop.m.KeyAction.EXDOWN, 18], [desktop.m.KeyAction.DOWN, 115], [desktop.m.KeyAction.UP, 115], [desktop.m.KeyAction.EXUP, 18]]); // MeshAgent: Alt press, 'F4' press, 'F4' release, Alt release
}
} else if (ks == 8) { // CTRL-W
if (desktop.contype == 2) {
desktop.m.sendkey([[0xffe3,1],[0x77,1],[0x77,0],[0xffe3,0]]); // Intel AMT: Ctrl down, 'w' press, 'w' release, Ctrl release
} else {
desktop.m.SendKeyMsgKC([[desktop.m.KeyAction.EXDOWN, 17], [desktop.m.KeyAction.DOWN, 87], [desktop.m.KeyAction.UP, 87], [desktop.m.KeyAction.EXUP, 17]]); // MeshAgent: Ctrl press, 'W' press, 'W' release, Ctrl release
}
} else if (ks == 9) { // ALT-TAB
if (desktop.contype == 2) {
desktop.m.sendkey([[0xffe9, 1], [0xff09, 1], [0xff09, 0], [0xffe9, 0]]); // Intel AMT: Alt down, 'TAB' press, 'TAB' release, Alt release
} else {
desktop.m.SendKeyMsgKC([[desktop.m.KeyAction.EXDOWN, 18], [desktop.m.KeyAction.DOWN, 9], [desktop.m.KeyAction.UP, 9], [desktop.m.KeyAction.EXUP, 18]]); // MeshAgent: Alt press, 'TAB' press, 'TAB' release, Alt release
}
} else if (ks == 10) { // CTRL-ALT-DEL
desktop.m.sendcad();
} else if (ks == 11) { // WIN-LEFT
if (desktop.contype == 2) {
desktop.m.sendkey([[0xffe7, 1], [0xff51, 1], [0xff51, 0], [0xffe7, 0]]); // Intel AMT: Meta-left down, Left arrow press, Left arrow release, Meta-left release
} else {
desktop.m.SendKeyMsgKC([[desktop.m.KeyAction.EXDOWN, 0x5B], [desktop.m.KeyAction.DOWN, 37], [desktop.m.KeyAction.UP, 37], [desktop.m.KeyAction.EXUP, 0x5B]]);
}
} else if (ks == 12) { // WIN-RIGHT
if (desktop.contype == 2) {
desktop.m.sendkey([[0xffe7, 1], [0xff53, 1], [0xff53, 0], [0xffe7, 0]]); // Intel AMT: Meta-left down, Right arrow press, Right arrow release, Meta-left release
} else {
desktop.m.SendKeyMsgKC([[desktop.m.KeyAction.EXDOWN, 0x5B], [desktop.m.KeyAction.DOWN, 39], [desktop.m.KeyAction.UP, 39], [desktop.m.KeyAction.EXUP, 0x5B]]);
}
}
}
// Remote desktop typing
function showDeskType() {
if (xxdialogMode || desktop == null || desktop.State != 3) return;
Q('DeskType').blur();
var x = '<div>' + "Voer tekst in en klik op OK om deze op afstand te typen met een Amerikaans Engels toetsenbord. Zorg ervoor dat u de externe cursor op de juiste positie plaatst voordat u doorgaat." + '<div>';
x += '<textarea id=d2typeText style="margin-top:5px;width:100%;height:184px;resize:none" maxlength=2000></textarea>';
setDialogMode(2, "Toetsenbordinvoer op afstand", 3, showDeskTypeEx, x);
Q('d2typeText').focus();
}
var AmtDeskTypeTimer = null;
var AmtDeskTypeContent = null;
var DeskTypeTranslate = { 39: 222, 42: 106, 43: 107, 44: 188, 45: 189, 46: 190, 47: 191, 59: 186, 61: 187, 91: 219, 92: 220, 93: 221, 96: 192, 191: 111 };
var DeskTypeShiftTranslate = { 33: 49, 34: 222, 35: 51, 36: 52, 37: 53, 38: 55, 40: 57, 41: 48, 58: 186, 60: 188, 62: 190, 63: 191, 64: 50, 94: 54, 95: 189, 106: 56, 107: 187, 123: 219, 124: 220, 125: 221, 126: 192 };
function showDeskTypeEx() {
var txt = Q('d2typeText').value, ltxt = Q('d2typeText').value.toUpperCase(), x = [], shift = false;
if (desktop.contype == 2) {
// Intel AMT
for (var i in txt) { var a = txt.charCodeAt(i); x.push([a, 1], [a, 0]); }
AmtDeskTypeContent = x;
AmtDeskTypeTimer = setInterval(function () {
var key = AmtDeskTypeContent.shift();
if (desktop) { desktop.m.sendkey(key[0], key[1]); }
if ((desktop == null) || (AmtDeskTypeContent.length == 0)) { clearInterval(AmtDeskTypeTimer); AmtDeskTypeContent = null; }
}, 10);
} else {
// MeshAgent
for (var i in txt) {
var a = txt.charCodeAt(i), b = ltxt.charCodeAt(i);
if (((a >= 65) && (a <= 90)) || ((a >= 97) && (a <= 122))) {
if ((a == b) && (shift == false)) { x.push([desktop.m.KeyAction.DOWN, 16]); shift = true; } // LShift down
if ((a != b) && (shift == true)) { x.push([desktop.m.KeyAction.UP, 16]); shift = false; } // LShift up
} else if ((a >= 48) && (a <= 57)) {
if (shift == true) { x.push([desktop.m.KeyAction.UP, 16]); shift = false; } // Shift up
} else if (DeskTypeTranslate[a]) {
if (shift == true) { x.push([desktop.m.KeyAction.UP, 16]); shift = false; } // Shift up
b = DeskTypeTranslate[a];
} else if (DeskTypeShiftTranslate[a]) {
if (shift == false) { x.push([desktop.m.KeyAction.DOWN, 16]); shift = true; } // LShift down
b = DeskTypeShiftTranslate[a];
}
x.push([desktop.m.KeyAction.DOWN, b], [desktop.m.KeyAction.UP, b]);
}
if (shift == true) { x.push([desktop.m.KeyAction.UP, 16]); shift = false; } // Shift up
desktop.m.SendKeyMsgKC(x);
}
}
// Show clipboard dialog
function showDeskClip() {
if (xxdialogMode || desktop == null || desktop.State != 3) return;
Q('DeskClip').blur();
var x = '';
x += '<input id=dlgClipGet type=button value="Get Clipboard" style=width:120px onclick=showDeskClipGet()>';
x += '<input id=dlgClipSet type=button value="Set Clipboard" style=width:120px onclick=showDeskClipSet()>';
x += '<div id=dlgClipStatus style="display:inline-block;margin-left:8px" ></div>';
x += '<textarea id=d2clipText style="width:100%;height:184px;resize:none" maxlength=65535></textarea>';
x += '<input type=button value="Close" style=width:80px;float:right onclick=dialogclose(0)><div style=height:26px;margin-top:3px><span id=linuxClipWarn style=display:none>' + "Het externe klembord is 60 seconden geldig." + '</span>&nbsp;</div><div></div>';
setDialogMode(2, "extern klembord", 8, null, x, 'clipboard');
Q('d2clipText').focus();
}
function showDeskClipGet() {
if (desktop == null || desktop.State != 3) return;
meshserver.send({ action: 'msg', type: 'getclip', nodeid: currentNode._id });
}
function showDeskClipSet() {
if (desktop == null || desktop.State != 3) return;
meshserver.send({ action: 'msg', type: 'setclip', nodeid: currentNode._id, data: Q('d2clipText').value });
QV('linuxClipWarn', currentNode && currentNode.agent && (currentNode.agent.id > 4) && (currentNode.agent.id != 21) && (currentNode.agent.id != 22));
}
// Send CTRL-ALT-DEL
function sendCAD() {
if (xxdialogMode || desktop == null || desktop.State != 3) return;
desktop.m.sendcad();
}
// Show process dialogs
function toggleDeskTools() {
if (xxdialogMode) return;
if (QS('DeskTools').display == 'none') {
QV('DeskTools', true);
Q('DeskTools').nodeid = currentNode._id;
QH('DeskToolsProcesses', '');
QH('DeskToolsServices', '');
QV('deskToolsTopTabService', false);
changeDeskToolTab(0)
refreshDeskTools(0);
refreshDeskTools(1);
} else {
QV('DeskTools', false);
}
}
var deskToolTabSelection = 0;
function changeDeskToolTab(tabnum) {
deskToolTabSelection = tabnum;
QV('DeskToolsProcessTab', tabnum == 0);
QV('DeskToolsServiceTab', tabnum == 1);
QS('deskToolsTopTabProcess')['bottom'] = (tabnum == 0) ? '0px' : '3px';
QS('deskToolsTopTabService')['bottom'] = (tabnum == 1) ? '0px' : '3px';
QS('deskToolsTopTabProcess')['color'] = (tabnum == 0) ? 'black' : 'gray';
QS('deskToolsTopTabService')['color'] = (tabnum == 1) ? 'black' : 'gray';
}
// Refresh all of the desktop tool panels
function refreshDeskTools(x) {
var sel = (x == null) ? deskToolTabSelection : x;
QV('DeskToolsRefreshButton', false);
setTimeout(refreshDeskToolsEx, 500);
if (sel == 0) meshserver.send({ action: 'msg', type: 'ps', nodeid: currentNode._id });
if (sel == 1) meshserver.send({ action: 'msg', type: 'services', nodeid: currentNode._id });
}
function refreshDeskToolsEx() { QV('DeskToolsRefreshButton', true); }
var deskTools = { sort: 1, ssort: 1, msg: null, smsg: null };
function sortProcess(sort) { deskTools.sort = sort; showDeskToolsProcesses(deskTools.msg); }
function sortService(sort) { deskTools.ssort = sort; showDeskToolsServices(deskTools.smsg); }
function sortProcessPid(a, b) { if (a.p > b.p) return 1; if (a.p < b.p) return (-1); return sortProcessName(a, b); }
function sortProcessName(a, b) { if (a.d > b.d) return 1; if (a.d < b.d) return (-1); return 0; }
function showDeskToolsProcesses(message) {
deskTools.msg = message;
if (message == null) { QH('DeskToolsProcesses', ''); return; }
if (Q('DeskTools').nodeid != message.nodeid) return;
var p = [], processes = null;
try { processes = JSON.parse(message.value); } catch (e) { }
if (processes != null) {
for (var pid in processes) { p.push( { p:parseInt(pid), c:processes[pid].cmd, d:processes[pid].cmd.toLowerCase(), u: processes[pid].user } ); }
if (deskTools.sort == 0) { p.sort(sortProcessPid); } else if (deskTools.sort == 1) { p.sort(sortProcessName); }
var x = '';
for (var i in p) {
if (p[i].p != 0) {
var c = p[i].c;
if (c.length > 30) { c = '<span title="' + c + '">' + c.substring(0,30) + '...</span>' }
x += '<div class=deskToolsBar><div style=width:50px;float:left;text-align:right;padding-right:5px>' + p[i].p + '</div><a href=# style=float:right;padding-right:5px;cursor:pointer title="Stop process" onclick=\'return stopProcess(' + p[i].p + ',"' + p[i].c + '")\'><img width=10 height=10 src="images/trash.png"></a><div style=float:right;padding-right:5px>' + (p[i].u ? p[i].u : '') + '</div><div>' + c + '</div></div>';
}
}
QH('DeskToolsProcesses', x);
}
}
function showDeskToolsServices(message) {
deskTools.smsg = message;
if (message == null) { QH('DeskToolsProcesses', ''); return; }
if (Q('DeskTools').nodeid != message.nodeid) return;
QV('deskToolsTopTabService', true);
var s = [], services = null;
try { services = JSON.parse(message.value); } catch (e) { }
deskTools.services = services;
if (services != null) {
for (var i in services) {
if (services[i].status) {
// Windows
s.push({ p: capitalizeFirstLetter(services[i].status.state.toLowerCase()), d: services[i].displayName, i: i });
} else if (services[i].serviceType) {
// Linux (TODO: This the service status is not displayed, not sure start/stop/restart will work).
s.push({ p: services[i].serviceType, d: services[i].name, i: i });
}
}
if (deskTools.ssort == 0) { s.sort(sortProcessPid); } else if (deskTools.ssort == 1) { s.sort(sortProcessName); }
var x = '';
for (var i in s) {
if (s[i].p != 0) {
var c = s[i].d;
if (c.length > 30) { c = '<span title="' + c + '">' + c.substring(0, 30) + '...</span>' }
x += '<div onclick=showServiceDetailsDialog(' + s[i].i + ') class=deskToolsBar><div style=width:70px;float:left;padding-right:5px>' + s[i].p + '</div><div>' + c + '</div></div>';
}
}
QH('DeskToolsServices', x);
}
}
function showServiceDetailsDialog(index) {
if (xxdialogMode) return;
var service = deskTools.services[index];
if (service != null) {
var x = '';
if (service.name) { x += addHtmlValue("Naam", service.name); }
if (service.displayName) { x += addHtmlValue("Schermnaam", service.displayName); }
if (service.status) {
if (service.status.state) { x += addHtmlValue("Status", capitalizeFirstLetter(service.status.state.toLowerCase())); }
if (service.status.pid) { x += addHtmlValue("PID", service.status.pid); }
var serviceTypes = [];
if (service.status.isFileSystemDriver === true) { serviceTypes.push("Bestandssysteem stuurprogramma"); }
if (service.status.isInteractive === true) { serviceTypes.push("Interactief"); }
if (service.status.isKernelDriver === true) { serviceTypes.push("KernelDriver"); }
if (service.status.isOwnProcess === true) { serviceTypes.push("Eigen proces"); }
if (service.status.isSharedProcess === true) { serviceTypes.push("Gedeeld proces"); }
if (serviceTypes.length > 0) { x += addHtmlValue("Typen", serviceTypes.join(', ')); }
}
x += '<br/><div style=float:right;margin-bottom:12px><input type=button value=\"' + "Sluiten" + '\" onclick=showServiceDetailsDialogEx(0,' + index + ')></div><div style=margin-bottom:12px><input type=button value=\"' + "Start" + '\" onclick=showServiceDetailsDialogEx(1,' + index + ')><input type=button value=\"' + "Stop" + '\" onclick=showServiceDetailsDialogEx(2,' + index + ')><input type=button value=\"' + "Herstarten" + '\" onclick=showServiceDetailsDialogEx(3,' + index + ')></div>';
setDialogMode(2, "Servicegegevens", 8, null, x, name);
}
}
function showServiceDetailsDialogEx(action, index) {
setDialogMode(0);
if (action == 0) return;
var service = deskTools.services[index];
if (service != null) {
if (action == 1) { meshserver.send({ action: 'msg', type: 'serviceStart', nodeid: currentNode._id, serviceName: service.name }); }
if (action == 2) { meshserver.send({ action: 'msg', type: 'serviceStop', nodeid: currentNode._id, serviceName: service.name }); }
if (action == 3) { meshserver.send({ action: 'msg', type: 'serviceRestart', nodeid: currentNode._id, serviceName: service.name }); }
setTimeout(function () { refreshDeskTools(1) }, 1000);
}
}
// Toggle mouse and keyboard input
function toggleKvmControl() { putstore('DeskControl', (Q("Besturing").checked?1:0)); }
// Save the desktop image to file
function deskSaveImage() {
if (xxdialogMode || desktop == null || desktop.State != 3) return;
var d = new Date(), n = 'Desktop-' + currentNode.name + '-' + d.getFullYear() + '-' + ('0' + (d.getMonth() + 1)).slice(-2) + '-' + ('0' + d.getDate()).slice(-2) + '-' + ('0' + d.getHours()).slice(-2) + '-' + ('0' + d.getMinutes()).slice(-2);
Q('Desk')['toBlob'](function (blob) { saveAs(blob, n + '.jpg'); });
}
function deskDisplayInfo(sender, displays, selDisplay) {
var displayCount = 0, displaySelector = '';
for (var i in displays) {
displayCount++;
displaySelector += '<option' + ((selDisplay == i) ? ' selected' : '') + ' value=' + i + '>' + displays[i] + '</option>';
if ((deskPreferedStickyDisplay == i) && (selDisplay != deskPreferedStickyDisplay)) { desktop.m.SetDisplay(i); }
}
QH('termdisplays', displaySelector);
QV('termdisplays', displayCount > 1);
}
function deskGetDisplayNumbers(e) { desktop.m.GetDisplayNumbers(); }
var deskPreferedStickyDisplay = 0;
function deskSetDisplay(e) { desktop.m.SetDisplay(deskPreferedStickyDisplay = parseInt(Q('termdisplays').value)); Q('termdisplays').blur(); }
// Double click detection. This is important for MacOS.
var dblClickDetectArgs = { t:0, x:0, y:0 };
function dblClickDetect(e) {
if (e.buttons != 1) return;
var t = Date.now();
if (((t - dblClickDetectArgs.t) < 250) && (Math.abs(e.clientX - dblClickDetectArgs.x) < 2) && (Math.abs(e.clientY - dblClickDetectArgs.y) < 2)) {
if (!xxdialogMode && desktop != null && Q('DeskControl').checked) { if ((webRtcDesktop != null) && (webRtcDesktop.softdesktop != null)) { webRtcDesktop.softdesktop.m.mousedblclick(e); desktop.m.sendKeepAlive(); } else { desktop.m.mousedblclick(e); } }
}
dblClickDetectArgs.t = t;
dblClickDetectArgs.x = e.clientX;
dblClickDetectArgs.y = e.clientY;
}
function dmousedown(e) { setSessionActivity(); e.addx = Q('DeskParent').scrollLeft; e.addy = Q('DeskParent').scrollTop; if (!xxdialogMode && desktop != null && Q('DeskControl').checked) { if ((webRtcDesktop != null) && (webRtcDesktop.softdesktop != null)) { webRtcDesktop.softdesktop.m.mousedown(e); desktop.m.sendKeepAlive(); } else { desktop.m.mousedown(e); } } dblClickDetect(e); }
function dmouseup(e) { setSessionActivity(); e.addx = Q('DeskParent').scrollLeft; e.addy = Q('DeskParent').scrollTop; if (!xxdialogMode && desktop != null && Q('DeskControl').checked) if ((webRtcDesktop != null) && (webRtcDesktop.softdesktop != null)) { webRtcDesktop.softdesktop.m.mouseup(e); desktop.m.sendKeepAlive(); } else { desktop.m.mouseup(e); } }
function dmousemove(e) { setSessionActivity(); e.addx = Q('DeskParent').scrollLeft; e.addy = Q('DeskParent').scrollTop; if (!xxdialogMode && desktop != null && Q('DeskControl').checked) { if ((webRtcDesktop != null) && (webRtcDesktop.softdesktop != null)) { webRtcDesktop.softdesktop.m.mousemove(e); desktop.m.sendKeepAlive(); } else { desktop.m.mousemove(e); } } }
function dmousewheel(e) { setSessionActivity(); e.addx = Q('DeskParent').scrollLeft; e.addy = Q('DeskParent').scrollTop; if (!xxdialogMode && desktop != null && Q('DeskControl').checked) { if ((webRtcDesktop != null) && (webRtcDesktop.softdesktop != null)) { webRtcDesktop.softdesktop.m.mousewheel(e); desktop.m.sendKeepAlive(); } else { if (desktop.m.mousewheel) { desktop.m.mousewheel(e); } } haltEvent(e); return true; } return false; }
function drotate(x) { if (!xxdialogMode && desktop != null) { desktop.m.setRotation(desktop.m.rotation + x); deskAdjust(); deskAdjust(); } }
function stopProcess(id, name) { setDialogMode(2, "Proces controle", 3, stopProcessEx, format("Stop process #{0} \"{1}\"?", id, name), id); return false; }
function stopProcessEx(buttons, tag) { meshserver.send({ action: 'msg', type: 'pskill', nodeid: currentNode._id, value: tag }); setTimeout(refreshDeskTools, 300); }
//
// TERMINAL
//
var terminalNode;
function setupTerminal() {
// Setup the terminal
if ((terminalNode != currentNode) && (terminal != null)) { terminal.Stop(); terminal = null; }
terminalNode = currentNode;
updateTerminalButtons();
}
// Show and enable the right buttons
function updateTerminalButtons() {
var mesh = meshes[terminalNode.meshid];
var termState = ((terminal != null) && (terminal.state != 0));
// Show the right buttons
QV('disconnectbutton2span', (termState == true));
QV('connectbutton2span', (termState == false) && (mesh.mtype == 2) && (currentNode.agent.caps & 2));
QV('connectbutton2hspan', (termState == false) && ((terminalNode.intelamt != null) && (mesh.mtype == 1 || terminalNode.intelamt.state == 2) && ((terminalNode.intelamt.ver != null) || (mesh.mtype == 1))));
// Enable buttons
var online = ((terminalNode.conn & 1) != 0); // If Agent (1) connected, enable Terminal
QE('connectbutton2', online);
var hwonline = ((terminalNode.conn & 6) != 0); // If CIRA (2) or AMT (4) connected, enable hardware terminal
QE('connectbutton2h', hwonline);
// Key buttons
QE('ctrlcbutton', termState);
QE('ctrlxbutton', termState);
QE('escbutton', termState);
QE('bsbutton', termState);
QE('pastebutton', termState);
QE('specialkeylist', termState);
QE('specialkeylistinput', termState);
// Terminal settings
QV('terminalSettingsButtons', (terminal) && (terminal.contype == 2));
if (terminal) {
Q('id_ttypebutton').value = terminalEmulations[terminal.m.terminalEmulation];
Q('id_tfxkeysbutton').value = fxEmulations[terminal.m.fxEmulation];
Q('id_tcrbutton').value = (terminal.m.lineFeed == '\r\n')?"CR+LF":"LF";
}
}
// Called when the terminal state changes
function onTerminalStateChange(xterminal, state) {
var xstate = state;
if ((xstate == 3) && (xterminal.contype == 2)) { xstate++; }
var str = StatusStrs[xstate];
if (terminal.webRtcActive == true) { str += ", WebRTC"; }
QH('termstatus', str);
switch (state) {
case 0:
// Disconnected, clear the terminal
QE('termSizeList', true);
QH('termtitle', '');
QV('termRecordIcon', false);
xterminal.m.TermResetScreen();
xterminal.m.TermDraw();
if (terminal != null) { terminal.Stop(); terminal = null; }
break;
case 3:
QE('termSizeList', false);
if (xterminal && (xterminal.serverIsRecording == true)) { QV('termRecordIcon', true); }
terminal.startTime = new Date();
if (updateSessionTimer == null) { updateSessionTimer = setInterval(updateSessionTime, 1000); }
break;
default:
QE('termSizeList', false);
//console.log('Unhandled onTerminalStateChange state', state);
break;
}
updateTerminalButtons();
}
// DEBUG
var autoConnectTerminalTimer = null;
function autoConnectTerminal(e) { if (autoConnectTerminalTimer == null) { autoConnectTerminalTimer = setInterval(connectTerminal, 100); } else { clearInterval(autoConnectTerminalTimer); autoConnectTerminalTimer = null; } }
function connectTerminal(e, contype, options) {
p12clearConsoleMsg();
if (!terminal) {
if (contype == 2) {
// Setup the Intel AMT terminal
if ((terminalNode.intelamt.user == null) || (terminalNode.intelamt.user == '')) { editDeviceAmtSettings(terminalNode._id, connectTerminal, 2); return; }
var termoptions = {};
if (Q('termSizeList').value == 2) { termoptions.width = 100; termoptions.height = 30; }
terminal = CreateAmtRedirect(CreateAmtRemoteTerminal('Term', termoptions), authCookie);
terminal.debugmode = debugmode;
terminal.m.debugmode = debugmode;
terminal.m.onTitleChange = function (sender, title) { QH('termtitle', ' - ' + EscapeHtml(title)); }
terminal.onStateChanged = onTerminalStateChange;
terminal.Start(terminalNode._id, 16994, '*', '*', 0);
terminal.contype = 2;
Q('id_ttypebutton').value = terminalEmulations[terminal.m.terminalEmulation];
} else {
// Setup a mesh agent terminal
var termoptions = { protocol: ((options != null) && (typeof options.protocol == 'number'))?options.protocol:1 };
if ([1, 2, 3, 4, 21, 22].indexOf(currentNode.agent.id) == -1) {
if (Q('termSizeList').value == 2) { termoptions.width = 100; termoptions.height = 30; termoptions.xterm = true; }
if (Q('termSizeList').value == 3) {
// TODO: Try to improve terminal auto-size.
termoptions.width = Math.floor((Q('column_l').clientWidth - 60) / 10);
termoptions.height = Math.floor((Q('column_l').clientHeight - 120) / 20);
termoptions.xterm = true;
}
}
// If shift is pressed
if ((e && (e.shiftKey == true))) {
if (currentNode.agent.id > 4) {
if (termoptions.protocol == 1) { termoptions.protocol = 7; } // Switch to user shell
} else {
if (termoptions.protocol == 1) { termoptions.protocol = 6; } // Switch to Powershell
}
}
terminal = CreateAgentRedirect(meshserver, CreateAmtRemoteTerminal('Term', termoptions), serverPublicNamePort, authCookie, authRelayCookie, domainUrl);
terminal.debugmode = debugmode;
terminal.m.debugmode = debugmode;
terminal.m.onTitleChange = function (sender, title) { QH('termtitle', ' - ' + EscapeHtml(title)); }
terminal.m.lineFeed = ([1, 2, 3, 4, 21, 22].indexOf(currentNode.agent.id) >= 0) ? '\r\n' : '\r'; // On windows, send \r\n, on Linux only \r
terminal.attemptWebRTC = false; // Never do WebRTC on terminal, because of a race condition we can't do it.
terminal.onStateChanged = onTerminalStateChange;
terminal.onConsoleMessageChange = function () {
p12clearConsoleMsg();
if (terminal.consoleMessage) {
QH('p12TermConsoleMsg', EscapeHtml(terminal.consoleMessage).split('\n').join('<br />'));
QV('p12TermConsoleMsg', true);
p12TermConsoleMsgTimer = setTimeout(p12clearConsoleMsg, 8000);
}
}
terminal.Start(terminalNode._id);
terminal.contype = 1;
terminal.m.terminalEmulation = 0;
terminal.m.fxEmulation = 0;
Q('id_ttypebutton').value = terminalEmulations[0];
}
} else {
//QH('Term', '');
terminal.Stop();
terminal = null;
}
Q('connectbutton2').blur(); // Deselect the connect button so the button does not get key presses.
}
var terminalEmulations = ["UTF8 Terminal", "Extended ASCII", "Intel ASCII"];
function termToggleType() {
if (!terminal || xxdialogMode) return;
terminal.m.terminalEmulation = (terminal.m.terminalEmulation + 1) % 3;
Q('id_ttypebutton').value = terminalEmulations[terminal.m.terminalEmulation];
Q('id_ttypebutton').blur(); // Deselect the connect button so the button does not get key presses.
}
var fxEmulations = ["Intel (F10 = ESC+[OM)", "Alternatief (F10 = ESC + 0)", "VT100+ (F10 = ESC+[OY)"];
function termToggleFx() {
if (!terminal || xxdialogMode) return;
terminal.m.fxEmulation = (terminal.m.fxEmulation + 1) % 3;
Q('id_tfxkeysbutton').value = fxEmulations[terminal.m.fxEmulation];
Q('id_tfxkeysbutton').blur(); // Deselect the connect button so the button does not get key presses.
}
function termToggleCr() {
if (!terminal || xxdialogMode) return;
if (terminal.m.lineFeed == '\n') { terminal.m.lineFeed = '\r\n'; } else { terminal.m.lineFeed = '\n'; }
Q('id_tcrbutton').value = (terminal.m.lineFeed == '\r\n') ? "CR+LF" : "LF";
}
function termSendKey(key, id) {
if (!terminal || xxdialogMode) return;
terminal.m.TermSendKey(key);
Q(id).blur(); // Deselect the connect button so the button does not get key presses.
}
function showTermPasteDialog() {
if (!terminal || xxdialogMode) return;
Q('pastebutton').blur();
setDialogMode(2, "Plakken", 3, showTermPasteDialogEx, '<textarea id=d2pasteText style="width:100%;height:184px;resize:none"></textarea>');
Q('d2pasteText').focus();
}
function showTermPasteDialogEx() {
if (!terminal) return;
terminal.m.TermSendKeys(Q('d2pasteText').value);
}
// Send special key
function sendSpecialKey() {
terminal.m.TermSendKey(Q('specialkeylist').value);
Q('specialkeylist').blur();
Q('specialkeylistinput').blur();
}
//
// FILES
//
var filesNode;
function setupFiles() {
// Setup the files tab
var samenode = (filesNode == currentNode);
filesNode = currentNode;
var online = ((filesNode.conn & 1) != 0)?true:false; // If Agent (1) connected, enable Terminal
QE('p13Connect', online);
if (((samenode == false) || (online == false)) && files) { files.Stop(); files = null; }
}
function onFilesStateChange(xfiles, state) {
p13Connect.value = (state == 0) ? "Verbinden" : "Verbreken";
var str = StatusStrs[state];
if (files.webRtcActive == true) { str += ", WebRTC"; }
Q('p13Status').textContent = str;
switch (state) {
case 0:
// Disconnected, clear the files
QH('p13files', '');
p13filetree = null;
p13filetreelocation = [];
QH('p13currentpath', '');
QE('p13FolderUp', false);
QV('filesRecordIcon', false);
p13setActions();
if (files != null) { files.Stop(); files = null; }
break;
case 3:
p13targetpath = '';
if (files) {
files.sendText({ action: 'ls', reqid: 1, path: '' });
if (files.serverIsRecording == true) { QV('filesRecordIcon', true); }
}
break;
default:
//console.log('Unknown onFilesStateChange state', state);
break;
}
}
function CreateRemoteFiles(onFileUpdate) {
var obj = { protocol: 5 };
obj.onFileUpdate = onFileUpdate;
obj.xxStateChange = function(state) { }
obj.ProcessData = function(data) { obj.onFileUpdate(data); }
return obj;
}
// Debug Only
var autoConnectFilesTimer = null;
function autoConnectFiles(e) { if (autoConnectFilesTimer == null) { autoConnectFilesTimer = setInterval(connectFiles, 100); } else { clearInterval(autoConnectFilesTimer); autoConnectFilesTimer = null; } }
function connectFiles(e) {
p13clearConsoleMsg();
if (!files) {
// Setup a mesh agent files
files = CreateAgentRedirect(meshserver, CreateRemoteFiles(p13gotFiles), serverPublicNamePort, authCookie, authRelayCookie, domainUrl);
files.attemptWebRTC = attemptWebRTC;
files.onStateChanged = onFilesStateChange;
files.onConsoleMessageChange = function () {
p13clearConsoleMsg();
if (files.consoleMessage) {
QH('p13FilesConsoleMsg', EscapeHtml(files.consoleMessage).split('\n').join('<br />'));
QV('p13FilesConsoleMsg', true);
p13FilesConsoleMsgTimer = setTimeout(p13clearConsoleMsg, 8000);
}
}
files.Start(filesNode._id);
} else {
//QH('Term', '');
files.Stop();
files = null;
}
p13clipboard = p13clipboardFolder = null;
p13clipboardCut = 0;
p13updateClipview();
}
var p13filetree = null;
var p13targetpath = null;
var p13filetreelocation = [];
function p13gotFiles(data) {
if ((data.length > 0) && (data.charCodeAt(0) != 123)) { p13gotDownloadBinaryData(data); return; }
//console.log('p13gotFiles', data);
data = JSON.parse(decode_utf8(data));
if (data.action == 'download') { p13gotDownloadCommand(data); return; }
data.path = data.path.replace(/\//g, '\\');
if ((p13filetree != null) && (data.path == p13filetree.path)) {
// This is an update to the same folder
var checkedNames = p13getCheckedNames();
p13filetree = data;
p13updateFiles(checkedNames);
} else {
// Make both paths use the same seperator not start with /
var x1 = data.path.replace(/\//g, '\\'), x2 = p13targetpath.replace(/\//g, '\\');
while ((x1.length > 0) && (x1[0] == '\\')) { x1 = x1.substring(1); }
while ((x2.length > 0) && (x2[0] == '\\')) { x2 = x2.substring(1); }
if ((x1 == x2) || ((data.path == '\\') && (p13targetpath == ''))) {
// This is a different folder
p13filetree = data;
p13updateFiles();
}
}
}
function p13getCheckedNames() {
// Save all existing checked boxes
var checkedNames = [], checkboxes = document.getElementsByName('fd');
for (var i = 0; i < checkboxes.length; i++) { if (checkboxes[i].checked) { checkedNames.push(p13filetree.dir[checkboxes[i].value].n) }; }
return checkedNames;
}
function p13updateFiles(checkedNames) {
var html1 = '', html2 = '', displayPath = '<a href=# style=cursor:pointer onclick="return p13folderup(0)">' + "Root" + '</a>', fullPath = 'Root';
// Work on parsing the file path
var x = p13filetree.path.split('\\');
p13filetreelocation = [];
for (var i in x) { if (x[i] != '') { p13filetreelocation.push(x[i]); } } // Remove empty spaces
for (var i in p13filetreelocation) { displayPath += ' / <a href=# style=cursor:pointer onclick="return p13folderup(' + (parseInt(i) + 1) + ')">' + p13filetreelocation[i] + '</a>' } // Setup the path we display
var newlinkpath = p13filetreelocation.join('/');
// Sort the files
var filetreexx = p13sort_files(p13filetree.dir);
// Display all files and folders at this location
for (var i in filetreexx) {
// Figure out the name and shortname
var f = filetreexx[i], name = f.n, shortname;
shortname = name;
if (name.length > 70) { shortname = '<span title="' + EscapeHtml(name) + '">' + EscapeHtml(name.substring(0, 70)) + ("..." + '</span>'); } else { shortname = EscapeHtml(name); }
name = EscapeHtml(name);
// Figure out the date
var fdatestr = '';
if (f.d != null) { var fdate = new Date(f.d), fdatestr = printDateTime(fdate) + '&nbsp;'; }
// Figure out the size
var fsize = '';
if (f.s != null) { fsize = getFileSizeStr(f.s); }
var h = '';
if (f.t < 3) {
var right = '', title = '';
h = '<div class=filelist file=999><input file=999 style=float:left name=fd class=fcb type=checkbox onchange=p13setActions() value=\'' + f.nx + '\'>&nbsp;<span style=float:right title=\"' + title + '\">' + right + '</span><span><div class=fileIcon' + f.t + ' onclick=p13folderset(\"' + encodeURIComponent(f.nx) + '\")></div><a href=# style=cursor:pointer onclick=\'return p13folderset(\"' + encodeURIComponent(f.nx) + '\")\'>' + shortname + '</a></span></div>';
} else {
var link = shortname;
if (f.s > 0) { link = '<a hrf=# rel=\"noreferrer noopener\" target=\"_blank\" style=cursor:pointer onclick=\"return p13downloadfile(\'' + encodeURIComponent(newlinkpath + '/' + name) + '\',\'' + encodeURIComponent(name) + '\',' + f.s + ')\">' + shortname + '</a>'; }
h = '<div class=filelist file=3><input file=3 style=float:left name=fd class=fcb type=checkbox onchange=p13setActions() value=\'' + f.nx + '\'>&nbsp;<span class=fsize>' + fdatestr + '</span><span style=float:right>' + fsize + '</span><span><div class=fileIcon' + f.t + '></div>' + link + '</span></div>';
}
if (f.t < 3) { html1 += h; } else { html2 += h; }
}
// Display the files and path
QH('p13files', html1 + html2);
QH('p13currentpath', displayPath);
QE('p13FolderUp', p13filetreelocation.length != 0);
// Re-check all boxes if needed using names
if (checkedNames != null) { var checkboxes = document.getElementsByName('fd'); for (var i = 0; i < checkboxes.length; i++) { if (checkedNames.indexOf(p13filetree.dir[checkboxes[i].value].n) >= 0) { checkboxes[i].checked = true; } } }
// Update the actions buttons
p13setActions();
}
function p13folderset(x) {
p13targetpath = joinPaths(p13filetree.path, p13filetree.dir[x].n).split('\\').join('/');
files.sendText({ action: 'ls', reqid: 1, path: p13targetpath });
}
function p13folderup(x) {
if (x == null) { p13filetreelocation.pop(); } else { while (p13filetreelocation.length > x) { p13filetreelocation.pop(); } }
p13targetpath = p13filetreelocation.join('/');
files.sendText({ action: 'ls', reqid: 1, path: p13targetpath });
return false;
}
var p13sortorder;
function p13sort_filename(a, b) { if (a.ln > b.ln) return (1 * p13sortorder); if (a.ln < b.ln) return (-1 * p13sortorder); return 0; }
function p13sort_timestamp(a, b) { if (a.d > b.d) return (1 * p13sortorder); if (a.d < b.d) return (-1 * p13sortorder); return 0; }
function p13sort_bysize(a, b) { if (a.s == b.s) return p13sort_filename(a, b); return (((a.s - b.s)) * p13sortorder); }
function p13sort_files(files) {
var r = [], sortselection = Q('p13sortdropdown').value;
for (var i in files) { files[i].nx = i; if (files[i].s == null) { files[i].s = 0; } if (files[i].n == null) { files[i].n = i; } files[i].ln = files[i].n.toLowerCase(); r.push(files[i]); }
p13sortorder = 1;
if (sortselection > 3) { p13sortorder = -1; sortselection -= 3; }
if (sortselection == 1) { r.sort(p13sort_filename); }
else if (sortselection == 2) { r.sort(p13sort_bysize); }
else if (sortselection == 3) { r.sort(p13sort_timestamp); }
return r;
}
function p13setActions() {
if (p13filetree == null) {
QE('p13DeleteFileButton', false);
QE('p13NewFolderButton', false);
QE('p13UploadButton', false);
QE('p13RenameFileButton', false);
QE('p13ViewFileButton', false);
QE('p13SelectAllButton', false);
Q('p13SelectAllButton').value = "Selecteer alles";
QE('p13RefreshButton', false);
QE('p13CutButton', false);
QE('p13CopyButton', false);
QE('p13PasteButton', false);
} else {
var cc = p13getFileSelCount(), tc = p13getFileCount(), sfc = p13getFileSelCount(false); // In order: number of entires selected, number of total entries, number of selected entires that are files (not folders)
var winAgent = ((currentNode.agent.id > 0) && (currentNode.agent.id < 5));
QE('p13DeleteFileButton', (cc > 0) && ((p13filetreelocation.length > 0) || (winAgent == false)));
QE('p13NewFolderButton', ((p13filetreelocation.length > 0) || (winAgent == false)));
QE('p13UploadButton', ((p13filetreelocation.length > 0) || (winAgent == false)));
QE('p13RenameFileButton', (cc == 1) && ((p13filetreelocation.length > 0) || (winAgent == false)));
QE('p13ViewFileButton', (cc == 1) && (sfc == 1) && ((p13filetreelocation.length > 0) || (winAgent == false)));
QE('p13SelectAllButton', tc > 0);
Q('p13SelectAllButton').value = (cc > 0 ? "Selecteer niets" : "Selecteer alles");
QE('p13RefreshButton', true);
QE('p13CutButton', (cc > 0) && (cc == sfc) && ((p13filetreelocation.length > 0) || (winAgent == false)));
QE('p13CopyButton', (cc > 0) && (cc == sfc) && ((p13filetreelocation.length > 0) || (winAgent == false)));
QE('p13PasteButton', ((p13filetreelocation.length > 0) || (winAgent == false)) && ((p13clipboard != null) && (p13clipboard.length > 0)));
}
}
function p13getFileSelCount(includeDirs) { var cc = 0; var checkboxes = document.getElementsByName('fd'); for (var i = 0; i < checkboxes.length; i++) { if ((checkboxes[i].checked) && ((includeDirs != false) || (checkboxes[i].attributes.file.value == '3'))) cc++; } return cc; }
function p13getFileSelDirCount() { var cc = 0, checkboxes = document.getElementsByName('fd'); for (var i = 0; i < checkboxes.length; i++) { if ((checkboxes[i].checked) && (checkboxes[i].attributes.file.value == '999')) cc++; } return cc; }
function p13getFileCount() { var cc = 0; var checkboxes = document.getElementsByName('fd'); return checkboxes.length; }
function p13selectallfile() { var nv = (p13getFileSelCount() == 0), checkboxes = document.getElementsByName('fd'); for (var i = 0; i < checkboxes.length; i++) { checkboxes[i].checked = nv; } p13setActions(); }
function p13createfolder() { setDialogMode(2, "Nieuwe map", 3, p13createfolderEx, '<input type=text id=p13renameinput maxlength=64 onkeyup=p13fileNameCheck(event) style=width:100% />'); focusTextBox('p13renameinput'); p13fileNameCheck(); }
function p13createfolderEx() { files.sendText({ action: 'mkdir', reqid: 1, path: p13filetreelocation.join('/') + '/' + Q('p13renameinput').value }); p13folderup(999); }
function p13deletefile() { var cc = p13getFileSelCount(), rec = (p13getFileSelDirCount() > 0) ? '<br /><br /><label><input type=checkbox id=p13recdeleteinput>' + "Recursieve verwijdering" + '</label><br>' : '<input type=checkbox id=p13recdeleteinput style=\'display:none\'>'; setDialogMode(2, "Verwijderen", 3, p13deletefileEx, (cc > 1) ? (format("Verwijder {0} gelecteerde items?", cc) + rec) : ("Verwijder geselecteerde item?" + rec)); }
function p13deletefileEx() { var delfiles = [], checkboxes = document.getElementsByName('fd'); for (var i = 0; i < checkboxes.length; i++) { if (checkboxes[i].checked) { delfiles.push(p13filetree.dir[checkboxes[i].value].n); } } files.sendText({ action: 'rm', reqid: 1, path: p13filetreelocation.join('/'), delfiles: delfiles, rec: Q('p13recdeleteinput').checked }); p13folderup(999); }
function p13renamefile() { var renamefile, checkboxes = document.getElementsByName('fd'); for (var i = 0; i < checkboxes.length; i++) { if (checkboxes[i].checked) { renamefile = p13filetree.dir[checkboxes[i].value].n; } } setDialogMode(2, "Hernoemen", 3, p13renamefileEx, '<input type=text id=p13renameinput maxlength=64 onkeyup=p13fileNameCheck(event) style=width:100% value="' + renamefile + '" />', { action: 'rename', path: p13filetreelocation.join('/'), oldname: renamefile}); focusTextBox('p13renameinput'); p13fileNameCheck(); }
function p13renamefileEx(b, t) { t.newname = Q('p13renameinput').value; files.sendText(t); p13folderup(999); }
function p13fileNameCheck(e) { var x = isFilenameValid(Q('p13renameinput').value); QE('idx_dlgOkButton', x); if ((x == true) && (e != null) && (e.keyCode == 13)) { dialogclose(1); } }
function p13uploadFile() { setDialogMode(2, "Upload bestand", 3, p13uploadFileEx, '<input type=file name=files id=p13uploadinput style=width:100% multiple=multiple onchange="updateUploadDialogOk(\'p13uploadinput\')" />'); updateUploadDialogOk('p13uploadinput'); }
function updateUploadDialogOk(x) { QE('idx_dlgOkButton', Q('p13uploadinput').files.length > 0); }
function p13uploadFileEx() { p13doUploadFiles(Q('p13uploadinput').files); }
function p13viewfile() {
var checkboxes = document.getElementsByName('fd');
for (var i = 0; i < checkboxes.length; i++) {
if (checkboxes[i].checked) {
if (p13filetree.dir[checkboxes[i].value].s <= 204800) {
p13downloadfile(encodeURIComponent(p13filetreelocation.join('/') + '/' + p13filetree.dir[checkboxes[i].value].n), encodeURIComponent(p13filetree.dir[checkboxes[i].value].n), p13filetree.dir[checkboxes[i].value].s, 'viewer');
} else { messagebox("Bestandsberwerker", "Alleen bestanden kleiner dan 200k kunnen worden bewerkt."); }
break;
}
}
}
var p13clipboard = null, p13clipboardFolder = null, p13clipboardCut = 0;
function p13copyFile(cut) { var checkboxes = document.getElementsByName('fd'); p13clipboard = []; p13clipboardCut = cut, p13clipboardFolder = p13targetpath; for (var i = 0; i < checkboxes.length; i++) { if ((checkboxes[i].checked) && (checkboxes[i].attributes.file.value == '3')) { p13clipboard.push(p13filetree.dir[checkboxes[i].value].n); } } p13updateClipview(); }
function p13pasteFile() {
var x = '';
if ((p13clipboard != null) && (p13clipboard.length > 0)) {
if (p13clipboardCut == 0) {
if (p13clipboard.length > 1) { x = format("Bevestig kopieën van {0} vermeldingen tot deze locatie?", p13clipboard.length); } else { x = format("Bevestig kopie van 1 vermelding tot deze locatie?"); }
} else {
if (p13clipboard.length > 1) { x = format("Verplaatsing van {0} vermeldingen naar deze locatie bevestigen?", p13clipboard.length); } else { x = format("Verplaatsing van 1 vermelding naar deze locatie bevestigen?"); }
}
}
setDialogMode(2, "Plakken", 3, p13pasteFileEx, x);
}
function p13pasteFileEx() { files.sendText({ action: (p13clipboardCut == 0?'copy':'move'), reqid: 1, scpath: p13clipboardFolder, dspath: p13targetpath, names: p13clipboard }); p13folderup(999); if (p13clipboardCut == 1) { p13clipboard = null, p13clipboardFolder = null, p13clipboardCut = 0; p13updateClipview(); } }
function p13updateClipview() {
var x = '';
if ((p13clipboard != null) && (p13clipboard.length > 0)) {
if (p13clipboardCut == 0) {
if (p13clipboard.length > 1) {
x = format("{0} items vasthouden voor kopiëren" + ', <a href=# onclick="return p13clearClip()" style=cursor:pointer>' + "Wissen" + '</a>.', p13clipboard.length);
} else {
x = format("1 item vasthouden voor kopiëren" + ', <a href=# onclick="return p13clearClip()" style=cursor:pointer>' + "Wissen" + '</a>.');
}
} else {
if (p13clipboard.length > 1) {
x = format("{0} items vasthouden voor verplaatsen" + ', <a href=# onclick="return p13clearClip()" style=cursor:pointer>' + "Wissen" + '</a>.', p13clipboard.length);
} else {
x = format("1 item vasthouden voor verplaatsen" + ', <a href=# onclick="return p13clearClip()" style=cursor:pointer>' + "Wissen" + '</a>.');
}
}
}
QH('p13bottomstatus', x);
p13setActions();
}
function p13clearClip() { p13clipboard = null; p13clipboardFolder = null; p13clipboardCut = 0; p13updateClipview(); return false; }
function p13fileDragDrop(e) {
haltEvent(e);
QV('p13bigfail', false);
QV('p13bigok', false);
if (e.dataTransfer == null || e.dataTransfer.files.length == 0 || p13filetree == null) return;
// Check if these are files we can upload, remove all folders.
var files = [];
for (var i in e.dataTransfer.files) { if ((e.dataTransfer.files[i].size != null) && (e.dataTransfer.files[i].size != 0)) { files.push(e.dataTransfer.files[i]); } }
if (files.length == 0) return;
p13doUploadFiles(files);
}
var p13dragtimer = null;
function p13fileDragOver(e) {
haltEvent(e);
if (p13dragtimer != null) { clearTimeout(p13dragtimer); p13dragtimer = null; }
var ac = (p13filetree != null); // Set to true if we can accept the file
QV('p13bigok', ac);
QV('p13bigfail', !ac);
}
function p13fileDragLeave(e) {
haltEvent(e);
if (e.target.id != 'p13filetable') {
QV('p13bigfail', false);
QV('p13bigok', false);
} else {
p13dragtimer = setTimeout(function () { QV('p13bigfail',false); QV('p13bigok',false); p13dragtimer=null; }, 10);
}
}
//
// FILES DOWNLOAD
//
var downloadFile; // Global state for file download
// Called by the html page to start a download, arguments are: path, file name and file size.
function p13downloadfile(x, y, z, tag) {
if (xxdialogMode || downloadFile || !files) return;
downloadFile = { path: decodeURIComponent(x), file: decodeURIComponent(y), size: z, tsize: 0, data: '', state: 0, id: Math.random(), tag: tag }
//console.log('p13downloadFileCancel', downloadFile);
files.sendText({ action: 'download', sub: 'start', id: downloadFile.id, path: downloadFile.path });
setDialogMode(2, "Download Bestand", 10, p13downloadFileCancel, '<div>' + downloadFile.file + '</div><br /><progress id=d2progressBar style=width:100% value=0 max=' + z + ' />');
}
// Called by the html page to cancel the download
function p13downloadFileCancel() { setDialogMode(0); files.sendText({ action: 'download', sub: 'cancel', id: downloadFile.id }); downloadFile = null; }
// Called by the transport when download control command is received
function p13gotDownloadCommand(cmd) {
//console.log('p13gotDownloadCommand', cmd);
if ((downloadFile == null) || (cmd.id != downloadFile.id)) return;
if (cmd.sub == 'start') { downloadFile.state = 1; files.sendText({ action: 'download', sub: 'startack', id: downloadFile.id }); }
else if (cmd.sub == 'cancel') { downloadFile = null; setDialogMode(0); }
}
// Called by the transport when binary data is received
function p13gotDownloadBinaryData(data) {
if (!downloadFile || downloadFile.state == 0) return;
if (data.length > 4) {
downloadFile.tsize += (data.length - 4); // Add to the total bytes received
downloadFile.data += data.substring(4); // Append the data
Q('d2progressBar').value = downloadFile.tsize; // Change the progress bar
}
if ((ReadInt(data, 0) & 1) != 0) { // Check end flag
if (downloadFile.tag == 'viewer') {
// View the file in the dialog box
setDialogMode(4, EscapeHtml(downloadFile.file), 3, p13editSaveBack, null, downloadFile.file);
QH('d4editorarea', EscapeHtml(downloadFile.data));
QS('dialog').width = 'auto';
QS('dialog').bottom = '80px';
QS('dialog').top = QS('dialog').left = QS('dialog').right = '100px';
downloadFile = null;
} else {
// Save the file to disk
saveAs(data2blob(downloadFile.data), downloadFile.file); downloadFile = null; setDialogMode(0); // Save the file
}
} else {
files.sendText({ action: 'download', sub: 'ack', id: downloadFile.id }); // Send the ACK
}
}
var d4EditWrapVal = 0;
var d4EditSizeVal = 0;
function d4ToggleWrap(update) {
if (!update) { d4EditWrapVal = ++d4EditWrapVal % 2; }
Q('d4WrapButton').value = ["Wrap: ON","Wrap: OFF"][d4EditWrapVal];
QS('d4editorarea').overflow = (d4EditWrapVal == 0)?'auto':'scroll';
QS('d4editorarea')['white-space'] = (d4EditWrapVal == 0)?null:'pre';
putstore('editorWrap', d4EditWrapVal);
}
function d4ToggleSize(update) {
if (!update) { d4EditSizeVal = ++d4EditSizeVal % 4; }
QS('d4editorarea')['font-size'] = ['100%','125%','150%','200%'][d4EditSizeVal];
Q('d4SizeButton').value = ["Size: 100%","Size: 125%","Size: 150%","Size: 200%"][d4EditSizeVal];
putstore('editorSize', d4EditSizeVal);
}
function p13editSaveBack(b, tag) {
var data = new TextEncoder().encode(Q('d4editorarea').value);
p13uploadFileContinue(1, [{ name: tag, size: data.byteLength, type: 'text/plain', xdata: data }]);
}
/*
var downloadFile; // Global state for file download
// Called by the html page to start a download, arguments are: path, file name and file size.
function p13downloadfile(x, y, z) {
if (xxdialogMode) return;
downloadFile = CreateAgentRedirect(meshserver, CreateRemoteFiles(p13gotDownloadData), serverPublicNamePort, authCookie, authRelayCookie, domainUrl); // Create our websocket file transport
downloadFile.ctrlMsgAllowed = false;
downloadFile.onStateChanged = onFileDownloadStateChange;
downloadFile.xpath = decodeURIComponent(x);
downloadFile.xfile = decodeURIComponent(y);
downloadFile.xsize = z;
downloadFile.xtsize = 0;
downloadFile.xstate = 0;
downloadFile.Start(filesNode._id);
setDialogMode(2, "Download File", 10, p13downloadFileCancel, '<div>' + downloadFile.xfile + '</div><br /><progress id=d2progressBar style=width:100% value=0 max=' + z + ' />');
}
// Called by the html page to cancel the download
function p13downloadFileCancel(button, tag) {
//console.log('p13downloadFileCancel');
downloadFile.Stop();
delete downloadFile;
downloadFile = null;
}
// Called by the file transport to indicate when the transport connection state has changed
function onFileDownloadStateChange(xdownloadFile, state) {
switch (state) {
case 0: // Transport as disconnected. If this is not part of an abort, we need to save the file
setDialogMode(0); // Close any dialog boxes if present
if ((downloadFile != null) && (downloadFile.xstate == 1)) { saveAs(data2blob(downloadFile.xdata), downloadFile.xfile); } // Save the file
break;
case 3: // Transport as connected, send a command to indicate we want to start a file download
downloadFile.send(JSON.stringify({ action: 'download', reqid: 1, path: downloadFile.xpath }));
break;
default:
console.log('Unknown onFileDownloadStateChange state', state);
break;
}
}
// Called by the transport when data is received
function p13gotDownloadData(data) {
if (downloadFile.xstate == 0) { // If state is 0, this is a command confirming if the file will be transfered.
var cmd = JSON.parse(data);
if (cmd.action == 'downloadstart') { // Yes, the file is about to start
downloadFile.xstate = 1; // Switch to state 1, we will start receiving the file data
downloadFile.xdata = ''; // Start with empty data
downloadFile.send('a'); // Send the first ACK
} else if (cmd.action == 'downloaderror') { // Problem opening this file, cancel
p13downloadFileCancel();
}
} else { // We are in the process of receiving the file
downloadFile.xtsize += (data.length); // Add to the total bytes received
downloadFile.xdata += data; // Append the data
Q('d2progressBar').value = downloadFile.xtsize; // Change the progress bar
downloadFile.send('a'); // Send the ACK
}
}
*/
//
// FILES UPLOAD
//
var uploadFile;
function p13doUploadFiles(files) {
if (xxdialogMode) return;
// Check if we are going to overwrite any files
var winAgent = ((currentNode.agent.id > 0) && (currentNode.agent.id < 5));
var targetFiles = [], overWriteCount = 0;
for (var i in p13filetree.dir) { if (winAgent) { targetFiles.push(p13filetree.dir[i].n.toLowerCase()); } else { targetFiles.push(p13filetree.dir[i].n); } }
for (var i = 0; i < files.length; i++) {
if (winAgent) {
if (targetFiles.indexOf(files[i].name.toLowerCase()) >= 0) { overWriteCount++; }
} else {
if (targetFiles.indexOf(files[i].name) >= 0) { overWriteCount++; }
}
}
if (overWriteCount == 0) {
// If no overwrite, go ahead with upload
p13uploadFileContinue(1, files);
} else {
// Otherwise, prompt for confirmation
setDialogMode(2, "Upload bestand", 3, p13uploadFileContinue, format("Uploaden overschrijft {0} bestand {1}. Doorgaan met?", overWriteCount, addLetterS(overWriteCount)), files);
}
}
function p13uploadFileContinue(b, files) {
uploadFile = {};
uploadFile.xpath = p13filetreelocation.join('/');
uploadFile.xfiles = files;
uploadFile.xfilePtr = -1;
setDialogMode(2, "Upload bestand", 10, p13uploadFileCancel, '<div id=p13dfileName>' + "Verbinden..." + '</div><br /><progress id=d2progressBar style=width:100% value=0 max=0 />');
p13uploadReconnect();
}
function onFileUploadStateChange(xdownloadFile, state) {
switch (state) {
case 0:
setTimeout(function () { p13folderup(9999); }, 200); // Delay the file refresh
break;
case 3:
p13uploadNextFile();
break;
default:
break;
}
}
// Connect again
function p13uploadReconnect() {
uploadFile.ws = CreateAgentRedirect(meshserver, CreateRemoteFiles(p13gotUploadData), serverPublicNamePort, authCookie, authRelayCookie, domainUrl);
uploadFile.ws.attemptWebRTC = false;
uploadFile.ws.ctrlMsgAllowed = false;
uploadFile.ws.onStateChanged = onFileUploadStateChange;
uploadFile.ws.Start(filesNode._id);
}
// Push the next file
function p13uploadNextFile() {
uploadFile.xfilePtr++;
if (uploadFile.xfiles.length > uploadFile.xfilePtr) {
uploadFile.xptr = 0;
var file = uploadFile.xfiles[uploadFile.xfilePtr];
QH('p13dfileName', file.name);
Q('d2progressBar').max = file.size;
Q('d2progressBar').value = 0;
if (file.xdata == null) {
// Load the data
uploadFile.xreader = new FileReader();
uploadFile.xreader.onload = function () {
uploadFile.xdata = uploadFile.xreader.result;
uploadFile.ws.sendText(JSON.stringify({ action: 'upload', reqid: uploadFile.xfilePtr, path: uploadFile.xpath, name: file.name, size: uploadFile.xdata.byteLength }));
};
uploadFile.xreader.readAsArrayBuffer(file);
} else {
// Data already loaded
uploadFile.xdata = file.xdata;
uploadFile.ws.sendText(JSON.stringify({ action: 'upload', reqid: uploadFile.xfilePtr, path: uploadFile.xpath, name: file.name, size: uploadFile.xdata.byteLength }));
}
} else {
p13uploadFileCancel();
}
}
// Used to cancel the entire transfer.
function p13uploadFileCancel(button, tag) {
if (uploadFile != null) {
if (uploadFile.ws != null) {
uploadFile.ws.Stop();
uploadFile.ws = null;
}
uploadFile = null;
}
setDialogMode(0); // Close any dialog boxes if present
}
// Receive upload ack from the mesh agent, use this to keep sending more data
function p13gotUploadData(data) {
var cmd = JSON.parse(data);
if ((uploadFile == null) || (parseInt(uploadFile.xfilePtr) != parseInt(cmd.reqid))) { return; }
if (cmd.action == 'uploadstart') {
p13uploadNextPart(false);
for (var i = 0; i < 8; i++) { p13uploadNextPart(true); } // Send 8 more blocks of 4 k to full the websocket.
} else if (cmd.action == 'uploadack') {
p13uploadNextPart(false);
} else if (cmd.action == 'uploaderror') {
p13uploadFileCancel();
}
}
// Push the next part of the file into the websocket. If dataPriming is true, push more data only if it's not the last block of the file.
function p13uploadNextPart(dataPriming) {
var data = uploadFile.xdata;
var start = uploadFile.xptr;
var end = uploadFile.xptr + 4096;
if (end > data.byteLength) { if (dataPriming == true) { return; } end = data.byteLength; }
if (start == data.byteLength) {
if (uploadFile.ws != null) { uploadFile.ws.Stop(); uploadFile.ws = null; }
if (uploadFile.xfiles.length > uploadFile.xfilePtr + 1) { p13uploadReconnect(); } else { p13uploadFileCancel(); }
} else {
var datapart = data.slice(start, end);
uploadFile.ws.send(datapart);
uploadFile.xptr = end;
Q('d2progressBar').value = end;
}
}
//
// DEVICE EVENTS
//
var currentDeviceEvents = null;
function deviceEventsUpdate() {
var x = '', dateHeader = null;
for (var i in currentDeviceEvents) {
var event = currentDeviceEvents[i], time = new Date(event.time);
if (event.msg) {
if (event.h == null) { event.h = Math.random(); }
if (printDate(time) != dateHeader) {
if (dateHeader != null) x += '</table>';
dateHeader = printDate(time);
x += '<table class=p3eventsTable cellpadding=0 cellspacing=0><tr><td colspan=4 class=DevSt>' + dateHeader + '</td></tr>';
}
var icon = 'si3';
if (event.etype == 'user') icon = 'm2';
if (event.etype == 'server') icon = 'si3';
var msg = EscapeHtml(event.msg).split('(R)').join('&reg;');
if (event.username) {
if ((userinfo.siteadmin & 2) && (event.userid)) {
msg = '<a href=# onclick=\'gotoUser("' + encodeURIComponent(event.userid) + '");haltEvent(event);\'>' + EscapeHtml(event.username) + '</a> &rarr; ' + msg;
} else {
msg = EscapeHtml(event.username) + ' &rarr; ' + msg;
}
}
if (event.etype == 'relay' || event.action == 'relaylog') icon = 'relayIcon16';
x += '<tr onclick=showEventDetails(' + event.h + ',1) onmouseover=eventMouseHover(this,1) onmouseout=eventMouseHover(this,0) style=cursor:pointer><td style=width:18px><div class=' + icon + '></div></td><td class=g1>&nbsp;</td><td class=style10>' + printTime(time) + ' - ' + msg + '</td><td class=g2>&nbsp;</td></tr><tr style=height:2px></tr>';
}
}
if (dateHeader != null) x += '</table>';
if (x == '') x = '<br><i>' + "Geen gebeurtenissen gevonden" + '</i><br><br>';
QH('p16events', x);
}
function refreshDeviceEvents() {
meshserver.send({ action: 'events', nodeid: currentNode._id, limit: parseInt(p16limitdropdown.value) });
}
function showEventDetails(h, mode) {
var eventList, xevent;
if (mode == 1) { eventList = currentDeviceEvents; }
if (mode == 2) { eventList = events; }
if (mode == 3) { eventList = currentUserEvents; }
for (var i in eventList) { if (eventList[i].h == h) { xevent = eventList[i]; break; } }
if (xevent) {
if (xxdialogMode) return false;
var x = '<div style=overflow-y:auto>';
for (var i in xevent) {
if ((i == 'h') || (i == '_id') || (i == 'ids') || (i == 'domain') || (xevent[i] == null) || (typeof xevent[i] == 'object')) continue;
x += addHtmlValue3(EscapeHtml(i), EscapeHtml(xevent[i]));
}
x += '</div>';
setDialogMode(2, "Gebeurtenis details", 9, null, x);
}
}
//
// CONSOLE
//
function agentConsoleHandleKeys(e) {
if ((e.ctrlKey) || (e.altKey)) { return true; }
var processed = 0, box = Q('p15consoleText');
if (e.key) {
if (e.keyCode == 13 && consoleFocus == 0) { p15consoleSend(e); processed = 1; }
else if (e.keyCode == 8 && consoleFocus == 0) { var x = box.value; box.value = x.substring(0, x.length - 1); processed = 1; }
else if (e.keyCode == 27) { box.value = ''; processed = 1; }
else if ((e.keyCode == 38) || (e.keyCode == 40)) { // Arrow up || Arrow down
var hindex = consoleHistory.indexOf(box.value);
//console.log(hindex, consoleHistory);
if ((e.keyCode == 38) && ((consoleHistory.length - 1) > hindex)) { box.value = consoleHistory[hindex + 1]; }
else if ((e.keyCode == 40) && (hindex > 0)) { box.value = consoleHistory[hindex - 1]; }
else if ((e.keyCode == 40) && (hindex == 0)) { box.value = ''; }
processed = 1;
}
else if (e.key.length === 1) {
//box.value = ((box.value + e.key));
insertTextAtCursor(box, e.key);
processed = 1;
}
} else {
if (e.charCode != 0 && consoleFocus == 0) { box.value = ((box.value + String.fromCharCode(e.charCode))); processed = 1; }
}
if (processed > 0) { return haltEvent(e); }
}
// Insert text at the cursor location on the
function insertTextAtCursor(ctrl, val) {
if (document.selection) { ctrl.focus(); sel = document.selection.createRange(); sel.text = val; }
else if (ctrl.selectionStart || ctrl.selectionStart == '0') {
var start = ctrl.selectionStart, end = ctrl.selectionEnd;
ctrl.value = ctrl.value.substring(0, start) + val + ctrl.value.substring(end, ctrl.value.length);
ctrl.setSelectionRange(end + 1, end + 1);
} else { ctrl.value += myValue; }
}
var consoleNode;
var consoleServerText = '';
function setupConsole() {
if (xxcurrentView == 115) {
// Setup server console
var samenode = (consoleNode == 'server');
consoleNode = 'server';
QH('p15deviceName', "Mijn server console");
QE('p15consoleText', true);
QH('p15statetext', '');
QH('p15coreName', '');
QV('p15outputselecttd', false);
if (samenode == false) {
QH('p15agentConsoleText', consoleServerText);
Q('p15agentConsoleText').scrollTop = Q('p15agentConsoleText').scrollHeight;
}
} else {
// Setup the console
var samenode = (consoleNode == currentNode);
consoleNode = currentNode;
var mesh = meshes[consoleNode.meshid];
var meshrights = mesh.links[userinfo._id].rights;
if ((meshrights & 16) != 0) {
if (consoleNode.consoleText == null) { consoleNode.consoleText = ''; }
if (samenode == false) {
QH('p15agentConsoleText', consoleNode.consoleText);
Q('p15agentConsoleText').scrollTop = Q('p15agentConsoleText').scrollHeight;
}
var online = (((consoleNode.conn & 1) != 0) || ((consoleNode.conn & 16) != 0)) ? true : false;
var onlineText = ((consoleNode.conn & 1) != 0) ? "Agent is online" : "Agent is offline"
if ((consoleNode.conn & 16) != 0) { onlineText += ", MQTT is online" }
QH('p15statetext', onlineText);
QE('p15consoleText', online);
QE('p15uploadCore', ((consoleNode.conn & 1) != 0));
QV('p15outputselecttd', (consoleNode.conn & 17) == 17);
} else {
QH('p15statetext', "Toegang geweigerd");
QE('p15consoleText', false);
QE('p15uploadCore', false);
QV('p15outputselecttd', false);
}
}
}
// Clear the console for this node
function p15consoleClear() {
QH('p15agentConsoleText', '');
Q('id_p15consoleClear').blur();
if (xxcurrentView == 115) {
consoleServerText = '';
} else {
consoleNode.consoleText = '';
}
}
// Send a command to the agent
var consoleHistory = [];
function p15consoleSend(e) {
if (e && e.keyCode != 13) return;
var v = Q('p15consoleText').value, t = '<div style=color:green>&gt; ' + EscapeHtml(v) + '<br/></div>';
if (xxcurrentView == 115) {
// Send the command to the server - TODO: In the future, we may support multiple servers.
consoleServerText += t;
meshserver.send({ action: 'serverconsole', value: v });
} else {
if (((consoleNode.conn & 16) != 0) && ((Q('p15outputselect').value == 2) || ((consoleNode.conn & 1) == 0))) {
// Send the command to MQTT
t = '<div style=color:orange>' + "MQTT" + '&gt; ' + EscapeHtml(v) + '<br/></div>';
consoleNode.consoleText += t;
meshserver.send({ action: 'sendmqttmsg', topic: 'console', nodeids: [ consoleNode._id ], msg: v });
} else {
// Send the command to the mesh agent
consoleNode.consoleText += t;
meshserver.send({ action: 'msg', type: 'console', nodeid: consoleNode._id, value: v });
}
}
Q('p15agentConsoleText').innerHTML += t;
Q('p15agentConsoleText').scrollTop = Q('p15agentConsoleText').scrollHeight;
Q('p15consoleText').value = '';
// Add command to history list
if (v.length > 0) {
// Move this command to the top if it already exists
var j = consoleHistory.indexOf(v);
if (j >= 0) { consoleHistory.splice(j, 1); }
consoleHistory.unshift(v);
consoleHistory.splice(10);
}
}
// Handle Mesh Agent console data
function p15consoleReceive(node, data, source) {
if (node === 'serverconsole') {
// Server console data
data = '<div>' + data + '</div>'
consoleServerText += data;
if (consoleNode == 'server') {
Q('p15agentConsoleText').innerHTML += data;
Q('p15agentConsoleText').scrollTop = Q('p15agentConsoleText').scrollHeight;
}
} else {
// Agent console data
if (source == 'MQTT') { data = '<div style=color:red>' + "MQTT" + '&gt; ' + EscapeHtml(data) + '<br/></div>'; } else { data = '<div>' + data + '</div>' }
if (node.consoleText == null) { node.consoleText = data; } else { node.consoleText += data; }
if (consoleNode == node) {
Q('p15agentConsoleText').innerHTML += data;
Q('p15agentConsoleText').scrollTop = Q('p15agentConsoleText').scrollHeight;
}
}
}
// Save console text to file
function p15downloadConsoleText() {
saveAs(new Blob([Q('p15agentConsoleText').innerText], { type: 'application/octet-stream' }), "console.txt");
}
// Called then user presses the "Change Core" button
function p15uploadCore(e) {
if (xxdialogMode) return;
if (e.shiftKey == true) { meshserver.send({ action: 'uploadagentcore', nodeid: consoleNode._id, type: 'default' }); } // Upload default core
else if (e.altKey == true) { meshserver.send({ action: 'uploadagentcore', nodeid: consoleNode._id, type: 'clear' }); } // Clear the core
else if (e.ctrlKey == true) { p15uploadCore2(); } // Upload the core from a file
else { setDialogMode(2, "Agentactie uitvoeren", 3, p15uploadCoreEx, addHtmlValue("Aktie", '<select id=d3coreMode style=width:230px><option value=1>' + "Upload standaard serverkern" + '</option><option value=2>' + "Maak de kern leeg" + '</option><option value=6>' + "Upload herstelkern" + '</option><option value=3>' + "Upload een kernbestand" + '</option><option value=4>' + "Softwarematig verbreken agent" + '</option><option value=5>' + "Harde ontkoppeling agent" + '</option></select>')); }
}
function p15uploadCoreEx() {
if (Q('d3coreMode').value == 1) {
// Upload default core
meshserver.send({ action: 'uploadagentcore', nodeid: consoleNode._id, type: 'default' });
} else if (Q('d3coreMode').value == 2) {
// Clear the core
meshserver.send({ action: 'uploadagentcore', nodeid: consoleNode._id, type: 'clear' });
} else if (Q('d3coreMode').value == 3) {
// Upload file as core
p15uploadCore2();
} else if (Q('d3coreMode').value == 4) {
// Soft disconnect the mesh agent
meshserver.send({ action: 'agentdisconnect', nodeid: consoleNode._id, disconnectMode: 1 });
} else if (Q('d3coreMode').value == 5) {
// Hard disconnect the mesh agent
meshserver.send({ action: 'agentdisconnect', nodeid: consoleNode._id, disconnectMode: 2 });
} else if (Q('d3coreMode').value == 6) {
// Upload a recovery core
meshserver.send({ action: 'uploadagentcore', nodeid: consoleNode._id, type:'recovery' });
}
}
// Called then user opts to upload a file as core
function p15uploadCore2() {
if (xxdialogMode) return;
Q('d3localmodeform').action = 'uploadmeshcorefile.ashx';
Q('d3auth').value = authCookie;
Q('d3attrib').value = currentNode._id;
setDialogMode(3, "Upload Mesh Agent Core", 3, p15uploadCoreEx2);
d3init();
}
function p15uploadCoreEx2() {
var mode = Q('d3uploadMode').value;
if (mode == 1) {
// Upload local mesh agent core
Q('d3submit').click();
} else {
// Upload server mesh agent code
var files = d3getFileSel();
if (files.length == 1) { meshserver.send({ action: 'uploadagentcore', nodeid: consoleNode._id, type: 'custom', path: d3filetreelocation.join('/') + '/' + files[0] }); }
}
}
//
// MY ACCOUNT
//
function account_manageAuthApp() {
if (xxdialogMode || ((features & 4096) == 0)) return;
if (userinfo.otpsecret == 1) { account_removeOtp(); } else { account_addOtp(); }
return false;
}
function account_addOtp() {
if (xxdialogMode || (userinfo.otpsecret == 1) || ((features & 4096) == 0)) return;
setDialogMode(2, "Verificatie-app", 2, function () { meshserver.send({ action: 'otpauth-setup', secret: Q('d2optsecret').attributes.secret.value, token: Q('d2otpauthinput').value }); }, ('<div id=d2optinfo>' + "Laden..." + '</div>'), 'otpauth-request');
meshserver.send({ action: 'otpauth-request' });
}
function account_addOtpCheck(e) {
var tokenIsValid = (Q('d2otpauthinput').value.length == 6);
QE('idx_dlgOkButton', tokenIsValid);
if (e && (e.keyCode == 13) && tokenIsValid) { dialogclose(1); }
}
function account_removeOtp() {
if (xxdialogMode || (userinfo.otpsecret != 1) || ((features & 4096) == 0)) return;
setDialogMode(2, "Verificatie-app", 3, function () { meshserver.send({ action: 'otpauth-clear' }); }, "Bevestig de verwijdering van de Tweestapsverificatie applicatie?");
}
function account_manageOtp(action) {
if ((xxdialogMode == 2) && (xxdialogTag == 'otpauth-manage')) { dialogclose(0); }
if (xxdialogMode || ((features & 4096) == 0)) return false;
if ((userinfo.otpsecret == 1) || (userinfo.otphkeys > 0)) { meshserver.send({ action: 'otpauth-getpasswords', subaction: action }); }
return false;
}
function account_manageHardwareOtp() {
if ((xxdialogMode == 2) && (xxdialogTag == 'otpauth-hardware-manage')) { dialogclose(0); }
if (xxdialogMode || ((features & 4096) == 0)) return false;
meshserver.send({ action: 'otp-hkey-get' });
return false;
}
function account_addhkey(type) {
if (type == 3) {
var x = "Typ de naam van de sleutel die u wilt toevoegen." + '<br /><br />';
x += addHtmlValue("Sleutelnaam", '<input id=dp1keyname style=width:230px maxlength=20 autocomplete=off placeholder="' + "Mijn sleutel" + '" onkeyup=account_addhkeyValidate(event,2) />');
} else if (type == 2) {
var x = "Typ een sleutelnaam, selecteer het vak OTP en druk op de knop op de YubiKey ™." + '<br /><br />';
x += addHtmlValue("Sleutelnaam", '<input id=dp1keyname style=width:230px maxlength=20 autocomplete=off placeholder="' + "Mijn sleutel" + '" onkeyup=account_addhkeyValidate(event,1) />');
x += addHtmlValue("YubiKey™ OTP", '<input id=dp1key style=width:230px autocomplete=off onkeyup=account_addhkeyValidate(event,2) />');
}
setDialogMode(2, "Beveiligingssleutel toevoegen", 3, account_addhkeyEx, x, type);
Q('dp1keyname').focus();
}
function account_addhkeyValidate(e,action) {
if ((e != null) && (e.keyCode == 13)) { if (action == 2) { dialogclose(1); } else { Q('dp1key').focus(); } }
}
function account_addhkeyEx(button, type) {
var name = Q('dp1keyname').value;
if (name == '') { name = 'MyKey'; }
if (type == 2) {
meshserver.send({ action: 'otp-hkey-yubikey-add', name: name, otp: Q('dp1key').value });
setDialogMode(2, "Beveiligingssleutel toevoegen", 0, null, '<br />' + "Controleren..." + '<br /><br /><br />', 'otpauth-hardware-manage');
} else if (type == 3) {
meshserver.send({ action: 'webauthn-startregister', name: name });
}
}
function account_removehkey(index) {
meshserver.send({ action: 'otp-hkey-remove', index: index });
meshserver.send({ action: 'otp-hkey-get' });
}
var loclist = { 'af': "Afrikaans", 'sq': "Albanees", 'ar': "Arabisch (Standaard)", 'ar-dz': "Arabisch (Algerije)", 'ar-bh': "Arabisch (Bahrein)", 'ar-eg': "Arabisch (Egypte)", 'ar-iq': "Arabisch (Irak)", 'ar-jo': "Arabisch (Jordanië)", 'ar-kw': "Arabisch (Koeweit)", 'ar-lb': "Arabisch (Libanon)", 'ar-ly': "Arabisch (Libië)", 'ar-ma': "Arabisch (Marokko)", 'ar-om': "Arabisch (Oman)", 'ar-qa': "Arabisch (Qatar)", 'ar-sa': "Arabisch (Saoedi-Arabië)", 'ar-sy': "Arabisch (Syrië)", 'ar-tn': "Arabisch (Tunesië)", 'ar-ae': "Arabisch (Verenigde Arabische Emiraten.)", 'ar-ye': "Arabisch (Jemen)", 'an': "Aragonese", 'hy': "Armeens", 'as': "Assamees", 'ast': "Asturische", 'az': "Azerbeidzjaanse", 'eu': "baskisch", 'bg': "Bulgaars", 'be': "Wit-Rusland", 'bn': "Bengalees", 'bs': "Bosnisch", 'br': "Breton", 'my': "Birmaans", 'ca': "Catalaans", 'ch': "Chamorro", 'ce': "Tsjetsjeense", 'zh': "Chinees", 'zh-hk': "Chinees (Hong Kong)", 'zh-cn': "Chinees (PRC)", 'zh-sg': "Chinees (Singapore)", 'zh-tw': "Chinees (Taiwan)", 'cv': "Chuvash", 'co': "Corsicaans", 'cr': "Cree", 'hr': "Kroatisch", 'cs': "Tsjechisch", 'da': "Deens", 'nl': "Nederlands (Standaard)", 'nl-be': "Nederlands (Belgisch)", 'en': "Engels", 'en-au': "Engels (Australië)", 'en-bz': "Engels (Belize)", 'en-ca': "Engels (Canada)", 'en-ie': "Engels (Ierland)", 'en-jm': "Engels (Jamaica)", 'en-nz': "Engels (Nieuw Zeeland)", 'en-ph': "Engels (Filippijnen)", 'en-za': "Engels (Zuid Africa)", 'en-tt': "Engels (Trinidad & Tobago)", 'en-gb': "Engels (Verenigd Koninkrijk)", 'en-us': "Engels (Verenigde staten van America)", 'en-zw': "Engels (Zimbabwe)", 'eo': "Esperanto", 'et': "Estlands", 'fo': "Faeroese", 'fa': "Perzisch (Perzisch)", 'fj': "Fijian", 'fi': "Fins", 'fr': "Frans (standaard)", 'fr-be': "Frans (België)", 'fr-ca': "Frans (Canada)", 'fr-fr': "Frans (Frankrijk)", 'fr-lu': "Frans (Luxemburg)", 'fr-mc': "Frans (Monaco)", 'fr-ch': "Frans (Zwitserland)", 'fy': "Fries", 'fur': " ", 'gd': "Gaelic (Schots)", 'gd-ie': "Gaelic (Iers)", 'gl': "Galacian", 'ka': "Georgisch", 'de': "Duits (standaard)", 'de-at': "Duits (Oostenrijk)", 'de-de': "Duits (duitsland)", 'de-li': "Duits (Liechtenstein)", 'de-lu': "Duits (Luxemburg)", 'de-ch': "Duits (Zwitserland)", 'el': "Grieks", 'gu': "Gujurati", 'ht': "Haïtiaanse", 'he': "Hebreeuws", 'hi': "Hindi", 'hu': "Hongaars", 'is': "IJslands", 'id': "Indonesisch", 'iu': "Inuktitut", 'ga': "Iers", 'it': "Italiaans (standaard)", 'it-ch': "Italiaans (Zwitserland)", 'ja': "Japans", 'kn': "Kannada", 'ks': "kasjmier", 'kk': "Kazachse", 'km': "Khmer", 'ky': "Kirgizisch", 'tlh': "Klingon", 'ko': "Koreaans", 'ko-kp': "Koreaans (Noord-Korea)", 'ko-kr': "Koreaans (Zuid-Korea)", 'la': "latijns", 'lv': "Lets", 'lt': "Litouws", 'lb': "Luxemburgs", 'mk': "FYRO Macedonisch", 'ms': "Maleis", 'ml': "Malayalam", 'mt': "Maltese", 'mi': "Maori", 'mr': "Marathi", 'mo': "Moldavisch ", 'nv': "Navajo", 'ng': "Ndonga", 'ne': "Nepalees", 'no': "Noors", 'nb': "Noors (Bokmal)", 'nn': "Noors (Nynorsk)", 'oc': "Occitaans", 'or': "Oriya", 'om': "Oromo", 'fa-ir': "Perzisch / Iran", 'pl': "Pools", 'pt': "Portugees", 'pt-br': "Portugees (Brazilië)", 'pa': "Punjabi", 'pa-in': "Punjabi (India)", 'pa-pk': "Punjabi (Pakistan)", 'qu': "Quechua", 'rm': "Rhetoromaans", 'ro': "Roemeense", 'ro-mo': "Roemeens (Moldavië)", 'ru': "Russisch", 'ru-mo': "Russisch (Moldavië)", 'sz': "Sami (Lapse)", 'sg': "Sango", 'sa': "Sanskriet", 'sc': "Sardijns", 'sd': "Sindhi", 'si': "Sinhalees", 'sr': "Servisch", 'sk': "Slowaaks", 'sl': "Sloveens", 'so': "Somani", 'sb': "Sorbisch", 'es': "Spaans", 'es-ar': "Spaans (Argentinië)", 'es-bo': "Spaans (Bolivia)", 'es-cl': "Spaans (Chili)", 'es-co': "Spaans (Colombia)", 'es-cr': "Spaans (Costa Rica)", 'es-do': "Spaans (Dominicaanse Republiek)", 'es-ec': "Spaans (Ecuador)", 'es-sv': "Spaans (El Salvador)", 'es-gt': "Spaans (Guatemala)", 'es-hn': "Spaans (Honduras)", 'es-mx': "Spaans (Mexico)", 'es-ni': "Spaans (Nicaragua)", 'es-pa': "Spaans (Panama)", 'es-py': "Spaans (Paraguay)", 'es-pe': "Spaans (Peru)", 'es-pr': "Spaans (Puerto Rico)", 'es-es': "Spaans (Spanje)", 'es-uy': "Spaans (Uruguay)", 'es-ve': "Spaans (Venezuela)", 'sx': "Sutu", 'sw': "Swahili", 'sv': "Zweeds", 'sv-fi': "Zweeds (Finland)", 'sv-sv': "Zweeds (Zweden)", 'ta': "Tamil", 'tt': "Tartaar", 'te': "Teluga", 'th': "Thais", 'tig': "Tigre", 'ts': "Tsonga", 'tn': "Tswana", 'tr': "Turks", 'tk': "Turkmeens", 'uk': "Oekraïens", 'hsb': "Sorbisch", 'ur': "Urdu", 've': "Venda", 'vi': "Vietnamees", 'vo': "Volapuk", 'wa': "Waals", 'cy': "Wels", 'xh': "Xhosa", 'ji': "Jiddisch", 'zu': "Zoeloe" };
function account_showLocalizationSettings() {
if (xxdialogMode) return false;
var n = getstore('loctag', 0), y = '';
var x = '<select id=d2locselect style=width:240px><option value=\"*\">' + "Browserwaarde gebruiker" + '</option>';
for (var i in loclist) { x += '<option value="' + i + '"' + ((n == i)?' selected':'') + '>' + i + ' - ' + loclist[i] + '</option>'; }
x += '</select>';
if (serverinfo.languages && serverinfo.languages.length > 0) {
y += "Als u de taal wilt wijzigen, moet de pagina worden vernieuwd." + '<br /><br />';
var z = '<select id=d2langselect style=width:240px><option value=\"*\">' + "Browserwaarde gebruiker" + '</option>';
for (var i in serverinfo.languages) {
var lang = serverinfo.languages[i];
z += '<option value="' + lang + '"' + ((userinfo.lang == lang)?' selected':'') + '>' + lang + ' - ' + loclist[lang] + '</option>';
}
z += '</select>';
y += addHtmlValue("Taal", z);
}
y += addHtmlValue("Datum & Tiid", x);
if ((userinfo.siteadmin == 0xFFFFFFFF) && (domain == '')) {
y += '<br /><a rel="noreferrer noopener" target="_blank" href="translator.htm">' + "Help bij het vertalen van MeshCentral" + '</a>';
}
setDialogMode(2, "Lokalisatie instellingen", 3, account_showLocalizationSettingsEx, y);
return false;
}
function account_showLocalizationSettingsEx() {
// Set user language
var lang = Q('d2langselect').value;
if ((lang == '*') && (userinfo.lang == null)) { lang = userinfo.lang; }
if (lang != userinfo.lang) { meshserver.send({ action: 'changelang', lang: lang }); }
// Set date localization
var n = getstore('loctag', 0);
var m = Q('d2locselect').value;
if (n != m) {
if (m != '*') { args.locale = m; } else { delete args.locale; }
putstore('loctag', args.locale);
masterUpdate(0xFFFFFFFF); // Refresh everything.
}
}
function account_enableNotifications() {
if (Notification) { Notification.requestPermission().then(function (permission) { QV('accountEnableNotificationsSpan', permission != 'granted'); }); }
return false;
}
function account_showAccountNotifySettings() {
if (xxdialogMode) return false;
var x = '';
x += '<div><label><input id=p2notifyPlayNotifySound type=checkbox />' + "Meldingsgeluid." + '</label></div>';
x += '<div><label><input id=p2notifyGroupName type=checkbox />' + "Display Device Group Name" + '</label></div>';
x += '<div><label><input id=p2notifyIntelDeviceConnect type=checkbox />' + "Apparaat verbindingen." + '</label></div>';
x += '<div><label><input id=p2notifyIntelDeviceDisconnect type=checkbox />' + "Apparaat verbroken." + '</label></div>';
x += '<div><label><input id=p2notifyIntelAmtKvmActions type=checkbox />' + "Intel® AMT desktop- en seriële gebeurtenissen." + '</label></div>';
setDialogMode(2, "meldingsinstellingen", 3, account_showAccountNotifySettingsEx, x);
var n = getstore('notifications', 0);
Q('p2notifyPlayNotifySound').checked = (n & 1);
Q('p2notifyIntelDeviceConnect').checked = (n & 2);
Q('p2notifyIntelDeviceDisconnect').checked = (n & 4);
Q('p2notifyIntelAmtKvmActions').checked = (n & 8);
Q('p2notifyGroupName').checked = (n & 16);
return false;
}
function account_showAccountNotifySettingsEx() {
var n = 0;
n += Q('p2notifyPlayNotifySound').checked ? 1 : 0;
n += Q('p2notifyIntelDeviceConnect').checked ? 2 : 0;
n += Q('p2notifyIntelDeviceDisconnect').checked ? 4 : 0;
n += Q('p2notifyIntelAmtKvmActions').checked ? 8 : 0;
n += Q('p2notifyGroupName').checked ? 16 : 0;
putstore('notifications', n);
}
function account_showVerifyEmail() {
if (xxdialogMode || (userinfo.emailVerified == true) || (serverinfo.emailcheck != true)) return false;
var x = "Klik op OK om een verificatiebericht te sturen naar:" + '<br /><div style=padding:8px><b>' + EscapeHtml(userinfo.email) + '</b></div>' + "Wacht enkele minuten om de verificatie te ontvangen.";
setDialogMode(2, "email verificatie", 3, account_showVerifyEmailEx, x);
return false;
}
function account_showVerifyEmailEx() {
meshserver.send({ action: 'verifyemail', email: userinfo.email });
}
function account_showChangeEmail() {
if (xxdialogMode) return false;
var x = "Wijzig hier het e-mailadres van uw account." + '<br /><br />';
x += addHtmlValue('Email', '<input id=dp2email style=width:230px maxlength=256 onchange=account_validateEmail() onkeyup=account_validateEmail(event) />');
setDialogMode(2, "Email Adres wijzigen", 3, account_changeEmail, x);
if (userinfo.email != null) { Q('dp2email').value = userinfo.email; }
account_validateEmail();
Q('dp2email').focus();
return false;
}
function account_validateEmail(e, email) {
QE('idx_dlgOkButton', validateEmail(Q('dp2email').value) && (Q('dp2email').value != userinfo.email));
if ((e != null) && (e.keyCode == 13)) { dialogclose(1); }
}
function account_changeEmail() {
meshserver.send({ action: 'changeemail', email: Q('dp2email').value });
}
function account_showDeleteAccount() {
if (xxdialogMode) return false;
var x = "Om dit account te verwijderen, typt u het accountwachtwoord in beide onderstaande vakken en drukt u op OK." + '<br /><br />';
x += '<form method=post><input type=hidden name=action value=deleteaccount /><input type=hidden name=authcookie value=" + authCookie + " /><table style=margin-left:80px><tr>';
x += '<td align=right>' + "Wachtwoord:" + '</td><td><input id=apassword1 type=password name=apassword1 autocomplete=off onchange=account_validateDeleteAccount() onkeyup=account_validateDeleteAccount() /></td>';
x += '</tr><tr><td align=right>' + "Wachtwoord:" + '</td><td><input id=apassword2 type=password name=apassword2 autocomplete=off onchange=account_validateDeleteAccount() onkeyup=account_validateDeleteAccount() /></td>';
x += '</tr></table><br /><div style=padding:10px;margin-bottom:4px>';
x += '<input id=account_dlgCancelButton type=button value=Cancel style=float:right;width:80px;margin-left:5px onclick=dialogclose(0)>';
x += '<input id=account_dlgOkButton type=submit value=OK style="float:right;width:80px" onclick=dialogclose(1)>';
x += '</div><br /></form>';
setDialogMode(2, "Verwijder account", 0, null, x);
account_validateDeleteAccount();
Q('apassword1').focus();
return false;
}
function account_showChangePassword() {
if (xxdialogMode) return false;
var x = "Wijzig uw wachtwoord door het invoeren van het oude en het nieuwe wachtwoord twee keer in de vakken hieronder.";
if (features & 0x00010000) { " Een wachtwoord hint kan gebruikt worden maar wordt afgeraden"; }
x += '<br /><br />';
//x += "<form action='" + domainUrl + "changepassword' method=post>";
x += '<table style=margin-left:60px>';
x += '<tr><td align=right>' + nobreak("Oud wachtwoord:") + '</td><td><input id=apassword0 type=password name=apassword0 autocomplete=off onchange=account_validateNewPassword() onkeyup=account_validateNewPassword() onkeydown=account_validateNewPassword() /> <b></b></td></tr>';
x += '<tr><td align=right>' + nobreak("Nieuw wachtwoord:") + '</td><td><input id=apassword1 type=password name=apassword1 autocomplete=off onchange=account_validateNewPassword() onkeyup=account_validateNewPassword() onkeydown=account_validateNewPassword() /> <b><span id=dxPassWarn></span></b></td></tr>';
x += '<tr><td align=right>' + nobreak("Nieuw wachtwoord:") + '</td><td><input id=apassword2 type=password name=apassword2 autocomplete=off onchange=account_validateNewPassword() onkeyup=account_validateNewPassword() onkeydown=account_validateNewPassword() /></td></tr>';
if (features & 0x00010000) { x += '<tr><td align=right>' + "wachtwoord hint:" + '</td><td><input id=apasswordhint name=apasswordhint maxlength=250 type=text autocomplete=off onchange=account_validateNewPassword() onkeyup=account_validateNewPassword() onkeydown=account_validateNewPassword() /></td></tr>'; }
x += '</table>'
if (passRequirements) {
var r = [], rc = 0;
for (var i in passRequirements) { if ((i != 'reset') && (i != 'hint')) { r.push(i + ':' + passRequirements[i]); rc++; } }
if (rc > 0) { x += '<br /><span style=font-size:x-small>' + "Vereisten:" + r.join(', ') + '.</span>'; }
}
x += '<br />';
//x += '<br /><div style=padding:10px;margin-bottom:4px>';
//x += '<input id=account_dlgCancelButton type=button value=Cancel style=float:right;width:80px;margin-left:5px onclick=dialogclose(0)>';
//x += '<input id=account_dlgOkButton type=submit value=OK style="float:right;width:80px" onclick=dialogclose(1)>';
//x += '</div><br /></form>';
setDialogMode(2, "Verander wachtwoord", 3, account_showChangePasswordEx, x);
Q('apassword0').focus();
account_validateNewPassword();
return false;
}
function account_showChangePasswordEx() {
if (Q('apassword1').value == Q('apassword2').value) {
var r = { action: 'changepassword', oldpass: Q('apassword0').value, newpass: Q('apassword1').value };
if (features & 0x00010000) { r.hint = Q('apasswordhint').value; }
meshserver.send(r);
}
}
function account_createMesh() {
if (xxdialogMode) return false;
// Check if we are disallowed from creating a device group
if ((userinfo.siteadmin != 0xFFFFFFFF) && ((userinfo.siteadmin & 64) != 0)) { setDialogMode(2, "Nieuwe apparaatgroep", 1, null, "Dit account heeft niet de rechten om een nieuwe apparaatgroep te maken."); return false; }
// Remind the user to verify the email address
if ((userinfo.emailVerified !== true) && (serverinfo.emailcheck == true) && (userinfo.siteadmin != 0xFFFFFFFF)) { setDialogMode(2, "Gebruikersaccount beveiliging", 1, null, "Geen toegang tot een apparaat totdat een e-mailadres is geverifieerd. Dit is vereist voor wachtwoordherstel. Ga naar het tabblad \"Mijn account\" om een e-mailadres te wijzigen en te verifiëren."); return false; }
// Remind the user to add two factor authentication
if ((features & 0x00040000) && !((userinfo.otpsecret == 1) || (userinfo.otphkeys > 0) || (userinfo.otpkeys > 0))) { setDialogMode(2, "Gebruikersaccount beveiliging", 1, null, "Geen toegang tot een apparaat totdat tweefactorauthenticatie is ingeschakeld. Dit is vereist voor extra beveiliging. Ga naar het tabblad \"Mijn account\" en bekijk het gedeelte \"Accountbeveiliging\"."); return false; }
// We are allowed, let's prompt to information
var x = "Maak een nieuwe apparaatgroep met behulp van de onderstaande opties." + '<br /><br />';
x += addHtmlValue("Naam", '<input id=dp2meshname style=width:230px maxlength=64 onchange=account_validateMeshCreate() onkeyup=account_validateMeshCreate(event,1) />');
x += addHtmlValue("Typen", '<div style=width:230px;margin:0;padding:0><select id=dp2meshtype style=width:100% onchange=account_validateMeshCreate() onkeyup=account_validateMeshCreate(event,2) ><option value=2>' + "Beheer met behulp van een software-agent" + '</option><option value=1>' + "Intel&reg; AMT alleen, geen agent" + '</option></select></div>');
x += addHtmlValue("Omschrijving", '<div style=width:230px;margin:0;padding:0><textarea id=dp2meshdesc maxlength=1024 style=width:100%;resize:none></textarea></div>');
setDialogMode(2, "Nieuwe apparaatgroep", 3, account_createMeshEx, x);
account_validateMeshCreate();
Q('dp2meshname').focus();
return false;
}
function account_validateMeshCreate(e, x) {
if ((x == 1) && (e != null) && (e.key == "invoeren") && (Q('dp2meshname').value.length > 0)) { Q('dp2meshtype').focus(); }
if ((x == 2) && (e != null) && (e.key == "invoeren")) { Q('dp2meshdesc').focus(); }
QE('idx_dlgOkButton', Q('dp2meshname').value.length > 0);
}
function account_createMeshEx(button, tag) {
meshserver.send({ action: 'createmesh', meshname: Q('dp2meshname').value, meshtype: Q('dp2meshtype').value, desc: Q('dp2meshdesc').value });
}
function account_validateDeleteAccount() {
QE('account_dlgOkButton', (Q('apassword1').value.length > 0) && (Q('apassword1').value == Q('apassword2').value));
}
function account_validateNewPassword() {
var r = '', ok = (Q('apassword0').value.length > 0) && (Q('apassword1').value.length > 0) && (Q('apassword1').value == Q('apassword2').value) && (Q('apassword0').value != Q('apassword1').value);
if ((features & 0x00010000) && (Q('apasswordhint').value == Q('apassword1').value)) { ok = false; }
if (Q('apassword1').value != '') {
if (passRequirements == null || passRequirements == '') {
// No password requirements, display password strength
var passStrength = checkPasswordStrength(Q('apassword1').value);
if (passStrength >= 80) { r = '<span style=color:green>' + "Sterk" + '<span>'; } else if (passStrength >= 60) { r = '<span style=color:blue>' + "Goed" + '<span>'; } else { r = '<span style=color:red>' + "Zwak" + '<span>'; }
} else {
// Password requirements provided, use that
var passReq = checkPasswordRequirements(Q('apassword1').value, passRequirements);
if (passReq == false) { ok = false; r = '<span style=color:red>' + "Beleid" + '<span>' }
}
}
QH('dxPassWarn', r);
//QE('account_dlgOkButton', ok);
QE('idx_dlgOkButton', ok);
}
// Return a password strength score
function checkPasswordStrength(password) {
var r = 0, letters = {}, varCount = 0, variations = { digits: /\d/.test(password), lower: /[a-z]/.test(password), upper: /[A-Z]/.test(password), nonWords: /\W/.test(password) }
if (!password) return 0;
for (var i = 0; i< password.length; i++) { letters[password[i]] = (letters[password[i]] || 0) + 1; r += 5.0 / letters[password[i]]; }
for (var c in variations) { varCount += (variations[c] == true) ? 1 : 0; }
return parseInt(r + (varCount - 1) * 10);
}
// Check password requirements
function checkPasswordRequirements(password, requirements) {
if ((requirements == null) || (requirements == '') || (typeof requirements != 'object')) return true;
if (requirements.min) { if (password.length < requirements.min) return false; }
if (requirements.max) { if (password.length > requirements.max) return false; }
var num = 0, lower = 0, upper = 0, nonalpha = 0;
for (var i = 0; i < password.length; i++) {
if (/\d/.test(password[i])) { num++; }
if (/[a-z]/.test(password[i])) { lower++; }
if (/[A-Z]/.test(password[i])) { upper++; }
if (/\W/.test(password[i])) { nonalpha++; }
}
if (requirements.num && (num < requirements.num)) return false;
if (requirements.lower && (lower < requirements.lower)) return false;
if (requirements.upper && (upper < requirements.upper)) return false;
if (requirements.nonalpha && (nonalpha < requirements.nonalpha)) return false;
return true;
}
function updateMeshes() {
var r = '';
var c = 0, count = 0;
for (i in meshes) {
// Mesh positioning
if (c > 1) { r += '</tr><tr>'; c = 0; }
c++;
count++;
// Mesh rights
var meshrights = 0;
if (meshes[i].links[userinfo._id]) { meshrights = meshes[i].links[userinfo._id].rights; }
var rights = "Gedeeltelijke rechten";
if (meshrights == 0xFFFFFFFF) rights = "Volledige beheerder"; else if (meshrights == 0) rights = "Geen rechten";
// Print the mesh information
r += '<div onmouseover=devMouseHover(this,1) onmouseout=devMouseHover(this,0) style=display:inline-block;width:431px;height:50px;padding-top:1px;padding-bottom:1px;float:left><div style=float:left;width:30px;height:100%></div><div tabindex=0 style=height:100%;cursor:pointer onclick=gotoMesh(\'' + i + '\') onkeypress="if (event.key==\'Enter\') gotoMesh(\'' + i + '\')"><div class=mi style=float:left;width:50px;height:50px></div><div style=height:100%><div class=g1></div><div class=e2 style=width:300px><div class=e1>' + EscapeHtml(meshes[i].name) + '</div><div>' + rights + '</div></div><div class=g2 style=float:left></div></div></div></div>';
}
meshcount = count;
QH('p2meshes', r);
QV('p2noMeshFound', count == 0);
}
function gotoMesh(meshid) {
currentMesh = meshes[meshid];
p20updateMesh();
go(20);
return false;
}
function server_showRestoreDlg() {
if (xxdialogMode) return false;
var x = "Herstel de server met een back-up, <span style = color: red> hiermee worden de bestaande servergegevens verwijderd </span>. Doe dit alleen als je weet wat je doet." + '<br /><br />';
x += '<form action="/restoreserver.ashx" enctype="multipart/form-data" method="post"><div>';
x += '<input type=hidden name=auth value=' + authCookie + '>';
x += '<input id=account_dlgFileInput type=file name=datafile style=width:100% accept=".zip,application/octet-stream,application/zip,application/x-zip,application/x-zip-compressed" onchange=account_validateServerRestore()>';
x += '<input id=account_dlgCancelButton type=button value=' + "Afbreken" + ' style=float:right;width:80px;margin-left:5px onclick=dialogclose(0)>';
x += '<input id=account_dlgOkButton type=submit value=' + "Oke" + ' style=float:right;width:80px onclick=dialogclose(1)>';
x += '</div><br /><br /></form>';
setDialogMode(2, "Server herstellen", 0, null, x);
account_validateServerRestore();
return false;
}
function account_validateServerRestore() {
QE('account_dlgOkButton', Q('account_dlgFileInput').files.length == 1);
}
function server_showVersionDlg() {
if (xxdialogMode) return false;
setDialogMode(2, "MeshCentral Versie", 1, null, "Laden...", 'MeshCentralServerUpdate');
meshserver.send({ action: 'serverversion' });
return false;
}
function server_showVersionDlgUpdate() { QE('idx_dlgOkButton', Q('d2updateCheck').checked); }
function server_showVersionDlgEx() { meshserver.send({ action: 'serverupdate' }); }
function server_showErrorsDlg() {
if (xxdialogMode) return false;
setDialogMode(2, "MeshCentral fouten", 1, null, "Laden...", 'MeshCentralServerErrors');
meshserver.send({ action: 'servererrors' });
return false;
}
function server_showErrorsDlgUpdate() { QE('idx_dlgOkButton', Q('d2updateCheck').checked); }
function server_showErrorsDlgEx() { meshserver.send({ action: 'serverclearerrorlog' }); }
function d2CopyServerErrorsToClip() { saveAs(new Blob([Q('d2ServerErrorsLogPre').innerText], { type: 'application/octet-stream' }), "servererrors.txt"); }
//
// MY MESHS
//
var currentMesh;
function p20updateMesh() {
if (currentMesh == null) return;
QH('p20meshName', EscapeHtml(currentMesh.name));
var meshtype = format("Onbekend #{0}", currentMesh.mtype);
var meshrights = 0;
try { meshrights = currentMesh.links[userinfo._id].rights; } catch (ex) { }
if (currentMesh.mtype == 1) meshtype = "Intel&reg; AMT alleen, geen agent";
if (currentMesh.mtype == 2) meshtype = "Beheerd met behulp van een software-agent";
var x = '';
x += addHtmlValue("Naam", addLinkConditional(EscapeHtml(currentMesh.name), 'p20editmesh(1)', (meshrights & 1) != 0));
x += addHtmlValue("Omschrijving", addLinkConditional(((currentMesh.desc && currentMesh.desc != '')?EscapeHtml(currentMesh.desc):('<i>' + "Geen" + '</i>')), 'p20editmesh(2)', (meshrights & 1) != 0));
// Display group type
x += addHtmlValue("Typen", meshtype);
//x += addHtmlValue('Identifier', currentMesh._id.split('/')[2]);
// Display features
if (currentMesh.mtype == 2) {
var meshFeatures = [];
if (currentMesh.flags) {
if (currentMesh.flags & 1) { meshFeatures.push("Geautomatiseerde verwijdering"); }
if (currentMesh.flags & 2) { meshFeatures.push("Hostname Sync"); }
}
meshFeatures = meshFeatures.join(', ');
if (meshFeatures == '') { meshFeatures = '<i>' + "Geen" + '</i>'; }
x += addHtmlValue("Kenmerken", addLinkConditional(meshFeatures, 'p20editmeshfeatures()', meshrights & 1));
}
// Display user consent
if (currentMesh.mtype == 2) {
meshFeatures = [];
var consent = 0;
if (currentMesh.consent) { consent = currentMesh.consent; }
if (serverinfo.consent) { consent |= serverinfo.consent; }
if ((consent & 0x0040) && (consent & 0x0008)) { meshFeatures.push("Bureaublad vraag en werkbalk"); } else if (consent & 0x0040) { meshFeatures.push("Bureaublad werkbalk"); } else if (consent & 0x0008) { meshFeatures.push("Bureaublad vraag"); } else { if (consent & 0x0001) { meshFeatures.push("Bureaublad melding"); } }
if (consent & 0x0010) { meshFeatures.push("Terminal Prompt"); } else { if (consent & 0x0002) { meshFeatures.push("Terminal melding"); } }
if (consent & 0x0020) { meshFeatures.push("Bestanden vragen"); } else { if (consent & 0x0004) { meshFeatures.push("Bestanden Melden"); } }
if (consent == 7) { meshFeatures = ["Altijd informeren"]; }
if ((consent & 56) == 56) { meshFeatures = ["Altijd prompt"]; }
meshFeatures = meshFeatures.join(', ');
if (meshFeatures == '') { meshFeatures = '<i>' + "Geen" + '</i>'; }
x += addHtmlValue("Toestemming van gebruiker", addLinkConditional(meshFeatures, 'p20editmeshconsent()', meshrights & 1));
}
// Display user consent
var meshNotify = 0, meshNotifyStr = [];
if (userinfo.links && userinfo.links[currentMesh._id] && userinfo.links[currentMesh._id].notify) { meshNotify = userinfo.links[currentMesh._id].notify; }
if (meshNotify & 2) { meshNotifyStr.push("Verbinden"); }
if (meshNotify & 4) { meshNotifyStr.push("Verbreken"); }
if (meshNotify & 8) { meshNotifyStr.push("Intel&reg; AMT"); }
if (meshNotifyStr.length == 0) { meshNotifyStr.push('<i>' + "Geen" + '</i>'); }
x += addHtmlValue("Meldingen", addLink(meshNotifyStr.join(', '), 'p20editMeshNotify()'));
// Intel AMT setup
var intelAmtPolicy = "Geen beleid";
if (currentMesh.amt) {
if (currentMesh.amt.type == 1) { intelAmtPolicy = 'Deactivate Client Control Mode (CCM)'; }
else if (currentMesh.amt.type == 2) {
intelAmtPolicy = "Simple Client Control Mode (CCM)";
if (currentMesh.amt.cirasetup == 2) { intelAmtPolicy += " + CIRA"; }
} else if (currentMesh.amt.type == 3) {
intelAmtPolicy = "Simple Admin Control Mode (ACM)";
if (currentMesh.amt.cirasetup == 2) { intelAmtPolicy += " + CIRA"; }
}
}
x += addHtmlValue("Intel&reg; AMT", addLinkConditional(intelAmtPolicy, 'p20editMeshAmt()', meshrights & 1));
// Display group note support
if (meshrights & 1) { x += '<br><input type=button value=' + "Notities" + ' title=\"' + "Bekijk opmerkingen over deze apparaatgroep" + '\" onclick=showNotes(false,"' + encodeURIComponent(currentMesh._id) + '") />'; }
x += '<br style=clear:both><br>';
var currentMeshLinks = currentMesh.links[userinfo._id];
if (currentMeshLinks && ((currentMeshLinks.rights & 2) != 0)) { x += '<a href=# onclick="return p20showAddMeshUserDialog()" style=cursor:pointer;margin-right:10px><img src=images/icon-addnew.png border=0 height=12 width=12> ' + "Gebruikers toevoegen" + '</a>'; }
if ((meshrights & 4) != 0) {
if (currentMesh.mtype == 1) {
x += '<a href=# onclick=\'return addCiraDeviceToMesh(\"' + currentMesh._id + '\")\' style=cursor:pointer;margin-right:10px title=\"' + "Voeg een nieuwe Intel® AMT computer toe welke zich op het internet bevind." + '\"><img src=images/icon-installmesh.png border=0 height=12 width=12> ' + "Installeer CIRA" + '</a>';
x += '<a href=# onclick=\'return addDeviceToMesh(\"' + currentMesh._id + '\")\' style=cursor:pointer;margin-right:10px title=\"' + "Voeg een nieuwe Intel® AMT computer toe welke zich op het lokale netwerk bevind." + '\"><img src=images/icon-installmesh.png border=0 height=12 width=12> ' + "Installeer lokaal" + '</a>';
if (currentMesh.amt && (currentMesh.amt.type == 2)) { // CCM activation
x += '<a href=# onclick=\'return showCcmActivation(\"' + currentMesh._id + '\")\' style=cursor:pointer;margin-right:10px title=\"' + "Voer Intel AMT client control mode (CCM) activering uit." + '\"><img src=images/icon-installmesh.png border=0 height=12 width=12> ' + "Activatie" + '</a>';
} else if (currentMesh.amt && (currentMesh.amt.type == 3) && ((features & 0x00100000) != 0)) { // ACM activation
x += '<a href=# onclick=\'return showAcmActivation(\"' + currentMesh._id + '\")\' style=cursor:pointer;margin-right:10px title=\"' + "Voer Intel AMT admin control mode (ACM) activering uit." + '\"><img src=images/icon-installmesh.png border=0 height=12 width=12> ' + "Activatie" + '</a>';
}
}
if (currentMesh.mtype == 2) {
x += '<a href=# onclick=\'return addAgentToMesh(\"' + currentMesh._id + '\")\' style=cursor:pointer;margin-right:10px title=\"' + "Voeg een nieuwe computer toe aan deze mesh door de mesh-agent te installeren." + '\"><img src=images/icon-addnew.png border=0 height=12 width=12> ' + "Installeren" + '</a>';
x += '<a href=# onclick=\'return inviteAgentToMesh(\"' + currentMesh._id + '\")\' style=cursor:pointer;margin-right:10px title=\"' + "Nodig iemand uit om de mesh-agent op deze mesh te installeren." + '\"><img src=images/icon-addnew.png border=0 height=12 width=12> ' + "Nodig uit" + '</a>';
}
}
x += '<table style="color:black;background-color:#EEE;border-color:#AAA;border-width:1px;border-style:solid;border-collapse:collapse" border=0 cellpadding=2 cellspacing=0 width=100%><tbody><tr style=background-color:#AAAAAA;font-weight:bold><th scope=col style=text-align:left;width:430px>' + "Gebruikersautorisaties" + '</th><th scope=col style=text-align:left></th></tr>';
// Sort the users for this mesh
var count = 1, sortedusers = [];
for (var i in currentMesh.links) {
var uname = i.split('/')[2];
if (currentMesh.links[i].name) { uname = currentMesh.links[i].name; }
if (i == userinfo._id) { uname = userinfo.name; }
sortedusers.push({ id: i, name: uname, rights: currentMesh.links[i].rights });
}
sortedusers.sort(function(a, b) { if (a.name > b.name) return 1; if (a.name < b.name) return -1; return 0; });
// Display all users for this mesh
for (var i in sortedusers) {
var trash = '', rights = "Gedeeltelijke rechten", r = sortedusers[i].rights;
if (r == 0xFFFFFFFF) rights = "Volledige beheerder"; else if (r == 0) rights = "Geen rechten";
if ((sortedusers[i].id != userinfo._id) && (meshrights == 0xFFFFFFFF || (((meshrights & 2) != 0)))) { trash = '<a href=# onclick=\'return p20deleteUser(event,"' + encodeURIComponent(sortedusers[i].id) + '")\' title=\"' + "Gebruikersrechten voor deze apparaatgroep verwijderen" + '\" style=cursor:pointer><img src=images/trash.png border=0 height=10 width=10></a>'; }
x += '<tr tabindex=0 onclick=p20viewuser("' + encodeURIComponent(sortedusers[i].id) + '") onkeypress="if (event.key==\'Enter\') p20viewuser(\'' + encodeURIComponent(sortedusers[i].id) + '\')" style=cursor:pointer' + (((count % 2) == 0) ? ';background-color:#DDD' : '') + '><td><div title=\"' + "Gebruiker" + '\" class=m2></div><div>&nbsp;' + EscapeHtml(decodeURIComponent(sortedusers[i].name)) + '<div></div></div></td><td><div style=float:right>' + trash + '</div><div>' + rights + '</div></td></tr>';
++count;
}
x += '</tbody></table>';
// If we are full administrator on this mesh, allow deletion of the mesh
if (meshrights == 0xFFFFFFFF) { x += '<div style=font-size:x-small;text-align:right><span><a href=# onclick=p20showDeleteMeshDialog() style=cursor:pointer>' + "Verwijder groep" + '</a></span></div>'; }
QH('p20info', x);
}
function p20editMeshAmt() {
if (xxdialogMode) return;
var x = '', acmoption = '';
if ((features & 0x100000) != 0) { acmoption = '<option value=3>' + "Simple Admin Control Mode (ACM)" + '</option>'; }
if (currentMesh.mtype == 1) {
x += addHtmlValue("Typen", '<select id=dp20amtpolicy style=width:230px onchange=p20editMeshAmtChange()><option value=0>' + "Geen beleid" + '</option><option value=2>' + "Simple Client Control Mode (CCM)" + '</option>' + acmoption + '</select>');
} else {
x += addHtmlValue("Typen", '<select id=dp20amtpolicy style=width:230px onchange=p20editMeshAmtChange()><option value=0>' + "Geen beleid" + '</option><option value=1>' + "Deactiveer Client Control Mode (CCM)" + '</option><option value=2>' + "Simple Client Control Mode (CCM)" + '</option>' + acmoption + '</select>');
}
x += '<div id=dp20amtpolicydiv></div>';
setDialogMode(2, "Intel® AMT beleid", 3, p20editMeshAmtEx, x);
if (currentMesh.amt) { Q('dp20amtpolicy').value = currentMesh.amt.type; }
p20editMeshAmtChange();
// Set the current Intel AMT policy
if (currentMesh.amt && (currentMesh.amt.type == 2) || (currentMesh.amt.type == 3)) {
Q('dp20amtpolicypass').value = currentMesh.amt.password;
if ((currentMesh.amt.type == 2) && (currentMesh.amt.badpass != null)) { Q('dp20amtbadpass').value = currentMesh.amt.badpass; }
if ((features & 0x400) == 0) { Q('dp20amtcira').value = currentMesh.amt.cirasetup; }
}
dp20amtValidatePolicy();
}
function p20editMeshAmtChange() {
var ptype = Q('dp20amtpolicy').value, x = '';
if (ptype >= 2) {
x = addHtmlValue("Wachtwoord*", '<input id=dp20amtpolicypass type=password style=width:230px maxlength=32 onchange=dp20amtValidatePolicy() onkeyup=dp20amtValidatePolicy() autocomplete=off />')
x += addHtmlValue("Wachtwoord*", '<input id=dp20amtpolicypass2 type=password style=width:230px maxlength=32 onchange=dp20amtValidatePolicy() onkeyup=dp20amtValidatePolicy() autocomplete=off />')
if ((ptype == 2) && (currentMesh.mtype == 2)) { x += addHtmlValue("Wachtwoord komt niet overeen", '<select id=dp20amtbadpass style=width:230px><option value=0>' + "Doe niets" + '</option><option value=1>' + "Heractiveer Intel® AMT" + '</option></select>'); }
if ((features & 0x400) == 0) {
if (ptype == 2) {
x += addHtmlValue('<span title="' + "Gebruiker geïnitieerde externe toegang" + '">' + "CIRA" + '</span>', '<select id=dp20amtcira style=width:230px><option value=0>' + "Configureer niet" + '</option><option value=1>' + "Maak geen verbinding met de server" + '</option><option value=2>' + "Verbinden met de server" + '</option></select>');
} else {
x += addHtmlValue('<span title="' + "Gebruiker geïnitieerde externe toegang" + '">' + "CIRA" + '</span>', '<select id=dp20amtcira style=width:230px><option value=0>' + "Configureer niet" + '</option><option value=2>' + "Verbinden met de server" + '</option></select>');
}
}
x += '<br/><span style="font-size:10px">' + "* Laat leeg om een willekeurig wachtwoord toe te wijzen aan elk apparaat." + '</span><br/>';
if (currentMesh.mtype == 2) {
if (ptype == 2) {
x += '<span style="font-size:10px">' + "This policy will not impact devices with Intel&reg; AMT in ACM mode." + '</span><br/>';
x += '<span style="font-size:10px">' + "Dit is geen veilig beleid omdat agenten activering zullen uitvoeren." + '</span>';
} else {
x += '<span style="font-size:10px">' + "Tijdens activering heeft de agent toegang tot beheerderswachtwoordinformatie." + '</span>';
}
}
}
QH('dp20amtpolicydiv', x);
setTimeout(dp20amtValidatePolicy, 1);
}
function dp20amtValidatePolicy() {
var ok = true, ptype = Q('dp20amtpolicy').value;
if ((ptype == 2) || (ptype == 3)) {
var pass = Q('dp20amtpolicypass').value, pass2 = Q('dp20amtpolicypass2').value;
ok = ((pass === pass2) && ((pass === '') ? true : passwordcheck(pass)));
}
QE('idx_dlgOkButton', ok);
}
function p20editMeshAmtEx() {
var ptype = parseInt(Q('dp20amtpolicy').value), amtpolicy = { type: ptype };
if (ptype == 2) {
amtpolicy = { type: ptype, password: Q('dp20amtpolicypass').value };
if (currentMesh.mtype == 2) { amtpolicy.badpass = parseInt(Q('dp20amtbadpass').value); }
if ((features & 0x400) == 0) { amtpolicy.cirasetup = parseInt(Q('dp20amtcira').value); } else { amtpolicy.cirasetup = 1; }
} else if (ptype == 3) {
amtpolicy = { type: ptype, password: Q('dp20amtpolicypass').value };
if ((features & 0x400) == 0) { amtpolicy.cirasetup = parseInt(Q('dp20amtcira').value); } else { amtpolicy.cirasetup = 1; }
}
meshserver.send({ action: 'meshamtpolicy', meshid: currentMesh._id, amtpolicy: amtpolicy });
}
function p20showDeleteMeshDialog() {
if (xxdialogMode) return false;
var x = format("Weet je zeker dat je groep {0} wilt verwijderen? Als u de apparaatgroep verwijdert, wordt ook alle informatie over apparaten binnen deze groep verwijderd.", EscapeHtml(currentMesh.name)) + '<br /><br />';
x += '<label><input id=p20check type=checkbox onchange=p20validateDeleteMeshDialog() />' + "Bevestig" + '</label>';
setDialogMode(2, "Verwijder groep", 3, p20showDeleteMeshDialogEx, x);
p20validateDeleteMeshDialog();
return false;
}
function p20validateDeleteMeshDialog() {
QE('idx_dlgOkButton', Q('p20check').checked);
}
function p20showDeleteMeshDialogEx(buttons, tag) {
meshserver.send({ action: 'deletemesh', meshid: currentMesh._id, meshname: currentMesh.name });
}
function p20editmesh(focus) {
if (xxdialogMode) return;
var x = addHtmlValue("Naam", '<input id=dp20meshname style=width:230px maxlength=32 onchange=p20editmeshValidate() onkeyup=p20editmeshValidate(event) />');
x += addHtmlValue("Omschrijving", '<div style=width:230px;margin:0;padding:0><textarea id=dp20meshdesc maxlength=1024 style=width:100%;resize:none></textarea></div>');
setDialogMode(2, "Bewerk apparaatgroep", 3, p20editmeshEx, x);
Q('dp20meshname').value = currentMesh.name;
if (currentMesh.desc) Q('dp20meshdesc').value = currentMesh.desc;
p20editmeshValidate();
if (focus == 2) { Q('dp20meshdesc').focus(); } else { Q('dp20meshname').focus(); }
}
function p20editmeshEx() {
meshserver.send({ action: 'editmesh', meshid: currentMesh._id, meshname: Q('dp20meshname').value, desc: Q('dp20meshdesc').value });
}
function p20editmeshValidate(e) {
QE('idx_dlgOkButton', Q('dp20meshname').value.length > 0);
if (e && e.key == 'Enter') { Q('dp20meshdesc').focus(); }
}
function p20editmeshconsent() {
if (xxdialogMode) return;
var x = '', consent = (currentMesh.consent) ? currentMesh.consent : 0;
x += '<div style="width:100%;border-bottom:1px solid gray;margin-bottom:5px"><b>' + "Bureaublad" + '</b></div>';
x += '<div><label><input type=checkbox id=d20flag1 ' + ((consent & 0x0001) ? 'checked' : '') + '>' + "Gebruiker informeren" + '</label></div>';
x += '<div><label><input type=checkbox id=d20flag2 ' + ((consent & 0x0008) ? 'checked' : '') + '>' + "Vragen gebruikerstoestemming" + '</label></div>';
x += '<div><label><input type=checkbox id=d20flag7 ' + ((consent & 0x0040) ? 'checked' : '') + '>' + "Toon verbindingswerkbalk" + '</label></div>';
x += '<div style="width:100%;border-bottom:1px solid gray;margin-bottom:5px;margin-top:8px"><b>' + "Terminal" + '</b></div>';
x += '<div><label><input type=checkbox id=d20flag3 ' + ((consent & 0x0002) ? 'checked' : '') + '>' + "Gebruiker informeren" + '</label></div>';
x += '<div><label><input type=checkbox id=d20flag4 ' + ((consent & 0x0010) ? 'checked' : '') + '>' + "Vragen gebruikerstoestemming" + '</label></div>';
x += '<div style="width:100%;border-bottom:1px solid gray;margin-bottom:5px;margin-top:8px"><b>' + "Bestanden" + '</b></div>';
x += '<div><label><input type=checkbox id=d20flag5 ' + ((consent & 0x0004) ? 'checked' : '') + '>' + "Gebruiker informeren" + '</label></div>';
x += '<div><label><input type=checkbox id=d20flag6 ' + ((consent & 0x0020) ? 'checked' : '') + '>' + "Vragen gebruikerstoestemming" + '</label></div>';
setDialogMode(2, "Toestemming gebruikersgroep bewerken", 3, p20editmeshconsentEx, x);
if (serverinfo.consent) {
if (serverinfo.consent & 0x0001) { Q('d20flag1').checked = true; }
if (serverinfo.consent & 0x0008) { Q('d20flag2').checked = true; }
if (serverinfo.consent & 0x0002) { Q('d20flag3').checked = true; }
if (serverinfo.consent & 0x0010) { Q('d20flag4').checked = true; }
if (serverinfo.consent & 0x0004) { Q('d20flag5').checked = true; }
if (serverinfo.consent & 0x0020) { Q('d20flag6').checked = true; }
if (serverinfo.consent & 0x0040) { Q('d20flag7').checked = true; }
QE('d20flag1', !(serverinfo.consent & 0x0001));
QE('d20flag2', !(serverinfo.consent & 0x0008));
QE('d20flag3', !(serverinfo.consent & 0x0002));
QE('d20flag4', !(serverinfo.consent & 0x0010));
QE('d20flag5', !(serverinfo.consent & 0x0004));
QE('d20flag6', !(serverinfo.consent & 0x0020));
if (debugmode == 1) { QE('d20flag7', !(serverinfo.consent & 0x0040)); }
}
}
function p20editmeshconsentEx() {
var consent = 0;
if (Q('d20flag1').checked) { consent += 0x0001; }
if (Q('d20flag2').checked) { consent += 0x0008; }
if (Q('d20flag3').checked) { consent += 0x0002; }
if (Q('d20flag4').checked) { consent += 0x0010; }
if (Q('d20flag5').checked) { consent += 0x0004; }
if (Q('d20flag6').checked) { consent += 0x0020; }
if (Q('d20flag7').checked) { consent += 0x0040; }
meshserver.send({ action: 'editmesh', meshid: currentMesh._id, consent: consent });
}
function p20editmeshfeatures() {
if (xxdialogMode) return;
var flags = (currentMesh.flags)?currentMesh.flags:0;
var x = '<div><label><input type=checkbox id=d20flag1 ' + ((flags & 1) ? 'checked' : '') + '>Remove device on disconnect</label><br></div>';
x += '<div><label><input type=checkbox id=d20flag2 ' + ((flags & 2) ? 'checked' : '') + '>Sync server device name to hostname</label><br></div>';
setDialogMode(2, "Functies van apparaatgroep bewerken", 3, p20editmeshfeaturesEx, x);
}
function p20editmeshfeaturesEx() {
var flags = 0;
if (Q('d20flag1').checked) { flags += 1; }
if (Q('d20flag2').checked) { flags += 2; }
meshserver.send({ action: 'editmesh', meshid: currentMesh._id, flags: flags });
}
function p20showAddMeshUserDialog(userid) {
if (xxdialogMode) return false;
var x = '';
if (userid == null) {
x += "Gebruikers toestaan deze apparaatgroep en apparaten in deze groep te beheren.";
if (features & 0x00080000) { x += " Users need to login to this server once before they can be added to a device group." }
x += '<br /><br /><div style=\'position:relative\'>';
x += addHtmlValue("Gebruikersnamen", '<input id=dp20username style=width:230px maxlength=32 onchange=p20validateAddMeshUserDialog() onkeyup=p20validateAddMeshUserDialog() placeholder="user1, user2, user3" />');
x += '<div id=dp20usersuggest class=suggestionBox style=\'top:30px;left:130px;display:none\'></div>';
x += '</div><br>';
} else {
userid = decodeURIComponent(userid);
var uname = userid.split('/')[2];
if (users && users[userid]) { uname = users[userid].name; }
if (userinfo._id == userid) { uname = userinfo.name; }
x += format("Groepsrechten voor gebruiker {0}.", uname) + '<br /><br />';
}
x += '<div style="height:120px;overflow-y:scroll;border:1px solid gray">';
x += '<label><input type=checkbox onchange=p20validateAddMeshUserDialog() id=p20fulladmin>' + "Volledige beheerder" + '</label><br>';
x += '<label><input type=checkbox onchange=p20validateAddMeshUserDialog() id=p20editmesh>' + "Bewerk apparaatgroep" + '</label><br>';
x += '<label><input type=checkbox onchange=p20validateAddMeshUserDialog() id=p20manageusers>' + "Beheer apparaatgroep gebruikers" + '</label><br>';
x += '<label><input type=checkbox onchange=p20validateAddMeshUserDialog() id=p20managecomputers>' + "Beheer apparaatgroep computers" + '</label><br>';
x += '<label><input type=checkbox onchange=p20validateAddMeshUserDialog() id=p20remotecontrol>' + "Extern beheer" + '</label><br>';
x += '<label><input type=checkbox onchange=p20validateAddMeshUserDialog() id=p20remoteview style=margin-left:12px>' + "Alleen extern meekijken" + '</label><br>';
x += '<label><input type=checkbox onchange=p20validateAddMeshUserDialog() id=p20remotelimitedinput style=margin-left:12px>' + "Alleen beperkte invoer" + '</label><br>';
x += '<label><input type=checkbox onchange=p20validateAddMeshUserDialog() id=p20noterminal style=margin-left:12px>' + "Geen terminal toegang" + '</label><br>';
x += '<label><input type=checkbox onchange=p20validateAddMeshUserDialog() id=p20nofiles style=margin-left:12px>' + "Geen bestandstoegang" + '</label><br>';
x += '<label><input type=checkbox onchange=p20validateAddMeshUserDialog() id=p20noamt style=margin-left:12px>' + "Geen Intel&reg; AMT" + '</label><br>';
x += '<label><input type=checkbox onchange=p20validateAddMeshUserDialog() id=p20meshagentconsole>' + "Mesh Agent Console" + '</label><br>';
x += '<label><input type=checkbox onchange=p20validateAddMeshUserDialog() id=p20meshserverfiles>' + "Serverbestanden" + '</label><br>';
x += '<label><input type=checkbox onchange=p20validateAddMeshUserDialog() id=p20wakedevices>' + "apparaat wekken" + '</label><br>';
x += '<label><input type=checkbox onchange=p20validateAddMeshUserDialog() id=p20editnotes>' + "Apparaatnotities bewerken" + '</label><br>';
x += '<label><input type=checkbox onchange=p20validateAddMeshUserDialog() id=p20limitevents>' + "Toon alleen eigen gebeurtenissen" + '</label><br>';
x += '<label><input type=checkbox onchange=p20validateAddMeshUserDialog() id=p20chatnotify>' + "Chat & Melden" + '</label><br>';
x += '<label><input type=checkbox onchange=p20validateAddMeshUserDialog() id=p20uninstall>' + "deinstallatie agent" + '</label><br>';
x += '</div>';
if (userid == null) {
setDialogMode(2, "Gebruikers toevoegen aan apparaatgroep", 3, p20showAddMeshUserDialogEx, x);
Q('dp20username').focus();
} else {
setDialogMode(2, "Gebruikersrechten apparaatgroep bewerken", 7, p20showAddMeshUserDialogEx, x, userid);
var cmeshrights = currentMesh.links[userinfo._id].rights, meshrights = currentMesh.links[userid].rights;
if (meshrights == 0xFFFFFFFF) {
Q('p20fulladmin').checked = true;
} else {
if (meshrights & 1) { Q('p20editmesh').checked = true; }
if (meshrights & 2) { Q('p20manageusers').checked = true; }
if (meshrights & 4) { Q('p20managecomputers').checked = true; }
if (meshrights & 8) {
Q('p20remotecontrol').checked = true;
if (meshrights & 256) { Q('p20remoteview').checked = true; }
if (meshrights & 512) { Q('p20noterminal').checked = true; }
if (meshrights & 1024) { Q('p20nofiles').checked = true; }
if (meshrights & 2048) { Q('p20noamt').checked = true; }
if (meshrights & 4096) { Q('p20remotelimitedinput').checked = true; }
}
if (meshrights & 16) { Q('p20meshagentconsole').checked = true; }
if (meshrights & 32) { Q('p20meshserverfiles').checked = true; }
if (meshrights & 64) { Q('p20wakedevices').checked = true; }
if (meshrights & 128) { Q('p20editnotes').checked = true; }
if (meshrights & 8192) { Q('p20limitevents').checked = true; }
if (meshrights & 16384) { Q('p20chatnotify').checked = true; }
if (meshrights & 32768) { Q('p20uninstall').checked = true; }
}
}
p20validateAddMeshUserDialog();
return false;
}
function p20setname(name) {
name = decodeURIComponent(name);
var xusers = Q('dp20username').value.split(',');
for (var i in xusers) { xusers[i] = xusers[i].trim(); }
xusers[xusers.length - 1] = name;
Q('dp20username').value = xusers.join(', ');
p20validateAddMeshUserDialog();
return false;
}
function p20validateAddMeshUserDialog() {
var meshrights = currentMesh.links[userinfo._id].rights;
var ok = true;
if (Q('dp20username')) {
var xusers = Q('dp20username').value.split(',');
for (var i in xusers) {
var xuser = xusers[i] = xusers[i].trim();
if (xuser.length == 0) { ok = false; } else if (xuser.indexOf('"') >= 0) { ok = false; }
}
// Fill the suggestion box
var showsuggestbox = false, exactMatch = false;
if (users != null) {
var lastuser = xusers[xusers.length - 1].trim(), lastuserl = lastuser.toLowerCase(), matchingUsers = [];
if (lastuser.length > 0) {
for (var i in users) {
if (users[i].name === lastuser) { exactMatch = true; break; }
if (users[i].name.toLowerCase().indexOf(lastuserl) >= 0) { matchingUsers.push(users[i].name); if (matchingUsers.length >= 8) break; }
}
if ((exactMatch == false) && (matchingUsers.length > 0)) {
var x = '';
for (var i in matchingUsers) { x += '<a href=# onclick=\'p20setname("' + encodeURIComponent(matchingUsers[i]) + '")\'>' + matchingUsers[i] + '</a><br />'; }
QH('dp20usersuggest', x);
showsuggestbox = true;
}
}
}
QV('dp20usersuggest', showsuggestbox);
}
QE('idx_dlgOkButton', ok);
var nc = !Q('p20fulladmin').checked;
QE('p20fulladmin', meshrights == 0xFFFFFFFF);
QE('p20editmesh', nc && (meshrights == 0xFFFFFFFF));
QE('p20manageusers', nc);
QE('p20managecomputers', nc);
QE('p20remotecontrol', nc);
QE('p20meshagentconsole', nc);
QE('p20meshserverfiles', nc);
QE('p20wakedevices', nc);
QE('p20editnotes', nc);
QE('p20limitevents', nc);
QE('p20remoteview', nc && Q('p20remotecontrol').checked);
QE('p20remotelimitedinput', nc && Q('p20remotecontrol').checked && !Q('p20remoteview').checked);
QE('p20noterminal', nc && Q('p20remotecontrol').checked);
QE('p20nofiles', nc && Q('p20remotecontrol').checked);
QE('p20noamt', nc && Q('p20remotecontrol').checked);
QE('p20chatnotify', nc);
QE('p20uninstall', nc);
}
function p20showAddMeshUserDialogEx(b, t) {
if (b == 2) {
p20viewuserEx(b, t);
} else {
var meshadmin = 0;
if (Q('p20fulladmin').checked == true) { meshadmin = 0xFFFFFFFF; } else {
if (Q('p20editmesh').checked == true) meshadmin += 1;
if (Q('p20manageusers').checked == true) meshadmin += 2;
if (Q('p20managecomputers').checked == true) meshadmin += 4;
if (Q('p20remotecontrol').checked == true) meshadmin += 8;
if (Q('p20meshagentconsole').checked == true) meshadmin += 16;
if (Q('p20meshserverfiles').checked == true) meshadmin += 32;
if (Q('p20wakedevices').checked == true) meshadmin += 64;
if (Q('p20editnotes').checked == true) meshadmin += 128;
if (Q('p20remoteview').checked == true) meshadmin += 256;
if (Q('p20noterminal').checked == true) meshadmin += 512;
if (Q('p20nofiles').checked == true) meshadmin += 1024;
if (Q('p20noamt').checked == true) meshadmin += 2048;
if (Q('p20remotelimitedinput').checked == true) meshadmin += 4096;
if (Q('p20limitevents').checked == true) meshadmin += 8192;
if (Q('p20chatnotify').checked == true) meshadmin += 16384;
if (Q('p20uninstall').checked == true) meshadmin += 32768;
}
if (t == null) {
var users = Q('dp20username').value.split(','), users2 = [];
for (var i in users) { users2.push(users[i].trim()); }
meshserver.send({ action: 'addmeshuser', meshid: currentMesh._id, meshname: currentMesh.name, usernames: users2, meshadmin: meshadmin });
} else {
meshserver.send({ action: 'addmeshuser', meshid: currentMesh._id, meshname: currentMesh.name, usernames: [ t.split('/')[2] ], meshadmin: meshadmin });
}
}
}
function p20viewuser(userid) {
if (xxdialogMode) return;
var xuserid = decodeURIComponent(userid);
var cmeshrights = currentMesh.links[userinfo._id].rights, meshrights = currentMesh.links[xuserid].rights;
if (((userinfo._id) != xuserid) && (cmeshrights == 0xFFFFFFFF || (((cmeshrights & 2) != 0) && (meshrights != 0xFFFFFFFF)))) {
p20showAddMeshUserDialog(userid);
} else {
var r = [];
if (meshrights == 0xFFFFFFFF) r.push("Volledige beheerder (alle rechten)"); else {
if ((meshrights & 1) != 0) r.push("Bewerk apparaatgroep");
if ((meshrights & 2) != 0) r.push("Beheer apparaatgroep gebruikers");
if ((meshrights & 4) != 0) r.push("Beheer apparaatgroep computers");
if ((meshrights & 8) != 0) r.push("Extern beheer");
if ((meshrights & 16) != 0) r.push("Agentconsole");
if ((meshrights & 32) != 0) r.push("Serverbestanden");
if ((meshrights & 64) != 0) r.push("apparaat wekken");
if ((meshrights & 128) != 0) r.push("Notities bewerken");
if (((meshrights & 8) != 0) && (meshrights & 256) != 0) r.push("Alleen extern meekijken");
if (((meshrights & 8) != 0) && (meshrights & 512) != 0) r.push("Geen terminal");
if (((meshrights & 8) != 0) && (meshrights & 1024) != 0) r.push("Geen bestanden");
if (((meshrights & 8) != 0) && (meshrights & 2048) != 0) r.push("Geen Intel&reg; AMT");
if (((meshrights & 8) != 0) && ((meshrights & 4096) != 0) && ((meshrights & 256) == 0)) r.push("Beperkte invoer");
if ((meshrights & 8192) != 0) r.push("Alleen eigen gebeurtenissen");
if ((meshrights & 16384) != 0) r.push("Chat & Melden");
if ((meshrights & 32768) != 0) r.push("deinstallatie");
}
if (r.length == 0) { r.push("Geen rechten"); }
var uname = xuserid.split('/')[2];
if (users && users[xuserid]) { uname = users[xuserid].name; }
if (userinfo._id == xuserid) { uname = userinfo.name; }
var buttons = 1, x = addHtmlValue("Gebruikersnaam", EscapeHtml(decodeURIComponent(uname)));
if (xuserid.split('/')[2] != uname) { x += addHtmlValue("gebruikers-ID", EscapeHtml(xuserid.split('/')[2])); }
x += addHtmlValue("machtigingen", r.join(","));
if (((userinfo._id) != xuserid) && (cmeshrights == 0xFFFFFFFF || (((cmeshrights & 2) != 0) && (meshrights != 0xFFFFFFFF)))) buttons += 4;
setDialogMode(2, "Apparaatgroep gebruiker", buttons, p20viewuserEx, x, xuserid);
}
}
function p20viewuserEx(button, userid) {
if (button != 2) return;
var uname = userid.split('/')[2];
if (users && users[userid]) { uname = users[userid].name; }
if (userinfo._id == userid) { uname = userinfo.name; }
setDialogMode(2, "externe Mesh gebruiker", 3, p20viewuserEx2, format("Bevestig de verwijdering van gebruiker {0}?", EscapeHtml(decodeURIComponent(uname))), userid);
}
function p20deleteUser(e, userid) { haltEvent(e); p20viewuserEx(2, decodeURIComponent(userid)); return false; }
function p20viewuserEx2(button, userid) { meshserver.send({ action: 'removemeshuser', meshid: currentMesh._id, meshname: currentMesh.name, userid: userid }); }
function p20editMeshNotify() {
if (xxdialogMode) return false;
var meshNotify = 0;
if (userinfo.links && userinfo.links[currentMesh._id] && userinfo.links[currentMesh._id].notify) { meshNotify = userinfo.links[currentMesh._id].notify; }
var x = 'Notification settings must also be turned on in account settings.<br /><br />';
x += '<div><label><input id=p20notifyIntelDeviceConnect type=checkbox />Device connections.</label></div>';
x += '<div><label><input id=p20notifyIntelDeviceDisconnect type=checkbox />Device disconnections.</label></div>';
x += '<div><label><input id=p20notifyIntelAmtKvmActions type=checkbox />Intel&reg; AMT desktop and serial events.</label></div>';
setDialogMode(2, "meldingsinstellingen", 3, p20editMeshNotifyEx, x);
Q('p20notifyIntelDeviceConnect').checked = (meshNotify & 2);
Q('p20notifyIntelDeviceDisconnect').checked = (meshNotify & 4);
Q('p20notifyIntelAmtKvmActions').checked = (meshNotify & 8);
return false;
}
function p20editMeshNotifyEx() {
var meshNotify = 0;
meshNotify += Q('p20notifyIntelDeviceConnect').checked ? 2 : 0;
meshNotify += Q('p20notifyIntelDeviceDisconnect').checked ? 4 : 0;
meshNotify += Q('p20notifyIntelAmtKvmActions').checked ? 8 : 0;
meshserver.send({ action: 'changemeshnotify', meshid: currentMesh._id, notify: meshNotify });
}
//
// Mesh Summary
//
function setupMeshSummaryStats() {
var draw = Chart.controllers.doughnut.prototype.draw;
Chart.controllers.doughnut = Chart.controllers.doughnut.extend({
draw: function() {
draw.apply(this, arguments);
let ctx = this.chart.chart.ctx;
let _fill = ctx.fill;
ctx.fill = function() {
ctx.save();
ctx.shadowColor = 'blue';
ctx.shadowBlur = 10;
ctx.shadowOffsetX = 2;
ctx.shadowOffsetY = 2;
_fill.apply(this, arguments)
ctx.restore();
}
}
});
window.meshPowerChart = new Chart(document.getElementById('meshPowerChart').getContext('2d'), {
type: 'doughnut',
data: { datasets: [{ data: [0, 0], backgroundColor: ['#20F', '#40D', '#60B', '#809', '#A07', '#C05'] }] },
options: { responsive: true, legend: { position: 'none' }, animation: { animateScale: true, animateRotate: true }, layout: { padding: { left: 10, right: 10, top: 10, bottom: 10 } } }
});
window.meshOsChart = new Chart(document.getElementById('meshOsChart').getContext('2d'), {
type: 'doughnut',
data: { datasets: [{ data: [0, 0], backgroundColor: ['#20F', '#40D', '#60B', '#809', '#A07', '#C05'] }] },
options: { responsive: true, legend: { position: 'none' }, animation: { animateScale: true, animateRotate: true }, layout: { padding: { left: 10, right: 10, top: 10, bottom: 10 } } }
});
window.meshConnChart = new Chart(document.getElementById('meshConnChart').getContext('2d'), {
type: 'doughnut',
data: { datasets: [{ data: [0, 0], backgroundColor: ['#20F', '#40D', '#60B', '#809', '#A07', '#C05'] }], labels: ["Not Connected", "Agent", "Intel AMT", "Agent + Intel AMT"] },
options: { responsive: true, legend: { position: 'none' }, animation: { animateScale: true, animateRotate: true }, layout: { padding: { left: 10, right: 10, top: 10, bottom: 10 } } }
});
}
function p21updateMesh() {
if (currentMesh == null) return;
QH('p21meshName', EscapeHtml(currentMesh.name));
// Update charts
var power = {};
var conn = {};
var agentTypes = {};
var powerStates = {};
var connectivityStates = [ 0, 0, 0, 0 ]; // None, Agent, AMT, Agent + AMT
var showAgents = false;
var showPower = false;
var showConn = false;
for (var i in nodes) {
if (nodes[i].meshid == currentMesh._id) {
if (nodes[i].agent) { showAgents = true; if (agentTypes[nodes[i].agent.id] == null) { agentTypes[nodes[i].agent.id] = 1; } else { agentTypes[nodes[i].agent.id]++; } }
if (nodes[i].pwr) { showPower = true; if (powerStates[nodes[i].pwr] == null) { powerStates[nodes[i].pwr] = 1; } else { powerStates[nodes[i].pwr]++; } }
if (nodes[i].conn == 0) { showConn = true; connectivityStates[0]++; }
else if ((nodes[i].conn & 6) != 0) { showConn = true; if ((nodes[i].conn & 1) != 0) { connectivityStates[3]++; } else { connectivityStates[2]++; } }
else if ((nodes[i].conn & 1) != 0) { showConn = true; connectivityStates[1]++; }
}
}
var agentsData = [], agentsLabels = [], powerData = [], powerLabels = [];
for (var i in agentTypes) { agentsData.push(agentTypes[i]); agentsLabels.push(agentsStr[i]); }
for (var i in powerStates) { powerData.push(powerStates[i]); powerLabels.push(powerStatetable[i]); }
window.meshPowerChart.config.data.datasets[0].data = powerData;
window.meshPowerChart.config.data.labels = powerLabels;
window.meshPowerChart.update();
if (currentMesh.mtype == 2) {
window.meshOsChart.config.data.datasets[0].data = agentsData;
window.meshOsChart.config.data.labels = agentsLabels;
window.meshOsChart.update();
}
window.meshConnChart.config.data.datasets[0].data = connectivityStates;
window.meshConnChart.update();
// Update tables
var x = '', count = 0;
if (powerData.length > 0) {
var xpowerStates = [];
for (var i in powerStates) { xpowerStates.push([powerStatetable[i], powerStates[i]]); }
xpowerStates.sort(function(a, b){ return -(a[1]-b[1]) });
x += '<table style="margin-top:10px;color:black;background-color:#EEE;border-color:#AAA;border-width:1px;border-style:solid;border-collapse:collapse" border=0 cellpadding=2 cellspacing=0 width=100%><tbody><tr style=background-color:#AAAAAA;font-weight:bold><th scope=col style=text-align:left;width:430px>' + "Power States" + '</th><th scope=col style=text-align:left></th></tr>';
for (var i in xpowerStates) { x += '<tr style=' + (((++count % 2) == 0) ? 'background-color:#DDD' : '') + '><td><divclass=m2></div><div>&nbsp;' + xpowerStates[i][0] + '<div></div></div></td><td><div style=float:right>' + xpowerStates[i][1] + ' </div><div></div></td></tr>'; }
x += '</tbody></table>';
}
if ((agentsData.length > 0) && (currentMesh.mtype == 2)) {
count = 0;
var xagentTypes = [];
for (var i in agentTypes) { xagentTypes.push([agentsStr[i], agentTypes[i]]); }
xagentTypes.sort(function(a, b){ return -(a[1]-b[1]) });
x += '<table style="margin-top:10px;color:black;background-color:#EEE;border-color:#AAA;border-width:1px;border-style:solid;border-collapse:collapse" border=0 cellpadding=2 cellspacing=0 width=100%><tbody><tr style=background-color:#AAAAAA;font-weight:bold><th scope=col style=text-align:left;width:430px>' + "Agent Types" + '</th><th scope=col style=text-align:left></th></tr>';
for (var i in xagentTypes) { x += '<tr style=' + (((++count % 2) == 0) ? 'background-color:#DDD' : '') + '><td><divclass=m2></div><div>&nbsp;' + xagentTypes[i][0] + '<div></div></div></td><td><div style=float:right>' + xagentTypes[i][1] + ' </div><div></div></td></tr>'; }
x += '</tbody></table>';
}
if (showConn) {
count = 0;
var xconnectivityStates = [];
for (var i = 0; i < 4; i++) { xconnectivityStates.push([["Not Connected", "Agent", "Intel AMT", "Agent + Intel AMT"][i], connectivityStates[i]]); }
xconnectivityStates.sort(function(a, b){ return -(a[1]-b[1]) });
x += '<table style="margin-top:10px;color:black;background-color:#EEE;border-color:#AAA;border-width:1px;border-style:solid;border-collapse:collapse" border=0 cellpadding=2 cellspacing=0 width=100%><tbody><tr style=background-color:#AAAAAA;font-weight:bold><th scope=col style=text-align:left;width:430px>' + "connectiviteit" + '</th><th scope=col style=text-align:left></th></tr>';
for (var i = 0; i < 4; i++) { if (xconnectivityStates[i][1] > 0) { x += '<tr style=' + (((++count % 2) == 0) ? 'background-color:#DDD' : '') + '><td><divclass=m2></div><div>&nbsp;' + xconnectivityStates[i][0] + '<div></div></div></td><td><div style=float:right>' + xconnectivityStates[i][1] + ' </div><div></div></td></tr>'; } }
x += '</tbody></table>';
}
if (x == '') { x = '<i>' + "No devices in this device group." + '</i>'; }
QH('p21info', x);
// Only show the OS chart if the mesh is agent type.
QS('meshPowerChartDiv')['display'] = (showPower)?'inline-block':'none';
QS('meshOsChartDiv')['display'] = ((currentMesh.mtype == 2) && showAgents)?'inline-block':'none';
QS('meshConnChartDiv')['display'] = (showConn)?'inline-block':'none';
}
//
// MY FILES
//
var filetreelinkpath;
var filetreelocation = [];
function updateFiles() {
QV('MainMenuMyFiles', ((features & 8) == 0));
if ((features & 8) != 0) return; // If running on a server without files, exit now.
var html1 = '', html2 = '', displayPath = '<a href=# style=cursor:pointer onclick="return p5folderup(0)">' + "Root" + '</a>', fullPath = 'Root', publicPath, filetreex = filetree, folderdepth = 1;
// Navigate to path location, build the paths at the same time
var filetreelocation2 = [], oldlinkpath = filetreelinkpath, checkedBoxes = [], checkboxes = document.getElementsByName('fc');
for (var i = 0; i < checkboxes.length; i++) { if (checkboxes[i].checked) { checkedBoxes.push(checkboxes[i].value) }; } // Save all existing checked boxes
filetreelinkpath = '';
for (var i in filetreelocation) {
if ((filetreex.f != null) && (filetreex.f[filetreelocation[i]] != null)) {
filetreelocation2.push(filetreelocation[i]);
fullPath += ' / ' + filetreelocation[i];
if ((folderdepth == 1)) {
var sp = filetreelocation[i].split('/');
publicPath = window.location + sp[0] + 'files/' + sp[2];
//if (filetreelocation[i] === userinfo._id) { filetreelinkpath += 'self'; } else { filetreelinkpath += (sp[0] + '/' + sp[2]); }
filetreelinkpath += filetreelocation[i];
} else {
if (filetreelinkpath != '') { filetreelinkpath += '/' + filetreelocation[i]; if (folderdepth > 2) { publicPath += '/' + filetreelocation[i]; } }
}
filetreex = filetreex.f[filetreelocation[i]];
displayPath += ' / <a href=# style=cursor:pointer onclick="return p5folderup(' + folderdepth + ')">' + (filetreex.n != null?filetreex.n:filetreelocation[i]) + '</a>';
folderdepth++;
} else {
break;
}
}
filetreelocation = filetreelocation2; // In case we could not go down the full path, we set the new path location here.
var publicfolder = fullPath.toLowerCase().startsWith('root / ' + userinfo._id + ' / public');
// Sort the files
var filetreexx = p5sort_files(filetreex.f);
// Display all files and folders at this location
for (var i in filetreexx) {
// Figure out the name and shortname
var f = filetreexx[i], name = f.n, shortname;
shortname = name;
if (name.length > 70) { shortname = '<span title="' + EscapeHtml(name) + '">' + EscapeHtml(name.substring(0, 70)) + "..." + '</span>'; } else { shortname = EscapeHtml(name); }
name = EscapeHtml(name);
// Figure out the date
var fdatestr = '';
if (f.d != null) { var fdate = new Date(f.d), fdatestr = printDateTime(fdate) + '&nbsp;'; }
// Figure out the size
var fsize = '';
if (f.s != null) { fsize = getFileSizeStr(f.s); }
var h = '';
if (f.t < 3 || f.t == 4) {
var right = (f.t == 1 || f.t == 4)?p5getQuotabar(f):'', title = '';
h = '<div class=filelist file=999><input file=999 style=float:left name=fc class=fcb type=checkbox onchange=p5setActions() value="' + name + '">&nbsp;<span style=float:right title=\"' + title + '\">' + right + '</span><span><div class=fileIcon' + f.t + ' onclick=p5folderset(\"' + encodeURIComponent(f.nx) + '\")></div><a href=# style=cursor:pointer onclick=\'return p5folderset(\"' + encodeURIComponent(f.nx) + '\")\'>' + shortname + '</a></span></div>';
} else {
var link = shortname, publiclink = '';
if (publicfolder) { publiclink = ' (<a style=cursor:pointer title="Display public link" onclick=\'return p5showPublicLink("' + publicPath + '/' + f.nx + '")\'>' + "Link" + '</a>)'; }
if (f.s > 0) { link = '<a rel="noreferrer noopener" target="_blank" download href="downloadfile.ashx?link=' + encodeURIComponent(filetreelinkpath + '/' + f.nx) + '">' + shortname + '</a>' + publiclink; }
h = '<div class=filelist file=3><input file=3 style=float:left name=fc class=fcb type=checkbox onchange=p5setActions() value="' + f.nx + '">&nbsp;<span class=fsize>' + fdatestr + '</span><span style=float:right>' + fsize + '</span><span><div class=fileIcon' + f.t + '></div>' + link + '</span></div>';
}
if (f.t < 3) { html1 += h; } else { html2 += h; }
}
//if (f.parent == null) { }
QH('p5rightOfButtons', p5getQuotabar(filetreex));
QH('p5files', html1 + html2);
QH('p5currentpath', displayPath);
QE('p5FolderUp', filetreelocation.length != 0);
QV('p5PublicShare', publicfolder);
// Re-check all boxes if needed
if (oldlinkpath == filetreelinkpath) {
checkboxes = document.getElementsByName('fc');
for (var i = 0; i < checkboxes.length; i++) { checkboxes[i].checked = (checkedBoxes.indexOf(checkboxes[i].value) >= 0); }
}
p5setActions();
}
function getNiceSize(bytes) {
if (bytes <= 0) return "Opslaglimiet overschreden";
if (bytes < 2048) return format("{0} resterende bytes", bytes);
if (bytes < 2097152) return format("{0} resterende kilobytes", Math.round(bytes / 1024));
if (bytes < 2147483648) return format("{0} resterende megabytes", Math.round(bytes / 1024 / 1024));
return format("{0} rsterende gigabytes", Math.round(bytes / 1024 / 1024 / 1024));
}
function getNiceSize2(bytes) {
if (bytes <= 0) return "Geen";
if (bytes < 2048) return format("{0} b", bytes);
if (bytes < 2097152) return format("{0} Kb", Math.round(bytes / 1024));
if (bytes < 2147483648) return format("{0} Mb", Math.round(bytes / 1024 / 1024));
return format("{0} Gb", Math.round(bytes / 1024 / 1024 / 1024));
}
function p5getQuotabar(f) {
while (f.t > 1 && f.t != 4) { f = f.parent; }
if ((f.t != 1 && f.t != 4) || (f.maxbytes == null)) return '';
var tf = Math.floor(f.s / 1024), tq = (f.maxbytes - f.s);
var title;
if (f.c > 1) { title = format("{0}k in 1 file. {2}k maximum", tf, f.c, (Math.floor(f.maxbytes / 1024 / 1024))); } else { title = format("{0}k in 1 bestand. {1}k maximum", tf, (Math.floor(f.maxbytes / 1024 / 1024))); }
return '<span title="' + title + '">' + getNiceSize(tq) + ' <progress style=height:10px;width:100px value=' + f.s + ' max=' + f.maxbytes + ' /></span>';
}
function p5showPublicLink(u) { setDialogMode(2, "Publieke link", 1, null, '<input type=text style=width:100% value="' + u + '" readonly />'); return false; }
var sortorder;
function p5sort_filename(a, b) { if (a.ln > b.ln) return (1 * sortorder); if (a.ln < b.ln) return (-1 * sortorder); return 0; }
function p5sort_timestamp(a, b) { if (a.d > b.d) return (1 * sortorder); if (a.d < b.d) return (-1 * sortorder); return 0; }
function p5sort_bysize(a, b) { if (a.s == b.s) return p5sort_filename(a, b); return (((a.s - b.s)) * sortorder); }
function p5sort_files(files) {
var r = [], sortselection = Q('p5sortdropdown').value;
for (var i in files) { files[i].nx = i; if (files[i].n == null) { files[i].n = i; } files[i].ln = files[i].n.toLowerCase(); r.push(files[i]); }
sortorder = 1;
if (sortselection > 3) { sortorder = -1; sortselection -= 3; }
if (sortselection == 1) { r.sort(p5sort_filename); }
else if (sortselection == 2) { r.sort(p5sort_bysize); }
else if (sortselection == 3) { r.sort(p5sort_timestamp); }
return r;
}
function p5setActions() {
var cc = getFileSelCount(), tc = getFileCount(), sfc = getFileSelCount(false); // In order: number of entires selected, number of total entries, number of selected entires that are files (not folders)
QE('p5DeleteFileButton', (cc > 0) && (filetreelocation.length > 0));
QE('p5NewFolderButton', filetreelocation.length > 0);
QE('p5UploadButton', filetreelocation.length > 0);
QE('p5RenameFileButton', (cc == 1) && (filetreelocation.length > 0));
//QE('p5ViewFileButton', (cc == 1) && (sfc == 1) && (filetreelocation.length > 0));
QE('p5SelectAllButton', tc > 0);
Q('p5SelectAllButton').value = (cc > 0 ? "Selecteer niets" : "Selecteer alles");
QE('p5CutButton', (sfc > 0) && (cc == sfc));
QE('p5CopyButton', (sfc > 0) && (cc == sfc));
QE('p5PasteButton', (p5clipboard != null) && (p5clipboard.length > 0) && (filetreelocation.length > 0));
}
function getFileSelCount(includeDirs) { var cc = 0, checkboxes = document.getElementsByName('fc'); for (var i = 0; i < checkboxes.length; i++) { if ((checkboxes[i].checked) && ((includeDirs != false) || (checkboxes[i].attributes.file.value == '3'))) cc++; } return cc; }
function getFileSelDirCount() { var cc = 0, checkboxes = document.getElementsByName('fc'); for (var i = 0; i < checkboxes.length; i++) { if ((checkboxes[i].checked) && (checkboxes[i].attributes.file.value == '999')) cc++; } return cc; }
function getFileCount() { var cc = 0; var checkboxes = document.getElementsByName('fc'); return checkboxes.length; }
function p5selectallfile() { var nv = (getFileSelCount() == 0), checkboxes = document.getElementsByName('fc'); for (var i = 0; i < checkboxes.length; i++) { checkboxes[i].checked = nv; } p5setActions(); }
function setupBackPointers(x) { if (x.f != null) { var fs = 0, fc = 0; for (var i in x.f) { setupBackPointers(x.f[i]); x.f[i].parent = x; if (x.f[i].s) { fs += x.f[i].s; } if (x.f[i].c) { fc += x.f[i].c; } if (x.f[i].t == 3) { fc++; } } x.s = fs; x.c = fc; } return x; }
function getFileSizeStr(size) { if (size == 1) return "1 byte"; return format("{0} bytes", size); }
function p5folderup(x) { if (x == null) { filetreelocation.pop(); } else { while (filetreelocation.length > x) { filetreelocation.pop(); } } updateFiles(); return false; }
function p5folderset(x) { filetreelocation.push(decodeURIComponent(x)); updateFiles(); return false; }
function p5createfolder() { setDialogMode(2, "Nieuwe map", 3, p5createfolderEx, '<input type=text id=p5renameinput maxlength=64 onkeyup=p5fileNameCheck(event) style=width:100% />'); focusTextBox('p5renameinput'); p5fileNameCheck(); }
function p5createfolderEx() { meshserver.send({ action: 'fileoperation', fileop: 'createfolder', path: filetreelocation, newfolder: Q('p5renameinput').value}); }
function p5deletefile() { var cc = getFileSelCount(), rec = (getFileSelDirCount() > 0) ? '<br /><br /><label><input type=checkbox id=p5recdeleteinput>' + "Recursieve verwijdering" + '</label><br>' : '<input type=checkbox id=p5recdeleteinput style=\'display:none\'>'; setDialogMode(2, "Verwijderen", 3, p5deletefileEx, (cc > 1) ? (format("Verwijder {0} gelecteerde items?", cc) + rec) : ("Verwijder geselecteerde item?" + rec)); }
function p5deletefileEx() { var delfiles = [], checkboxes = document.getElementsByName('fc'); for (var i = 0; i < checkboxes.length; i++) { if (checkboxes[i].checked) { delfiles.push(checkboxes[i].value); } } meshserver.send({ action: 'fileoperation', fileop: 'delete', path: filetreelocation, delfiles: delfiles, rec: Q('p5recdeleteinput').checked }); }
function p5renamefile() { var renamefile, checkboxes = document.getElementsByName('fc'); for (var i = 0; i < checkboxes.length; i++) { if (checkboxes[i].checked) { renamefile = checkboxes[i].value; } } setDialogMode(2, "Hernoemen", 3, p5renamefileEx, '<input type=text id=p5renameinput maxlength=64 onkeyup=p5fileNameCheck(event) style=width:100% value="' + renamefile + '" />', { action: 'fileoperation', fileop: 'rename', path: filetreelocation, oldname: renamefile}); focusTextBox('p5renameinput'); p5fileNameCheck(); }
function p5renamefileEx(b, t) { t.newname = Q('p5renameinput').value; meshserver.send(t); }
function p5fileNameCheck(e) { var x = isFilenameValid(Q('p5renameinput').value); QE('idx_dlgOkButton', x); if ((x == true) && (e && e.keyCode == 13)) { dialogclose(1); } }
var isFilenameValid = (function(){ var x1=/^[^\\/:\*\?"<>\|]+$/, x2=/^\./, x3=/^(nul|prn|con|lpt[0-9]|com[0-9])(\.|$)/i; return function isFilenameValid(fname){ return x1.test(fname)&&!x2.test(fname)&&!x3.test(fname)&&(fname[0] != '.'); } })();
function p5uploadFile() { setDialogMode(2, "Upload bestand", 3, p5uploadFileEx, '<form method=post enctype=multipart/form-data action=uploadfile.ashx target=fileUploadFrame><input type=text name=link style=display:none id=p5uploadpath value=\"' + encodeURIComponent(filetreelinkpath) + '\" /><input type=file name=files id=p5uploadinput style=width:100% multiple=multiple onchange="p5updateUploadDialogOk(\'p5uploadinput\')" /><input type=hidden name=authCookie value=' + authCookie + ' /><input type=submit id=p5loginSubmit style=display:none /><span id=p5confirmOverwriteSpan style=display:none><br /><label><input type=checkbox id=p5confirmOverwrite onchange="p5updateUploadDialogOk(\'p5uploadinput\')" />' + "Bevestig overschrijven?" + '</label></span></form>'); p5updateUploadDialogOk('p5uploadinput'); }
function p5uploadFileEx() { Q('p5loginSubmit').click(); }
function p5updateUploadDialogOk() {
// Check if these are files we can upload, remove all folders.
var xallfiles = Q('p5uploadinput').files, files = [];
for (var i in xallfiles) { if ((xallfiles[i].size != null) && (xallfiles[i].size != 0)) { files.push(xallfiles[i]); } }
// Check if these files are duplicates of existing files.
var filetreex = filetree, allfiles = [], overWriteCount = 0;
for (var i in filetreelocation) {
if ((filetreex.f != null) && (filetreex.f[filetreelocation[i]] != null)) { filetreex = filetreex.f[filetreelocation[i]]; }
}
QE('idx_dlgOkButton', xallfiles.length > 0);
if (xallfiles.length > 0) {
if (filetreex.f != null) {
for (var i in filetreex.f) { allfiles.push(i); }
for (var i = 0; i < xallfiles.length; i++) {
if (allfiles.indexOf(xallfiles[i].name) >= 0) { overWriteCount++; } // TODO: If the server is Windows, we need to lowercase both names.
}
}
QV('p5confirmOverwriteSpan', overWriteCount > 0);
if (overWriteCount > 0) {
QE('idx_dlgOkButton', Q('p5confirmOverwrite').checked);
} else {
Q('p5confirmOverwrite').checked = false;
QE('idx_dlgOkButton', true);
}
}
}
/*
function p5viewfile() {
var checkboxes = document.getElementsByName('fc');
for (var i = 0; i < checkboxes.length; i++) {
if (checkboxes[i].checked) {
console.log(filetreelocation.join('/') + '/' + checkboxes[i].value); // TODO: Download and show this file
break;
}
}
}
*/
var p5clipboard = null, p5clipboardFolder = null, p5clipboardCut = 0;
function p5copyFile(cut) {
var checkboxes = document.getElementsByName('fc'); p5clipboard = []; p5clipboardCut = cut, p5clipboardFolder = Clone(filetreelocation);
for (var i = 0; i < checkboxes.length; i++) {
if ((checkboxes[i].checked) && (checkboxes[i].attributes.file.value == '3')) {
console.log('yy', checkboxes[i].value);
p5clipboard.push(checkboxes[i].value);
}
}
p5updateClipview();
}
function p5pasteFile() { var x = ''; if ((p5clipboard != null) && (p5clipboard.length > 0)) { x = format("Bevestig {0} van {1} vermelding {2} voor deze locatie?", (p5clipboardCut == 0?'copy':'move'), p5clipboard.length, ((p5clipboard.length > 1)?'s':'')) } setDialogMode(2, "Plakken", 3, p5pasteFileEx, x); }
function p5pasteFileEx() { meshserver.send({ action: 'fileoperation', fileop: (p5clipboardCut == 0?'copy':'move'), scpath: p5clipboardFolder, path: filetreelocation, names: p5clipboard }); p5folderup(999); if (p5clipboardCut == 1) { p5clipboard = null, p5clipboardFolder = null, p5clipboardCut = 0; p5updateClipview(); } }
function p5updateClipview() { var x = ''; if ((p5clipboard != null) && (p5clipboard.length > 0)) { x = format("Houd {0} item {1} vast voor {2}", p5clipboard.length, ((p5clipboard.length > 1)?'s':''), (p5clipboardCut == 0?"kopie":"verplaatsen")) + ', <a href=# onclick="return p5clearClip()" style=cursor:pointer>' + "Wissen" + '</a>.' } QH('p5bottomstatus', x); p5setActions(); }
function p5clearClip() { p5clipboard = null; p5clipboardFolder = null; p5clipboardCut = 0; p5updateClipview(); return false; }
function p5fileDragDrop(e) {
if (xxdialogMode) return;
haltEvent(e);
QV('bigfail', false);
QV('bigok', false);
//QV('p5fileCatchAllInput', false);
// Check if these are files we can upload, remove all folders.
if (e.dataTransfer == null) return;
var files = [];
for (var i in e.dataTransfer.files) { if ((e.dataTransfer.files[i].size != null) && (e.dataTransfer.files[i].size != 0)) { files.push(e.dataTransfer.files[i]); } }
if (files.length == 0) return;
// Check if these files are duplicates of existing files.
var filetreex = filetree, allfiles = [], overWriteCount = 0;
for (var i in filetreelocation) {
if ((filetreex.f != null) && (filetreex.f[filetreelocation[i]] != null)) { filetreex = filetreex.f[filetreelocation[i]]; }
}
if (filetreex.f != null) {
for (var i in filetreex.f) { allfiles.push(i); }
for (var i = 0; i < e.dataTransfer.files.length; i++) {
if (allfiles.indexOf(e.dataTransfer.files[i].name) >= 0) { overWriteCount++; } // TODO: If the server is Windows, we need to lowercase both names.
}
}
if (overWriteCount == 0) {
// If no overwrite, go ahead with upload
p5PerformUpload(1, files);
} else {
// Otherwise, prompt for confirmation
setDialogMode(2, "Upload bestand", 3, p5PerformUpload, format("Uploaden overschrijft {0} bestand {1}. Doorgaan met?", overWriteCount, addLetterS(overWriteCount)), files);
}
}
function p5PerformUpload(b, files) {
// For Chrome & Firefox
var error = 0;
p5uploadFile(); // Display the the dialog box
try { Q('p5uploadinput').files = files; } catch (ex) { error = 1; } // Set the files in the dialog box
if (error == 0) { p5uploadFileEx(); } // Press the submit button
setDialogMode(0); // Close the dialog box
// For IE browser - This will not work with very large files
if (error == 1) {
if (filetreelocation.length == 0) return;
var names = [], sizes = [], types = [], datas = [], readercount = files.length, totalSize = 0;
for (var i = 0; i < files.length; i++) { totalSize += files[i].size; }
if (totalSize > 1300000) { p5uploadFile(); return; } // File is too large, not sure what the real maximum is.
for (var i = 0; i < files.length; i++) {
var reader = new FileReader(), file = files[i];
names.push(file.name);
sizes.push(file.size);
types.push(file.type);
reader.onload = function (event) {
datas.push(event.target.result);
if (--readercount == 0) {
Q('p5fileDragName').value = names.join('*');
Q('p5fileDragSize').value = sizes.join('*');
Q('p5fileDragType').value = types.join('*');
Q('p5fileDragData').value = datas.join('*'); // This will not work for large files, there is a limit on the data size in a field.
Q('p5fileDragLink').value = encodeURIComponent(filetreelinkpath);
Q('p5fileDragAuthCookie').value = authCookie;
Q('p5loginSubmit2').click();
}
}
reader.readAsDataURL(file);
}
}
}
var p5dragtimer = null;
function p5fileDragOver(e) {
if (xxdialogMode) return;
haltEvent(e);
if (p5dragtimer != null) { clearTimeout(p5dragtimer); p5dragtimer = null; }
var ac = true; // TODO: Set to true if we can accept the file
if (filetreelocation.length == 0) { ac = false; }
QV('bigok', ac);
QV('bigfail', !ac);
//QV('p5fileCatchAllInput', ac);
}
function p5fileDragLeave(e) {
if (xxdialogMode) return;
haltEvent(e);
if (e.target.id != 'p5filetable') {
QV('bigfail', false);
QV('bigok', false);
//QV('p5fileCatchAllInput', false);
} else {
p5dragtimer = setTimeout(function () { QV('bigfail',false); QV('bigok',false); p5dragtimer=null; }, 10);
}
}
/*
function p5fileCatchAllInputChanged(e) {
p5fileDragLeave(e);
Q('p5fileDragLink2').value = encodeURIComponent(filetreelinkpath);
Q('p5fileCatchAllSubmit').click();
}
*/
//
// MY EVENTS
//
// Highlights the device being hovered
function eventMouseHover(e, over) {
e.children[1].classList.remove('g1s');
e.children[2].style['background-color'] = ((over == 0) ? '#c9c9c9' : '#b9b9b9');
e.children[3].classList.remove('g2s');
if (over == 1) { e.children[1].classList.add('g1s'); e.children[3].classList.add('g2s'); }
}
function eventsUpdate() {
var x = '', dateHeader = null;
for (var i in events) {
var event = events[i], time = new Date(event.time);
if (event.msg) {
if (event.h == null) { event.h = Math.random(); }
if (printDate(time) != dateHeader) {
if (dateHeader != null) x += '</table>';
dateHeader = printDate(time);
x += '<table class=p3eventsTable cellpadding=0 cellspacing=0><tr><td colspan=4 class=DevSt>' + dateHeader + '</td></tr>';
}
var icon = 'si3';
if (event.etype == 'user') icon = 'm2';
if (event.etype == 'server') icon = 'si3';
var msg = EscapeHtml(event.msg).split('(R)').join('&reg;');
if (event.nodeid) {
var node = getNodeFromId(event.nodeid);
if (node != null) {
icon = 'si' + node.icon;
msg = '<a href=# onclick=\'gotoDevice("' + event.nodeid + '",10);haltEvent(event);\'>' + EscapeHtml(node.name) + '</a> &rarr; ' + msg;
}
}
if (event.username) {
if ((userinfo.siteadmin & 2) && (event.userid)) {
msg = '<a href=# onclick=\'gotoUser("' + encodeURIComponent(event.userid) + '");haltEvent(event);\'>' + EscapeHtml(event.username) + '</a> &rarr; ' + msg;
} else {
msg = EscapeHtml(event.username) + ' &rarr; ' + msg;
}
}
if (event.etype == 'relay' || event.action == 'relaylog') icon = 'relayIcon16';
x += '<tr onclick=showEventDetails(' + event.h + ',2) onmouseover=eventMouseHover(this,1) onmouseout=eventMouseHover(this,0) style=cursor:pointer><td style=width:18px><div class=' + icon + '></div></td><td class=g1>&nbsp;</td><td class=style10>' + printTime(time) + ' - ' + msg + '</td><td class=g2>&nbsp;</td></tr><tr style=height:2px></tr>';
}
}
if (dateHeader != null) x += '</table>';
if (x == '') x = '<br><i>' + "Geen gebeurtenissen gevonden" + '</i><br><br>';
QH('p3events', x);
}
function refreshEvents() {
meshserver.send({ action: 'events', limit: parseInt(p3limitdropdown.value) });
}
function p3showDownloadEventsDialog(mode) {
if (xxdialogMode) return;
var x = "Download de lijst met gebeurtenissen in een van de onderstaande bestandsindelingen." + '<br /><br />';
x += addHtmlValue("CSV Formaat", '<a href=# style=cursor:pointer onclick="return p3downloadEventsDialogCSV(' + mode + ')">' + "eventslist.csv" + '</a>');
x += addHtmlValue("JSON-indeling", '<a href=# style=cursor:pointer onclick="return p3downloadEventsDialogJSON(' + mode + ')">' + "eventslist.json" + '</a>');
setDialogMode(2, "Gebeurtenis Lijst exporteren", 1, null, x, mode);
}
function p3downloadEventsDialogCSV(mode) {
var csv, eventList;
if (mode == 1) { eventList = currentDeviceEvents; }
if (mode == 2) { eventList = events; }
if (mode == 3) { eventList = currentUserEvents; }
csv = "time, type, action, user, message" + '\r\n';
for (var i in eventList) { csv += '\"' + eventList[i].time + '\",\"' + eventList[i].etype + '\",\"' + ((eventList[i].action != null) ? eventList[i].action : '') + '\",\"' + ((eventList[i].username != null) ? eventList[i].username : '') + '\",\"' + ((eventList[i].msg != null) ? eventList[i].msg : '') + '\"\r\n'; }
saveAs(new Blob([csv], { type: 'application/octet-stream' }), "eventslist.csv");
return false;
}
function p3downloadEventsDialogJSON(mode) {
var r = [], eventList;
if (mode == 1) { eventList = currentDeviceEvents; }
if (mode == 2) { eventList = events; }
if (mode == 3) { eventList = currentUserEvents; }
for (var i in eventList) { r.push(events[i]); }
saveAs(new Blob([JSON.stringify(r)], { type: 'application/octet-stream' }), "eventslist.json");
return false;
}
//
// MY USERS
//
function updateUsers() {
QV('MainMenuMyUsers', (users != null) && ((features & 4) == 0));
QV('LeftMenuMyUsers', (users != null) && ((features & 4) == 0));
QV('UserNewAccountButton', ((features & 4) == 0) && (serverinfo.domainauth == false));
if ((users == null) || ((features & 4) != 0)) { QH('p3users', ''); return; }
// Sort the list of user id's
var sortedUserIds = [], maxUsers = 100, hiddenUsers = 0;
for (var i in users) { sortedUserIds.push(i); }
sortedUserIds.sort();
// Get search
var userSearch = Q('UserSearchInput').value.toLowerCase();
var emailSearch = userSearch;
if (userSearch.startsWith('email:')) { userSearch = null; emailSearch = emailSearch.substring(6); }
else if (userSearch.startsWith('name:')) { emailSearch = null; userSearch = userSearch.substring(5); }
else if (userSearch.startsWith('e:')) { userSearch = null; emailSearch = emailSearch.substring(2); }
else if (userSearch.startsWith('n:')) { emailSearch = null; userSearch = userSearch.substring(2); }
// Display the users using the sorted list
var x = '<table class=p3usersTable cellpadding=0 cellspacing=0>', addHeader = true;
x += '<th>' + "Naam" + '<th style=width:80px>Groups<th style=width:120px>' + nobreak("Laatste toegang") + '<th style=width:120px>' + "machtigingen";
// Online users
for (var i in sortedUserIds) {
var user = users[sortedUserIds[i]], sessions = null;
if (wssessions != null) { sessions = wssessions[user._id]; }
if ((sessions != null) &&
((userSearch != null) && ((userSearch == '') || (user.name.toLowerCase().indexOf(userSearch) >= 0)) ||
((emailSearch != null) && ((user.email != null) && (user.email.toLowerCase().indexOf(emailSearch) >= 0))))
) {
if (maxUsers > 0) {
if (addHeader) { x += '<tr><td class=userTableHeader colspan=4>' + "Online gebruikers"; addHeader = false; }
x += addUserHtml(user, sessions);
maxUsers--;
} else {
hiddenUsers++;
}
}
}
addHeader = true;
// Offline users
for (var i in sortedUserIds) {
var user = users[sortedUserIds[i]], sessions = null;
if (wssessions != null) { sessions = wssessions[user._id]; }
if ((sessions == null) &&
((userSearch != null) && ((userSearch == '') || (user.name.toLowerCase().indexOf(userSearch) >= 0)) ||
((emailSearch != null) && ((user.email != null) && (user.email.toLowerCase().indexOf(emailSearch) >= 0))))
) {
if (maxUsers > 0) {
if (addHeader) { x += '<tr><td class=userTableHeader colspan=4>' + "Offline gebruikers"; addHeader = false; }
x += addUserHtml(user, sessions);
maxUsers--;
} else {
hiddenUsers++;
}
}
}
x += '</table>';
if (hiddenUsers == 1) { x += '<br />' + "1 gebruiker niet getoond, gebruik de zoekfunctie om gebruikers te vinden" + '<br />'; }
else if (hiddenUsers > 1) { x += '<br />' + format("{0} meer gebruikers niet getoond, gebruik zoekvak om gebruikers te zoeken ...", hiddenUsers) + '<br />'; }
if (maxUsers == 100) { x += '<br />' + "Geen gebruikers gevonden" + '<br />'; }
QH('p3users', x);
// Update current user panel if needed
if ((currentUser != null) && (xxcurrentView == 30)) { gotoUser(encodeURIComponent(currentUser._id),true); }
}
function addUserHtml(user, sessions) {
var x = '', gray = ' gray', icon = 'm2', msg = '', self = (user.name != userinfo.name), lastAccess = '', permissions = '';
if (sessions != null) {
gray = '';
if (self) {
msg = '<span style=float:right;margin-top:1px;margin-right:4px title=' + "Chat" + '><a href=# onclick=userChat(event,\"' + encodeURIComponent(user._id) + '\",\"' + encodeURIComponent(user.name) + '\")><img src=\'images/icon-chat.png\' height=16 width=16 style=padding-top:2px /></a></span>';
msg += '<span style=float:right;margin-top:1px;margin-left:4px;margin-right:4px title=Notify><a href=# onclick=\'return showUserAlertDialog(event,\"' + encodeURIComponent(user._id) + '\")\'><img src=\'images/icon-notify.png\' height=16 width=16 style=padding-top:2px /></a></span>';
}
if (sessions == 1) { lastAccess += nobreak("1 sessie"); } else { lastAccess += nobreak(format("{0} sessies", sessions)); }
} else {
if (user.login) { lastAccess += '<span title=\"' + format("Laatste inlog: {0}", printDateTime(new Date(user.login * 1000))) + '\">' + printDate(new Date(user.login * 1000)) + '</span>'; }
}
if (self) { permissions += '<a href=# style=cursor:pointer onclick=\'return showUserAdminDialog(event,\"' + encodeURIComponent(user._id) + '\")\'>'; }
if ((user.siteadmin != null) && ((user.siteadmin & 32) != 0) && (user.siteadmin != 0xFFFFFFFF)) { permissions += "Vergrendeld" + ',&nbsp;'; }
permissions += '<span title=\'' + "Serverrechten" + '\'>';
var urights = user.siteadmin & (0xFFFFFFFF - 224);
if ((user.siteadmin == null) || (urights == 0)) {
permissions += "Gebruiker";
} else if (urights == 8) {
permissions += "Gebruiker + bestanden";
} else if (user.siteadmin == 0xFFFFFFFF) {
permissions += "Beheerder";
} else if ((urights & 2) != 0) {
permissions += "Beheerder";
} else {
permissions += "Gedeeltelijk";
}
if ((user.siteadmin != null) && (user.siteadmin != 0xFFFFFFFF) && ((user.siteadmin & (64 + 128)) != 0)) { permissions += '*'; }
permissions += '</span>';
//if ((user.quota != null) && ((user.siteadmin & 8) != 0)) { msg += ", " + (user.quota / 1024) + " k"; }
if (self) { permissions += '</a>'; }
var groups = 0
if (user.links) { for (var i in user.links) { groups++; } }
var username = EscapeHtml(user.name), emailVerified = '';
if (serverinfo.emailcheck == true) { emailVerified = ((user.emailVerified != true) ? ' <b style=color:red title="Email is not verified">&#x2717;</b>' : ' <b style=color:green title="Email is verified">&#x2713</b>'); }
if (user.email != null) {
if (((features & 0x200000) == 0) || (user.email.toLowerCase() != user.name.toLowerCase())) {
// Username & email are different
username += ', <a href=# onclick=\'return doemail(event,\"' + user.email + '\")\'>' + user.email + '</a>' + emailVerified;
} else {
// Username & email are the same
username += ' <a href=# onclick=\'return doemail(event,\"' + user.email + '\")\'><img src="images/mail12.png" height=9 width=12 title="Send email to user" style="margin-top:2px" /></a>' + emailVerified;
}
}
if ((user.otpsecret > 0) || (user.otphkeys > 0)) { username += ' <img src="images/key12.png" height=12 width=11 title="2nd factor authentication enabled" style="margin-top:2px" />'; }
if ((user.siteadmin != null) && ((user.siteadmin & 32) != 0) && (user.siteadmin != 0xFFFFFFFF)) { username += ' <img src="images/padlock12.png" height=12 width=8 title="Account is locked" style="margin-top:2px" />'; }
x += '<tr tabindex=0 onmouseover=userMouseHover(this,1) onmouseout=userMouseHover(this,0) onkeypress="if (event.key==\'Enter\') gotoUser(\'' + encodeURIComponent(user._id) + '\')"><td style=cursor:pointer onclick=gotoUser(\"' + encodeURIComponent(user._id) + '\")>';
x += '<div class=bar>';
x += '<div class=baricon><div class="' + icon + gray + '"></div></div>';
x += '<div class=g1></div><div class=g2></div>';
x += '<div><span>' + username + '</span>' + msg + '</div></div><td style=text-align:center>' + groups + '<td style=text-align:center>' + lastAccess + '<td style=text-align:center>' + permissions;
return x;
}
// Highlights the user being hovered
function userMouseHover(element, over) {
var e = element.children[0].children[0];
e.children[1].classList.remove('g1s');
e.children[2].classList.remove('g2s');
if (over == 1) { e.children[1].classList.add('g1s'); e.children[2].classList.add('g2s'); }
element.children[0].children[0].style['background-color'] = ((over == 0) ? '#c9c9c9' : '#b9b9b9');
}
function userChat(e, userid, name) {
haltEvent(e);
var url = '/messenger?id=meshmessenger/' + userid + '/' + encodeURIComponent(userinfo._id) + '&title=' + name;
if ((authCookie != null) && (authCookie != '')) { url += '&auth=' + authCookie; }
window.open(url, 'meshmessenger:' + userid);
meshserver.send({ action: 'meshmessenger', userid: decodeURIComponent(userid) });
return false;
}
function showUserAlertDialog(e, userid) {
if (xxdialogMode) return;
haltEvent(e);
setDialogMode(2, format("Melden {0}", EscapeHtml(users[decodeURIComponent(userid)].name)), 3, showUserAlertDialogEx, "Stuur een tekstbericht naar deze gebruiker." + '<textarea id=d2notifyText maxlength=2048 style="width:100%;height:184px;resize:none"></textarea>', userid);
Q('d2notifyText').focus();
return false;
}
function showUserAlertDialogEx(button, userid) { meshserver.send({ action: 'notifyuser', userid: decodeURIComponent(userid), msg: Q('d2notifyText').value }); }
function doemail(e, addr) {
if (xxdialogMode) return false;
haltEvent(e);
window.open('mailto:' + addr);
return false;
}
function p4batchAccountCreate() {
if (xxdialogMode) return;
var x = "Maak meerdere accounts tegelijk door een JSON-bestand met de volgende indeling te importeren:" + '<br /><pre>[\r\n {"user":"x1","pass":"x","email":"x1@x"},\r\n {"user":"x2","pass":"x","resetNextLogin":true}\r\n]</pre><input style=width:370px type=file id=d4importFile accept=".json" onchange=p4batchAccountCreateValidate() />';
setDialogMode(2, "Gebruikersaccount importeren", 3, p4batchAccountCreateEx, x);
QE('idx_dlgOkButton', false);
}
function p4batchAccountCreateValidate() {
QE('idx_dlgOkButton', Q('d4importFile').value != null);
}
function p4batchAccountCreateEx() {
var fr = new FileReader();
fr.onload = function (r) {
var j = null;
try { j = JSON.parse(r.target.result); } catch (ex) { setDialogMode(2, "Gebruikersaccount importeren", 1, null, format("Ongeldig JSON-bestand: {0}.", ex)); return; }
if ((j != null) && (Array.isArray(j))) {
var ok = true;
for (var i in j) {
if ((typeof j[i].user != 'string') || (j[i].user.length < 1) || (j[i].user.length > 64)) { ok = false; }
if ((typeof j[i].pass != 'string') || (j[i].pass.length < 1) || (j[i].pass.length > 256)) { ok = false; }
if (checkPasswordRequirements(j[i].pass, passRequirements) == false) { ok = false; }
if ((j[i].email != null) && ((typeof j[i].email != 'string') || (j[i].email.length < 1) || (j[i].email.length > 128))) { ok = false; }
}
if (ok == false) { setDialogMode(2, "Gebruikersaccount importeren", 1, null, "Ongeldige JSON-bestandsindeling."); } else { meshserver.send({ action: 'adduserbatch', users: j }); }
} else { setDialogMode(2, "Gebruikersaccount importeren", 1, null, "Ongeldige JSON-bestandsindeling."); }
};
fr.readAsText(Q('d4importFile').files[0]);
}
function p4downloadUserInfo() {
if (xxdialogMode) return;
var x = "Download de lijst met gebruikers in een van de onderstaande bestandsindelingen." + '<br /><br />';
x += addHtmlValue("CSV Formaat", '<a href=# style=cursor:pointer onclick=\'return p4downloadUserInfoCSV()\'>' + "userlist.csv" + '</a>');
x += addHtmlValue("JSON-indeling", '<a href=# style=cursor:pointer onclick=\'return p4downloadUserInfoJSON()\'>' + "userlist.json" + '</a>');
setDialogMode(2, "Gebruikerslijst exporteren", 1, null, x);
}
function p4downloadUserInfoCSV() {
var csv = "id, naam, e-mail, aanmaken, laatste inlog, groepen, authenticatiefactors" + '\r\n';
for (var i in users) {
var multiFactor = false, factors = [];
if ((users[i].otpsecret > 0) || (users[i].otphkeys > 0)) {
multiFactor = true;
if (users[i].otpsecret > 0) { factors.push('AuthApp'); }
if (users[i].otphkeys > 0) { factors.push('SecurityKey'); }
if (users[i].otpkeys > 0) { factors.push('BackupCodes'); }
}
csv += '\"' + users[i]._id + '\",\"' + users[i].name + '\",\"' + (users[i].email ? users[i].email : '') + '\",\"' + (users[i].creation ? new Date(users[i].creation * 1000) : '') + '\",\"' + (users[i].login ? new Date(users[i].login * 1000) : '') + '\",\"' + (users[i].groups ? users[i].groups.join(',') : '') + '\",\"' + (multiFactor ? factors.join(',') : '') + '\"\r\n';
}
saveAs(new Blob([csv], { type: 'application/octet-stream' }), "userlist.csv");
return false;
}
function p4downloadUserInfoJSON() {
var r = []
for (var i in users) { r.push(users[i]); }
saveAs(new Blob([JSON.stringify(r)], { type: 'application/octet-stream' }), "userlist.json");
return false;
}
function showUserBroadcastDialog() {
if (xxdialogMode) return;
var x = "Verzend een bericht naar alle verbonden gebruikers." + '<textarea id=broadcastMessage value="" maxlength="256"/></textarea>';
setDialogMode(2, "Bericht uitzenden", 3, showUserBroadcastDialogEx, x);
Q('broadcastMessage').focus();
}
function showUserBroadcastDialogEx() {
meshserver.send({ action: 'userbroadcast', msg: Q('broadcastMessage').value });
}
function showCreateNewAccountDialog() {
if (xxdialogMode) return;
var x = '';
if ((features & 0x200000) == 0) { x += addHtmlValue("Naam", '<input id=p4name maxlength=64 onchange=showCreateNewAccountDialogValidate() onkeyup=showCreateNewAccountDialogValidate() />'); }
x += addHtmlValue("Email", '<input id=p4email maxlength=256 onchange=showCreateNewAccountDialogValidate() onkeyup=showCreateNewAccountDialogValidate() />');
x += addHtmlValue("wachtwoord", '<input id=p4pass1 type=password maxlength=256 onchange=showCreateNewAccountDialogValidate() onkeyup=showCreateNewAccountDialogValidate() />');
x += addHtmlValue("wachtwoord", '<input id=p4pass2 type=password maxlength=256 onchange=showCreateNewAccountDialogValidate() onkeyup=showCreateNewAccountDialogValidate() />');
x += '<div><label><input id=p4randomPassword onchange=showCreateNewAccountDialogValidate() type=checkbox />' + "Randomiseer het wachtwoord." + '</label></div>';
x += '<div><label><input id=p4resetNextLogin onchange=showCreateNewAccountDialogValidate() type=checkbox />' + "Forceer wachtwoord opnieuw instellen bij de volgende aanmelding." + '</label></div>';
if (serverinfo.emailcheck) {
x += '<div><label><input id=p4verifiedEmail onchange=showCreateNewAccountDialogValidate() type=checkbox />' + "Email is geverifieerd." + '</label></div>';
x += '<div><label><input id=p4invitationEmail type=checkbox />' + "Verzend uitnodigingsmail." + '</label></div>';
}
if (passRequirements) {
var r = [], rc = 0;
for (var i in passRequirements) { if ((i != 'reset') && (i != 'hint')) { r.push(i + ':' + passRequirements[i]); rc++; } }
if (rc > 0) { x += '<div style=font-size:x-small;padding:6px>' + format("Vereisten: {0}.", r.join(', ')) + '</div>'; }
}
setDialogMode(2, "Account aanmaken", 3, showCreateNewAccountDialogEx, x);
showCreateNewAccountDialogValidate();
if ((features & 0x200000) == 0) { Q('p4name').focus(); } else { Q('p4email').focus(); }
}
function showCreateNewAccountDialogValidate(x) {
var ve = true;
if (serverinfo.emailcheck) {
ve = validateEmail(Q('p4email').value);
QE('p4verifiedEmail', ve);
QE('p4invitationEmail', ve && Q('p4resetNextLogin').checked && Q('p4verifiedEmail').checked);
if (ve == false) { Q('p4verifiedEmail').checked = false; }
if ((Q('p4resetNextLogin').checked == false) || (Q('p4verifiedEmail').checked == false)) { Q('p4invitationEmail').checked = false; }
}
QE('p4pass1', !Q('p4randomPassword').checked);
QE('p4pass2', !Q('p4randomPassword').checked);
if ((x == null) && (Q('p4email').value.length > 0) && (ve == false)) { QE('idx_dlgOkButton', false); return; }
var ok = true;
if ((features & 0x200000) == 0) { ok &= (!Q('p4name') || ((Q('p4name').value.length > 0) && (Q('p4name').value.indexOf(' ') == -1))); } // Username is not email address
if (Q('p4randomPassword').checked == false) { ok &= (Q('p4pass1').value.length > 0 && Q('p4pass1').value == Q('p4pass2').value && checkPasswordRequirements(Q('p4pass1').value, passRequirements)); }
QE('idx_dlgOkButton', ok);
}
function showCreateNewAccountDialogEx() {
var username = ((features & 0x200000) == 0) ? Q('p4name').value : Q('p4email').value; // Username is email address
var x = { action: 'adduser', username: username, email: Q('p4email').value, pass: Q('p4pass1').value, resetNextLogin: Q('p4resetNextLogin').checked, randomPassword: Q('p4randomPassword').checked };
if (serverinfo.emailcheck) {
x.emailVerified = Q('p4verifiedEmail').checked;
x.emailInvitation = Q('p4invitationEmail').checked;
}
meshserver.send(x);
}
function showUserGroupDialog(e, userid) {
if (xxdialogMode) return;
haltEvent(e);
userid = decodeURIComponent(userid);
var user = users[userid.toLowerCase()], groups = "";
if (user.groups != null) { groups = user.groups.join(', ') }
var x = "Voer een door komma's gescheiden lijst met beheerdersnamen in." + '<br /><br />';
x += addHtmlValue("Realms", '<input id=dp4usergroups style=width:230px value="' + groups + '" placeholder=\"' + "Naam1, Naam2, Naam3" + '\" maxlength=256 onchange=p4validateUserGroups() onkeyup=p4validateUserGroups() />');
setDialogMode(2, "Administratieve gebieden", 3, showUserGroupDialogEx, x, user);
focusTextBox('dp4usergroups');
p4validateUserGroups();
return false;
}
function p4validateUserGroups() {
var groups = Q('dp4usergroups').value;
var k = 0, i = groups.indexOf('\"') + groups.indexOf('/') + groups.indexOf('>') + groups.indexOf('<') + groups.indexOf('\'');
var g = groups.split(',');
for (var j in g) { if (g[j].trim().length == 0) k++; }
QE('idx_dlgOkButton', (groups == '') || ((i == -5) && (k < 1)));
}
function showUserGroupDialogEx(event, user) {
var groups = Q('dp4usergroups').value, g = groups.split(','), g2 = [];
for (var j in g) { var x = g[j].trim(); if (x.length > 0) { g2.push(x); } }
meshserver.send({ action: 'edituser', id: user._id, groups: g2 });
}
function showUserAdminDialog(e, userid) {
if (xxdialogMode) return;
haltEvent(e);
userid = decodeURIComponent(userid);
var x = '<div><div id=d2AdminPermissions>';
x += '<label><input type=checkbox onchange=showUserAdminDialogValidate() id=ua_fileaccess>' + "Serverbestanden" + '</label>, <input type=number onchange=showUserAdminDialogValidate() maxlength=10 id=ua_fileaccessquota>k max, blank for default<br><hr/>';
x += '<label><input type=checkbox onchange=showUserAdminDialogValidate() id=ua_fulladmin>' + "Volledige beheerder" + '</label><br>';
x += '<label><input type=checkbox onchange=showUserAdminDialogValidate() id=ua_serverbackup>' + "Server Back-up" + '</label><br>';
x += '<label><input type=checkbox onchange=showUserAdminDialogValidate() id=ua_serverrestore>' + "Server herstellen" + '</label><br>';
x += '<label><input type=checkbox onchange=showUserAdminDialogValidate() id=ua_serverupdate>' + "Serverupdates" + '</label><br>';
x += '<label><input type=checkbox onchange=showUserAdminDialogValidate() id=ua_manageusers>' + "Beheer gebruikers" + '</label><br>';
x += '<hr/></div><label><input type=checkbox onchange=showUserAdminDialogValidate() id=ua_lockedaccount>' + "Account vergrendelen" + '</label><br>';
x += '<label><input type=checkbox onchange=showUserAdminDialogValidate() id=ua_nonewgroups>' + "Geen nieuwe apparaatgroepen" + '</label><br>';
x += '<label><input type=checkbox onchange=showUserAdminDialogValidate() id=ua_nomeshcmd>' + "Geen Tools (MeshCmd/Router)" + '</label><br>';
x += '</div>';
var user = users[userid.toLowerCase()];
setDialogMode(2, "Serverrechten", 3, showUserAdminDialogEx, x, user);
if (user.siteadmin && user.siteadmin != 0) {
Q('ua_fulladmin').checked = (user.siteadmin == 0xFFFFFFFF);
Q('ua_serverbackup').checked = ((user.siteadmin != 0xFFFFFFFF) && ((user.siteadmin & 1) != 0)); // Server Backup
Q('ua_manageusers').checked = ((user.siteadmin != 0xFFFFFFFF) && ((user.siteadmin & 2) != 0)); // Manage Users
Q('ua_serverrestore').checked = ((user.siteadmin != 0xFFFFFFFF) && ((user.siteadmin & 4) != 0)); // Server Restore
Q('ua_fileaccess').checked = ((user.siteadmin != 0xFFFFFFFF) && ((user.siteadmin & 8) != 0)); // Server Files
Q('ua_serverupdate').checked = ((user.siteadmin != 0xFFFFFFFF) && ((user.siteadmin & 16) != 0)); // Server Update
Q('ua_lockedaccount').checked = ((user.siteadmin != 0xFFFFFFFF) && ((user.siteadmin & 32) != 0)); // Account locked
Q('ua_nonewgroups').checked = ((user.siteadmin != 0xFFFFFFFF) && ((user.siteadmin & 64) != 0)); // No New Groups
Q('ua_nomeshcmd').checked = ((user.siteadmin != 0xFFFFFFFF) && ((user.siteadmin & 128) != 0)); // No Tools (MeshCMD / Router)
}
QE('ua_fulladmin', userinfo.siteadmin == 0xFFFFFFFF);
QE('ua_serverbackup', userinfo.siteadmin == 0xFFFFFFFF);
QE('ua_manageusers', userinfo.siteadmin == 0xFFFFFFFF);
QE('ua_serverrestore', userinfo.siteadmin == 0xFFFFFFFF);
QE('ua_fileaccess', userinfo.siteadmin == 0xFFFFFFFF);
QE('ua_fileaccessquota', userinfo.siteadmin == 0xFFFFFFFF);
QE('ua_serverupdate', userinfo.siteadmin == 0xFFFFFFFF);
QV('d2AdminPermissions', userinfo.siteadmin == 0xFFFFFFFF)
QE('ua_lockedaccount', (userinfo.siteadmin & 2) && (user.siteadmin != 0xFFFFFFFF) && (userinfo._id != user._id));
QE('ua_nonewgroups', (userinfo.siteadmin & 2) && (user.siteadmin != 0xFFFFFFFF) && (userinfo._id != user._id));
QE('ua_nomeshcmd', (userinfo.siteadmin & 2) && (user.siteadmin != 0xFFFFFFFF) && (userinfo._id != user._id));
Q('ua_fileaccessquota').value = (user.quota != null)?(user.quota / 1024):'';
showUserAdminDialogValidate();
return false;
}
function showUserAdminDialogValidate() {
if (userinfo.siteadmin == 0xFFFFFFFF) {
QE('ua_serverbackup', !Q('ua_fulladmin').checked);
QE('ua_manageusers', !Q('ua_fulladmin').checked);
QE('ua_serverrestore', !Q('ua_fulladmin').checked);
QE('ua_fileaccess', !Q('ua_fulladmin').checked);
QE('ua_serverupdate', !Q('ua_fulladmin').checked);
QE('ua_lockedaccount', !Q('ua_fulladmin').checked);
QE('ua_nonewgroups', !Q('ua_fulladmin').checked);
QE('ua_nomeshcmd', !Q('ua_fulladmin').checked);
QE('ua_fileaccessquota', Q('ua_fileaccess').checked && !Q('ua_fulladmin').checked);
}
}
function showUserAdminDialogEx(button, user) {
var siteadmin = 0, quota = parseInt(Q('ua_fileaccessquota').value);
if (Q('ua_fulladmin').checked == true) { siteadmin = 0xFFFFFFFF; } else {
if (Q('ua_serverbackup').checked == true) siteadmin += 1;
if (Q('ua_manageusers').checked == true) siteadmin += 2;
if (Q('ua_serverrestore').checked == true) siteadmin += 4;
if (Q('ua_fileaccess').checked == true) siteadmin += 8;
if (Q('ua_serverupdate').checked == true) siteadmin += 16;
if (Q('ua_lockedaccount').checked == true) siteadmin += 32;
if (Q('ua_nonewgroups').checked == true) siteadmin += 64;
if (Q('ua_nomeshcmd').checked == true) siteadmin += 128;
}
var x = { action: 'edituser', id: user._id, siteadmin: siteadmin };
if (isNaN(quota) == false) { x.quota = (quota * 1024); }
meshserver.send(x);
}
function onUserSearchInputChanged() { updateUsers(); }
//
// MY USERS GENERAL
//
var currentUser = null;
function gotoUser(userid, force) {
if (xxdialogMode && !force) return;
var user = currentUser = users[decodeURIComponent(userid)];
if (user == null) { setDialogMode(0); go(4); return; }
QH('p30userName', user.name);
QH('p31userName', user.name);
var self = (user.name == userinfo.name), activeSessions = 0;
if (wssessions != null && wssessions[user._id]) { activeSessions = wssessions[user._id]; }
// Change user grayscale
Q('MainUserImage').classList.remove('gray');
if (activeSessions == 0) { Q('MainUserImage').classList.add('gray'); }
// Server permissions
var msg = [], premsg = '';
if ((user.siteadmin != null) && ((user.siteadmin & 32) != 0) && (user.siteadmin != 0xFFFFFFFF)) { premsg = '<img src="images/padlock12.png" height=12 width=8 title="Account is locked" style="margin-top:2px" /> '; msg.push("Vergrendeld account"); }
if ((user.siteadmin == null) || ((user.siteadmin & (0xFFFFFFFF - 224)) == 0)) { msg.push("Geen server rechten"); } else if (user.siteadmin == 8) { msg.push("Toegang tot de server bestanden"); } else if (user.siteadmin == 0xFFFFFFFF) { msg.push("Volledige beheerder"); } else { msg.push("Gedeeltelijke rechten"); }
if ((user.siteadmin != null) && (user.siteadmin != 0xFFFFFFFF) && ((user.siteadmin & (64 + 128)) != 0)) { msg.push("Beperkingen"); }
// Show user attributes
var x = '<div style=min-height:80px><table style=width:100%>';
var email = user.email?EscapeHtml(user.email):'<i>' + "Niet ingesteld" + '</i>', everify = '';
if (serverinfo.emailcheck) { everify = ((user.emailVerified == true) ? '<b style=color:green;cursor:pointer title=\"' + "Email is geverifieerd" + '\">&#x2713</b> ' : '<b style=color:red;cursor:pointer title=\"' + "Email is niet geverifieerd" + '\">&#x2717;</b> '); }
if (user.name.toLowerCase() != user._id.split('/')[2]) { x += addDeviceAttribute("gebruikers-ID", user._id.split('/')[2]); }
if (((features & 0x200000) == 0) && ((user.siteadmin != 0xFFFFFFFF) || (userinfo.siteadmin == 0xFFFFFFFF))) { // If we are not site admin, we can't change a admin email.
x += addDeviceAttribute("Email", everify + '<a href=# style=cursor:pointer onclick=p30showUserEmailChangeDialog(event,\"' + userid + '\")>' + email + '</a> <a href=# style=cursor:pointer onclick=\'return doemail(event,\"' + user.email + '\")\'><img class=hoverButton src="images/link1.png" /></a>');
} else {
x += addDeviceAttribute("Email", everify + email + ' <a href=# style=cursor:pointer onclick=\'return doemail(event,\"' + user.email + '\")\'><img class=hoverButton src="images/link1.png" /></a>');
}
x += addDeviceAttribute("Serverrechten", premsg + '<a href=# style=cursor:pointer onclick=\'return showUserAdminDialog(event,\"' + userid + '\")\'>' + msg.join(', ') + '</a>');
if (user.quota) x += addDeviceAttribute("Serverquotum", EscapeHtml(parseInt(user.quota) / 1024) + ' k');
x += addDeviceAttribute("Aanmaken", printDateTime(new Date(user.creation * 1000)));
if (user.login) x += addDeviceAttribute("Laatste inlog", printDateTime(new Date(user.login * 1000)));
if (user.passchange == -1) { x += addDeviceAttribute("wachtwoord", "Wordt bij de volgende aanmelding gewijzigd."); }
else if (user.passchange) { x += addDeviceAttribute("wachtwoord", format("Laatst gewijzigd: {0}", printDateTime(new Date(user.passchange * 1000)))); }
// Device Groups
var linkCount = 0, linkCountStr = '<i>' + "Geen" + '<i>';
if (user.links) {
for (var i in user.links) { linkCount++; }
if (linkCount == 1) { linkCountStr = "1 groep"; } else if (linkCount > 1) { linkCountStr = format("{0} groepen", linkCount); }
}
x += addDeviceAttribute("Apparaatgroepen", linkCountStr);
// Administrative Realms
if ((userinfo.siteadmin == 0xFFFFFFFF) || (userinfo.siteadmin & 2)) {
var userGroups = '<i>' + "Geen" + '</i>';
if (user.groups) { userGroups = ''; for (var i in user.groups) { userGroups += '<span class="tagSpan">' + user.groups[i] + '</span>'; } }
x += addDeviceAttribute("Beheerdersgebied", addLinkConditional(userGroups, 'showUserGroupDialog(event,\"' + userid + '\")', (userinfo.siteadmin == 0xFFFFFFFF) || ((userinfo.groups == null) && (userinfo._id != user._id) && (user.siteadmin != 0xFFFFFFFF))));
}
var multiFactor = 0;
if ((user.otpsecret > 0) || (user.otphkeys > 0)) {
multiFactor = 1;
var factors = [];
if (user.otpsecret > 0) { factors.push("Verificatie-app"); }
if (user.otphkeys > 0) { factors.push("Veiligheidssleutel"); }
if (user.otpkeys > 0) { factors.push("Back-upcodes"); }
x += addDeviceAttribute("Veiligheid", '<img src="images/key12.png" height=12 width=11 title=\"' + "Tweestapsverificatie ingeschakeld" + '\" style="margin-top:2px" /> ' + factors.join(', '));
}
x += '</table></div><br />';
// Add action buttons
x += '<input type=button value=\"' + "Notities" + '\" title=\"' + "Bekijk opmerkingen over deze gebruiker" + '\" onclick=showNotes(false,"' + userid + '") />';
if (!self && (activeSessions > 0)) { x += '<input type=button value=\"' + "Melden" + '\" title=\"' + "Stuur gebruikersmelding" + '\" onclick=showUserAlertDialog(event,"' + userid + '") />'; }
// Setup the panel
QH('p30html', x);
// Draw the user timeline
drawUserTimeline();
// Check if we can delete this user
var deletePossible = true;
if (user._id == userinfo._id) deletePossible = false;
if (user.siteadmin && user.siteadmin > 0 && userinfo.siteadmin != 0xFFFFFFFF) deletePossible = false;
// Show bottom buttons
x = '<div style=float:right;font-size:x-small>';
if (deletePossible) x += '<a href=# style=cursor:pointer onclick=\'return p30showDeleteUserDialog()\' title="Remove this user">Delete User</a>';
x += '</div><div style=font-size:x-small>';
if (userinfo.siteadmin == 0xFFFFFFFF) x += '<a href=# style=cursor:pointer onclick=\'return p30showUserChangePassDialog(' + multiFactor + ')\' title="Change the password for this user">Change Password</a>';
x += '</div><br>'
QH('p30html3', x);
// Update user's connection state
x = '';
if (activeSessions == 1) { x = "1 actieve sessie"; } else if (activeSessions > 1) { x = format("{0} actieve sessies", activeSessions); }
QH('MainUserState', x);
go(30);
// Update user events (TODO: do this only if we change users)
QH('p31events', '');
refreshUsersEvents();
}
// Display the user's email change dialog box
function p30showUserEmailChangeDialog(event) {
if (xxdialogMode) return false;
var x = '';
x += addHtmlValue("Email", '<input id=dp30email style=width:230px maxlength=32 onchange=p30validateEmail() onkeyup=p30validateEmail() />');
if (serverinfo.emailcheck) { x += addHtmlValue("Status", '<select id=dp30verified style=width:230px onchange=p30validateEmail()><option value=0>Not verified</option><option value=1>Verified</option></select>'); }
setDialogMode(2, format("Verander e-mail voor {0}", EscapeHtml(currentUser.name)), 3, p30showUserEmailChangeDialogEx, x);
Q('dp30email').focus();
Q('dp30email').value = (currentUser.email?currentUser.email:'');
if (serverinfo.emailcheck) { Q('dp30verified').value = currentUser.emailVerified?1:0; }
p30validateEmail();
return false;
}
// Perform validation on the user's email change dialog box
function p30validateEmail() {
var v = Q('dp30email').value, x = v.split('@');
x = (x.length == 2) && (x[0].length > 0) && (x[1].split('.').length > 1) && (x[1].length > 2) && (v.length < 1024) && ((v != userinfo.email) || ((serverinfo.emailcheck == true) && (Q('dp30verified').value != (userinfo.emailVerified?1:0))));
QE('idx_dlgOkButton', x);
}
// Send to the server the new user's email address and validation status
function p30showUserEmailChangeDialogEx() {
var x = { action: 'edituser', id: currentUser._id, email: Q('dp30email').value };
if (serverinfo.emailcheck) { x.emailVerified = (Q('dp30verified').value == 1); }
meshserver.send(x);
}
// Display the user's password change dialog box
function p30showUserChangePassDialog(multiFactor) {
if (xxdialogMode) return;
var x = '';
x += addHtmlValue("wachtwoord", '<input id=p4pass1 type=password style=width:230px maxlength=256 onchange=p30showUserChangePassDialogValidate(1) onkeyup=p30showUserChangePassDialogValidate(1)></input>');
x += addHtmlValue("wachtwoord", '<input id=p4pass2 type=password style=width:230px maxlength=256 onchange=p30showUserChangePassDialogValidate(1) onkeyup=p30showUserChangePassDialogValidate(1)></input>');
if (features & 0x00010000) { x += addHtmlValue("wachtwoord hint", '<input id=p4hint type=text style=width:230px maxlength=256></input>'); }
if (passRequirements) {
var r = [], rc = 0;
for (var i in passRequirements) { if ((i != 'reset') && (i != 'hint')) { r.push(i + ':' + passRequirements[i]); rc++; } }
if (rc > 0) { x += '<div style=font-size:x-small;padding:6px>' + format("Vereisten: {0}.", r.join(', ')) + '</div>'; }
}
x += '<div><label><input id=p4resetNextLogin type=checkbox />' + "Forceer wachtwoord opnieuw instellen bij de volgende aanmelding." + '</label></div>';
if (multiFactor == 1) { x += '<div><label><input id=p4twoFactorRemove type=checkbox />' + "Verwijder alle Tweestapsverificatie." + '</label></div>'; }
setDialogMode(2, format("Verander wachtwoord voor {0}", EscapeHtml(currentUser.name)), 3, p30showUserChangePassDialogEx, x, multiFactor);
p30showUserChangePassDialogValidate();
Q('p4pass1').focus();
if (currentUser.passchange == -1) { Q('p4resetNextLogin').checked = true; }
}
function p30showUserChangePassDialogValidate() {
var ok = true;
if ((Q('p4pass1').value != '') || (Q('p4pass2').value != '')) {
if (Q('p4pass1').value != Q('p4pass2').value) { ok = false; } else {
if (passRequirements) { if (checkPasswordRequirements(Q('p4pass1').value, passRequirements) == false) { ok = false; } }
}
}
QE('idx_dlgOkButton', ok);
}
function p30showUserChangePassDialogEx(b, tag) {
var removeMultiFactor = false;
if ((tag == 1) && (Q('p4twoFactorRemove').checked == true)) { removeMultiFactor = true; }
if (Q('p4pass1').value == Q('p4pass2').value) {
var r = { action: 'changeuserpass', userid: currentUser._id, pass: Q('p4pass1').value, removeMultiFactor: removeMultiFactor, resetNextLogin: Q('p4resetNextLogin').checked };
if (features & 0x00010000) { r.hint = Q('p4hint').value; }
meshserver.send(r);
}
}
function p30showDeleteUserDialog() {
if (xxdialogMode) return;
setDialogMode(2, format("Verwijder gebruiker {0}", EscapeHtml(currentUser.name)), 3, p30showDeleteUserDialogEx, format('Confirm deletion of user {0}?', EscapeHtml(currentUser.name)));
}
function p30showDeleteUserDialogEx() {
meshserver.send({ action: 'deleteuser', userid: currentUser._id, username: currentUser.name });
}
// Draw device power bars. The bars are 766px wide.
function drawUserTimeline() {
var timeline = null, now = Date.now();
//if (currentNode._id == powerTimelineNode) { timeline = powerTimeline; }
timeline = [];
// Calculate when the timeline starts
var d = new Date();
d.setHours(0, 0, 0, 0);
d = new Date(d.getTime() - (1000 * 60 * 60 * 24 * 6));
var timelineStart = d.getTime();
// De-compact the timeline
var timeline2 = [];
if (timeline != null && timeline.length > 1) {
timeline2.push([ 0, timeline[1], timeline[0] ]); // Start, End, Power
var ct = timeline[1];
for (var i = 2; i < timeline.length; i += 2) {
var power = timeline[i], dt = now;
if (timeline.length > (i + 1)) { dt = timeline[i + 1]; }
timeline2.push([ ct, ct + dt, power ]); // Start, End, Power
ct = ct + dt;
}
}
// Draw the timeline
var x = '', count = 1, date = new Date();
date.setHours(0, 0, 0, 0);
for (var i = 0; i < 7; i++) {
var datavalue = '', start = date.getTime(), end = start + (1000 * 60 * 60 * 24);
for (var j in timeline2) {
var block = timeline2[j];
if (isTimeBlockInside(start, end, block[0], block[1]) == true) {
var ts = Math.max(start, block[0]);
var te = Math.min(Math.min(end, block[1]), now);
var width = Math.round((te - ts) / 112794);
if (width > 0) {
var title = powerStateStrings2[block[2]] + ' from ' + printTime(new Date(ts)) + ' to ' + printTime(new Date(te)) + '.';
datavalue += '<div title="' + title + '" style=display:table-cell;width:' + width + 'px;background-color:' + powerColor(block[2]) + ';height:16px></div>';
}
}
}
x += '<tr style=' + (((count % 2) == 0)?'background-color:#DDD':'') + '><td><div>&nbsp;' + printDate(date) + '<div></div></div></td><td><div>' + datavalue + '</div></td></tr>';
++count;
date = new Date(date.getTime() - (1000 * 60 * 60 * 24)); // Substract one day
}
QH('p30html2', '<table style="color:black;background-color:#EEE;border-color:#AAA;border-width:1px;border-style:solid;border-collapse:collapse" border=0 cellpadding=2 cellspacing=0 width=100%><tbody><tr style=background-color:#AAAAAA;font-weight:bold><th scope=col style=text-align:center;width:150px>Day</th><th scope=col style=text-align:center>7 Day Login State</th></tr>' + x + '</tbody></table>');
}
//
// MY USERS EVENTS
//
var currentUserEvents = null;
function userEventsUpdate() {
var x = '', dateHeader = null;
for (var i in currentUserEvents) {
var event = currentUserEvents[i], time = new Date(event.time);
if (event.msg) {
if (event.h == null) { event.h = Math.random(); }
if (printDate(time) != dateHeader) {
if (dateHeader != null) x += '</table>';
dateHeader = printDate(time);
x += '<table class=p3eventsTable cellpadding=0 cellspacing=0><tr><td colspan=4 class=DevSt>' + dateHeader + '</td></tr>';
}
var icon = 'si3';
if (event.etype == 'user') icon = 'm2';
if (event.etype == 'server') icon = 'si3';
var msg = EscapeHtml(event.msg).split('(R)').join('&reg;');
if (event.nodeid) {
var node = getNodeFromId(event.nodeid);
if (node != null) {
icon = 'si' + node.icon;
msg = '<a href=# onclick=\'gotoDevice("' + event.nodeid + '",10);haltEvent(event);\'>' + EscapeHtml(node.name) + '</a> &rarr; ' + msg;
}
}
if (event.username && (event.username != currentUser.name)) {
if ((userinfo.siteadmin & 2) && (event.userid)) {
msg = '<a href=# onclick=\'gotoUser("' + encodeURIComponent(event.userid) + '");haltEvent(event);\'>' + EscapeHtml(event.username) + '</a> &rarr; ' + msg;
} else {
msg = EscapeHtml(event.username) + ' &rarr; ' + msg;
}
}
if (event.etype == 'relay' || event.action == 'relaylog') icon = 'relayIcon16';
x += '<tr onclick=showEventDetails(' + event.h + ',3) onmouseover=eventMouseHover(this,1) onmouseout=eventMouseHover(this,0) style=cursor:pointer><td style=width:18px><div class=' + icon + '></div></td><td class=g1>&nbsp;</td><td class=style10>' + printTime(time) + ' - ' + msg + '</td><td class=g2>&nbsp;</td></tr><tr style=height:2px></tr>';
}
}
if (dateHeader != null) x += '</table>';
if (x == '') x = '<br><i>' + "Geen gebeurtenissen gevonden" + '</i><br><br>';
QH('p31events', x);
}
function refreshUsersEvents() {
meshserver.send({ action: 'events', limit: parseInt(p31limitdropdown.value), user: currentUser.name });
}
//
// FILE SELECTOR, DIALOG 3
//
function d3init() {
Q('d3localFile').value = '';
d3modechange();
}
function d3modechange() {
var mode = Q('d3uploadMode').value;
QV('d3localmode', mode == 1);
QV('d3servermode', mode == 2);
if (mode == 1) { d3setActions(); } else { d3updatefiles(); }
}
var d3filetreelinkpath;
var d3filetreelocation = [];
function d3updatefiles() {
if (Q('d3uploadMode').value == 1) return;
var html1 = '', html2 = '', filetreex = filetree, folderdepth = 1;
// Navigate to path location, build the paths at the same time
var d3filetreelocation2 = [], oldlinkpath = d3filetreelinkpath, checkedBoxes = [], checkboxes = document.getElementsByName('fc');
for (var i = 0; i < checkboxes.length; i++) { if (checkboxes[i].checked) { checkedBoxes.push(checkboxes[i].value) }; } // Save all existing checked boxes
d3filetreelinkpath = '';
for (var i in d3filetreelocation) {
if ((filetreex.f != null) && (filetreex.f[d3filetreelocation[i]] != null)) {
d3filetreelocation2.push(d3filetreelocation[i]);
if ((folderdepth == 1)) {
var sp = d3filetreelocation[i].split('/');
publicPath = window.location + sp[0] + 'files/' + sp[2];
if (d3filetreelocation[i] === userinfo._id) { d3filetreelinkpath += 'self'; } else { d3filetreelinkpath += (sp[0] + '/' + sp[2]); }
} else {
if (d3filetreelinkpath != '') { d3filetreelinkpath += '/' + d3filetreelocation[i]; if (folderdepth > 2) { publicPath += '/' + d3filetreelocation[i]; } }
}
filetreex = filetreex.f[d3filetreelocation[i]];
folderdepth++;
} else {
break;
}
}
d3filetreelocation = d3filetreelocation2; // In case we could not go down the full path, we set the new path location here.
// Sort the files
var filetreexx = p5sort_files(filetreex.f);
// Display all files and folders at this location
for (var i in filetreexx) {
// Figure out the name and shortname
var f = filetreexx[i], name = f.n, shortname;
shortname = name;
if (name.length > 70) { shortname = '<span title="' + EscapeHtml(name) + '">' + EscapeHtml(name.substring(0, 70)) + ("..." + '</span>'); } else { shortname = EscapeHtml(name); }
name = EscapeHtml(name);
// Figure out the size
var fsize = '';
if (f.s != null) { fsize = getFileSizeStr(f.s); }
var h = '';
if (f.t < 3) {
var title = '';
h = '<div class=filelist file=999><span style=float:right title=\"' + title + '\"></span><span><div class=fileIcon' + f.t + ' onclick=d3folderset(\"' + encodeURIComponent(f.nx) + '\")></div>&nbsp;<a href=# style=cursor:pointer onclick=\'return d3folderset(\"' + encodeURIComponent(f.nx) + '\")\'>' + shortname + '</a></span></div>';
} else {
var link = shortname;
//if (f.s > 0) { link = "<a rel=\"noreferrer noopener\" target=\"_blank\" href=\"downloadfile.ashx?link=" + encodeURIComponent(filetreelinkpath + '/' + f.nx) + "\">" + shortname + "</a>"; }
h = '<div class=filelist file=3><input style=float:left name=fcx class=fcb type=checkbox onchange=d3setActions() value="' + f.nx + '">&nbsp;<span style=float:right>' + fsize + '</span><span><div class=fileIcon' + f.t + '></div>' + link + '</span></div>';
}
if (f.t < 3) { html1 += h; } else { html2 += h; }
}
QH('d3serverfiles', html1 + html2);
QE('p3FolderUp', d3filetreelocation.length > 0);
d3setActions();
}
function d3folderset(x) { d3filetreelocation.push(decodeURIComponent(x)); d3updatefiles(); return false; }
function d3folderup(x) { if (x == null) { d3filetreelocation.pop(); } else { while (d3filetreelocation.length > x) { d3filetreelocation.pop(); } } d3updatefiles(); }
function d3getFileSel() { var cc = []; var checkboxes = document.getElementsByName('fcx'); for (var i = 0; i < checkboxes.length; i++) { if (checkboxes[i].checked) { cc.push(checkboxes[i].value) } } return cc; }
function d3setActions() {
var mode = Q('d3uploadMode').value;
if (mode == 1) {
QE('idx_dlgOkButton', Q('d3localFile').value.length > 0);
} else {
QE('idx_dlgOkButton', d3getFileSel().length == 1);
}
}
//
// NOTIFICATIONS
//
var notifications = [];
// Toggle showing notifications
function clickNotificationIcon(show) {
//addNotification({ icon:0, text:'test' });
if (show == true) { QV('notifiyBox', true); } else if (show == false) { QV('notifiyBox', false); } else { QV('notifiyBox', QS('notifiyBox')['display'] == 'none'); }
drawNotifications();
}
// Set the notification count on the upper right oft he screen
function setNotificationCount(c) {
if (parseInt(Q('notificationCount').innerHTML) == c) return; // If the count did not change, exit now.
QH('notificationCount', c);
QS('notificationCount')['background-color'] = (c == 0)?'lightblue':'orange';
QV('notificationCount', c > 0);
}
// Refresh the notification box
function drawNotifications() {
var notifySettings = getstore('notifications', 0);
var r = '';
if (notifications.length == 0) {
r = '<div style=margin:5px>' + "Er zijn momenteel geen meldingen" + '</div>';
} else {
for (var i in notifications) {
var n = notifications[i], t = '', d = new Date(n.time), icon = 0;
if (n.title != null) { t = '<b>' + n.title + '</b>: ' }
if (n.nodeid != null) {
var node = getNodeFromId(n.nodeid);
if (node != null) {
icon = node.icon;
if (notifySettings & 16) { t = '<b>' + meshes[node.meshid].name + ' / ' + node.name + '</b>: '; } else { t = '<b>' + node.name + '</b>: '; } // Display with or without group name
}
}
r += '<div title="' + format("Heeft plaatsgevonden op {0}", printDateTime(d)) + '" id="notifyx' + n.id + '" class=notification style="cursor:pointer;border-top:1px solid ' + ((r == '') ? 'transparent' : 'orange') + '">';
if (icon) { r += '<div class=j' + icon + ' onclick="notificationSelected(' + n.id + ')" style=margin:5px;float:left></div>'; }
r += '<div onclick="notificationDelete(' + n.id + ')" class=unselectable title="Clear this notification" style=margin:5px;float:right;color:orange><b>X</b></div><div onclick="notificationSelected(' + n.id + ')" style=margin:5px>' + t + n.text + '</div></div>';
}
}
var deleteall = '';
if (notifications.length > 1) { deleteall = '<div id="notifyRemoveAll" onclick="deleteAllNotifications()" style="cursor:pointer;border-top:1px solid orange;margin:5px;color:orange;text-align:right;padding-right:3px">Clear all</div>'; }
QH('notifiyBox', '<div class=customScroll style="max-height:170px;overflow-y:auto;margin:5px">' + r + '</div>' + deleteall );
}
// A notification was selected
function notificationSelected(id, del) {
var j = -1;
for (var i in notifications) { if (notifications[i].id == id) { j = i; } }
if (j != -1) {
notificationSelectedEx(notifications[j], id);
if (del && notifications[j]) {
if (notifications[j].notification) { notifications[j].notification.close(); delete notifications[j].notification; }
notificationDelete(id);
}
}
}
function notificationSelectedEx(n, id) {
if (n.nodeid != null) {
if (n.tag == 'desktop') gotoDevice(n.nodeid, 12); // Desktop
else if (n.tag == 'terminal') gotoDevice(n.nodeid, 11); // Terminal
else if (n.tag == 'files') gotoDevice(n.nodeid, 13); // Files
else if (n.tag == 'intelamt') gotoDevice(n.nodeid, 14); // Intel AMT
else if (n.tag == 'console') gotoDevice(n.nodeid, 15); // Files
else gotoDevice(n.nodeid, 10); // General
} else {
if ((n.tag != null) && n.tag.startsWith('meshmessenger/')) {
window.open('/messenger?id=' + n.tag + '&title=' + encodeURIComponent(n.username), n.tag.split('/')[2]);
notificationDelete(id);
}
}
}
// Remove one notification
function notificationDelete(id) {
var j = -1, e = Q('notifyx' + id);
if (e != null) {
for (var i in notifications) { if (notifications[i].id == id) { j = i; } }
if (j != -1) {
if (notifications[j].notification) { notifications[j].notification.close(); delete notifications[j].notification; }
notifications.splice(j, 1);
e.parentNode.removeChild(e);
setNotificationCount(notifications.length);
if (notifications.length == 0) { QV('notifiyBox', false); }
if (notifications.length == 1) { QV('notifyRemoveAll', false); }
if ((notifications.length > 0) && (j == 0)) {
var n = notifications[0];
QS('notifyx' + n.id)['border-top'] = '1px solid transparent';
}
}
}
}
// Add a new notification and play the notification sound
function addNotification(n) {
// Show notification within the web page.
if (n.time == null) { n.time = Date.now(); }
if (n.id == null) { n.id = Math.random(); }
notifications.unshift(n);
setNotificationCount(notifications.length);
clickNotificationIcon(true);
var notifySettings = getstore('notifications', 0);
if (notifySettings & 1) { Q('chimes').play(); }
// If web notifications are granted, use it.
var notification = null;
if (Notification && (Notification.permission == 'granted')) {
var text = n.text.split('&reg;').join('').split('<b>').join('').split('</b>').join('').split('<br />').join('\r\n'); // Clean up any HTML codes
if (n.nodeid) {
var node = getNodeFromId(n.nodeid);
if (node) {
if (notifySettings & 16) { // Notify with group name
notification = new Notification('{{{title}}} - ' + meshes[node.meshid].name + ' - ' + node.name, { tag: n.tag, body: text, icon: '/images/notify/icons128-' + node.icon + '.png' });
} else {
notification = new Notification('{{{title}}} - ' + node.name, { tag: n.tag, body: text, icon: '/images/notify/icons128-' + node.icon + '.png' });
}
}
} else {
if (n.icon == null) { n.icon = 0; }
var title = n.title;
if (title == null) { title = ''; } else { title = ' - ' + n.title; }
notification = new Notification('{{{title}}}' + title, { tag: n.tag, body: text, icon: '/images/notify/icons128-' + n.icon + '.png' });
}
notification.id = n.id;
notification.xtag = n.tag;
notification.nodeid = n.nodeid;
notification.username = n.username;
notification.onclick = function (e) { notificationSelected(e.target.id, true); }
n.notification = notification;
}
}
// Remove all notifications
function deleteAllNotifications() {
notifications = [];
setNotificationCount(0);
drawNotifications();
QV('notifiyBox', false);
}
//
// MyServer General
//
function setupGeneralServerStats() {
window.serverStatCpu = new Chart(document.getElementById('serverCpuChart').getContext('2d'), {
type: 'doughnut',
data: { datasets: [{ data: [0, 0], backgroundColor: ['#AAAAAA', '#00AA00'] }], labels: ["Gebruikt", "Vrij"] },
options: { responsive: true, legend: { position: 'none', }, animation: { animateScale: true, animateRotate: true }, width: '60px' }
});
window.serverStatMemory = new Chart(document.getElementById('serverMemoryChart').getContext('2d'), {
type: 'doughnut',
data: { datasets: [{ data: [0, 0], backgroundColor: ['#AAAAAA', '#00AA00'] }], labels: ["Gebruikt", "Vrij"] },
options: { responsive: true, legend: { position: 'none', }, animation: { animateScale: true, animateRotate: true }, width: '60px' }
});
}
var lastServerStats = null;
function updateGeneralServerStats(message) {
if (message != null) { lastServerStats = message; } else { message = lastServerStats; }
if (message == null) return;
// Paint the pie graphs
if (typeof message.cpuavg == 'object') {
var m = Math.min(message.cpuavg[0], 1);
window.serverStatCpu.config.data.datasets[0].data = [m, 1 - m];
QH('serverCpuChartText', '<div style=margin-bottom:5px>CPU Load</div><div><b title=\"' + "CPU-belasting in de laatste minuut" + '\">' + (Math.round(message.cpuavg[0] * 100.0) / 100.0) + '</b>, <b title=\"' + "CPU-belasting in de afgelopen 5 minuten" + '\">' + (Math.round(message.cpuavg[1] * 100.0) / 100.0) + '</b>, <b title=\"' + "CPU-belasting in de afgelopen 15 minuten" + '\">' + (Math.round(message.cpuavg[2] * 100.0) / 100.0) + '</b></div>');
QS('serverCpuChartView')['display'] = 'inline-block';
window.serverStatCpu.update();
}
if ((typeof message.totalmem == 'number') && (typeof message.freemem == 'number')) {
window.serverStatMemory.config.data.datasets[0].data = [message.totalmem - message.freemem, message.freemem];
QH('serverMemoryChartText', '<div style=margin-bottom:5px>' + "Geheugen" + '</div><div><b>' + getNiceSize2(message.freemem) + '</b> ' + "vrij" + ', <b>' + getNiceSize2(message.totalmem) + '</b> ' + "totaal" + '</div>');
QS('serverMemoryChartView')['display'] = 'inline-block';
window.serverStatMemory.update();
}
// Display all of the server values
var x = '<div style=width:100% cellpadding=0 cellspacing=0>';
if (typeof message.values == 'object') {
for (var i in message.values) {
x += '<div class=userTableHeader style=margin-bottom:4px;width:200px>' + i + '</div>';
for (var j in message.values[i]) {
x += '<div style=display:inline-block><table class=serverStateTableCell><tr><td class=h1></td><td><span>' + j + '</span><span style=float:right>' + message.values[i][j] + '</span></td><td class=h2></td></tr></table></div>';
}
}
}
x += '</div>';
QH('serverStatsTable', x);
}
//
// MyServer Stats
//
var serverTimelineStats = null;
var serverTimelineConfig = {
type: 'line',
data: { labels: [], datasets: [{ label: '', backgroundColor: 'rgba(255, 99, 132, .5)', borderColor: 'rgb(255, 99, 132)', data: [], fill: true }] },
options: {
responsive: true,
maintainAspectRatio: false,
elements: { line: { cubicInterpolationMode: 'monotone' } },
scales: {
xAxes: [{ type: 'time', time: { tooltipFormat: 'll HH:mm' }, display: true, scaleLabel: { display: false, labelString: '' } }],
yAxes: [{ type: 'linear', display: true, scaleLabel: { display: true, labelString: '' } }]
}
}
};
function refreshServerTimelineStats(stats) { meshserver.send({ action: 'servertimelinestats', hours: 24 * 30 }); }
function pastDate(hours) { var t = new Date(); t.setTime(t.getTime() - (60 * 60 * 1000 * hours)); return t; }
function setServerTimelineStats(stats) { serverTimelineStats = stats; updateServerTimelineStats(); }
function addServerTimelineStats(stats) {
if (serverTimelineStats == null) return;
serverTimelineStats.push(stats);
var chartType = Q('p40type').value;
if (chartType == 0) {
serverTimelineConfig.data.datasets[0].data.push({ x: stats.time, y: stats.conn.ca });
serverTimelineConfig.data.datasets[1].data.push({ x: stats.time, y: stats.conn.cu });
serverTimelineConfig.data.datasets[2].data.push({ x: stats.time, y: stats.conn.us });
serverTimelineConfig.data.datasets[3].data.push({ x: stats.time, y: stats.conn.rs });
if (stats.conn.am != null) { serverTimelineConfig.data.datasets[4].data.push({ x: stats.time, y: stats.conn.am }); }
} else if (chartType == 1) {
serverTimelineConfig.data.datasets[0].data.push({ x: stats.time, y: stats.mem.external / (1024 * 1024) });
serverTimelineConfig.data.datasets[1].data.push({ x: stats.time, y: stats.mem.heapUsed / (1024 * 1024) });
serverTimelineConfig.data.datasets[2].data.push({ x: stats.time, y: stats.mem.heapTotal / (1024 * 1024) });
serverTimelineConfig.data.datasets[3].data.push({ x: stats.time, y: stats.mem.rss / (1024 * 1024) });
} /* else if (chartType == 2) {
serverTimelineConfig.data.datasets[0].data.push({ x: stats.time, y: stats.db.meshes });
serverTimelineConfig.data.datasets[1].data.push({ x: stats.time, y: stats.db.nodes });
serverTimelineConfig.data.datasets[2].data.push({ x: stats.time, y: stats.db.users });
serverTimelineConfig.data.datasets[3].data.push({ x: stats.time, y: stats.db.total });
} */
updateServerTimelineHours();
}
function updateServerTimelineHours() {
serverTimelineConfig.options.scales.yAxes[0].type = (Q('p40log').checked ? 'logarithmic' : 'linear');
serverTimelineConfig.options.scales.xAxes[0].time = { min: pastDate(Q('p40time').value) };
window.serverMainStats.update();
}
function setupServerTimelineStats() { window.serverMainStats = new Chart(document.getElementById('serverMainStats').getContext('2d'), serverTimelineConfig); }
function updateServerTimelineStats() {
var data, chartType = Q('p40type').value, timeAfter = pastDate(Q('p40time').value);
serverTimelineConfig.options.scales.xAxes[0].time = { min: timeAfter };
if (chartType == 0) { // Connections
serverTimelineConfig.options.scales.yAxes[0].scaleLabel.labelString = "Aantal verbindingen";
data = {
labels: [pastDate(0), timeAfter],
datasets: [
{ label: "Agents", data: [], backgroundColor: 'rgba(158, 151, 16, .1)', borderColor: 'rgb(158, 151, 16)', fill: true },
{ label: "Gebruikers", data: [], backgroundColor: 'rgba(16, 84, 158, .1)', borderColor: 'rgb(16, 84, 158)', fill: true },
{ label: "Gebruikerssessie", data: [], backgroundColor: 'rgba(255, 99, 132, .1)', borderColor: 'rgb(255, 99, 132)', fill: true },
{ label: "Relay Sessies", data: [], backgroundColor: 'rgba(39, 158, 16, .1)', borderColor: 'rgb(39, 158, 16)', fill: true },
{ label: "Intel AMT", data: [], backgroundColor: 'rgba(134, 16, 158, .1)', borderColor: 'rgb(134, 16, 158)', fill: true }
]
};
for (var i = 0; i < serverTimelineStats.length; i++) {
var t = new Date(serverTimelineStats[i].time);
if (serverTimelineStats[i].conn) {
data.datasets[0].data.push({ x: serverTimelineStats[i].time, y: serverTimelineStats[i].conn.ca });
data.datasets[1].data.push({ x: serverTimelineStats[i].time, y: serverTimelineStats[i].conn.cu });
data.datasets[2].data.push({ x: serverTimelineStats[i].time, y: serverTimelineStats[i].conn.us });
data.datasets[3].data.push({ x: serverTimelineStats[i].time, y: serverTimelineStats[i].conn.rs });
if (serverTimelineStats[i].conn.am != null) { data.datasets[4].data.push({ x: serverTimelineStats[i].time, y: serverTimelineStats[i].conn.am }); }
}
}
} else if (chartType == 1) { // Memory
serverTimelineConfig.options.scales.yAxes[0].scaleLabel.labelString = "Megabytes";
data = {
labels: [pastDate(0), timeAfter],
datasets: [
{ label: 'External', data: [], backgroundColor: 'rgba(158, 151, 16, .1)', borderColor: 'rgb(158, 151, 16)', fill: true },
{ label: 'Heap Used', data: [], backgroundColor: 'rgba(16, 84, 158, .1)', borderColor: 'rgb(16, 84, 158)', fill: true },
{ label: 'Heap Total', data: [], backgroundColor: 'rgba(255, 99, 132, .1)', borderColor: 'rgb(255, 99, 132)', fill: true },
{ label: 'RSS', data: [], backgroundColor: 'rgba(39, 158, 16, .1)', borderColor: 'rgb(39, 158, 16)', fill: true }
]
};
for (var i = 0; i < serverTimelineStats.length; i++) {
data.datasets[0].data.push({ x: serverTimelineStats[i].time, y: serverTimelineStats[i].mem.external / (1024 * 1024) });
data.datasets[1].data.push({ x: serverTimelineStats[i].time, y: serverTimelineStats[i].mem.heapUsed / (1024 * 1024) });
data.datasets[2].data.push({ x: serverTimelineStats[i].time, y: serverTimelineStats[i].mem.heapTotal / (1024 * 1024) });
data.datasets[3].data.push({ x: serverTimelineStats[i].time, y: serverTimelineStats[i].mem.rss / (1024 * 1024) });
}
} /*else if (chartType == 2) { // Database
serverTimelineConfig.options.scales.yAxes[0].scaleLabel.labelString = 'Records';
data = {
labels: [pastDate(0), timeAfter],
datasets: [
{ label: 'Groups', data: [], backgroundColor: 'rgba(158, 151, 16, .1)', borderColor: 'rgb(158, 151, 16)', fill: true },
{ label: 'Devices', data: [], backgroundColor: 'rgba(16, 84, 158, .1)', borderColor: 'rgb(16, 84, 158)', fill: true },
{ label: 'Users', data: [], backgroundColor: 'rgba(255, 99, 132, .1)', borderColor: 'rgb(255, 99, 132)', fill: true },
{ label: 'Records', data: [], backgroundColor: 'rgba(39, 158, 16, .1)', borderColor: 'rgb(39, 158, 16)', fill: true }
]
};
for (var i = 0; i < serverTimelineStats.length; i++) {
data.datasets[0].data.push({ x: serverTimelineStats[i].time, y: serverTimelineStats[i].db.meshes });
data.datasets[1].data.push({ x: serverTimelineStats[i].time, y: serverTimelineStats[i].db.nodes });
data.datasets[2].data.push({ x: serverTimelineStats[i].time, y: serverTimelineStats[i].db.users });
data.datasets[3].data.push({ x: serverTimelineStats[i].time, y: serverTimelineStats[i].db.total });
}
}*/
serverTimelineConfig.data = data;
window.serverMainStats.update();
}
function p40downloadEvents() {
var csv = "time, conn.agent, conn.users, conn.usersessions, conn.relaysession, conn.intelamt, mem.external, mem.heapused, mem.heaptotal, mem.rss" + '\r\n';
for (var i = 0; i < serverTimelineStats.length; i++) {
if (serverTimelineStats[i].conn && serverTimelineStats[i].mem) {
csv += new Date(serverTimelineStats[i].time) + ', ' + serverTimelineStats[i].conn.ca + ', ' + serverTimelineStats[i].conn.cu + ', ' + serverTimelineStats[i].conn.us + ', ' + serverTimelineStats[i].conn.rs + ', ' + (serverTimelineStats[i].conn.am ? serverTimelineStats[i].conn.am : '') + ', ' + serverTimelineStats[i].mem.external + ', ' + serverTimelineStats[i].mem.heapUsed + ', ' + serverTimelineStats[i].mem.heapTotal + ', ' + serverTimelineStats[i].mem.rss + '\r\n';
}
}
saveAs(new Blob([csv], { type: 'application/octet-stream' }), "ServerStats.csv");
}
//
// My Server Tracing
//
var serverTrace = [];
var serverTraceSources = [];
function displayServerTrace() {
var x = '', max = parseInt(Q('p41limitdropdown').value);
if (serverTrace.length > max) { serverTrace.splice(max); }
for (var i in serverTrace) { x += '<div class=traceEvent>' + EscapeHtml(new Date(serverTrace[i].time).toLocaleTimeString()) + ' - <b>' + EscapeHtml(serverTrace[i].source.toUpperCase()) + '</b>: ' + EscapeHtml(serverTrace[i].args.join(', ')) + '</div>' }
QH('p41events', x);
}
function clearServerTracing() { serverTrace = []; displayServerTrace(); }
function setServerTracing() {
var x = '';
x += '<div style="width:100%;border-bottom:1px solid gray;margin-bottom:5px;margin-top:5px"><b>' + "Core Server" + '</b></div>';
x += '<div><label><input type=checkbox id=p41c1 ' + ((serverTraceSources.indexOf('cookie') >= 0) ? 'checked' : '') + '>' + "Cookie encoder" + '</label></div>';
x += '<div><label><input type=checkbox id=p41c2 ' + ((serverTraceSources.indexOf('dispatch') >= 0) ? 'checked' : '') + '>' + "Bericht Dispatcher" + '</label></div>';
x += '<div><label><input type=checkbox id=p41c3 ' + ((serverTraceSources.indexOf('main') >= 0) ? 'checked' : '') + '>' + "Hoofdserver berichten" + '</label></div>';
x += '<div><label><input type=checkbox id=p41c4 ' + ((serverTraceSources.indexOf('peer') >= 0) ? 'checked' : '') + '>' + "MeshCentral Server Peering" + '</label></div>';
x += '<div><label><input type=checkbox id=p41c15 ' + ((serverTraceSources.indexOf('agent') >= 0) ? 'checked' : '') + '>' + "MeshAgent verkeer" + '</label></div>';
x += '<div><label><input type=checkbox id=p41c14 ' + ((serverTraceSources.indexOf('agentupdate') >= 0) ? 'checked' : '') + '>' + "MeshAgent update" + '</label></div>';
x += '<div><label><input type=checkbox id=p41c16 ' + ((serverTraceSources.indexOf('cert') >= 0) ? 'checked' : '') + '>' + "Server Certificaat" + '</label></div>';
x += '<div style="width:100%;border-bottom:1px solid gray;margin-bottom:5px;margin-top:5px"><b>' + "webserver" + '</b></div>';
x += '<div><label><input type=checkbox id=p41c5 ' + ((serverTraceSources.indexOf('web') >= 0) ? 'checked' : '') + '>' + "webserver" + '</label></div>';
x += '<div><label><input type=checkbox id=p41c6 ' + ((serverTraceSources.indexOf('webrequest') >= 0) ? 'checked' : '') + '>' + "Webserver Verzoeken" + '</label></div>';
x += '<div><label><input type=checkbox id=p41c7 ' + ((serverTraceSources.indexOf('relay') >= 0) ? 'checked' : '') + '>' + "Web Socket Relay" + '</label></div>';
//x += '<div><label><input type=checkbox id=p41c8 ' + ((serverTraceSources.indexOf('webrelaydata') >= 0) ? 'checked' : '') + '>' + "Traffic Relay 2 Data" + '</label></div>';
x += '<div style="width:100%;border-bottom:1px solid gray;margin-bottom:5px;margin-top:5px"><b>' + "Intel AMT" + '</b></div>';
x += '<div><label><input type=checkbox id=p41c9 ' + ((serverTraceSources.indexOf('webrelay') >= 0) ? 'checked' : '') + '>' + "Verbindings Relay" + '</label></div>';
x += '<div><label><input type=checkbox id=p41c10 ' + ((serverTraceSources.indexOf('mps') >= 0) ? 'checked' : '') + '>' + "CIRA Server" + '</label></div>';
x += '<div><label><input type=checkbox id=p41c11 ' + ((serverTraceSources.indexOf('mpscmd') >= 0) ? 'checked' : '') + '>' + "CIRA Server opdrachten" + '</label></div>';
//x += '<div style="width:100%;border-bottom:1px solid gray;margin-bottom:5px;margin-top:5px"><b>Legacy</b></div>';
//x += '<div><label><input type=checkbox id=p41c12 ' + ((serverTraceSources.indexOf('swarm') >= 0) ? 'checked' : '') + ">' + "Legacy Swarm Server" + '</label></div>";
//x += '<div><label><input type=checkbox id=p41c13 ' + ((serverTraceSources.indexOf('swarmcmd') >= 0) ? 'checked' : '') + ">' + "Legacy Swarm Server Commands" + '</label></div>";
setDialogMode(2, "Server traceren", 7, setServerTracingEx, x);
}
function setServerTracingEx(b) {
var sources = [], allsources = ['cookie', 'dispatch', 'main', 'peer', 'web', 'webrequest', 'relay', 'webrelaydata', 'webrelay', 'mps', 'mpscmd', 'swarm', 'swarmcmd', 'agentupdate', 'agent', 'cert'];
if (b == 1) { for (var i = 1; i < 17; i++) { try { if (Q('p41c' + i).checked) { sources.push(allsources[i - 1]); } } catch (ex) { } } }
meshserver.send({ action: 'traceinfo', traceSources: sources });
}
function p41downloadServerTrace() {
var csv = "time, source, message" + '\r\n';
for (var i in serverTrace) { csv += '\"' + new Date(serverTrace[i].time).toLocaleTimeString() + '\",\"' + serverTrace[i].source + '\",\"' + serverTrace[i].args.join(', ') + '\"\r\n'; }
saveAs(new Blob([csv], { type: 'application/octet-stream' }), "servertrace.csv");
return false;
}
//
// POPUP DIALOG
//
// null = Hidden, 1 = Generic Message
var xxdialogMode;
var xxdialogFunc;
var xxdialogButtons;
var xxdialogTag;
var xxcurrentView = -1;
// Display a dialog box
// Parameters: Dialog Mode (0 = none), Dialog Title, Buttons (1 = OK, 2 = Cancel, 3 = OK & Cancel), Call back function(0 = Cancel, 1 = OK), Dialog Content (Mode 2 only)
function setDialogMode(x, y, b, f, c, tag) {
setSessionActivity();
QV('uiMenu', false);
xxdialogMode = x;
xxdialogFunc = f;
xxdialogButtons = b;
xxdialogTag = tag;
// Reset dialog size
QS('dialog').width = QS('dialog').top = QS('dialog').left = QS('dialog').right = QS('dialog').bottom = null;
QE('idx_dlgOkButton', true);
QV('idx_dlgOkButton', b & 1);
QV('idx_dlgCancelButton', b & 2);
QV('id_dialogclose', (b & 2) || (b & 8));
QV('idx_dlgDeleteButton', b & 4);
QV('idx_dlgButtonBar', b & 7);
if (y) QH('id_dialogtitle', y);
for (var i = 1; i < 24; i++) { QV('dialog' + i, i == x); } // Edit this line when more dialogs are added
QV('dialog', x);
if (c) { if (x == 2) { QH('id_dialogOptions', c); } else { QH('id_dialogMessage', c); } }
}
function dialogclose(x) {
setSessionActivity();
var f = xxdialogFunc, b = xxdialogButtons, t = xxdialogTag;
setDialogMode();
if (((b & 8) || x) && f) f(x, t);
}
function center() {
setSessionActivity();
if (xxcurrentView == 11) { deskAdjust(); }
else if (xxcurrentView == 10) { masterUpdate(256); }
else if (xxcurrentView == 1) { masterUpdate(4); }
}
function messagebox(t, m) { setSessionActivity(); QH('id_dialogMessage', m); setDialogMode(1, t, 1); }
function statusbox(t, m) { setSessionActivity(); QH('id_dialogMessage', m); setDialogMode(1, t); }
function goBack() {
setSessionActivity();
if (xxdialogMode) return;
if (fullscreen) { deskToggleFull(); }
if ((xxcurrentView >= 10) && (xxcurrentView < 20)) { go(1); } // Return to My Devices
if ((xxcurrentView >= 20) && (xxcurrentView < 30)) { go(2); } // Return to My Account
if ((xxcurrentView >= 30) && (xxcurrentView < 40)) { go(4); } // Return to My Users
}
function go(x, event) {
setSessionActivity();
if (xxdialogMode) return;
QV('uiMenu', false);
// If "shift" is pressed, open a new tab.
if (event && (event.shiftKey == true) && (x != 15) && ('{{currentNode}}' == '')) {
// Open the device in a different tab
if ((x >= 10) && (x <= 19)) {
if (currentNode) { window.open(window.location.origin + '?node=' + currentNode._id.split('/')[2] + '&viewmode=' + x + '&hide=16', 'meshcentral:' + currentNode._id); }
} else if (x < 10) {
window.open(window.location.origin + '?viewmode=' + x + '&hide=0', 'meshcentral:' + x);
}
return;
}
if (xxcurrentView == x) return;
// Edit this line when adding a new screen
for (var i = 0; i < 44; i++) { QV('p' + i, i == x); }
xxcurrentView = x;
// Remove top bar selection
var mainBarItems = ['MainMenuMyDevices', 'MainMenuMyAccount', 'MainMenuMyEvents', 'MainMenuMyFiles', 'MainMenuMyUsers', 'MainMenuMyServer'];
for (var i in mainBarItems) {
QC(mainBarItems[i]).remove('fullselect');
QC(mainBarItems[i]).remove('semiselect');
}
// Remove left bar selection
var leftBarItems = ['LeftMenuMyDevices', 'LeftMenuMyAccount', 'LeftMenuMyEvents', 'LeftMenuMyFiles', 'LeftMenuMyUsers', 'LeftMenuMyServer'];
for (var i in leftBarItems) {
QC(leftBarItems[i]).remove('lbbuttonsel');
QC(leftBarItems[i]).remove('lbbuttonsel2');
}
// Define class for Menu(s) as fully or semi active.
var mainMenuActiveClass = (x < 9 ? 'fullselect' : 'semiselect');
var leftMenuActiveClass = (((x < 9) || (x == 115) || (x == 40) || (x == 41) || (x == 42)) ? 'lbbuttonsel2' : 'lbbuttonsel');
// My Devices
if (x == 1 || (x >= 10 && x < 20)) QC('MainMenuMyDevices').add(mainMenuActiveClass);
if (x == 1 || (x >= 10 && x < 20)) QC('LeftMenuMyDevices').add(leftMenuActiveClass);
// My Account
if (x == 2 || (x >= 20 && x < 30)) QC('MainMenuMyAccount').add(mainMenuActiveClass);
if (x == 2 || (x >= 20 && x < 30)) QC('LeftMenuMyAccount').add(leftMenuActiveClass);
// My Events
if (x == 3) QC('MainMenuMyEvents').add(mainMenuActiveClass);
if (x == 3) QC('LeftMenuMyEvents').add(leftMenuActiveClass);
// My Users
if (x == 4 || (x >= 30 && x < 40)) QC('MainMenuMyUsers').add(mainMenuActiveClass);
if (x == 4 || (x >= 30 && x < 40)) QC('LeftMenuMyUsers').add(leftMenuActiveClass);
// My Files
if (x == 5) QC('MainMenuMyFiles').add(mainMenuActiveClass);
if (x == 5) QC('LeftMenuMyFiles').add(leftMenuActiveClass);
// My Server
if ((x == 6) || (x == 115)) QC('MainMenuMyServer').add(mainMenuActiveClass);
if ((x == 6) || (x == 115) || (x == 40) || (x == 41) || (x == 42) || (x == 43)) QC('LeftMenuMyServer').add(leftMenuActiveClass);
QV('ServerPlugins', pluginHandler != null);
// column_l max-height
if (webPageStackMenu && (x >= 10)) { QC('column_l').add('room4submenu'); } else { QC('column_l').remove('room4submenu'); }
// If we are going to panel 0 in "full screen mode", hide the left bar.
QV('topbar', x != 0);
if ((x == 0) && (webPageFullScreen)) { QC('body').add('arg_hide'); }
QV('MainSubMenuSpan', x >= 10 && x < 20);
QV('UserDummyMenuSpan', (x < 10) && (x != 6) && webPageFullScreen);
QV('MeshSubMenuSpan', x >= 20 && x < 30);
QV('UserSubMenuSpan', x >= 30 && x < 40);
QV('ServerSubMenuSpan', x == 6 || x == 115 || x == 40 || x == 41 || x == 42 || x == 43);
var panels = { 10: 'MainDev', 11: 'MainDevDesktop', 12: 'MainDevTerminal', 13: 'MainDevFiles', 14: 'MainDevAmt', 15: 'MainDevConsole', 16: 'MainDevEvents', 17: 'MainDevInfo', 19: 'MainDevPlugins', 20: 'MeshGeneral', 21: 'MeshSummary', 30: 'UserGeneral', 31: 'UserEvents', 6: 'ServerGeneral', 40: 'ServerStats', 41: 'ServerTrace', 42: 'ServerPlugins', 115: 'ServerConsole' };
for (var i in panels) {
QC(panels[i]).remove('style3x');
QC(panels[i]).remove('style3sel');
QC(panels[i]).add((x == i) ? 'style3sel' : 'style3x');
}
// If going to the remote desktop tab, adjust the tab.
if (x == 11) { deskAdjust(); }
// Panel 115 is weird, it's panel 15 for device console but used as a server console.
if (x == 115) { QV('p15', true); }
QV('p15uploadCore', x != 115);
QV('p15BackButton', x != 115);
if ((x == 15) || (x == 115)) { setupConsole(); }
if (x == 1) masterUpdate(4);
// Setup web notifications
if ((x == 2) && Notification) { QV('accountEnableNotificationsSpan', Notification.permission != 'granted'); }
// Fetch the server timeline stats if needed
if ((x == 40) && (serverTimelineStats == null)) { refreshServerTimelineStats(); }
// MyServer Plugins
if (x == 42) { refreshPluginLatest(); }
// Update Mesh Summary
if (x == 21) { p21updateMesh(); }
// Update the web page title
if ((currentNode) && (x >= 10) && (x < 20)) {
document.title = decodeURIComponent('{{{extitle}}}') + ' - ' + currentNode.name + ' - ' + meshes[currentNode.meshid].name;
} else {
document.title = decodeURIComponent('{{{extitle}}}');
}
}
//
// Plugin Management
//
function updatePluginList(versInfo) {
if (pluginHandler == null) return;
if (Array.isArray(versInfo)) { versInfo.forEach(function(v) { updatePluginList(v); }); }
QV('pluginNoneNotice', installedPluginList.length == 0);
if (installedPluginList.length) {
if (versInfo != null) {
if (installedPluginList['version_info'] == null) installedPluginList['version_info'] = [];
installedPluginList['version_info'][versInfo.id] = versInfo;
}
var tr = Q('p42tbl').querySelectorAll('.p42tblRow');
if (tr.length) {
for (var i in Object.values(tr)) {
tr[i].parentNode.removeChild(tr[i]);
}
}
var statusMap = {
0: {
'text': 'Disabled',
'color': '858483'
},
1: {
'text': 'Installed',
'color': '00aa00'
}
};
var statusAvailability = {
0: {
'install': 'Install',
'delete': 'Delete'
},
1: {
'disable': 'Disable',
'upgrade': 'Upgrade',
// 'downgrade': 'Downgrade' // disabling until plugins have prior versions available for better testing
}
};
var vers_not_compat = ' [ <span onclick="return setDialogMode(2, \'Compatibility Issue\', 1, null, \'This plugin version is not compatible with your MeshCentral installation, please upgrade MeshCentral first.\');" title="Version incompatible, please upgrade your MeshCentral installation first" style="cursor: pointer; color:red;"> ! </span> ]';
var tbl = Q('p42tbl');
installedPluginList.forEach(function(p){
var cant_action = [];
if (p.hasAdminPanel == true && p.status) {
p.nameHtml = '<a onclick="return goPlugin(\'' + p.shortName + '\', \'' + p.name.replace(/'/g, "\\'") + '\');">' + p.name + '</a>';
} else {
p.nameHtml = p.name;
}
p.statusText = statusMap[p.status].text;
p.statusColor = statusMap[p.status].color;
if (p.versionHistoryUrl == null) { cant_action.push('downgrade'); }
if (!p.status) { p.version = ' - '; } // It isn't technically installed, so no version number
p.upgradeAvail = "Controleren...";
if (installedPluginList['version_info'] != null && installedPluginList['version_info'][p._id] != null) {
var vin = installedPluginList['version_info'][p._id];
if (vin.hasUpdate) {
p.upgradeAvail = '<a title="View Changelog" target="_blank" href="' + vin.changelogUrl + '">' + vin.version + '</a>';
} else {
cant_action.push('upgrade');
if (p.status) p.upgradeAvail = "Bijgewerkt";
else p.upgradeAvail = '<a title="View Changelog" target="_blank" href="' + vin.changelogUrl + '">' + vin.version + '</a>';
}
if (!vin.meshCentralCompat) {
p.upgradeAvail += vers_not_compat;
cant_action.push('install');
cant_action.push('upgrade');
}
}
p.actions = '<select onchange="return pluginAction(this,\'' + p._id + '\');"><option value=""> --</option>';
var entries = Object.entries(statusAvailability[p.status]);
for (var k in entries) {
if (cant_action.indexOf(entries[k][0]) === -1) {
p.actions += '<option value="' + entries[k][0] + '">' + entries[k][1] + '</option>';
}
}
p.actions += '</select>';
let tpl = '<td><img style=margin-top:3px src=images/plugin24.png></td><td class=gradTable1>&nbsp;</td><td class=gradTable2>' + p.nameHtml + '</td><td class=gradTable2>' + p.description + '</td><td class=gradTable2 style=text-align:center><a href="' + p.homepage + '" target="_blank">Home</a></td><td class=gradTable2 style=text-align:center>' + p.version + '</td><td style=text-align:center class="pluginUpgradeAvailable gradTable2">' + p.upgradeAvail + '</td><td class=gradTable2 style="text-align:center;color:#' + p.statusColor + '">' + p.statusText + '</td><td class="pluginAction gradTable2" style=text-align:center>' + p.actions + '</td><td class=gradTable3>&nbsp;</td>';
let tr = tbl.insertRow(-1);
tr.innerHTML = tpl;
tr.classList.add('p42tblRow');
tr.setAttribute('data-id', p._id);
tr.setAttribute('id', 'pluginRow-' + p._id);
});
} else {
var tr = Q('p42tbl').querySelectorAll('.p42tblRow');
for (var i in Object.values(tr)) { tr[i].parentNode.removeChild(tr[i]); }
}
if (versInfo == null) refreshPluginLatest();
}
function refreshPluginLatest() {
if (pluginHandler == null) return;
meshserver.send({ action: 'pluginLatestCheck' });
}
function distributeCore() {
if (pluginHandler == null) return;
meshserver.send({ action: 'distributeCore', nodes: nodes }); // All nodes the user has access to
QV('pluginRestartNotice', false);
}
function pluginActionEx() {
if (pluginHandler == null) return;
var act = Q('lastPluginAct').value, id = Q('lastPluginId').value, pVersUrl = Q('lastPluginVersion').value;
switch(act) {
case 'upgrade':
case 'install':
meshserver.send({ 'action': 'installplugin', 'id': id, 'version_only': false });
break;
case 'downgrade':
Q('lastPluginVersion').querySelectorAll('option').forEach(function(opt) {
if (opt.value == pVersUrl) pVers = opt.text;
});
meshserver.send({ 'action': 'installplugin', 'id': id, 'version_only': { 'name': pVers, 'url': pVersUrl }});
break;
case 'delete':
meshserver.send({ 'action': 'removeplugin', 'id': id });
break;
case 'disable':
meshserver.send({ 'action': 'disableplugin', 'id': id });
break;
}
QV('pluginRestartNotice', true);
}
function pluginAction(elem, id) {
if (pluginHandler == null) return;
if (elem.value == 'downgrade') {
meshserver.send({ 'action': 'getpluginversions', 'id': id });
} else {
var plugin = null;
for (var i in installedPluginList) { if (installedPluginList[i]._id == id) { plugin = installedPluginList[i]; } }
setDialogMode(2, "Plugin Actie", 3, pluginActionEx, format("Weet u zeker dat u de plug-in {0} wilt gebruiken: {1}", elem.value, plugin.name) + '<input id="lastPluginAct" type="hidden" value="' + elem.value + '" /><input id="lastPluginId" type="hidden" value="' + id + '" /><input id="lastPluginVersion" type="hidden" value="" />');
}
elem.value = '';
}
function goPlugin(pname, title) {
if (pluginHandler == null) return;
if (pname == null) { Q('p43iframe').src = ''; } else { QH('p43title', title); Q('p43iframe').src = '/pluginadmin.ashx?pin=' + pname; go(43); }
}
// Generic methods
function joinPaths() { var x = []; for (var i in arguments) { var w = arguments[i]; if ((w != null) && (w != '')) { while (w.endsWith('/') || w.endsWith('\\')) { w = w.substring(0, w.length - 1); } while (w.startsWith('/') || w.startsWith('\\')) { w = w.substring(1); } x.push(w); } } return x.join('/'); }
function putstore(name, val) {
try {
if ((typeof (localStorage) === 'undefined') || (localStorage.getItem(name) == val)) return;
if (val == null) { localStorage.removeItem(name); } else { localStorage.setItem(name, val); } } catch (e) { }
if (name[0] != '_') {
var s = {};
for (var i = 0, len = localStorage.length; i < len; ++i) {
var k = localStorage.key(i);
if (k[0] != '_') {
s[k] = localStorage.getItem(k);
if ((k != 'desktopsettings') && (typeof s[k] == 'string') && (s[k].length > 64)) { delete s[k]; }
}
}
meshserver.send({ action: 'userWebState', state: JSON.stringify(s) });
}
}
function getstore(name, val) { try { if (typeof (localStorage) === 'undefined') return val; var v = localStorage.getItem(name); if ((v == null) || (v == null)) return val; return v; } catch (e) { return val; } }
function addLink(x, f) { return '<span tabindex=0 style=cursor:pointer;text-decoration:none onclick=\'' + f + '\' onkeypress=\"if (event.key==\'Enter\') {' + f + '} \">' + x + ' <img class=hoverButton src=images/link5.png></span>'; }
function addLinkConditional(x, f, c) { if (c) return addLink(x, f); return x; }
function haltEvent(e) { if (e.preventDefault) e.preventDefault(); if (e.stopPropagation) e.stopPropagation(); return false; }
function addOption(q, t, i) { var option = document.createElement('option'); option.text = t; option.value = i; Q(q).add(option); }
function passwordcheck(p) { return (p.length > 7) && (/\d/.test(p)) && (/[a-z]/.test(p)) && (/[A-Z]/.test(p)) && (/\W/.test(p)); }
function methodcheck(r) { if (r && r != null && r.Body && r.Body.ReturnValueStr != 'SUCCESS') { messagebox("Oproepfout", r.Header.Method + ': ' + r.Body.ReturnValueStr.replace('_', ' ')); return true; } return false; }
function TableStart() { return '<table cellpadding=0 cellspacing=0 style=width:100%;border-radius:8px><tr><td width=200px><p><td>'; }
function TableStart2() { return '<table cellpadding=0 cellspacing=0 style=width:100%;border-radius:8px><tr><td><p><td>'; }
function TableEntry(n, v) { return '<tr><td><p>' + n + '<td>' + v; }
function FullTable(x, e) { var r = TableStart(); for (i in x) { if (i && x[i]) r += TableEntry(i, x[i]); } return r + TableEnd(e); }
function TableEnd(n) { return '<tr><td colspan=2><p>' + (n?n:'') + '</table>'; }
function AddButton(v, f) { return '<input type=button value="' + v + '" onclick="' + f + '" style=margin:4px>'; }
function AddButton2(v, f) { return '<input type=button value="' + v + '" onclick="' + f + '">'; }
function AddRefreshButton(f) { return '<input type=button name=refreshbtn value=Refresh onclick="refreshButtons(false);' + f + '" style=margin:4px ' + (refreshButtonsState==false?'disabled':'') + '>'; }
function MoreStart() { return '<a href=# style=cursor:pointer;color:blue id=morexxx1 onclick=QV(\"morexxx1\",false);QV(\"morexxx2\",true)>&#x25BC; ' + "Meer" + '</a><div id=morexxx2 style=display:none><br><hr>'; };
function MoreEnd() { return '<a href=# style=cursor:pointer;color:blue onclick=QV(\"morexxx2\",false);QV(\"morexxx1\",true)>&#x25B2; ' + "Minder" + '</a></div>'; };
function getSelectedOptions(sel) { var opts = [], opt; for (var i = 0, len = sel.options.length; i < len; i++) { opt = sel.options[i]; if (opt.selected) { opts.push(opt.value); } } return opts; }
function getInstance(x, y) { for (var i in x) { if (x[i]['InstanceID'] == y) return x[i]; } return null; }
function getItem(x, y, z) { for (var i in x) { if (x[i][y] == z) return x[i]; } return null; }
function guidToStr(g) { return g.substring(6, 8) + g.substring(4, 6) + g.substring(2, 4) + g.substring(0, 2) + '-' + g.substring(10, 12) + g.substring(8, 10) + '-' + g.substring(14, 16) + g.substring(12, 14) + '-' + g.substring(16, 20) + '-' + g.substring(20); }
function getUrlVars() { var j, hash, vars = [], hashes = window.location.href.slice(window.location.href.indexOf('?') + 1).split('&'); for (var i = 0; i < hashes.length; i++) { j = hashes[i].indexOf('='); if (j > 0) { vars[hashes[i].substring(0, j)] = hashes[i].substring(j + 1, hashes[i].length); } } return vars; }
//function getDocWidth() { if (window.innerWidth) return window.innerWidth; if (document.documentElement && document.documentElement.clientWidth && document.documentElement.clientWidth != 0) return document.documentElement.clientWidth; return document.getElementsByTagName('body')[0].clientWidth; }
//function addHtmlValue(t, v) { return '<div style=height:20px><div style=float:right;width:220px><b>' + v + '</b></div><div>' + t + '</div></div>'; }
function addHtmlValue(t, v) { return '<table><td style=width:120px>' + t + '<td><b>' + v + '</b></table>'; }
function addHtmlValue2(t, v) { return '<div><div style=display:inline-block;float:right>' + v + '</div><div style=display:inline-block>' + t + '</div></div>'; }
function addHtmlValue3(t, v) { return '<div><b>' + t + '</b></div><div style=margin-left:16px>' + v + '</div>'; }
function parseUriArgs() { var name, r = {}, parsedUri = window.document.location.href.split(/[\?&|\=]/); parsedUri.splice(0, 1); for (x in parsedUri) { switch (x % 2) { case 0: { name = decodeURIComponent(parsedUri[x]); break; } case 1: { r[name] = decodeURIComponent(parsedUri[x]); var x = parseInt(r[name]); if (x == r[name]) { r[name] = x; } break; } default: { break; } } } return r; }
function focusTextBox(x) { setTimeout(function(){ Q(x).selectionStart = Q(x).selectionEnd = 65535; Q(x).focus(); }, 0); }
function validateEmail(v) { var emailReg = /^(([^<>()\[\]\\.,;:\s@"]+(\.[^<>()\[\]\\.,;:\s@"]+)*)|(".+"))@((\[[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}])|(([a-zA-Z\-0-9]+\.)+[a-zA-Z]{2,}))$/; return emailReg.test(v); } // New version
function isPrivateIP(a) { return (a.startsWith('10.') || a.startsWith('172.16.') || a.startsWith('192.168.')); }
function u2fSupported() { return (window.u2f && ((navigator.userAgent.indexOf('Chrome/') > 0) || (navigator.userAgent.indexOf('Firefox/') > 0) || (navigator.userAgent.indexOf('Opera/') > 0) || (navigator.userAgent.indexOf('Safari/') > 0))); }
function findOne(arr1, arr2) { if ((arr1 == null) || (arr2 == null)) return false; return arr2.some(function (v) { return arr1.indexOf(v) >= 0; }); };
function copyTextToClip(txt) { function selectElementText(e) { if (document.selection) { var range = document.body.createTextRange(); range.moveToElementText(e); range.select(); } else if (window.getSelection) { var range = document.createRange(); range.selectNode(e); window.getSelection().removeAllRanges(); window.getSelection().addRange(range); } } var e = document.createElement('DIV'); e.textContent = txt; document.body.appendChild(e); selectElementText(e); document.execCommand('copy'); e.remove(); }
function copyTextToClip2(txt) { function selectElementText(e) { if (document.selection) { var range = document.body.createTextRange(); range.moveToElementText(e); range.select(); } else if (window.getSelection) { var range = document.createRange(); range.selectNode(e); window.getSelection().removeAllRanges(); window.getSelection().addRange(range); } } var e = document.createElement('DIV'); e.textContent = decodeURIComponent(txt); document.body.appendChild(e); selectElementText(e); document.execCommand('copy'); e.remove(); }
function capitalizeFirstLetter(x) { return x.charAt(0).toUpperCase() + x.slice(1); }
function printDate(d) { return d.toLocaleDateString(args.locale); }
function printTime(d) { return d.toLocaleTimeString(args.locale); }
function printDateTime(d) { return d.toLocaleString(args.locale); }
function addDetailItem(title, value, state) { return '<div><span style=float:right>' + value + '</span><span>' + title + '</span></div>'; }
function format(format) { var args = Array.prototype.slice.call(arguments, 1); return format.replace(/{(\d+)}/g, function (match, number) { return typeof args[number] != 'undefined' ? args[number] : match; }); };
function addTextLink(subtext, text, link) { var i = text.toLowerCase().indexOf(subtext.toLowerCase()); if (i == -1) { return text; } return text.substring(0, i) + '<a href=\"' + link + '\">' + subtext + '</a>' + text.substring(i + subtext.length); }
function nobreak(x) { return x.split(' ').join('&nbsp;'); }</script>